1.0 2011-09-21 01:47:12 UTC 2015-07-21 06:59:34 UTC FDB028913 Triphosphoric acid Triphosphoric acid, also tripolyphosphoric acid, with formula H5P3O10, is a condensed form of phosphoric acid. In polyphosphoric acids, it is the next after pyrophosphoric acid, H4P2O7, also called diphosphoric acid. Compounds such as ATP (adenosine triphosphate) are esters of triphosphoric acid. [Wikipedia] (ate)N (ate)N-1 (ate)N+1 Acide triorique Bis(dihydroxidodioxidoato)hydroxidooxidoorus Bis(onooxy)inic acid Catena-trioric acid catena-Triphosphoric acid DAD DCT DGT DiONO hydrogen ate DTP H5P3O10 Inorganic open chain tripolyate Triate analogs Trioric acid Triorsaeure Triphospate Tripolyoric acid Tripolyphosphoric acid H5O10P3 257.955 257.909555916 {[hydroxy(phosphonooxy)phosphoryl]oxy}phosphonic acid tripolyphosphate 10380-08-2 OP(O)(=O)OP(O)(=O)OP(O)(O)=O InChI=1S/H5O10P3/c1-11(2,3)9-13(7,8)10-12(4,5)6/h(H,7,8)(H2,1,2,3)(H2,4,5,6) UNXRWKVEANCORM-UHFFFAOYSA-N belongs to the class of inorganic compounds known as non-metal phosphates. These are inorganic non-metallic compounds containing a phosphate as its largest oxoanion. Non-metal phosphates Inorganic compounds Homogeneous non-metal compounds Non-metal oxoanionic compounds Non-metal phosphates Inorganic oxides Inorganic oxide Non-metal phosphate acyclic phosphorus acid anhydride phosphorus oxoacid Solid logp -1.9 ChemAxon pka_strongest_acidic 0.89 ChemAxon iupac {[hydroxy(phosphonooxy)phosphoryl]oxy}phosphonic acid ChemAxon average_mass 257.955 ChemAxon mono_mass 257.909555916 ChemAxon smiles OP(O)(=O)OP(O)(=O)OP(O)(O)=O ChemAxon formula H5O10P3 ChemAxon inchi InChI=1S/H5O10P3/c1-11(2,3)9-13(7,8)10-12(4,5)6/h(H,7,8)(H2,1,2,3)(H2,4,5,6) ChemAxon inchikey UNXRWKVEANCORM-UHFFFAOYSA-N ChemAxon polar_surface_area 170.82 ChemAxon refractivity 36.4 ChemAxon polarizability 14.67 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 8 ChemAxon donor_count 5 ChemAxon physiological_charge -4 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 3136 Specdb::CMs 133951 Specdb::CMs 141685 Specdb::MsMs 23885 Specdb::MsMs 23886 Specdb::MsMs 23887 Specdb::MsMs 30683 Specdb::MsMs 30684 Specdb::MsMs 30685 Specdb::MsMs 2437252 Specdb::MsMs 2437253 Specdb::MsMs 2437254 Specdb::MsMs 2529150 Specdb::MsMs 2529151 Specdb::MsMs 2529152 HMDB12282 39949 3PO Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Cob(I)yrinic acid a,c-diamide adenosyltransferase, mitochondrial Q96EY8 MMAB