1.0 2010-04-08 22:04:29 UTC 2019-11-26 02:54:35 UTC FDB000246 2-S-Glutathionyl caftaric acid 2-s-glutathionyl caftaric acid is a member of the class of compounds known as oligopeptides. Oligopeptides are organic compounds containing a sequence of between three and ten alpha-amino acids joined by peptide bonds. 2-s-glutathionyl caftaric acid is practically insoluble (in water) and a moderately acidic compound (based on its pKa). 2-s-glutathionyl caftaric acid can be found in common grape, grape wine, and vinegar, which makes 2-s-glutathionyl caftaric acid a potential biomarker for the consumption of these food products. C23H27N3O15S 617.537 617.116287899 2-{[(2E)-3-(2-{[2-(4-amino-4-carboxybutanamido)-2-[(carboxymethyl)carbamoyl]ethyl]sulfanyl}-3,4-dihydroxyphenyl)prop-2-enoyl]oxy}-3-hydroxybutanedioic acid 2-{[(2E)-3-(2-{[2-(4-amino-4-carboxybutanamido)-2-(carboxymethylcarbamoyl)ethyl]sulfanyl}-3,4-dihydroxyphenyl)prop-2-enoyl]oxy}-3-hydroxybutanedioic acid NC(CCC(=O)NC(CSC1=C(\C=C\C(=O)OC(C(O)C(O)=O)C(O)=O)C=CC(O)=C1O)C(=O)NCC(O)=O)C(O)=O InChI=1S/C23H27N3O15S/c24-10(21(35)36)3-5-13(28)26-11(20(34)25-7-14(29)30)8-42-19-9(1-4-12(27)16(19)32)2-6-15(31)41-18(23(39)40)17(33)22(37)38/h1-2,4,6,10-11,17-18,27,32-33H,3,5,7-8,24H2,(H,25,34)(H,26,28)(H,29,30)(H,35,36)(H,37,38)(H,39,40)/b6-2+ FRUUTAANUZUTPG-QHHAFSJGSA-N belongs to the class of organic compounds known as oligopeptides. These are organic compounds containing a sequence of between three and ten alpha-amino acids joined by peptide bonds. Oligopeptides Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids 1-hydroxy-4-unsubstituted benzenoids Alkylarylthioethers Alpha amino acid amides Alpha amino acids Alpha hydroxy acids and derivatives Amino acids Beta hydroxy acids and derivatives Carbonyl compounds Carboxylic acids Catechols Cinnamic acid esters Coumaric acids and derivatives Cysteine and derivatives Enoate esters Fatty acid esters Gamma-glutamyl peptides Glutamine and derivatives Hydrocarbon derivatives Monoalkylamines Monosaccharides N-acyl amines N-acyl-alpha amino acids Organic oxides Organopnictogen compounds Pentacarboxylic acids and derivatives Secondary alcohols Secondary carboxylic acid amides Styrenes Sugar acids and derivatives Sulfenyl compounds Thiophenol ethers 1-hydroxy-2-unsubstituted benzenoid 1-hydroxy-4-unsubstituted benzenoid Alcohol Alkylarylthioether Alpha,beta-unsaturated carboxylic ester Alpha-amino acid Alpha-amino acid amide Alpha-amino acid or derivatives Alpha-hydroxy acid Alpha-oligopeptide Amine Amino acid Amino acid or derivatives Aromatic homomonocyclic compound Aryl thioether Benzenoid Beta-hydroxy acid Carbonyl group Carboxamide group Carboxylic acid Carboxylic acid ester Catechol Cinnamic acid ester Cinnamic acid or derivatives Coumaric acid or derivatives Cysteine or derivatives Enoate ester Fatty acid ester Fatty acyl Fatty amide Gamma-glutamyl alpha peptide Glutamine or derivatives Hydrocarbon derivative Hydroxy acid Hydroxycinnamic acid or derivatives Monocyclic benzene moiety Monosaccharide N-acyl-alpha amino acid or derivatives N-acyl-alpha-amino acid N-acyl-amine N-substituted-alpha-amino acid Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Organosulfur compound Pentacarboxylic acid or derivatives Phenol Primary aliphatic amine Primary amine Secondary alcohol Secondary carboxylic acid amide Styrene Sugar acid Sulfenyl compound Thioether Thiophenol ether logp -1.13 ALOGPS logs -3.33 ALOGPS solubility 2.91e-01 g/l ALOGPS logp -4.6 ChemAxon pka_strongest_acidic 1.67 ChemAxon pka_strongest_basic 8.92 ChemAxon iupac 2-{[(2E)-3-(2-{[2-(4-amino-4-carboxybutanamido)-2-[(carboxymethyl)carbamoyl]ethyl]sulfanyl}-3,4-dihydroxyphenyl)prop-2-enoyl]oxy}-3-hydroxybutanedioic acid ChemAxon average_mass 617.537 ChemAxon mono_mass 617.116287899 ChemAxon smiles NC(CCC(=O)NC(CSC1=C(\C=C\C(=O)OC(C(O)C(O)=O)C(O)=O)C=CC(O)=C1O)C(=O)NCC(O)=O)C(O)=O ChemAxon formula C23H27N3O15S ChemAxon inchi InChI=1S/C23H27N3O15S/c24-10(21(35)36)3-5-13(28)26-11(20(34)25-7-14(29)30)8-42-19-9(1-4-12(27)16(19)32)2-6-15(31)41-18(23(39)40)17(33)22(37)38/h1-2,4,6,10-11,17-18,27,32-33H,3,5,7-8,24H2,(H,25,34)(H,26,28)(H,29,30)(H,35,36)(H,37,38)(H,39,40)/b6-2+ ChemAxon inchikey FRUUTAANUZUTPG-QHHAFSJGSA-N ChemAxon polar_surface_area 320.41 ChemAxon refractivity 137.38 ChemAxon polarizability 56.6 ChemAxon rotatable_bond_count 18 ChemAxon acceptor_count 15 ChemAxon donor_count 10 ChemAxon physiological_charge -3 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 73914 Specdb::MsMs 73915 Specdb::MsMs 73916 Specdb::MsMs 133176 Specdb::MsMs 133177 Specdb::MsMs 133178 Specdb::MsMs 3596893 Specdb::MsMs 3596894 Specdb::MsMs 3596895 Specdb::MsMs 3596896 Specdb::MsMs 3596897 Specdb::MsMs 3596898 Common grape Type 1 specific Vitis vinifera 29760 0.359198 0.60699998 0.0 mg/100 g Grape wine Type 2 specific 0.423 0.423000012 0.423000012 mg/100 g Vinegar Type 2 specific 0.058545 0.058544579 0.058544579 mg/100 g