1.0 2010-04-08 22:04:29 UTC 2025-11-18 22:16:37 UTC FDB000247 5-Feruloylquinic acid 5-feruloylquinic acid, also known as O-feruloylquinate, belongs to quinic acids and derivatives class of compounds. Those are compounds containing a quinic acid moiety (or a derivative thereof), which is a cyclitol made up of a cyclohexane ring that bears four hydroxyl groups at positions 1,3.4, and 5, as well as a carboxylic acid at position 1. 5-feruloylquinic acid is slightly soluble (in water) and a weakly acidic compound (based on its pKa). 5-feruloylquinic acid can be found in a number of food items such as sweet cherry, apricot, redcurrant, and peach (variety), which makes 5-feruloylquinic acid a potential biomarker for the consumption of these food products. . C17H20O9 368.3353 368.110732238 (1S,3R,4R,5R)-1,3,4-trihydroxy-5-{[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy}cyclohexane-1-carboxylic acid (1S,3R,4R,5R)-1,3,4-trihydroxy-5-{[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy}cyclohexane-1-carboxylic acid COC1=CC(\C=C\C(=O)O[C@@H]2C[C@@](O)(C[C@@H](O)[C@H]2O)C(O)=O)=CC=C1O InChI=1S/C17H20O9/c1-25-12-6-9(2-4-10(12)18)3-5-14(20)26-13-8-17(24,16(22)23)7-11(19)15(13)21/h2-6,11,13,15,18-19,21,24H,7-8H2,1H3,(H,22,23)/b5-3+/t11-,13-,15-,17+/m1/s1 RAGZUCNPTLULOL-KJJWLSQTSA-N belongs to the class of organic compounds known as quinic acids and derivatives. Quinic acids and derivatives are compounds containing a quinic acid moiety (or a derivative thereof), which is a cyclitol made up of a cyclohexane ring that bears four hydroxyl groups at positions 1,3.4, and 5, as well as a carboxylic acid at position 1. Quinic acids and derivatives Organic compounds Organic oxygen compounds Organooxygen compounds Alcohols and polyols Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids Alkyl aryl ethers Alpha hydroxy acids and derivatives Anisoles Carbonyl compounds Carboxylic acids Cinnamic acid esters Coumaric acids and derivatives Cyclohexanols Dicarboxylic acids and derivatives Enoate esters Fatty acid esters Hydrocarbon derivatives Methoxybenzenes Methoxyphenols Organic oxides Phenoxy compounds Polyols Styrenes Tertiary alcohols 1-hydroxy-2-unsubstituted benzenoid Alkyl aryl ether Alpha,beta-unsaturated carboxylic ester Alpha-hydroxy acid Anisole Aromatic homomonocyclic compound Benzenoid Carbonyl group Carboxylic acid Carboxylic acid derivative Carboxylic acid ester Cinnamic acid ester Cinnamic acid or derivatives Coumaric acid or derivatives Cyclohexanol Dicarboxylic acid or derivatives Enoate ester Ether Fatty acid ester Fatty acyl Hydrocarbon derivative Hydroxy acid Hydroxycinnamic acid or derivatives Methoxybenzene Methoxyphenol Monocyclic benzene moiety Organic oxide Phenol Phenol ether Phenoxy compound Polyol Quinic acid Secondary alcohol Styrene Tertiary alcohol enoate ester quinic acid logp 0.23 ALOGPS logs -2.08 ALOGPS solubility 3.04e+00 g/l ALOGPS logp -0.12 ChemAxon pka_strongest_acidic 3.33 ChemAxon pka_strongest_basic -3.2 ChemAxon iupac (1S,3R,4R,5R)-1,3,4-trihydroxy-5-{[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy}cyclohexane-1-carboxylic acid ChemAxon average_mass 368.3353 ChemAxon mono_mass 368.110732238 ChemAxon smiles COC1=CC(\C=C\C(=O)O[C@@H]2C[C@@](O)(C[C@@H](O)[C@H]2O)C(O)=O)=CC=C1O ChemAxon formula C17H20O9 ChemAxon inchi InChI=1S/C17H20O9/c1-25-12-6-9(2-4-10(12)18)3-5-14(20)26-13-8-17(24,16(22)23)7-11(19)15(13)21/h2-6,11,13,15,18-19,21,24H,7-8H2,1H3,(H,22,23)/b5-3+/t11-,13-,15-,17+/m1/s1 ChemAxon inchikey RAGZUCNPTLULOL-KJJWLSQTSA-N ChemAxon polar_surface_area 153.75 ChemAxon refractivity 87.72 ChemAxon polarizability 35.44 ChemAxon rotatable_bond_count 6 ChemAxon acceptor_count 8 ChemAxon donor_count 5 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 134898 Specdb::CMs 142632 Specdb::MsMs 92133 Specdb::MsMs 92134 Specdb::MsMs 92135 Specdb::MsMs 155706 Specdb::MsMs 155707 Specdb::MsMs 155708 Specdb::MsMs 2330739 Specdb::MsMs 2330740 Specdb::MsMs 2330741 Specdb::MsMs 2631062 Specdb::MsMs 2631063 Specdb::MsMs 2631064 Specdb::NmrOneD 110558 Specdb::NmrOneD 110559 Specdb::NmrOneD 110560 Specdb::NmrOneD 110561 Specdb::NmrOneD 110562 Specdb::NmrOneD 110563 Specdb::NmrOneD 110564 Specdb::NmrOneD 110565 Specdb::NmrOneD 110566 Specdb::NmrOneD 110567 Specdb::NmrOneD 110568 Specdb::NmrOneD 110569 Specdb::NmrOneD 110570 Specdb::NmrOneD 110571 Specdb::NmrOneD 110572 Specdb::NmrOneD 110573 Specdb::NmrOneD 110574 Specdb::NmrOneD 110575 Specdb::NmrOneD 110576 Specdb::NmrOneD 110577 Apple Type 1 specific Malus pumila 283210 0.0 0.0 0.0 mg/100 g Apricot Type 1 specific Prunus armeniaca 36596 0.04 0.040000001 0.040000001 mg/100 g Arabica coffee Type 1 specific Coffea arabica 13443 8.438556 11.690000534 4.640999794 mg/100 g Blackcurrant Type 1 specific Ribes nigrum 78511 0.133333 0.133333335 0.133333335 mg/100 g Carrot Type 1 specific Daucus carota ssp. sativus 79200 0.336667 0.336666659 0.336666659 mg/100 g Coffee Type 1 generic Coffea 13442 10.337333 11.690000534 8.984666189 mg/100 g European plum Type 1 specific Prunus domestica 3758 0.05 0.050000001 0.050000001 mg/100 g Gooseberry Type 1 specific Ribes uva-crispa 135518 0.0 0.0 0.0 mg/100 g Highbush blueberry Type 1 specific Vaccinium corymbosum 69266 0.75 0.75 0.75 mg/100 g Jostaberry Type 1 specific Ribes × nidigrolaria 0.0 0.0 0.0 mg/100 g Loquat Type 1 specific Eriobotrya japonica 32224 7.427143 7.427142961 7.427142961 mg/100 g Peach (var.) Type 1 specific Prunus persica var. persica 323852 0.0 0.0 0.0 mg/100 g Pear Type 1 specific Pyrus communis 23211 0.0 0.0 0.0 mg/100 g Redcurrant Type 1 specific Ribes rubrum 175228 0.166667 0.166666669 0.166666669 mg/100 g Robusta coffee Type 1 specific Coffea canephora 49390 12.416556 16.575000763 8.984666189 mg/100 g Rubus (Blackberry, Raspberry) Type 1 specific Rubus 23216 0.0 0.0 0.0 mg/100 g Sour cherry Type 1 specific Prunus cerasus 140311 0.066667 0.066666668 0.066666668 mg/100 g Strawberry Type 1 specific Fragaria X ananassa 3747 0.0 0.0 0.0 mg/100 g Sweet cherry Type 1 specific Prunus avium 42229 0.0 0.0 0.0 mg/100 g