1.0 2010-04-08 22:04:29 UTC 2025-11-18 22:16:38 UTC FDB000248 4-Feruloylquinic acid 4-feruloylquinic acid, also known as O-feruloylquinate, belongs to quinic acids and derivatives class of compounds. Those are compounds containing a quinic acid moiety (or a derivative thereof), which is a cyclitol made up of a cyclohexane ring that bears four hydroxyl groups at positions 1,3.4, and 5, as well as a carboxylic acid at position 1. 4-feruloylquinic acid is slightly soluble (in water) and a weakly acidic compound (based on its pKa). 4-feruloylquinic acid can be found in a number of food items such as european plum, peach (variety), jostaberry, and apricot, which makes 4-feruloylquinic acid a potential biomarker for the consumption of these food products. C17H20O9 368.3353 368.110732238 (1S,3R,4S,5R)-1,3,5-trihydroxy-4-{[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy}cyclohexane-1-carboxylic acid 4-O-feruloyl-D-quinic acid COC1=CC(\C=C\C(=O)O[C@H]2[C@H](O)C[C@@](O)(C[C@H]2O)C(O)=O)=CC=C1O InChI=1S/C17H20O9/c1-25-13-6-9(2-4-10(13)18)3-5-14(21)26-15-11(19)7-17(24,16(22)23)8-12(15)20/h2-6,11-12,15,18-20,24H,7-8H2,1H3,(H,22,23)/b5-3+/t11-,12-,15-,17+/m1/s1 VTMFDSJJVNQXLT-KSQYBWRXSA-N belongs to the class of organic compounds known as quinic acids and derivatives. Quinic acids and derivatives are compounds containing a quinic acid moiety (or a derivative thereof), which is a cyclitol made up of a cyclohexane ring that bears four hydroxyl groups at positions 1,3.4, and 5, as well as a carboxylic acid at position 1. Quinic acids and derivatives Organic compounds Organic oxygen compounds Organooxygen compounds Alcohols and polyols Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids Alkyl aryl ethers Alpha hydroxy acids and derivatives Anisoles Carbonyl compounds Carboxylic acids Cinnamic acid esters Coumaric acids and derivatives Cyclohexanols Dicarboxylic acids and derivatives Enoate esters Fatty acid esters Hydrocarbon derivatives Methoxybenzenes Methoxyphenols Organic oxides Phenoxy compounds Polyols Styrenes Tertiary alcohols 1-hydroxy-2-unsubstituted benzenoid Alkyl aryl ether Alpha,beta-unsaturated carboxylic ester Alpha-hydroxy acid Anisole Aromatic homomonocyclic compound Benzenoid Carbonyl group Carboxylic acid Carboxylic acid derivative Carboxylic acid ester Cinnamic acid ester Cinnamic acid or derivatives Coumaric acid or derivatives Cyclohexanol Dicarboxylic acid or derivatives Enoate ester Ether Fatty acid ester Fatty acyl Hydrocarbon derivative Hydroxy acid Hydroxycinnamic acid or derivatives Methoxybenzene Methoxyphenol Monocyclic benzene moiety Organic oxide Phenol Phenol ether Phenoxy compound Polyol Quinic acid Secondary alcohol Styrene Tertiary alcohol enoate ester quinic acid logp 0.23 ALOGPS logs -2.12 ALOGPS solubility 2.80e+00 g/l ALOGPS logp -0.12 ChemAxon pka_strongest_acidic 3.39 ChemAxon pka_strongest_basic -3.2 ChemAxon iupac (1S,3R,4S,5R)-1,3,5-trihydroxy-4-{[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy}cyclohexane-1-carboxylic acid ChemAxon average_mass 368.3353 ChemAxon mono_mass 368.110732238 ChemAxon smiles COC1=CC(\C=C\C(=O)O[C@H]2[C@H](O)C[C@@](O)(C[C@H]2O)C(O)=O)=CC=C1O ChemAxon formula C17H20O9 ChemAxon inchi InChI=1S/C17H20O9/c1-25-13-6-9(2-4-10(13)18)3-5-14(21)26-15-11(19)7-17(24,16(22)23)8-12(15)20/h2-6,11-12,15,18-20,24H,7-8H2,1H3,(H,22,23)/b5-3+/t11-,12-,15-,17+/m1/s1 ChemAxon inchikey VTMFDSJJVNQXLT-KSQYBWRXSA-N ChemAxon polar_surface_area 153.75 ChemAxon refractivity 87.72 ChemAxon polarizability 35.51 ChemAxon rotatable_bond_count 6 ChemAxon acceptor_count 8 ChemAxon donor_count 5 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 153911 Specdb::MsMs 81813 Specdb::MsMs 81814 Specdb::MsMs 81815 Specdb::MsMs 143019 Specdb::MsMs 143020 Specdb::MsMs 143021 Specdb::MsMs 2468845 Specdb::MsMs 2468846 Specdb::MsMs 2468847 Specdb::MsMs 2493191 Specdb::MsMs 2493192 Specdb::MsMs 2493193 Specdb::NmrOneD 73592 Specdb::NmrOneD 73593 Specdb::NmrOneD 73594 Specdb::NmrOneD 73595 Specdb::NmrOneD 73596 Specdb::NmrOneD 73597 Specdb::NmrOneD 73598 Specdb::NmrOneD 73599 Specdb::NmrOneD 73600 Specdb::NmrOneD 73601 Specdb::NmrOneD 73602 Specdb::NmrOneD 73603 Specdb::NmrOneD 73604 Specdb::NmrOneD 73605 Specdb::NmrOneD 73606 Specdb::NmrOneD 73607 Specdb::NmrOneD 73608 Specdb::NmrOneD 73609 Specdb::NmrOneD 73610 Specdb::NmrOneD 73611 Apple Type 1 specific Malus pumila 283210 0.0 0.0 0.0 mg/100 g Apricot Type 1 specific Prunus armeniaca 36596 0.0 0.0 0.0 mg/100 g Arabica coffee Type 1 specific Coffea arabica 13443 10.448556 13.260000229 8.569999695 mg/100 g Blackcurrant Type 1 specific Ribes nigrum 78511 0.233333 0.233333339 0.233333339 mg/100 g Carrot Type 1 specific Daucus carota ssp. sativus 79200 0.133333 0.133333335 0.133333335 mg/100 g Coffee Type 1 generic Coffea 13442 9.042833 9.515666962 8.569999695 mg/100 g European plum Type 1 specific Prunus domestica 3758 0.0 0.0 0.0 mg/100 g Gooseberry Type 1 specific Ribes uva-crispa 135518 0.0 0.0 0.0 mg/100 g Highbush blueberry Type 1 specific Vaccinium corymbosum 69266 0.0 0.0 0.0 mg/100 g Jostaberry Type 1 specific Ribes × nidigrolaria 0.2 0.200000003 0.200000003 mg/100 g Peach (var.) Type 1 specific Prunus persica var. persica 323852 0.0 0.0 0.0 mg/100 g Pear Type 1 specific Pyrus communis 23211 0.0 0.0 0.0 mg/100 g Redcurrant Type 1 specific Ribes rubrum 175228 0.0 0.0 0.0 mg/100 g Robusta coffee Type 1 specific Coffea canephora 49390 16.047222 30.055999756 8.569999695 mg/100 g Rubus (Blackberry, Raspberry) Type 1 specific Rubus 23216 0.0 0.0 0.0 mg/100 g Sour cherry Type 1 specific Prunus cerasus 140311 0.066667 0.066666668 0.066666668 mg/100 g Strawberry Type 1 specific Fragaria X ananassa 3747 0.0 0.0 0.0 mg/100 g Sweet cherry Type 1 specific Prunus avium 42229 0.0 0.0 0.0 mg/100 g