1.0 2010-04-08 22:04:30 UTC 2025-11-18 22:16:39 UTC FDB000249 3-Feruloylquinic acid 3-feruloylquinic acid belongs to quinic acids and derivatives class of compounds. Those are compounds containing a quinic acid moiety (or a derivative thereof), which is a cyclitol made up of a cyclohexane ring that bears four hydroxyl groups at positions 1,3.4, and 5, as well as a carboxylic acid at position 1. 3-feruloylquinic acid is slightly soluble (in water) and a weakly acidic compound (based on its pKa). 3-feruloylquinic acid can be found in a number of food items such as carrot, peach (variety), apricot, and pear, which makes 3-feruloylquinic acid a potential biomarker for the consumption of these food products. . C17H20O9 368.3353 368.110732238 (1R,3R,4S,5R)-1,3,4-trihydroxy-5-{[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy}cyclohexane-1-carboxylic acid (1R,3R,4S,5R)-1,3,4-trihydroxy-5-{[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy}cyclohexane-1-carboxylic acid COC1=CC(\C=C\C(=O)O[C@@H]2C[C@](O)(C[C@@H](O)[C@@H]2O)C(O)=O)=CC=C1O InChI=1S/C17H20O9/c1-25-12-6-9(2-4-10(12)18)3-5-14(20)26-13-8-17(24,16(22)23)7-11(19)15(13)21/h2-6,11,13,15,18-19,21,24H,7-8H2,1H3,(H,22,23)/b5-3+/t11-,13-,15+,17-/m1/s1 RAGZUCNPTLULOL-KQJPBSFVSA-N belongs to the class of organic compounds known as phenolic glycosides. These are organic compounds containing a phenolic structure attached to a glycosyl moiety. Some examples of phenolic structures include lignans, and flavonoids. Among the sugar units found in natural glycosides are D-glucose, L-Fructose, and L rhamnose. Phenolic glycosides Organic compounds Organic oxygen compounds Organooxygen compounds Carbohydrates and carbohydrate conjugates Aromatic heteromonocyclic compounds Acetals Alkyl glycosides Beta hydroxy acids and derivatives Carbonyl compounds Carboxylic acid esters Carboxylic acids Dicarboxylic acids and derivatives Fatty acyl glycosides of mono- and disaccharides Gamma butyrolactones Hydrocarbon derivatives Monosaccharides O-glucuronides O-glycosyl compounds Organic oxides Oxacyclic compounds Oxanes Phenol ethers Phenoxy compounds Polyols Pyrans Secondary alcohols Tetrahydrofurans 1-o-glucuronide Acetal Alcohol Alkyl glycoside Aromatic heteromonocyclic compound Benzenoid Beta-hydroxy acid Carbonyl group Carboxylic acid Carboxylic acid derivative Carboxylic acid ester Dicarboxylic acid or derivatives Fatty acyl Fatty acyl glycoside Fatty acyl glycoside of mono- or disaccharide Gamma butyrolactone Glucuronic acid or derivatives Hydrocarbon derivative Hydroxy acid Lactone Monocyclic benzene moiety Monosaccharide O-glucuronide O-glycosyl compound Organic oxide Organoheterocyclic compound Oxacycle Oxane Phenol ether Phenolic glycoside Phenoxy compound Polyol Pyran Secondary alcohol Tetrahydrofuran logp 0.23 ALOGPS logs -2.08 ALOGPS solubility 3.04e+00 g/l ALOGPS logp -0.12 ChemAxon pka_strongest_acidic 3.33 ChemAxon pka_strongest_basic -3.2 ChemAxon iupac (1R,3R,4S,5R)-1,3,4-trihydroxy-5-{[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy}cyclohexane-1-carboxylic acid ChemAxon average_mass 368.3353 ChemAxon mono_mass 368.110732238 ChemAxon smiles COC1=CC(\C=C\C(=O)O[C@@H]2C[C@](O)(C[C@@H](O)[C@@H]2O)C(O)=O)=CC=C1O ChemAxon formula C17H20O9 ChemAxon inchi InChI=1S/C17H20O9/c1-25-12-6-9(2-4-10(12)18)3-5-14(20)26-13-8-17(24,16(22)23)7-11(19)15(13)21/h2-6,11,13,15,18-19,21,24H,7-8H2,1H3,(H,22,23)/b5-3+/t11-,13-,15+,17-/m1/s1 ChemAxon inchikey RAGZUCNPTLULOL-KQJPBSFVSA-N ChemAxon polar_surface_area 153.75 ChemAxon refractivity 87.72 ChemAxon polarizability 35.22 ChemAxon rotatable_bond_count 6 ChemAxon acceptor_count 8 ChemAxon donor_count 5 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 168881 Specdb::NmrOneD 74032 Specdb::NmrOneD 74033 Specdb::NmrOneD 74034 Specdb::NmrOneD 74035 Specdb::NmrOneD 74036 Specdb::NmrOneD 74037 Specdb::NmrOneD 74038 Specdb::NmrOneD 74039 Specdb::NmrOneD 74040 Specdb::NmrOneD 74041 Specdb::NmrOneD 74042 Specdb::NmrOneD 74043 Specdb::NmrOneD 74044 Specdb::NmrOneD 74045 Specdb::NmrOneD 74046 Specdb::NmrOneD 74047 Specdb::NmrOneD 74048 Specdb::NmrOneD 74049 Specdb::NmrOneD 74050 Specdb::NmrOneD 74051 Specdb::MsMs 104313 Specdb::MsMs 104314 Specdb::MsMs 104315 Specdb::MsMs 170565 Specdb::MsMs 170566 Specdb::MsMs 170567 Specdb::MsMs 2446252 Specdb::MsMs 2446253 Specdb::MsMs 2446254 Specdb::MsMs 2516172 Specdb::MsMs 2516173 Specdb::MsMs 2516174 Apple Type 1 specific Malus pumila 283210 0.0 0.0 0.0 mg/100 g Apricot Type 1 specific Prunus armeniaca 36596 0.6 0.600000012 0.600000012 mg/100 g Arabica coffee Type 1 specific Coffea arabica 13443 3.455 4.170000076 2.74000001 mg/100 g Blackcurrant Type 1 specific Ribes nigrum 78511 0.066667 0.066666668 0.066666668 mg/100 g Carrot Type 1 specific Daucus carota ssp. sativus 79200 0.22 0.219999994 0.219999994 mg/100 g Coffee Type 1 generic Coffea 13442 3.455 4.170000076 2.74000001 mg/100 g Corn Type 1 specific Zea mays 4577 European plum Type 1 specific Prunus domestica 3758 1.85 1.850000024 1.850000024 mg/100 g Gooseberry Type 1 specific Ribes uva-crispa 135518 0.1 0.100000001 0.100000001 mg/100 g Highbush blueberry Type 1 specific Vaccinium corymbosum 69266 0.0 0.0 0.0 mg/100 g Jostaberry Type 1 specific Ribes × nidigrolaria 0.2 0.200000003 0.200000003 mg/100 g Peach (var.) Type 1 specific Prunus persica var. persica 323852 0.2 0.200000003 0.200000003 mg/100 g Pear Type 1 specific Pyrus communis 23211 0.0 0.0 0.0 mg/100 g Redcurrant Type 1 specific Ribes rubrum 175228 0.0 0.0 0.0 mg/100 g Robusta coffee Type 1 specific Coffea canephora 49390 3.455 4.170000076 2.74000001 mg/100 g Rubus (Blackberry, Raspberry) Type 1 specific Rubus 23216 0.3 0.300000007 0.300000007 mg/100 g Sour cherry Type 1 specific Prunus cerasus 140311 0.133333 0.133333335 0.133333335 mg/100 g Strawberry Type 1 specific Fragaria X ananassa 3747 0.0 0.0 0.0 mg/100 g Sweet cherry Type 1 specific Prunus avium 42229 0.433333 0.433333337 0.433333337 mg/100 g