1.0 2010-04-08 22:04:30 UTC 2019-11-26 02:54:36 UTC FDB000251 4-Sinapoylquinic acid 4-sinapoylquinic acid belongs to quinic acids and derivatives class of compounds. Those are compounds containing a quinic acid moiety (or a derivative thereof), which is a cyclitol made up of a cyclohexane ring that bears four hydroxyl groups at positions 1,3.4, and 5, as well as a carboxylic acid at position 1. 4-sinapoylquinic acid is slightly soluble (in water) and a weakly acidic compound (based on its pKa). 4-sinapoylquinic acid can be found in a number of food items such as apricot, peach (variety), sweet cherry, and pear, which makes 4-sinapoylquinic acid a potential biomarker for the consumption of these food products. C18H22O10 398.3613 398.121296924 (1S,3R,4S,5R)-1,3,5-trihydroxy-4-{[(2E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]oxy}cyclohexane-1-carboxylic acid (1S,3R,4S,5R)-1,3,5-trihydroxy-4-{[(2E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]oxy}cyclohexane-1-carboxylic acid COC1=CC(\C=C\C(=O)O[C@H]2[C@H](O)C[C@@](O)(C[C@H]2O)C(O)=O)=CC(OC)=C1O InChI=1S/C18H22O10/c1-26-12-5-9(6-13(27-2)15(12)22)3-4-14(21)28-16-10(19)7-18(25,17(23)24)8-11(16)20/h3-6,10-11,16,19-20,22,25H,7-8H2,1-2H3,(H,23,24)/b4-3+/t10-,11-,16-,18+/m1/s1 WKRKXTOYTASIOP-RKTLJHTASA-N belongs to the class of organic compounds known as oligopeptides. These are organic compounds containing a sequence of between three and ten alpha-amino acids joined by peptide bonds. Oligopeptides Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aromatic homomonocyclic compounds 1-hydroxy-4-unsubstituted benzenoids Alkylarylthioethers Alpha amino acid amides Alpha amino acids Alpha hydroxy acids and derivatives Amino acids Beta hydroxy acids and derivatives Carbonyl compounds Carboxylic acids Catechols Cinnamic acid esters Coumaric acids and derivatives Cysteine and derivatives Enoate esters Fatty acid esters Gamma-glutamyl peptides Glutamine and derivatives Hydrocarbon derivatives Monoalkylamines Monosaccharides N-acyl amines N-acyl-alpha amino acids Organic oxides Organopnictogen compounds Secondary alcohols Secondary carboxylic acid amides Styrenes Sugar acids and derivatives Sulfenyl compounds Thiophenol ethers 1-hydroxy-4-unsubstituted benzenoid Alcohol Alkylarylthioether Alpha,beta-unsaturated carboxylic ester Alpha-amino acid Alpha-amino acid amide Alpha-amino acid or derivatives Alpha-hydroxy acid Alpha-oligopeptide Amine Amino acid Amino acid or derivatives Aromatic homomonocyclic compound Aryl thioether Benzenoid Beta-hydroxy acid Carbonyl group Carboxamide group Carboxylic acid Carboxylic acid ester Catechol Cinnamic acid ester Cinnamic acid or derivatives Coumaric acid or derivatives Cysteine or derivatives Enoate ester Fatty acid ester Fatty acyl Fatty amide Gamma-glutamyl alpha peptide Glutamine or derivatives Hydrocarbon derivative Hydroxy acid Hydroxycinnamic acid or derivatives Monocyclic benzene moiety Monosaccharide N-acyl-alpha amino acid or derivatives N-acyl-alpha-amino acid N-acyl-amine N-substituted-alpha-amino acid Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Organosulfur compound Phenol Primary aliphatic amine Primary amine Secondary alcohol Secondary carboxylic acid amide Styrene Sugar acid Sulfenyl compound Thioether Thiophenol ether logp 0.28 ALOGPS logs -2.43 ALOGPS solubility 1.49e+00 g/l ALOGPS logp -0.28 ChemAxon pka_strongest_acidic 3.38 ChemAxon pka_strongest_basic -3.2 ChemAxon iupac (1S,3R,4S,5R)-1,3,5-trihydroxy-4-{[(2E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]oxy}cyclohexane-1-carboxylic acid ChemAxon average_mass 398.3613 ChemAxon mono_mass 398.121296924 ChemAxon smiles COC1=CC(\C=C\C(=O)O[C@H]2[C@H](O)C[C@@](O)(C[C@H]2O)C(O)=O)=CC(OC)=C1O ChemAxon formula C18H22O10 ChemAxon inchi InChI=1S/C18H22O10/c1-26-12-5-9(6-13(27-2)15(12)22)3-4-14(21)28-16-10(19)7-18(25,17(23)24)8-11(16)20/h3-6,10-11,16,19-20,22,25H,7-8H2,1-2H3,(H,23,24)/b4-3+/t10-,11-,16-,18+/m1/s1 ChemAxon inchikey WKRKXTOYTASIOP-RKTLJHTASA-N ChemAxon polar_surface_area 162.98 ChemAxon refractivity 94.18 ChemAxon polarizability 38.6 ChemAxon rotatable_bond_count 7 ChemAxon acceptor_count 9 ChemAxon donor_count 5 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 70938 Specdb::MsMs 70939 Specdb::MsMs 70940 Specdb::MsMs 129510 Specdb::MsMs 129511 Specdb::MsMs 129512 Specdb::MsMs 3596905 Specdb::MsMs 3596906 Specdb::MsMs 3596907 Specdb::MsMs 3598244 Specdb::MsMs 3598245 Specdb::MsMs 3598246 Apple Type 1 specific Malus pumila 283210 0.0 0.0 0.0 mg/100 g Apricot Type 1 specific Prunus armeniaca 36596 0.0 0.0 0.0 mg/100 g European plum Type 1 specific Prunus domestica 3758 0.0 0.0 0.0 mg/100 g Peach (var.) Type 1 specific Prunus persica var. persica 323852 0.0 0.0 0.0 mg/100 g Pear Type 1 specific Pyrus communis 23211 0.0 0.0 0.0 mg/100 g Sour cherry Type 1 specific Prunus cerasus 140311 0.0 0.0 0.0 mg/100 g Sweet cherry Type 1 specific Prunus avium 42229 0.0 0.0 0.0 mg/100 g