1.0 2010-04-08 22:04:30 UTC 2025-11-18 22:16:40 UTC FDB000256 Ferulic acid 4-glucoside Ferulic acid 4-glucoside is a member of the class of compounds known as phenolic glycosides. Phenolic glycosides are organic compounds containing a phenolic structure attached to a glycosyl moiety. Some examples of phenolic structures include lignans, and flavonoids. Among the sugar units found in natural glycosides are D-glucose, L-Fructose, and L rhamnose. Ferulic acid 4-glucoside is slightly soluble (in water) and a weakly acidic compound (based on its pKa). Ferulic acid 4-glucoside can be found in a number of food items such as redcurrant, gooseberry, highbush blueberry, and blackcurrant, which makes ferulic acid 4-glucoside a potential biomarker for the consumption of these food products. Ferulic acid 4-glucoside Ferulic acid 4-O-glucoside Ferulic acid glucoside C16H20O9 356.3246 356.110732238 (2E)-3-(3-methoxy-4-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}phenyl)prop-2-enoic acid (2E)-3-(3-methoxy-4-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}phenyl)prop-2-enoic acid 537-98-4 COC1=CC(\C=C\C(O)=O)=CC=C1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O InChI=1S/C16H20O9/c1-23-10-6-8(3-5-12(18)19)2-4-9(10)24-16-15(22)14(21)13(20)11(7-17)25-16/h2-6,11,13-17,20-22H,7H2,1H3,(H,18,19)/b5-3+/t11-,13-,14+,15-,16-/m1/s1 IEMIRSXOYFWPFD-BJGSYIFTSA-N belongs to the class of organic compounds known as phenolic glycosides. These are organic compounds containing a phenolic structure attached to a glycosyl moiety. Some examples of phenolic structures include lignans, and flavonoids. Among the sugar units found in natural glycosides are D-glucose, L-Fructose, and L rhamnose. Phenolic glycosides Organic compounds Organic oxygen compounds Organooxygen compounds Carbohydrates and carbohydrate conjugates Aromatic heteromonocyclic compounds Acetals Alkyl aryl ethers Anisoles Carbonyl compounds Carboxylic acids Cinnamic acids Coumaric acids and derivatives Hexoses Hydrocarbon derivatives Methoxybenzenes Monocarboxylic acids and derivatives O-glycosyl compounds Organic oxides Oxacyclic compounds Oxanes Phenoxy compounds Polyols Primary alcohols Secondary alcohols Styrenes Acetal Alcohol Alkyl aryl ether Anisole Aromatic heteromonocyclic compound Benzenoid Carbonyl group Carboxylic acid Carboxylic acid derivative Cinnamic acid Cinnamic acid or derivatives Coumaric acid or derivatives Ether Hexose monosaccharide Hydrocarbon derivative Methoxybenzene Monocarboxylic acid or derivatives Monocyclic benzene moiety Monosaccharide O-glycosyl compound Organic oxide Organoheterocyclic compound Oxacycle Oxane Phenol ether Phenolic glycoside Phenoxy compound Polyol Primary alcohol Secondary alcohol Styrene logp -0.29 ALOGPS logs -1.86 ALOGPS solubility 4.91e+00 g/l ALOGPS logp -0.59 ChemAxon pka_strongest_acidic 3.57 ChemAxon pka_strongest_basic -3 ChemAxon iupac (2E)-3-(3-methoxy-4-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}phenyl)prop-2-enoic acid ChemAxon average_mass 356.3246 ChemAxon mono_mass 356.110732238 ChemAxon smiles COC1=CC(\C=C\C(O)=O)=CC=C1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O ChemAxon formula C16H20O9 ChemAxon inchi InChI=1S/C16H20O9/c1-23-10-6-8(3-5-12(18)19)2-4-9(10)24-16-15(22)14(21)13(20)11(7-17)25-16/h2-6,11,13-17,20-22H,7H2,1H3,(H,18,19)/b5-3+/t11-,13-,14+,15-,16-/m1/s1 ChemAxon inchikey IEMIRSXOYFWPFD-BJGSYIFTSA-N ChemAxon polar_surface_area 145.91 ChemAxon refractivity 83.65 ChemAxon polarizability 34.8 ChemAxon rotatable_bond_count 6 ChemAxon acceptor_count 9 ChemAxon donor_count 5 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 107406 Specdb::MsMs 107407 Specdb::MsMs 107408 Specdb::MsMs 174387 Specdb::MsMs 174388 Specdb::MsMs 174389 Specdb::MsMs 3596914 Specdb::MsMs 3596915 Specdb::MsMs 3596916 Specdb::MsMs 3596917 Specdb::MsMs 3596918 Specdb::MsMs 3596919 Blackcurrant Type 1 specific Ribes nigrum 78511 0.266667 0.266666676 0.266666676 mg/100 g Carrot Type 1 specific Daucus carota ssp. sativus 79200 Flaxseed Type 1 specific Linum usitatissimum 4006 345.0 345.0 345.0 mg/100 g Garden tomato (var.) Type 1 specific Solanum lycopersicum var. lycopersicum 397755 Gooseberry Type 1 specific Ribes uva-crispa 135518 0.3 0.300000004 0.300000004 mg/100 g Highbush blueberry Type 1 specific Vaccinium corymbosum 69266 0.55 0.550000012 0.550000012 mg/100 g Jostaberry Type 1 specific Ribes × nidigrolaria 0.4 0.400000006 0.400000006 mg/100 g Redcurrant Type 1 specific Ribes rubrum 175228 0.0 0.0 0.0 mg/100 g Rubus (Blackberry, Raspberry) Type 1 specific Rubus 23216 0.0 0.0 0.0 mg/100 g Strawberry Type 1 specific Fragaria X ananassa 3747 0.0 0.0 0.0 mg/100 g Wild carrot Type 1 specific Daucus carota 4039