1.0 2010-04-08 22:04:30 UTC 2020-02-24 19:10:06 UTC FDB000275 Cis-5-Caffeoylquinic acid A polyphenol compound found in foods of plant origin (PhenolExplorer). 5-O-(Z)-Caffeoylquinate 5-O-(Z)-Caffeoylquinic acid cis-5-O-Caffeoylquinate cis-5-O-Caffeoylquinic acid cis-Chlorogenate cis-Chlorogenic acid C16H18O9 354.3087 354.095082174 (1S,3R,4R,5R)-3-{[(2Z)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}-1,4,5-trihydroxycyclohexane-1-carboxylic acid (1S,3R,4R,5R)-3-{[(2Z)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}-1,4,5-trihydroxycyclohexane-1-carboxylic acid 327-97-9 O[C@@H]1C[C@](O)(C[C@@H](OC(=O)\C=C/C2=CC=C(O)C(O)=C2)[C@@H]1O)C(O)=O InChI=1S/C16H18O9/c17-9-3-1-8(5-10(9)18)2-4-13(20)25-12-7-16(24,15(22)23)6-11(19)14(12)21/h1-5,11-12,14,17-19,21,24H,6-7H2,(H,22,23)/b4-2-/t11-,12-,14-,16+/m1/s1 CWVRJTMFETXNAD-XYXZIBEBSA-N belongs to the class of organic compounds known as quinic acids and derivatives. Quinic acids and derivatives are compounds containing a quinic acid moiety (or a derivative thereof), which is a cyclitol made up of a cyclohexane ring that bears four hydroxyl groups at positions 1,3.4, and 5, as well as a carboxylic acid at position 1. Quinic acids and derivatives Organic compounds Organic oxygen compounds Organooxygen compounds Alcohols and polyols Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids 1-hydroxy-4-unsubstituted benzenoids Alpha hydroxy acids and derivatives Carbonyl compounds Carboxylic acids Catechols Cinnamic acid esters Coumaric acids and derivatives Cyclohexanols Dicarboxylic acids and derivatives Enoate esters Fatty acid esters Hydrocarbon derivatives Organic oxides Polyols Styrenes Tertiary alcohols 1-hydroxy-2-unsubstituted benzenoid 1-hydroxy-4-unsubstituted benzenoid Alpha,beta-unsaturated carboxylic ester Alpha-hydroxy acid Aromatic homomonocyclic compound Benzenoid Carbonyl group Carboxylic acid Carboxylic acid derivative Carboxylic acid ester Catechol Cinnamic acid ester Cinnamic acid or derivatives Coumaric acid or derivatives Cyclohexanol Dicarboxylic acid or derivatives Enoate ester Fatty acid ester Fatty acyl Hydrocarbon derivative Hydroxy acid Hydroxycinnamic acid or derivatives Monocyclic benzene moiety Organic oxide Phenol Polyol Quinic acid Secondary alcohol Styrene Tertiary alcohol cinnamate ester cyclitol carboxylic acid logp 0.17 ALOGPS logs -2.01 ALOGPS solubility 3.44e+00 g/l ALOGPS logp -0.27 ChemAxon pka_strongest_acidic 3.33 ChemAxon pka_strongest_basic -3.2 ChemAxon iupac (1S,3R,4R,5R)-3-{[(2Z)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}-1,4,5-trihydroxycyclohexane-1-carboxylic acid ChemAxon average_mass 354.3087 ChemAxon mono_mass 354.095082174 ChemAxon smiles O[C@@H]1C[C@](O)(C[C@@H](OC(=O)\C=C/C2=CC=C(O)C(O)=C2)[C@@H]1O)C(O)=O ChemAxon formula C16H18O9 ChemAxon inchi InChI=1S/C16H18O9/c17-9-3-1-8(5-10(9)18)2-4-13(20)25-12-7-16(24,15(22)23)6-11(19)14(12)21/h1-5,11-12,14,17-19,21,24H,6-7H2,(H,22,23)/b4-2-/t11-,12-,14-,16+/m1/s1 ChemAxon inchikey CWVRJTMFETXNAD-XYXZIBEBSA-N ChemAxon polar_surface_area 164.75 ChemAxon refractivity 83.23 ChemAxon polarizability 31.87 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 8 ChemAxon donor_count 6 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 2213 Specdb::CMs 25602 Specdb::CMs 31597 Specdb::CMs 41241 Specdb::CMs 166180 Specdb::NmrOneD 108638 Specdb::NmrOneD 108639 Specdb::NmrOneD 108640 Specdb::NmrOneD 108641 Specdb::NmrOneD 108642 Specdb::NmrOneD 108643 Specdb::NmrOneD 108644 Specdb::NmrOneD 108645 Specdb::NmrOneD 108646 Specdb::NmrOneD 108647 Specdb::NmrOneD 108648 Specdb::NmrOneD 108649 Specdb::NmrOneD 108650 Specdb::NmrOneD 108651 Specdb::NmrOneD 108652 Specdb::NmrOneD 108653 Specdb::NmrOneD 108654 Specdb::NmrOneD 108655 Specdb::NmrOneD 108656 Specdb::NmrOneD 108657 Specdb::MsMs 57000 Specdb::MsMs 57001 Specdb::MsMs 57002 Specdb::MsMs 112542 Specdb::MsMs 112543 Specdb::MsMs 112544 Specdb::MsMs 2816884 Specdb::MsMs 2816885 Specdb::MsMs 2816886 Specdb::MsMs 2888080 Specdb::MsMs 2888081 Specdb::MsMs 2888082 HMDB29278 #<Reference:0x000055ac40fb3410> Apple Type 1 specific Malus pumila 283210 0.0 0.0 0.0 mg/100 g Pear Type 1 specific Pyrus communis 23211 0.0 0.0 0.0 mg/100 g Quince Type 1 specific Cydonia oblonga 36610 0.0 0.0 0.0 mg/100 g