1.0 2010-04-08 22:04:30 UTC 2019-11-26 02:54:37 UTC FDB000276 3,4-Diferuloylquinic acid 3,4-diferuloylquinic acid belongs to quinic acids and derivatives class of compounds. Those are compounds containing a quinic acid moiety (or a derivative thereof), which is a cyclitol made up of a cyclohexane ring that bears four hydroxyl groups at positions 1,3.4, and 5, as well as a carboxylic acid at position 1. 3,4-diferuloylquinic acid is practically insoluble (in water) and a weakly acidic compound (based on its pKa). 3,4-diferuloylquinic acid can be found in carrot, which makes 3,4-diferuloylquinic acid a potential biomarker for the consumption of this food product. C27H28O12 544.504 544.15807636 (1R,3R,4S,5R)-1,3-dihydroxy-4,5-bis({[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy})cyclohexane-1-carboxylic acid (1R,3R,4S,5R)-1,3-dihydroxy-4,5-bis({[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy})cyclohexane-1-carboxylic acid COC1=CC(\C=C\C(=O)O[C@@H]2C[C@](O)(C[C@@H](O)[C@@H]2OC(=O)\C=C\C2=CC=C(O)C(OC)=C2)C(O)=O)=CC=C1O InChI=1S/C27H28O12/c1-36-20-11-15(3-7-17(20)28)5-9-23(31)38-22-14-27(35,26(33)34)13-19(30)25(22)39-24(32)10-6-16-4-8-18(29)21(12-16)37-2/h3-12,19,22,25,28-30,35H,13-14H2,1-2H3,(H,33,34)/b9-5+,10-6+/t19-,22-,25+,27-/m1/s1 WCIDSNIXNCYSPH-HPMQQOSDSA-N belongs to the class of organic compounds known as quinic acids and derivatives. Quinic acids and derivatives are compounds containing a quinic acid moiety (or a derivative thereof), which is a cyclitol made up of a cyclohexane ring that bears four hydroxyl groups at positions 1,3.4, and 5, as well as a carboxylic acid at position 1. Quinic acids and derivatives Organic compounds Organic oxygen compounds Organooxygen compounds Alcohols and polyols Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids Alkyl aryl ethers Alpha hydroxy acids and derivatives Anisoles Carbonyl compounds Carboxylic acids Cinnamic acid esters Coumaric acids and derivatives Cyclohexanols Enoate esters Fatty acid esters Hydrocarbon derivatives Methoxybenzenes Methoxyphenols Organic oxides Phenoxy compounds Styrenes Tertiary alcohols Tricarboxylic acids and derivatives 1-hydroxy-2-unsubstituted benzenoid Alkyl aryl ether Alpha,beta-unsaturated carboxylic ester Alpha-hydroxy acid Anisole Aromatic homomonocyclic compound Benzenoid Carbonyl group Carboxylic acid Carboxylic acid derivative Carboxylic acid ester Cinnamic acid ester Cinnamic acid or derivatives Coumaric acid or derivatives Cyclohexanol Enoate ester Ether Fatty acid ester Fatty acyl Hydrocarbon derivative Hydroxy acid Hydroxycinnamic acid or derivatives Methoxybenzene Methoxyphenol Monocyclic benzene moiety Organic oxide Phenol Phenol ether Phenoxy compound Quinic acid Secondary alcohol Styrene Tertiary alcohol Tricarboxylic acid or derivatives logp 2.67 ALOGPS logs -3.99 ALOGPS solubility 5.63e-02 g/l ALOGPS logp 2.45 ChemAxon pka_strongest_acidic 3.31 ChemAxon pka_strongest_basic -3.2 ChemAxon iupac (1R,3R,4S,5R)-1,3-dihydroxy-4,5-bis({[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy})cyclohexane-1-carboxylic acid ChemAxon average_mass 544.504 ChemAxon mono_mass 544.15807636 ChemAxon smiles COC1=CC(\C=C\C(=O)O[C@@H]2C[C@](O)(C[C@@H](O)[C@@H]2OC(=O)\C=C\C2=CC=C(O)C(OC)=C2)C(O)=O)=CC=C1O ChemAxon formula C27H28O12 ChemAxon inchi InChI=1S/C27H28O12/c1-36-20-11-15(3-7-17(20)28)5-9-23(31)38-22-14-27(35,26(33)34)13-19(30)25(22)39-24(32)10-6-16-4-8-18(29)21(12-16)37-2/h3-12,19,22,25,28-30,35H,13-14H2,1-2H3,(H,33,34)/b9-5+,10-6+/t19-,22-,25+,27-/m1/s1 ChemAxon inchikey WCIDSNIXNCYSPH-HPMQQOSDSA-N ChemAxon polar_surface_area 189.28 ChemAxon refractivity 135.73 ChemAxon polarizability 53.75 ChemAxon rotatable_bond_count 11 ChemAxon acceptor_count 10 ChemAxon donor_count 5 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 64170 Specdb::MsMs 64171 Specdb::MsMs 64172 Specdb::MsMs 121248 Specdb::MsMs 121249 Specdb::MsMs 121250 Specdb::MsMs 3596959 Specdb::MsMs 3596960 Specdb::MsMs 3596961 Specdb::MsMs 3596962 Specdb::MsMs 3596963 Specdb::MsMs 3596964 Carrot Type 1 specific Daucus carota ssp. sativus 79200 0.166667 0.166666667 0.166666667 mg/100 g