1.0 2010-04-08 22:04:32 UTC 2025-11-18 22:17:04 UTC FDB000344 Hydroxytyrosol acetate Hydroxytyrosol acetate belongs to tyrosols and derivatives class of compounds. Those are compounds containing a hydroxyethyl group attached to the C4 carbon of a phenol group. Hydroxytyrosol acetate is slightly soluble (in water) and a very weakly acidic compound (based on its pKa). Hydroxytyrosol acetate can be found in olive, which makes hydroxytyrosol acetate a potential biomarker for the consumption of this food product. 2-(3,4-Dihydroxyphenyl) ethyl acetate 3,4-DHPEA-AC 4-(2-(Acetyloxy)ethyl)-1,2-benzenediol 4-(Acetoxyethyl)-1,2-dihydroxybenzene Hydroxytyrosol acetate C10H12O4 196.1999 196.073558872 2-(3,4-dihydroxyphenyl)ethyl acetate 2-(3,4-dihydroxyphenyl)ethyl acetate 7440-34-8 CC(=O)OCCC1=CC(O)=C(O)C=C1 InChI=1S/C10H12O4/c1-7(11)14-5-4-8-2-3-9(12)10(13)6-8/h2-3,6,12-13H,4-5H2,1H3 FGJGLFPNIZXRLV-UHFFFAOYSA-N belongs to the class of organic compounds known as tyrosols and derivatives. Tyrosols and derivatives are compounds containing a hydroxyethyl group attached to the C4 carbon of a phenol group. Tyrosols and derivatives Organic compounds Benzenoids Phenols Tyrosols and derivatives Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids 1-hydroxy-4-unsubstituted benzenoids Benzene and substituted derivatives Carbonyl compounds Carboxylic acid esters Catechols Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides 1-hydroxy-2-unsubstituted benzenoid 1-hydroxy-4-unsubstituted benzenoid Aromatic homomonocyclic compound Carbonyl group Carboxylic acid derivative Carboxylic acid ester Catechol Hydrocarbon derivative Monocarboxylic acid or derivatives Monocyclic benzene moiety Organic oxide Organic oxygen compound Organooxygen compound Tyrosol derivative logp 1.45 ALOGPS logs -2.14 ALOGPS solubility 1.43e+00 g/l ALOGPS logp 1.33 ChemAxon pka_strongest_acidic 9.28 ChemAxon pka_strongest_basic -6.3 ChemAxon iupac 2-(3,4-dihydroxyphenyl)ethyl acetate ChemAxon average_mass 196.1999 ChemAxon mono_mass 196.073558872 ChemAxon smiles CC(=O)OCCC1=CC(O)=C(O)C=C1 ChemAxon formula C10H12O4 ChemAxon inchi InChI=1S/C10H12O4/c1-7(11)14-5-4-8-2-3-9(12)10(13)6-8/h2-3,6,12-13H,4-5H2,1H3 ChemAxon inchikey FGJGLFPNIZXRLV-UHFFFAOYSA-N ChemAxon polar_surface_area 66.76 ChemAxon refractivity 50.74 ChemAxon polarizability 20.07 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 59394 Specdb::MsMs 59395 Specdb::MsMs 59396 Specdb::MsMs 115515 Specdb::MsMs 115516 Specdb::MsMs 115517 Specdb::MsMs 3438988 Specdb::MsMs 3438989 Specdb::MsMs 3438990 Specdb::MsMs 3438991 Specdb::MsMs 3438992 Specdb::MsMs 3438993 Specdb::CMs 114021 Specdb::CMs 127963 Specdb::CMs 911960 Specdb::CMs 911961 Specdb::CMs 911962 Specdb::CMs 911963 Specdb::CMs 911964 Specdb::CMs 911965 Olive Type 1 specific Olea europaea 4146 1.419435 1.481759971 1.357110775 mg/100 g