1.0 2010-04-08 22:04:32 UTC 2025-11-18 22:17:04 UTC FDB000345 p-HPEA-AC P-hpea-ac belongs to tyrosols and derivatives class of compounds. Those are compounds containing a hydroxyethyl group attached to the C4 carbon of a phenol group. P-hpea-ac is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). P-hpea-ac can be found in olive, which makes P-hpea-ac a potential biomarker for the consumption of this food product. 4-(Acetoxyethyl)-1-hydroxybenzene Tyrosol acetate C10H12O3 180.2005 180.07864425 2-(4-hydroxyphenyl)ethyl acetate 2-(4-hydroxyphenyl)ethyl acetate CC(=O)OCCC1=CC=C(O)C=C1 InChI=1S/C10H12O3/c1-8(11)13-7-6-9-2-4-10(12)5-3-9/h2-5,12H,6-7H2,1H3 LDLOCPJLLDCCGO-UHFFFAOYSA-N belongs to the class of organic compounds known as tyrosols and derivatives. Tyrosols and derivatives are compounds containing a hydroxyethyl group attached to the C4 carbon of a phenol group. Tyrosols and derivatives Organic compounds Benzenoids Phenols Tyrosols and derivatives Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids Benzene and substituted derivatives Carbonyl compounds Carboxylic acid esters Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides 1-hydroxy-2-unsubstituted benzenoid Aromatic homomonocyclic compound Carbonyl group Carboxylic acid derivative Carboxylic acid ester Hydrocarbon derivative Monocarboxylic acid or derivatives Monocyclic benzene moiety Organic oxide Organic oxygen compound Organooxygen compound Tyrosol derivative logp 2.52 ALOGPS logs -2.35 ALOGPS solubility 7.98e-01 g/l ALOGPS logp 1.63 ChemAxon pka_strongest_acidic 9.5 ChemAxon pka_strongest_basic -6 ChemAxon iupac 2-(4-hydroxyphenyl)ethyl acetate ChemAxon average_mass 180.2005 ChemAxon mono_mass 180.07864425 ChemAxon smiles CC(=O)OCCC1=CC=C(O)C=C1 ChemAxon formula C10H12O3 ChemAxon inchi InChI=1S/C10H12O3/c1-8(11)13-7-6-9-2-4-10(12)5-3-9/h2-5,12H,6-7H2,1H3 ChemAxon inchikey LDLOCPJLLDCCGO-UHFFFAOYSA-N ChemAxon polar_surface_area 46.53 ChemAxon refractivity 48.76 ChemAxon polarizability 19.14 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 87312 Specdb::MsMs 53730 Specdb::MsMs 53731 Specdb::MsMs 53732 Specdb::MsMs 131136 Specdb::MsMs 131137 Specdb::MsMs 131138 Olive Type 1 specific Olea europaea 4146 0.004054 0.004054257 0.004054257 mg/100 g