1.0 2010-04-08 22:04:32 UTC 2025-11-18 22:17:05 UTC FDB000350 p-HPEA-EA p-HPEA-EA is the major form of the ligstroside-aglycone. p-HPEA-EA is found in olive. Ligstroside-aglycone mono-aldehyde p-HPEA-Elenolic acid mono-aldehyde C17H20O5 304.3377 304.13107375 2-(4-hydroxyphenyl)ethyl (4E)-4-formyl-3-(2-oxoethyl)hex-4-enoate 2-(4-hydroxyphenyl)ethyl (4E)-4-formyl-3-(2-oxoethyl)hex-4-enoate 501-94-0 [H]\C(C)=C(/C=O)C(CC=O)CC(=O)OCCC1=CC=C(O)C=C1 InChI=1S/C17H20O5/c1-2-14(12-19)15(7-9-18)11-17(21)22-10-8-13-3-5-16(20)6-4-13/h2-6,9,12,15,20H,7-8,10-11H2,1H3/b14-2- VPOVFCBNUOUZGG-VVHNFQOZSA-N belongs to the class of organic compounds known as tyrosols and derivatives. Tyrosols and derivatives are compounds containing a hydroxyethyl group attached to the C4 carbon of a phenol group. Tyrosols and derivatives Organic compounds Benzenoids Phenols Tyrosols and derivatives Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids Alpha-hydrogen aldehydes Benzene and substituted derivatives Carboxylic acid esters Enals Fatty acid esters Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides 1-hydroxy-2-unsubstituted benzenoid Aldehyde Alpha,beta-unsaturated aldehyde Alpha-hydrogen aldehyde Aromatic homomonocyclic compound Carbonyl group Carboxylic acid derivative Carboxylic acid ester Enal Fatty acid ester Fatty acyl Hydrocarbon derivative Monocarboxylic acid or derivatives Monocyclic benzene moiety Organic oxide Organic oxygen compound Organooxygen compound Tyrosol derivative logp 2.95 ALOGPS logs -4.29 ALOGPS solubility 1.56e-02 g/l ALOGPS logp 1.83 ChemAxon pka_strongest_acidic 9.5 ChemAxon pka_strongest_basic -4.4 ChemAxon iupac 2-(4-hydroxyphenyl)ethyl (4E)-4-formyl-3-(2-oxoethyl)hex-4-enoate ChemAxon average_mass 304.3377 ChemAxon mono_mass 304.13107375 ChemAxon smiles [H]\C(C)=C(/C=O)C(CC=O)CC(=O)OCCC1=CC=C(O)C=C1 ChemAxon formula C17H20O5 ChemAxon inchi InChI=1S/C17H20O5/c1-2-14(12-19)15(7-9-18)11-17(21)22-10-8-13-3-5-16(20)6-4-13/h2-6,9,12,15,20H,7-8,10-11H2,1H3/b14-2- ChemAxon inchikey VPOVFCBNUOUZGG-VVHNFQOZSA-N ChemAxon polar_surface_area 80.67 ChemAxon refractivity 83.27 ChemAxon polarizability 31.69 ChemAxon rotatable_bond_count 10 ChemAxon acceptor_count 4 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 12644 Specdb::CMs 41266 Specdb::CMs 136229 Specdb::CMs 143963 Specdb::MsMs 46422 Specdb::MsMs 46423 Specdb::MsMs 46424 Specdb::MsMs 160623 Specdb::MsMs 160624 Specdb::MsMs 160625 Specdb::MsMs 2261524 Specdb::MsMs 2261525 Specdb::MsMs 2261526 Specdb::MsMs 3077454 Specdb::MsMs 3077455 Specdb::MsMs 3077456 HMDB0029305 Olive Type 1 specific Olea europaea 4146 4.080864 6.909886517 1.527639985 mg/100 g Olive oil Type 2