1.0 2010-04-08 22:04:33 UTC 2019-11-26 02:54:46 UTC FDB000419 4-Hydroxyproline galactoside Isolated from hydrolysed wheat endosperm. 4-Hydroxyproline galactoside is found in cereals and cereal products. 4-Hydroxyproline galactoside L-trans-4-hydroxy-2-pyrrolidinecarboxylic acid galactoside L-trans-4-hydroxy-2-pyrrolidinecarboxylic acid O-b-D-galactopyranoside L-trans-4-hydroxy-2-pyrrolidinecarboxylic acid O-b-D-galactoside L-trans-4-Hydroxyproline galactoside C11H19NO8 293.2705 293.111066589 4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}pyrrolidine-2-carboxylic acid 4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}pyrrolidine-2-carboxylic acid 80185-44-0 OCC1OC(OC2CNC(C2)C(O)=O)C(O)C(O)C1O InChI=1S/C11H19NO8/c13-3-6-7(14)8(15)9(16)11(20-6)19-4-1-5(10(17)18)12-2-4/h4-9,11-16H,1-3H2,(H,17,18) OJEYXWIZDRJBDC-UHFFFAOYSA-N belongs to the class of organic compounds known as fatty acyl glycosides of mono- and disaccharides. Fatty acyl glycosides of mono- and disaccharides are compounds composed of a mono- or disaccharide moiety linked to one hydroxyl group of a fatty alcohol or of a phosphorylated alcohol (phosphoprenols), a hydroxy fatty acid or to one carboxyl group of a fatty acid (ester linkage) or to an amino alcohol. Fatty acyl glycosides of mono- and disaccharides Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acyl glycosides Aliphatic heteromonocyclic compounds Acetals Alpha amino acids Amino acids Azacyclic compounds Carbonyl compounds Carboxylic acids Dialkylamines Hexoses Hydrocarbon derivatives Monocarboxylic acids and derivatives O-glycosyl compounds Organic oxides Organopnictogen compounds Oxacyclic compounds Oxanes Polyols Primary alcohols Proline and derivatives Pyrrolidine carboxylic acids Secondary alcohols Acetal Alcohol Aliphatic heteromonocyclic compound Alpha-amino acid Alpha-amino acid or derivatives Amine Amino acid Amino acid or derivatives Azacycle Carbonyl group Carboxylic acid Carboxylic acid derivative Fatty acyl glycoside of mono- or disaccharide Glycosyl compound Hexose monosaccharide Hydrocarbon derivative Monocarboxylic acid or derivatives Monosaccharide O-glycosyl compound Organic nitrogen compound Organic oxide Organic oxygen compound Organoheterocyclic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Oxacycle Oxane Polyol Primary alcohol Proline or derivatives Pyrrolidine Pyrrolidine carboxylic acid Pyrrolidine carboxylic acid or derivatives Secondary alcohol Secondary aliphatic amine Secondary amine logp -2.77 ALOGPS logs -0.20 ALOGPS solubility 1.86e+02 g/l ALOGPS logp -5.5 ChemAxon pka_strongest_acidic 1.23 ChemAxon pka_strongest_basic 10.51 ChemAxon iupac 4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}pyrrolidine-2-carboxylic acid ChemAxon average_mass 293.2705 ChemAxon mono_mass 293.111066589 ChemAxon smiles OCC1OC(OC2CNC(C2)C(O)=O)C(O)C(O)C1O ChemAxon formula C11H19NO8 ChemAxon inchi InChI=1S/C11H19NO8/c13-3-6-7(14)8(15)9(16)11(20-6)19-4-1-5(10(17)18)12-2-4/h4-9,11-16H,1-3H2,(H,17,18) ChemAxon inchikey OJEYXWIZDRJBDC-UHFFFAOYSA-N ChemAxon polar_surface_area 148.71 ChemAxon refractivity 61.8 ChemAxon polarizability 27.65 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 9 ChemAxon donor_count 6 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 106692 Specdb::MsMs 106693 Specdb::MsMs 106694 Specdb::MsMs 173508 Specdb::MsMs 173509 Specdb::MsMs 173510 Specdb::CMs 13424 Specdb::CMs 41297 HMDB29354 #<Reference:0x000055ac40659e50> Breakfast cereal Type 2 specific Cereals and cereal products Unknown generic