1.0 2010-04-08 22:04:34 UTC 2019-11-26 02:54:49 UTC FDB000450 Chavicine Constituent of pepper (Piper nigrum) (Piperaceae) Chavicine is an alkaloid found in pepper. It is one of the four diastereomeric geometric isomers of piperine. Chavicine C17H19NO3 285.3377 285.136493479 (2Z,4Z)-5-(2H-1,3-benzodioxol-5-yl)-1-(piperidin-1-yl)penta-2,4-dien-1-one chavicine 495-91-0 O=C(\C=C\C=C\C1=CC2=C(OCO2)C=C1)N1CCCCC1 InChI=1S/C17H19NO3/c19-17(18-10-4-1-5-11-18)7-3-2-6-14-8-9-15-16(12-14)21-13-20-15/h2-3,6-9,12H,1,4-5,10-11,13H2/b6-2+,7-3+ MXXWOMGUGJBKIW-YPCIICBESA-N belongs to the class of organic compounds known as alkaloids and derivatives. These are naturally occurring chemical compounds that contain mostly basic nitrogen atoms. This group also includes some related compounds with neutral and even weakly acidic properties. Also some synthetic compounds of similar structure are attributed to alkaloids. In addition to carbon, hydrogen and nitrogen, alkaloids may also contain oxygen, sulfur and more rarely other elements such as chlorine, bromine, and phosphorus. Alkaloids and derivatives Organic compounds Alkaloids and derivatives Aromatic heteropolycyclic compounds Acetals Azacyclic compounds Benzodioxoles Carbonyl compounds Hydrocarbon derivatives N-acylpiperidines Organic oxides Organonitrogen compounds Organopnictogen compounds Oxacyclic compounds Styrenes Tertiary carboxylic acid amides Acetal Alkaloid or derivatives Aromatic heteropolycyclic compound Azacycle Benzenoid Benzodioxole Carbonyl group Carboxamide group Carboxylic acid derivative Hydrocarbon derivative N-acyl-piperidine Organic nitrogen compound Organic oxide Organic oxygen compound Organoheterocyclic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Oxacycle Piperidine Styrene Tertiary carboxylic acid amide melting_point < 25 oC logp 2.78 ChemAxon pka_strongest_basic -0.13 ChemAxon iupac (2Z,4Z)-5-(2H-1,3-benzodioxol-5-yl)-1-(piperidin-1-yl)penta-2,4-dien-1-one ChemAxon average_mass 285.3377 ChemAxon mono_mass 285.136493479 ChemAxon smiles O=C(\C=C\C=C\C1=CC2=C(OCO2)C=C1)N1CCCCC1 ChemAxon formula C17H19NO3 ChemAxon inchi InChI=1S/C17H19NO3/c19-17(18-10-4-1-5-11-18)7-3-2-6-14-8-9-15-16(12-14)21-13-20-15/h2-3,6-9,12H,1,4-5,10-11,13H2/b6-2+,7-3+ ChemAxon inchikey MXXWOMGUGJBKIW-YPCIICBESA-N ChemAxon polar_surface_area 38.77 ChemAxon refractivity 82.9 ChemAxon polarizability 31.01 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 3 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Herbs and Spices Unknown generic Pepper (Spice) Type 1 specific Piper nigrum 13216 diaphoretic 879