1.0 2010-04-08 22:04:36 UTC 2019-11-26 02:54:56 UTC FDB000525 L-cis-4-(Hydroxymethyl)-2-pyrrolidinecarboxylic acid Constituent of apples and loquat. L-cis-4-(Hydroxymethyl)-2-pyrrolidinecarboxylic acid is found in pomes and fruits. 4-(Hydroxymethyl)-2-pyrrolidinecarboxylic acid; L-cis-form C6H11NO3 145.1564 145.073893223 (2S,4S)-4-(hydroxymethyl)pyrrolidine-2-carboxylic acid (2S,4S)-4-(hydroxymethyl)pyrrolidine-2-carboxylic acid 2370-39-0 OCC1CNC(C1)C(O)=O InChI=1S/C6H11NO3/c8-3-4-1-5(6(9)10)7-2-4/h4-5,7-8H,1-3H2,(H,9,10) CISMGNUPDUKNQK-UHFFFAOYSA-N belongs to the class of organic compounds known as proline and derivatives. Proline and derivatives are compounds containing proline or a derivative thereof resulting from reaction of proline at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. Proline and derivatives Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic heteromonocyclic compounds 1,3-aminoalcohols Amino acids Azacyclic compounds Carbonyl compounds Carboxylic acids Dialkylamines Hydrocarbon derivatives L-alpha-amino acids Monocarboxylic acids and derivatives Organic oxides Primary alcohols Pyrrolidine carboxylic acids 1,3-aminoalcohol Alcohol Aliphatic heteromonocyclic compound Alpha-amino acid Amine Amino acid Azacycle Carbonyl group Carboxylic acid Hydrocarbon derivative L-alpha-amino acid Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organoheterocyclic compound Organonitrogen compound Organooxygen compound Primary alcohol Proline or derivatives Pyrrolidine Pyrrolidine carboxylic acid Pyrrolidine carboxylic acid or derivatives Secondary aliphatic amine Secondary amine melting_point Mp 257-258° dec. logp -3.6 ChemAxon pka_strongest_acidic 1.78 ChemAxon pka_strongest_basic 10.94 ChemAxon iupac (2S,4S)-4-(hydroxymethyl)pyrrolidine-2-carboxylic acid ChemAxon average_mass 145.1564 ChemAxon mono_mass 145.073893223 ChemAxon smiles OCC1CNC(C1)C(O)=O ChemAxon formula C6H11NO3 ChemAxon inchi InChI=1S/C6H11NO3/c8-3-4-1-5(6(9)10)7-2-4/h4-5,7-8H,1-3H2,(H,9,10) ChemAxon inchikey CISMGNUPDUKNQK-UHFFFAOYSA-N ChemAxon polar_surface_area 69.56 ChemAxon refractivity 34.37 ChemAxon polarizability 14.18 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 4 ChemAxon donor_count 3 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Fruits Unknown generic Pomes Unknown generic