1.0 2010-04-08 22:04:36 UTC 2025-11-18 22:19:24 UTC FDB000540 Lysozyme Preservative. Prevents late blowing in semi-hard cheeses due to Clostridium tyrobutyricum Lysozyme is part of the innate immune system. Children fed infant formula lack lysozyme in their diet and have three times the rate of diarrheal disease.[citation needed] Since lysozyme is a natural form of protection from pathogens like Salmonella, E.coli and Pseudomonas, when it is deficient due to infant formula feeding, can lead to increased incidence of disease.; Whereas the skin is a protective barrier due to its dryness and acidity, the conjunctiva (membrane covering the eye) is instead protected by secreted enzymes, mainly lysozyme and defensin. However, when these protective barriers fail, conjunctivitis results. Lysozyme is found in garden onion, papaya, and soft-necked garlic. E.C. 3.2.1.17 E1105 Muramidase N-Acetylmuramylhydrolase Peptidoglycan N-acetylmuramoylhydrolase C8H15NOS2 205.33 205.059506455 5-[(3R)-1,2-dithiolan-3-yl]pentanimidic acid lipoamide 9001-63-2 [H][C@@]1(CCCCC(O)=N)CCSS1 InChI=1S/C8H15NOS2/c9-8(10)4-2-1-3-7-5-6-11-12-7/h7H,1-6H2,(H2,9,10)/t7-/m1/s1 FCCDDURTIIUXBY-SSDOTTSWSA-N belongs to the class of organic compounds known as lipoamides. Lipoamides are compounds containing a lipoamide moiety, which consists of a pentanamide attached to the C3 carbon atom of a 1,2-dithiolane ring. Lipoamides Organic compounds Organoheterocyclic compounds Dithiolanes Lipoamides Aliphatic heteromonocyclic compounds 1,2-dithiolanes Carbonyl compounds Fatty amides Hydrocarbon derivatives Organic disulfides Organic oxides Organonitrogen compounds Organopnictogen compounds Primary carboxylic acid amides 1,2-dithiolane Aliphatic heteromonocyclic compound Carbonyl group Carboxamide group Carboxylic acid derivative Fatty acyl Fatty amide Hydrocarbon derivative Lipoamide Organic disulfide Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary carboxylic acid amide lipoamide logp 2.47 ALOGPS logs -3.29 ALOGPS solubility 1.06e-01 g/l ALOGPS logp -0.52 ChemAxon pka_strongest_acidic -0.064 ChemAxon pka_strongest_basic 13.21 ChemAxon iupac 5-[(3R)-1,2-dithiolan-3-yl]pentanimidic acid ChemAxon average_mass 205.33 ChemAxon mono_mass 205.059506455 ChemAxon smiles [H][C@@]1(CCCCC(O)=N)CCSS1 ChemAxon formula C8H15NOS2 ChemAxon inchi InChI=1S/C8H15NOS2/c9-8(10)4-2-1-3-7-5-6-11-12-7/h7H,1-6H2,(H2,9,10)/t7-/m1/s1 ChemAxon inchikey FCCDDURTIIUXBY-SSDOTTSWSA-N ChemAxon polar_surface_area 44.08 ChemAxon refractivity 67.13 ChemAxon polarizability 22.05 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 2 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 56262 Specdb::MsMs 56263 Specdb::MsMs 56264 Specdb::MsMs 111636 Specdb::MsMs 111637 Specdb::MsMs 111638 Specdb::MsMs 3610813 Specdb::MsMs 3610814 Specdb::MsMs 3610815 Specdb::MsMs 3610816 Specdb::MsMs 3610817 Specdb::MsMs 3610818 Garden onion Type 1 specific Allium cepa 4679 Papaya Type 1 specific Carica papaya 3649 Soft-necked garlic Type 1 specific Allium sativum L. var. sativum 4682 Anti bacterial 145 A substance that kills or slows the growth of bacteria. Gram(+)icide 962 A substance that kills or slows the growth of bacteria. Pesticide 1210 Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests.