1.0 2010-04-08 22:04:43 UTC 2025-11-18 22:24:14 UTC FDB000821 3,5-Dihydroxy-4-methoxybenzaldehyde 3,5-dihydroxy-4-methoxybenzaldehyde is a member of the class of compounds known as methoxyphenols. Methoxyphenols are compounds containing a methoxy group attached to the benzene ring of a phenol moiety. 3,5-dihydroxy-4-methoxybenzaldehyde is slightly soluble (in water) and a very weakly acidic compound (based on its pKa). 3,5-dihydroxy-4-methoxybenzaldehyde can be found in date, which makes 3,5-dihydroxy-4-methoxybenzaldehyde a potential biomarker for the consumption of this food product. 3,5-Dihydroxy-4-methoxy-benzaldehyde 3,5-Dihydroxy-4-methoxybenzaldehyde C8H8O4 168.1467 168.042258744 3,5-dihydroxy-4-methoxybenzaldehyde 3,5-dihydroxy-4-methoxybenzaldehyde 29865-85-8 COC1=C(O)C=C(C=O)C=C1O InChI=1S/C8H8O4/c1-12-8-6(10)2-5(4-9)3-7(8)11/h2-4,10-11H,1H3 UAFQVVYJCLAIGY-UHFFFAOYSA-N belongs to the class of organic compounds known as methoxyphenols. Methoxyphenols are compounds containing a methoxy group attached to the benzene ring of a phenol moiety. Methoxyphenols Organic compounds Benzenoids Phenols Methoxyphenols Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids 1-hydroxy-4-unsubstituted benzenoids Alkyl aryl ethers Anisoles Benzoyl derivatives Hydrocarbon derivatives Hydroxybenzaldehydes Methoxybenzenes Organic oxides Phenoxy compounds Resorcinols 1-hydroxy-2-unsubstituted benzenoid 1-hydroxy-4-unsubstituted benzenoid Aldehyde Alkyl aryl ether Anisole Aromatic homomonocyclic compound Aryl-aldehyde Benzaldehyde Benzoyl Ether Hydrocarbon derivative Hydroxybenzaldehyde Methoxybenzene Methoxyphenol Monocyclic benzene moiety Organic oxide Organic oxygen compound Organooxygen compound Phenol ether Phenoxy compound Resorcinol logp 0.97 ALOGPS logs -1.43 ALOGPS solubility 6.29e+00 g/l ALOGPS melting_point Mp 139-140° logp 0.92 ChemAxon pka_strongest_acidic 9.2 ChemAxon pka_strongest_basic -4.8 ChemAxon iupac 3,5-dihydroxy-4-methoxybenzaldehyde ChemAxon average_mass 168.1467 ChemAxon mono_mass 168.042258744 ChemAxon smiles COC1=C(O)C=C(C=O)C=C1O ChemAxon formula C8H8O4 ChemAxon inchi InChI=1S/C8H8O4/c1-12-8-6(10)2-5(4-9)3-7(8)11/h2-4,10-11H,1H3 ChemAxon inchikey UAFQVVYJCLAIGY-UHFFFAOYSA-N ChemAxon polar_surface_area 66.76 ChemAxon refractivity 43.07 ChemAxon polarizability 15.76 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 4 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 69867 Specdb::MsMs 69868 Specdb::MsMs 69869 Specdb::MsMs 128238 Specdb::MsMs 128239 Specdb::MsMs 128240 Specdb::MsMs 3597163 Specdb::MsMs 3597164 Specdb::MsMs 3597165 Specdb::MsMs 3597166 Specdb::MsMs 3597167 Specdb::MsMs 3597168 Date Type 1 specific Phoenix dactylifera 42345