1.0 2010-04-08 22:04:44 UTC 2025-11-18 22:24:40 UTC FDB000843 2-Hydroxy-4-methoxybenzoic acid 2-hydroxy-4-methoxybenzoic acid belongs to P-methoxybenzoic acids and derivatives class of compounds. Those are benzoic acids in which the hydrogen atom at position 4 of the benzene ring is replaced by a methoxy group. 2-hydroxy-4-methoxybenzoic acid is slightly soluble (in water) and a weakly acidic compound (based on its pKa). 2-hydroxy-4-methoxybenzoic acid can be found in evening primrose, which makes 2-hydroxy-4-methoxybenzoic acid a potential biomarker for the consumption of this food product. 2-Hydroxy-4-methoxybenzoic acid 2-Hydroxyanisic acid 4-Methoxysalicylic acid C8H8O4 168.1467 168.042258744 2-hydroxy-4-methoxybenzoic acid 2-hydroxy-4-methoxybenzoic acid 2237-36-7 COC1=CC(O)=C(C=C1)C(O)=O InChI=1S/C8H8O4/c1-12-5-2-3-6(8(10)11)7(9)4-5/h2-4,9H,1H3,(H,10,11) MRIXVKKOHPQOFK-UHFFFAOYSA-N belongs to the class of organic compounds known as p-methoxybenzoic acids and derivatives. These are benzoic acids in which the hydrogen atom at position 4 of the benzene ring is replaced by a methoxy group. P-methoxybenzoic acids and derivatives Organic compounds Benzenoids Benzene and substituted derivatives Benzoic acids and derivatives Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids 1-hydroxy-4-unsubstituted benzenoids Alkyl aryl ethers Anisoles Benzoic acids Benzoyl derivatives Carboxylic acids Hydrocarbon derivatives Methoxybenzenes Methoxyphenols Monocarboxylic acids and derivatives Organic oxides Phenoxy compounds Salicylic acids Vinylogous acids 1-hydroxy-2-unsubstituted benzenoid 1-hydroxy-4-unsubstituted benzenoid Alkyl aryl ether Anisole Aromatic homomonocyclic compound Benzoic acid Benzoyl Carboxylic acid Carboxylic acid derivative Ether Hydrocarbon derivative Hydroxybenzoic acid Methoxybenzene Methoxyphenol Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound P-methoxybenzoic acid or derivatives Phenol Phenol ether Phenoxy compound Salicylic acid Salicylic acid or derivatives Vinylogous acid logp 1.82 ALOGPS logs -1.68 ALOGPS solubility 3.47e+00 g/l ALOGPS melting_point Mp 159-161° (157°) logp 1.82 ChemAxon pka_strongest_acidic 3.09 ChemAxon pka_strongest_basic -4.9 ChemAxon iupac 2-hydroxy-4-methoxybenzoic acid ChemAxon average_mass 168.1467 ChemAxon mono_mass 168.042258744 ChemAxon smiles COC1=CC(O)=C(C=C1)C(O)=O ChemAxon formula C8H8O4 ChemAxon inchi InChI=1S/C8H8O4/c1-12-5-2-3-6(8(10)11)7(9)4-5/h2-4,9H,1H3,(H,10,11) ChemAxon inchikey MRIXVKKOHPQOFK-UHFFFAOYSA-N ChemAxon polar_surface_area 66.76 ChemAxon refractivity 41.76 ChemAxon polarizability 15.87 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 4 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsIr 11109 Specdb::MsIr 11110 Specdb::MsIr 11111 Specdb::MsMs 57699 Specdb::MsMs 57700 Specdb::MsMs 57701 Specdb::MsMs 113457 Specdb::MsMs 113458 Specdb::MsMs 113459 Specdb::MsMs 2271345 Specdb::MsMs 2271346 Specdb::MsMs 2271347 Specdb::MsMs 3067340 Specdb::MsMs 3067341 Specdb::MsMs 3067342 Specdb::CMs 5806 Specdb::CMs 54343 Specdb::CMs 134521 Specdb::CMs 142255 545919 Evening primrose Type 1 specific Oenothera biennis 3942