1.0 2010-04-08 22:04:45 UTC 2025-11-18 22:25:58 UTC FDB000899 (±)-Leucine Dietary supplement, nutrient [DFC]. (±)-Leucine is found in many foods, some of which are green bell pepper, italian sweet red pepper, green zucchini, and red bell pepper. (±)-Leucine (+-)-Leucine (+/-)-Amino-4-methylpentanoic acid (RS)-Leucine alpha-Amino-gamma-methylvaleric acid DL-2-Amino-4-methylpentanoic acid DL-Leucine C6H13NO2 131.1729 131.094628665 2-amino-4-methylpentanoic acid leucine 328-39-2 CC(C)CC(N)C(O)=O InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9) ROHFNLRQFUQHCH-UHFFFAOYSA-N belongs to the class of organic compounds known as leucine and derivatives. Leucine and derivatives are compounds containing leucine or a derivative thereof resulting from reaction of leucine at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. Leucine and derivatives Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds Alpha amino acids Amino acids Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Methyl-branched fatty acids Monoalkylamines Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Aliphatic acyclic compound Alpha-amino acid Amine Amino acid Branched fatty acid Carbonyl group Carboxylic acid Fatty acid Fatty acyl Hydrocarbon derivative Leucine or derivatives Methyl-branched fatty acid Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary aliphatic amine Primary amine Amino fatty acids a D-amino acid alpha-amino acid branched-chain amino acid logp -1.82 ALOGPS logs -0.27 ALOGPS solubility 6.98e+01 g/l ALOGPS melting_point Mp 293-295° (sealed tube) logp -1.6 ChemAxon pka_strongest_acidic 2.79 ChemAxon pka_strongest_basic 9.52 ChemAxon iupac 2-amino-4-methylpentanoic acid ChemAxon average_mass 131.1729 ChemAxon mono_mass 131.094628665 ChemAxon smiles CC(C)CC(N)C(O)=O ChemAxon formula C6H13NO2 ChemAxon inchi InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9) ChemAxon inchikey ROHFNLRQFUQHCH-UHFFFAOYSA-N ChemAxon polar_surface_area 63.32 ChemAxon refractivity 34.17 ChemAxon polarizability 14.33 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::EiMs 398 Specdb::NmrOneD 3236 Specdb::CMs 951 Specdb::CMs 1006 Specdb::CMs 32234 Specdb::CMs 34924 Specdb::CMs 48797 Specdb::MsMs 20039 Specdb::MsMs 20040 Specdb::MsMs 20041 Specdb::MsMs 21590 Specdb::MsMs 21591 Specdb::MsMs 21592 Specdb::MsMs 440058 Specdb::MsMs 445203 Specdb::MsMs 445204 Specdb::MsMs 445205 Specdb::MsMs 447353 Specdb::MsMs 447557 Specdb::MsMs 447558 Specdb::MsMs 447559 Specdb::MsMs 447560 Specdb::MsMs 447561 Specdb::MsMs 447562 Specdb::MsMs 447563 Specdb::MsMs 447564 Specdb::MsMs 447565 Specdb::MsMs 447566 Specdb::MsMs 451890 Acorn Type 1 specific Quercus 3511 0.489 0.489 0.489 mg/100 g Acorn squash Type 1 Cucurbita pepo var. turbinata 0.045 0.045 0.045 mg/100 g Agave Type 1 specific Agave 39509 0.025 0.025 0.025 mg/100 g Almond Type 1 specific Prunus dulcis 3755 1.473 1.473 1.473 mg/100 g Amaranth Type 1 specific Amaranthus 3564 0.879 0.879 0.879 mg/100 g American butterfish Type 1 specific Peprilus triacanthus 183653 1.405 1.405 1.405 mg/100 g American lobster Type 1 specific Homarus americanus 6706 1.197 1.197 1.197 mg/100 g American shad Type 1 specific Alosa sapidissima 34773 1.376 1.376 1.376 mg/100 g Anatidae Type 1 specific Anatidae 8830 1.48625 1.691 0.9 mg/100 g Anchovy Type 1 specific Engraulidae 43062 1.654 1.654 1.654 mg/100 g Anguilliformes Type 1 specific Anguilliformes 7933 1.499 1.499 1.499 mg/100 g Apple Type 1 specific Malus pumila 283210 0.014 0.014 0.014 mg/100 g Apricot Type 1 specific Prunus armeniaca 36596 0.077 0.077 0.077 mg/100 g Asian pear Type 1 specific Pyrus pyrifolia 3767 0.025 0.025 0.025 mg/100 g Asparagus Type 1 specific Asparagus officinalis 4686 0.128 0.128 0.128 mg/100 g Atlantic cod Type 1 specific Gadus morhua 8049 1.447 1.447 1.447 mg/100 g Atlantic croaker Type 1 specific Micropogonias undulatus 29154 1.445 1.445 1.445 mg/100 g Atlantic halibut Type 1 specific Hippoglossus hippoglossus 8267 1.598 1.598 1.598 mg/100 g Atlantic herring Type 1 specific Clupea harengus harengus 7950 1.46 1.46 1.46 mg/100 g Atlantic pollock Type 1 specific Pollachius pollachius 185739 1.512 1.512 1.512 mg/100 g Atlantic salmon Type 1 specific Salmo salar 8030 1.613 1.613 1.613 mg/100 g Atlantic wolffish Type 1 specific Anarhichas lupus 8204 1.422 1.422 1.422 mg/100 g Avocado Type 1 specific Persea americana 3435 0.143 0.143 0.143 mg/100 g Bamboo shoots Type 1 specific Phyllostachys edulis 38705 0.14 0.14 0.14 mg/100 g Banana Type 1 specific Musa acuminata 4641 0.068 0.068 0.068 mg/100 g Barley Type 1 specific Hordeum vulgare 4513 0.673 0.673 0.673 mg/100 g Beech nut Type 1 specific Fagus 21024 0.367 0.367 0.367 mg/100 g Beer Type 2 specific 0.0 0.0 0.0 mg/100 g Bison Type 1 specific Bison bison 9901 1.601 1.601 1.601 mg/100 g Black walnut Type 1 specific Juglans nigra 16719 1.684 1.684 1.684 mg/100 g Black-eyed pea Type 1 specific Vigna unguiculata ssp. unguiculata 3920 1.0065 1.802 0.211 mg/100 g Blue cheese Type 2 1.919 1.919 1.919 mg/100 g Blue crab Type 1 specific Callinectes sapidus 6763 1.433 1.433 1.433 mg/100 g Blue mussel Type 1 specific Mytilus edulis 6550 0.838 0.838 0.838 mg/100 g Bluefish Type 1 specific Pomatomus saltatrix 75034 1.629 1.629 1.629 mg/100 g Breadfruit Type 1 specific Artocarpus altilis 194251 0.065 0.065 0.065 mg/100 g Breadnut tree seed Type 1 specific Brosimum alicastrum 194253 0.647 0.647 0.647 mg/100 g Broccoli Type 1 specific Brassica oleracea var. italica 36774 0.0125 0.0125 0.0125 mg/100 g Brussel sprouts Type 1 specific Brassica oleracea var. gemmifera 178616 0.152 0.152 0.152 mg/100 g Buffalo Type 1 specific Bubalus bubalis 89462 1.755 1.755 1.755 mg/100 g Bulgur Type 2 specific 0.83 0.83 0.83 mg/100 g Burbot Type 1 specific Lota lota 69944 1.57 1.57 1.57 mg/100 g Burdock Type 1 specific Arctium lappa 4217 0.032 0.032 0.032 mg/100 g Butter Type 2 specific 0.083 0.083 0.083 mg/100 g Buttermilk Type 2 specific 0.304 0.304 0.304 mg/100 g Butternut Type 1 specific Juglans cinerea 91214 2.199 2.199 2.199 mg/100 g Butternut squash Type 1 specific Cucurbita moschata 3662 0.057 0.057 0.057 mg/100 g Cabbage Type 1 specific Brassica oleracea var. capitata 3716 0.041 0.041 0.041 mg/100 g Calabash Type 1 specific Lagenaria siceraria 3668 0.036 0.036 0.036 mg/100 g Cantaloupe melon Type 1 Cucumis melo var. cantalupensis 0.0005 0.0005 0.0005 mg/100 g Carp bream Type 1 specific Abramis brama 38527 1.449 1.449 1.449 mg/100 g Carrot Type 1 specific Daucus carota ssp. sativus 79200 0.022 0.022 0.022 mg/100 g Cassava Type 1 specific Manihot esculenta 3983 0.039 0.039 0.039 mg/100 g Catfish Type 1 specific Siluriformes 7995 1.331 1.331 1.331 mg/100 g Catjang pea Type 1 specific Vigna unguiculata ssp. cylindrica 3840 1.828 1.828 1.828 mg/100 g Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 0.106 0.106 0.106 mg/100 g Celery stalks Type 1 specific Apium graveolens var. dulce 117781 0.032 0.032 0.032 mg/100 g Channel catfish Type 1 specific Ictalurus punctatus 7998 1.331 1.331 1.331 mg/100 g Chayote Type 1 specific Sechium edule 184140 0.077 0.077 0.077 mg/100 g Cherimoya Type 1 specific Annona cherimola 49314 0.063 0.063 0.063 mg/100 g Chestnut Type 1 specific Castanea 21019 0.259 0.259 0.259 mg/100 g Chia Type 1 specific Salvia hispanica 49212 1.371 1.371 1.371 mg/100 g Chickpea Type 1 specific Cicer arietinum 3827 1.465 1.465 1.465 mg/100 g Chicory Type 1 specific Cichorium intybus 13427 0.074 0.074 0.074 mg/100 g Chinese cabbage Type 1 specific Brassica rapa 3711 0.088 0.088 0.088 mg/100 g Chinese chestnut Type 1 specific Castanea mollissima 60419 0.259 0.259 0.259 mg/100 g Chinese chives Type 1 specific Allium tuberosum 4683 0.195 0.195 0.195 mg/100 g Chinook salmon Type 1 specific Oncorhynchus tshawytscha 74940 1.63 1.63 1.63 mg/100 g Chives Type 1 specific Allium schoenoprasum 74900 0.195 0.195 0.195 mg/100 g Chum salmon Type 1 specific Oncorhynchus keta 8018 1.637 1.637 1.637 mg/100 g Cichlidae (Tilapia) Type 1 specific Cichlidae 8113 1.603 1.603 1.603 mg/100 g Cinnamon Type 1 specific Cinnamomum 13428 0.253 0.253 0.253 mg/100 g Cisco Type 1 specific Coregonus artedi 36181 1.543 1.543 1.543 mg/100 g Clam Type 1 1.2 1.2 1.2 mg/100 g Clawed lobster Type 1 specific Nephropidae 6704 1.197 1.197 1.197 mg/100 g Cloves Type 1 specific Syzygium aromaticum 219868 0.4 0.4 0.4 mg/100 g Cocoa butter Type 2 specific 0.0 0.0 0.0 mg/100 g Coconut Type 1 specific Cocos nucifera 13894 0.247 0.247 0.247 mg/100 g Coho salmon Type 1 specific Oncorhynchus kisutch 8019 1.757 1.757 1.757 mg/100 g Colorado pinyon Type 1 specific Pinus edulis 3340 0.834 0.834 0.834 mg/100 g Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 1.624333 1.866 1.501 mg/100 g Common beet Type 1 specific Beta vulgaris 161934 0.068 0.068 0.068 mg/100 g Common buckwheat Type 1 specific Fagopyrum esculentum 3617 0.832 0.832 0.832 mg/100 g Common cabbage Type 1 specific Brassica oleracea 3712 0.063 0.063 0.063 mg/100 g Common carp Type 1 specific Cyprinus carpio 7962 1.449 1.449 1.449 mg/100 g Common hazelnut Type 1 specific Corylus avellana 13451 1.063 1.063 1.063 mg/100 g Common ling Type 1 specific Molva molva 163112 1.543 1.543 1.543 mg/100 g Common octopus Type 1 specific Octopus vulgaris 6645 1.049 1.049 1.049 mg/100 g Common oregano Type 1 specific Origanum vulgare 39352 0.78 0.78 0.78 mg/100 g Common persimmon Type 1 specific Diospyros virginiana 13493 0.058 0.058 0.058 mg/100 g Common thyme Type 1 specific Thymus vulgaris 49992 0.346 0.43 0.262 mg/100 g Common walnut Type 1 specific Juglans regia 51240 1.17 1.17 1.17 mg/100 g Corn Type 1 specific Zea mays 4577 1.155 1.155 1.155 mg/100 g Cottonseed Type 1 specific Gossypium 3633 2.226 2.226 2.226 mg/100 g Cottonseed oil Type 2 0.0 0.0 0.0 mg/100 g Cowpea Type 1 specific Vigna unguiculata 3917 0.211 0.211 0.211 mg/100 g Crab Type 1 specific Brachyura 6752 1.451 1.468 1.433 mg/100 g Crayfish Type 1 specific Astacidea 6712 1.2205 1.265 1.176 mg/100 g Cream Type 2 specific 0.237 0.258 0.213 mg/100 g Cucumber Type 1 specific Cucumis sativus 3659 0.029 0.029 0.029 mg/100 g Cusk Type 1 specific Brosme brosme 81638 1.544 1.544 1.544 mg/100 g Cuttlefish Type 1 specific Sepiidae 6608 1.143 1.143 1.143 mg/100 g Daikon radish Type 1 specific Raphanus sativus var. longipinnatus 41679 0.031 0.031 0.031 mg/100 g Date Type 1 specific Phoenix dactylifera 42345 0.082 0.082 0.082 mg/100 g Deer Type 1 specific Cervidae 9850 1.951 1.951 1.951 mg/100 g Dill Type 1 specific Anethum graveolens 40922 0.159 0.159 0.159 mg/100 g Dock Type 1 specific Rumex 3618 0.167 0.167 0.167 mg/100 g Domestic goat Type 1 specific Capra aegagrus hircus 9925 1.716 1.716 1.716 mg/100 g Dungeness crab Type 1 specific Cancer magister 29965 1.381 1.381 1.381 mg/100 g Eastern oyster Type 1 specific Crassostrea virginica 6565 0.358 0.358 0.358 mg/100 g Egg substitute Type 2 specific 0.972 0.972 0.972 mg/100 g Egg yolk Type 1 0.11 0.11 0.11 mg/100 g Eggplant Type 1 specific Solanum melongena 4111 0.064 0.064 0.064 mg/100 g Eggs Unknown generic 0.095 0.095 0.095 mg/100 g Elk Type 1 specific Cervus canadensis 1574408 1.622 1.622 1.622 mg/100 g Emu Type 1 specific Dromaius novaehollandiae 8790 1.257 1.257 1.257 mg/100 g Endive Type 1 specific Cichorium endivia 114280 0.098 0.098 0.098 mg/100 g European anchovy Type 1 specific Engraulis encrasicolus 184585 1.654 1.654 1.654 mg/100 g European chestnut Type 1 specific Castanea sativa 21020 0.096 0.096 0.096 mg/100 g European rabbit Type 1 specific Oryctolagus 9984 1.698 1.698 1.698 mg/100 g Feijoa Type 1 specific Feijoa sellowiana 260130 0.028 0.028 0.028 mg/100 g Fenugreek Type 1 specific Trigonella foenum-graecum 78534 1.757 1.757 1.757 mg/100 g Fig Type 1 specific Ficus carica 3494 0.0085 0.0085 0.0085 mg/100 g Flatfish Type 1 specific Pleuronectiformes 8252 1.087 1.087 1.087 mg/100 g Flaxseed Type 1 specific Linum usitatissimum 4006 1.235 1.235 1.235 mg/100 g Florida pompano Type 1 specific Trachinotus carolinus 173342 1.502 1.502 1.502 mg/100 g Freshwater drum Type 1 specific Aplodinotus grunniens 225389 1.425 1.425 1.425 mg/100 g Freshwater eel Type 1 specific Anguilla 7935 1.499 1.499 1.499 mg/100 g Gadiformes Type 1 specific Gadiformes 8043 1.329 1.447 1.211 mg/100 g Gadus (Common cod) Type 1 specific Gadus 8048 1.447 1.447 1.447 mg/100 g Garden onion Type 1 specific Allium cepa 4679 0.025 0.025 0.025 mg/100 g Garden onion (var.) Type 1 specific Allium cepa var. cepa 4679 0.025 0.025 0.025 mg/100 g Garlic Type 1 specific Allium sativum 4682 0.308 0.308 0.308 mg/100 g Ginger Type 1 specific Zingiber officinale 94328 0.074 0.074 0.074 mg/100 g Ginkgo nuts Type 1 specific Ginkgo biloba 3311 0.316 0.316 0.316 mg/100 g Goji Type 1 0.456 0.456 0.456 mg/100 g Grape Type 1 specific Vitis 3603 0.0175 0.022 0.013 mg/100 g Grapefruit Type 1 specific Citrus X paradisi 37656 0.012 0.012 0.012 mg/100 g Grapefruit/Pummelo hybrid Type 1 specific Citrus paradisi X Citrus maxima 37656 0.015 0.015 0.015 mg/100 g Grapeseed oil Type 2 0.0 0.0 0.0 mg/100 g Greater sturgeon Type 1 specific Acipenser 7901 1.312 1.312 1.312 mg/100 g Greek feta cheese Type 2 1.395 1.395 1.395 mg/100 g Green bell pepper Type 1 specific Capsicum annuum 4072 36.0 36.0 36.0 mg/100 g Green lentil Type 1 Lens culinaris 1.786 1.786 1.786 mg/100 g Green plum Type 1 0.015 0.015 0.015 mg/100 g Green zucchini Type 1 specific Cucurbita pepo var. cylindrica 36.0795 72.0 0.159 mg/100 g Greenland halibut/turbot Type 1 specific Reinhardtius hippoglossoides 111784 1.168 1.168 1.168 mg/100 g Grouper Type 1 specific Epinephelus 94231 1.575 1.575 1.575 mg/100 g Guava Type 1 specific Psidium guajava 120290 0.171 0.171 0.171 mg/100 g Guinea hen Type 1 specific Numida meleagris 8996 1.549 1.549 1.549 mg/100 g Hazelnut Type 1 specific Corylus 13450 1.063 1.063 1.063 mg/100 g Hickory nut Type 1 specific Carya 13402 1.027 1.027 1.027 mg/100 g Hippoglossus (Common halibut) Type 1 specific Hippoglossus 8266 1.692 1.692 1.692 mg/100 g Honey Type 2 specific 0.01 0.01 0.01 mg/100 g Horse Type 1 specific Equus caballus 9796 1.696 1.696 1.696 mg/100 g Hyacinth bean Type 1 specific Lablab purpureus 35936 2.026 2.026 2.026 mg/100 g Iceberg lettuce Type 1 0.025 0.025 0.025 mg/100 g Italian oregano Type 1 specific Origanum X majoricum 1384207 0.78 0.78 0.78 mg/100 g Italian sweet red pepper Type 1 specific Capsicum annuum 4072 36.0 36.0 36.0 mg/100 g Jackfruit Type 1 specific Artocarpus heterophyllus 3489 0.103 0.103 0.103 mg/100 g Japanese chestnut Type 1 specific Castanea crenata 103480 0.139 0.139 0.139 mg/100 g Japanese persimmon Type 1 specific Diospyros kaki 35925 0.042 0.042 0.042 mg/100 g Japanese sea bass Type 1 Lateolabrax japonicus 1.498 1.498 1.498 mg/100 g Jicama Type 1 specific Pachyrhizus erosus 109171 0.025 0.025 0.025 mg/100 g Jute Type 1 specific Corchorus olitorius 93759 0.388 0.388 0.388 mg/100 g Kelp Type 1 specific Laminaria 33637 0.083 0.083 0.083 mg/100 g King mackerel Type 1 specific Scomberomorus cavalla 13679 1.648 1.648 1.648 mg/100 g Kiwi Type 1 specific Actinidia chinensis 3625 0.0055 0.0055 0.0055 mg/100 g Kohlrabi Type 1 specific Brassica oleracea var. gongylodes 109379 0.067 0.067 0.067 mg/100 g Lambsquarters Type 1 specific Chenopodium album 3559 0.35 0.35 0.35 mg/100 g Lard Type 2 specific 0.0 0.0 0.0 mg/100 g Leek Type 1 specific Allium porrum 0.096 0.096 0.096 mg/100 g Lemon sole Type 1 specific Microstomus kitt 106175 1.087 1.087 1.087 mg/100 g Lentils Type 1 generic Lens culinaris 3864 1.786 1.786 1.786 mg/100 g Lettuce Type 1 specific Lactuca sativa 4236 0.005 0.005 0.005 mg/100 g Lima bean Type 1 specific Phaseolus lunatus 3884 0.538 0.538 0.538 mg/100 g Lingcod Type 1 specific Ophiodon elongatus 225387 1.435 1.435 1.435 mg/100 g Longan Type 1 specific Dimocarpus longan 128017 0.054 0.054 0.054 mg/100 g Loquat Type 1 specific Eriobotrya japonica 32224 0.026 0.026 0.026 mg/100 g Lotus Type 1 specific Nelumbo 4430 0.069 0.069 0.069 mg/100 g Lupine Type 1 specific Lupinus 3869 2.743 2.743 2.743 mg/100 g Macadamia nut Type 1 specific Macadamia 4329 0.602 0.602 0.602 mg/100 g Macadamia nut (M. tetraphylla) Type 1 specific Macadamia tetraphylla 512563 0.602 0.602 0.602 mg/100 g Maitake Type 1 specific Grifola frondosa 5627 0.08 0.08 0.08 mg/100 g Mamey sapote Type 1 specific Pouteria sapota 233744 0.073 0.073 0.073 mg/100 g Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571 0.028 0.028 0.028 mg/100 g Mango Type 1 specific Mangifera indica 29780 0.05 0.05 0.05 mg/100 g Marine mussel Type 1 specific Mytilidae 6547 0.838 0.838 0.838 mg/100 g Mexican oregano Type 1 specific Lippia graveolens 0.78 0.78 0.78 mg/100 g Milkfish Type 1 specific Chanos chanos 29144 1.669 1.669 1.669 mg/100 g Millet Type 1 specific Panicum miliaceum 4540 1.4 1.4 1.4 mg/100 g Monkfish Type 1 specific Lophius piscatorius 8074 1.177 1.177 1.177 mg/100 g Moth bean Type 1 specific Vigna aconitifolia 3918 1.541 1.541 1.541 mg/100 g Mountain yam Type 1 specific Dioscorea pentaphylla 167592 0.084 0.084 0.084 mg/100 g Mung bean Type 1 specific Vigna radiata 157791 1.847 1.847 1.847 mg/100 g Nectarine Type 1 specific Prunus persica var. nucipersica 323851 0.014 0.014 0.014 mg/100 g Nopal Type 1 specific Opuntia cochenillifera 338184 0.077 0.077 0.077 mg/100 g Northern bluefin tuna Type 1 specific Thunnus thynnus 8237 1.896 1.896 1.896 mg/100 g Northern pike Type 1 specific Esox lucius 8010 1.565 1.565 1.565 mg/100 g Norway pout Type 1 specific Trisopterus esmarkii 80723 1.352 1.352 1.352 mg/100 g Oat Type 1 specific Avena sativa 4498 1.374 1.374 1.374 mg/100 g Ocean pout Type 1 specific Zoarces americanus 8199 1.352 1.352 1.352 mg/100 g Oil palm Type 1 specific Elaeis 51952 0.0 0.0 0.0 mg/100 g Okra Type 1 specific Abelmoschus esculentus 455045 0.105 0.105 0.105 mg/100 g Orange roughy Type 1 specific Hoplostethus atlanticus 96778 1.293 1.293 1.293 mg/100 g Oriental wheat Type 1 specific Triticum turanicum 376534 1.112 1.112 1.112 mg/100 g Ostrich Type 1 specific Struthio camelus 8801 1.73825 1.787 1.643 mg/100 g Oyster mushroom Type 1 specific Pleurotus ostreatus 5322 0.168 0.168 0.168 mg/100 g Pacific cod Type 1 specific Gadus macrocephalus 80720 1.211 1.211 1.211 mg/100 g Pacific halibut Type 1 specific Hippoglossus stenolepis 195615 1.692 1.692 1.692 mg/100 g Pacific herring Type 1 specific Clupea pallasii 30724 1.332 1.332 1.332 mg/100 g Pacific jack mackerel Type 1 specific Trachurus symmetricus 271940 1.631 1.631 1.631 mg/100 g Pacific ocean perch Type 1 specific Sebastes alutus 72055 1.239 1.239 1.239 mg/100 g Pacific oyster Type 1 specific Crassostrea gigas 29159 0.665 0.665 0.665 mg/100 g Pacific rockfish Type 1 specific Sebastes 34820 1.516 1.516 1.516 mg/100 g Pak choy Type 1 specific Brassica rapa var. chinensis 93385 0.088 0.088 0.088 mg/100 g Papaya Type 1 specific Carica papaya 3649 0.016 0.016 0.016 mg/100 g Parsley Type 1 specific Petroselinum crispum 4043 0.204 0.204 0.204 mg/100 g Pea shoots Type 1 0.323 0.323 0.323 mg/100 g Peach Type 1 specific Prunus persica 3760 0.0005 0.0005 0.0005 mg/100 g Peach (var.) Type 1 specific Prunus persica var. persica 323852 0.0005 0.0005 0.0005 mg/100 g Peanut Type 1 specific Arachis hypogaea 3818 1.672 1.672 1.672 mg/100 g Peanut oil Type 2 0.0 0.0 0.0 mg/100 g Pear Type 1 specific Pyrus communis 23211 0.001 0.001 0.001 mg/100 g Pecan nut Type 1 specific Carya illinoinensis 32201 0.598 0.598 0.598 mg/100 g Pepper (Spice) Type 1 specific Piper nigrum 13216 1.014 1.014 1.014 mg/100 g Peppermint Type 1 specific Mentha X piperita 34256 0.281 0.281 0.281 mg/100 g Percoidei (Bass and others) Type 1 specific Percoidei 8112 1.441 1.441 1.441 mg/100 g Persimmon Type 1 specific Diospyros 13492 0.058 0.058 0.058 mg/100 g Pheasant Type 1 specific Phasianus colchicus 9054 2.029 2.063 1.995 mg/100 g Pigeon pea Type 1 specific Cajanus cajan 3821 1.549 1.549 1.549 mg/100 g Pili nut Type 1 specific Canarium ovatum 43691 0.89 0.89 0.89 mg/100 g Pine nut Type 1 specific Pinus 3337 0.991 0.991 0.991 mg/100 g Pineapple Type 1 specific Ananas comosus 4615 0.024 0.024 0.024 mg/100 g Pink salmon Type 1 specific Oncorhynchus gorbuscha 8017 1.562 1.562 1.562 mg/100 g Pistachio Type 1 specific Pistacia vera 55513 1.604 1.604 1.604 mg/100 g Pollock Type 1 specific Pollachius 8059 1.06 1.06 1.06 mg/100 g Pumpkinseed sunfish Type 1 specific Lepomis gibbosus 270329 1.577 1.577 1.577 mg/100 g Purple laver Type 1 specific Porphyra laciniata 0.501 0.501 0.501 mg/100 g Quail Type 1 specific Phasianidae 9005 1.866 1.866 1.866 mg/100 g Quinoa Type 1 specific Chenopodium quinoa 63459 0.84 0.84 0.84 mg/100 g Rabbit Type 1 specific Leporidae 9979 1.698 1.698 1.698 mg/100 g Radish Type 1 specific Raphanus sativus 3726 0.031 0.031 0.031 mg/100 g Rainbow smelt Type 1 specific Osmerus mordax 8014 1.433 1.433 1.433 mg/100 g Rainbow trout Type 1 specific Oncorhynchus mykiss 8022 1.664 1.664 1.664 mg/100 g Rapeseed oil Type 2 0.0 0.0 0.0 mg/100 g Red bell pepper Type 1 specific Capsicum annuum 4072 52000.0 52000.0 52000.0 mg/100 g Red king crab Type 1 specific Paralithodes camtschaticus 6741 1.452 1.452 1.452 mg/100 g Red rice Type 1 specific Oryza rufipogon 4529 0.657 0.657 0.657 mg/100 g Roe Type 2 generic 1.956 1.956 1.956 mg/100 g Rosemary Type 1 specific Rosmarinus officinalis 39367 0.249 0.249 0.249 mg/100 g Rye Type 1 specific Secale cereale 4550 0.563 0.563 0.563 mg/100 g Sablefish Type 1 specific Anoplopoma fimbria 229290 1.09 1.09 1.09 mg/100 g Salted butter Type 1 0.083 0.083 0.083 mg/100 g Sapodilla Type 1 specific Manilkara zapota 3741 0.024 0.024 0.024 mg/100 g Savoy cabbage Type 1 specific Brassica oleracea var. sabauda 1216010 0.103 0.103 0.103 mg/100 g Scallop Type 1 specific Pectinidae 6566 0.07 0.07 0.07 mg/100 g Scup Type 1 specific Stenotomus chrysops 35579 1.534 1.534 1.534 mg/100 g Sea trout Type 1 specific Salmo trutta forma trutta 13028 1.361 1.361 1.361 mg/100 g Sesame Type 1 specific Sesamum orientale 4182 1.358 1.358 1.358 mg/100 g Sesame oil Type 2 0.0 0.0 0.0 mg/100 g Sesbania flower Type 1 specific Sesbania bispinosa 485725 0.106 0.106 0.106 mg/100 g Shallot Type 1 specific Allium ascalonicum 1476995 0.149 0.149 0.149 mg/100 g Shark Type 1 specific Squaliformes 282414 1.705 1.705 1.705 mg/100 g Sheefish Type 1 specific Stenodus leucichthys 59296 1.52 1.52 1.52 mg/100 g Sheepshead Type 1 specific Archosargus probatocephalus 119682 1.643 1.643 1.643 mg/100 g Shiitake Type 1 specific Lentinus edodes 5353 0.189 0.189 0.189 mg/100 g Skipjack tuna Type 1 specific Katsuwonus pelamis 8226 1.788 1.788 1.788 mg/100 g Snapper Type 1 specific Lutjanidae 30850 1.667 1.667 1.667 mg/100 g Sockeye salmon Type 1 specific Oncorhynchus nerka 8023 1.837 1.837 1.837 mg/100 g Soft-necked garlic Type 1 specific Allium sativum L. var. sativum 4682 0.308 0.308 0.308 mg/100 g Sorghum Type 1 specific Sorghum bicolor 4558 1.491 1.491 1.491 mg/100 g Soy bean Type 1 specific Glycine max 3847 3.223 3.223 3.223 mg/100 g Soy sauce Type 2 specific 0.735 0.735 0.735 mg/100 g Soybean oil Type 2 0.0 0.0 0.0 mg/100 g Spanish mackerel Type 1 specific Scomberomorus maculatus 99344 1.568 1.568 1.568 mg/100 g Spearmint Type 1 specific Mentha spicata 29719 0.247 0.247 0.247 mg/100 g Spelt Type 1 specific Triticum spelta 58933 1.07 1.07 1.07 mg/100 g Spinach Type 1 specific Spinacia oleracea 3562 0.223 0.223 0.223 mg/100 g Spiny lobster Type 1 specific Palinuridae 6731 1.634 1.634 1.634 mg/100 g Spirulina Type 1 specific Spirulina 551299 0.509 0.509 0.509 mg/100 g Spot croaker Type 1 specific Leiostomus xanthurus 59837 1.505 1.505 1.505 mg/100 g Squab Type 1 specific Columba 8931 1.501 1.501 1.501 mg/100 g Squid Type 1 specific Teuthida 551290 1.096 1.096 1.096 mg/100 g Star fruit Type 1 specific Averrhoa carambola 28974 0.077 0.077 0.077 mg/100 g Strawberry guava Type 1 specific Psidium cattleianum 375274 0.039 0.039 0.039 mg/100 g Striped bass Type 1 specific Morone saxatilis 34816 1.441 1.441 1.441 mg/100 g Striped mullet Type 1 specific Mugil cephalus 48193 1.573 1.573 1.573 mg/100 g Sturgeon Type 1 specific Acipenseridae 7900 1.312 1.312 1.312 mg/100 g Sunflower oil Type 2 0.0 0.0 0.0 mg/100 g Sweet basil Type 1 specific Ocimum basilicum 39350 0.191 0.191 0.191 mg/100 g Sweet orange Type 1 specific Citrus sinensis 2711 0.004 0.004 0.004 mg/100 g Sweet potato Type 1 specific Ipomoea batatas 4120 0.092 0.092 0.092 mg/100 g Swiss chard Type 1 specific Beta vulgaris ssp. cicla 1527200 0.13 0.13 0.13 mg/100 g Swordfish Type 1 specific Xiphias gladius 8245 1.609 1.609 1.609 mg/100 g Tallow Type 2 specific 0.0 0.0 0.0 mg/100 g Tapioca pearl Type 2 specific 0.006 0.006 0.006 mg/100 g Taro Type 1 specific Colocasia esculenta 4460 0.111 0.111 0.111 mg/100 g Teff Type 1 specific Eragrostis tef 110835 1.068 1.068 1.068 mg/100 g Tilefish Type 1 specific Lopholatilus chamaeleonticeps 390349 1.422 1.422 1.422 mg/100 g Tofu Type 2 specific 1.916333 3.644 0.713 mg/100 g Triticale Type 1 specific X Triticosecale rimpaui 0.911 0.911 0.911 mg/100 g True sole Type 1 specific Soleidae 30948 1.087 1.087 1.087 mg/100 g Turbot Type 1 specific Scophthalmus maximus 52904 1.305 1.305 1.305 mg/100 g Turkey Type 1 specific Meleagris gallopavo 9103 1.569 1.569 1.569 mg/100 g Turmeric Type 1 specific Curcuma longa 136217 0.81 0.81 0.81 mg/100 g Turnip Type 1 specific Brassica rapa var. rapa 51350 0.033 0.033 0.033 mg/100 g Ucuhuba Type 1 specific Virola surinamensis 224910 0.0 0.0 0.0 mg/100 g Vodka Type 2 specific 0.0 0.0 0.0 mg/100 g Wakame Type 1 specific Undaria pinnatifida 74381 0.257 0.257 0.257 mg/100 g Walnut Type 1 specific Juglans 16718 1.684 1.684 1.684 mg/100 g Water spinach Type 1 Ipomoea aquatica 0.223 0.223 0.223 mg/100 g Watercress Type 1 specific Rorippa nasturtium-aquaticum 135518 0.166 0.166 0.166 mg/100 g Watermelon Type 1 specific Citrullus lanatus 3654 0.018 0.018 0.018 mg/100 g Welsh onion Type 1 specific Allium fistulosum 35875 0.113 0.113 0.113 mg/100 g Whelk Type 1 specific Buccinidae 37796 1.903 1.903 1.903 mg/100 g White sucker Type 1 specific Catostomus commersonii 7971 1.362 1.362 1.362 mg/100 g Whitefish Type 1 specific Coregonus 27772 1.551 1.551 1.551 mg/100 g Whiting Type 1 specific Merlangius merlangus 8058 1.488 1.488 1.488 mg/100 g Wild boar Type 1 specific Sus scrofa 9823 1.748 1.748 1.748 mg/100 g Wild carrot Type 1 specific Daucus carota 4039 0.022 0.022 0.022 mg/100 g Wild celery Type 1 specific Apium graveolens 4045 0.032 0.032 0.032 mg/100 g Wild leek Type 1 specific Allium ampeloprasum 4681 0.096 0.096 0.096 mg/100 g Wild rice Type 1 specific Zizania 15949 1.018 1.018 1.018 mg/100 g Winged bean Type 1 specific Psophocarpus tetragonolobus 3891 2.497 2.497 2.497 mg/100 g Winter squash Type 1 specific Cucurbita maxima 3661 0.045 0.045 0.045 mg/100 g Yam Type 1 specific Dioscorea 4672 0.096 0.096 0.096 mg/100 g Yardlong bean Type 1 specific Vigna unguiculata ssp. sesquipedalis 138955 0.2 0.2 0.2 mg/100 g Yellow zucchini Type 1 specific Cucurbita pepo var. cylindrica 0.055 0.055 0.055 mg/100 g Yellowfin tuna Type 1 specific Thunnus albacares 8236 1.9 1.9 1.9 mg/100 g Yellowtail amberjack Type 1 specific Seriola lalandi 302047 1.881 1.881 1.881 mg/100 g