1.0 2010-04-08 22:04:46 UTC 2025-11-18 22:26:35 UTC FDB000941 1H-Indole-3-propanoic acid Indole-3-propionate (IPA), a deamination product of tryptophan formed by symbiotic bacteria in the gastrointestinal tract of mammals and birds. 3-Indolepropionic acid has been shown to prevent oxidative stress and death of primary neurons and neuroblastoma cells exposed to the amyloid beta-protein in the form of amyloid fibrils, one of the most prominent neuropathologic features of Alzheimer's disease. 3-Indolepropionic acid also shows a strong level of neuroprotection in two other paradigms of oxidative stress. (PMID: 10419516) [HMDB]. 1H-Indole-3-propanoic acid is found in common pea. 1H-Indole-3-propionate 1H-Indole-3-propionic acid 3-(1H-indol-3-yl)Propanoate 3-(1H-indol-3-yl)Propanoic acid 3-(1H-indol-3-yl)Propionate 3-(1H-indol-3-yl)Propionic acid 3-(2-Carboxyethyl)-1H-indole 3-(3-Indolyl)propanoate 3-(3-Indolyl)propanoic acid 3-(3-Indolyl)propionate 3-(3-Indolyl)propionic acid 3-Indolepropionate Antibiotic KG 431B b-(3-Indolyl)propionate b-(3-Indolyl)propionic acid b-Indole-3-propionate b-Indole-3-propionic acid b-Indolepropionate b-Indolepropionic acid beta-(3-Indolyl)propionate beta-(3-Indolyl)propionic acid beta-Indole-3-propionate beta-Indole-3-propionic acid beta-Indolepropionate beta-Indolepropionic acid Indole-3-propionate Indole-3-propionic acid Indolepropionate Indolepropionic acid IPA KG 431B β-(3-indolyl)propionate β-(3-indolyl)propionic acid C11H11NO2 189.2105 189.078978601 3-(1H-indol-3-yl)propanoic acid indolylpropionic acid 830-96-6 OC(=O)CCC1=CNC2=CC=CC=C12 InChI=1S/C11H11NO2/c13-11(14)6-5-8-7-12-10-4-2-1-3-9(8)10/h1-4,7,12H,5-6H2,(H,13,14) GOLXRNDWAUTYKT-UHFFFAOYSA-N belongs to the class of organic compounds known as indolyl carboxylic acids and derivatives. Indolyl carboxylic acids and derivatives are compounds containing a carboxylic acid chain (of at least 2 carbon atoms) linked to an indole ring. Indolyl carboxylic acids and derivatives Organic compounds Organoheterocyclic compounds Indoles and derivatives Indolyl carboxylic acids and derivatives Aromatic heteropolycyclic compounds 3-alkylindoles Azacyclic compounds Benzenoids Carbonyl compounds Carboxylic acids Heteroaromatic compounds Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Organonitrogen compounds Organopnictogen compounds Substituted pyrroles 3-alkylindole Aromatic heteropolycyclic compound Azacycle Benzenoid Carbonyl group Carboxylic acid Carboxylic acid derivative Heteroaromatic compound Hydrocarbon derivative Indole Indolyl carboxylic acid derivative Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Pyrrole Substituted pyrrole indol-3-yl carboxylic acid Solid logp 2.04 ALOGPS logs -2.42 ALOGPS solubility 7.27e-01 g/l ALOGPS logp 2.15 ChemAxon pka_strongest_acidic 4.8 ChemAxon iupac 3-(1H-indol-3-yl)propanoic acid ChemAxon average_mass 189.2105 ChemAxon mono_mass 189.078978601 ChemAxon smiles OC(=O)CCC1=CNC2=CC=CC=C12 ChemAxon formula C11H11NO2 ChemAxon inchi InChI=1S/C11H11NO2/c13-11(14)6-5-8-7-12-10-4-2-1-3-9(8)10/h1-4,7,12H,5-6H2,(H,13,14) ChemAxon inchikey GOLXRNDWAUTYKT-UHFFFAOYSA-N ChemAxon polar_surface_area 53.09 ChemAxon refractivity 53.05 ChemAxon polarizability 20 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 2 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::EiMs 1728 Specdb::MsIr 20 Specdb::MsIr 23 Specdb::MsIr 38 Specdb::MsIr 1728 Specdb::MsIr 1729 Specdb::MsIr 1730 Specdb::CMs 8921 Specdb::CMs 27581 Specdb::CMs 38359 Specdb::CMs 99763 Specdb::CMs 153783 Specdb::NmrOneD 1870 Specdb::NmrOneD 3991 Specdb::NmrOneD 166647 Specdb::MsMs 2049 Specdb::MsMs 2050 Specdb::MsMs 2051 Specdb::MsMs 5758 Specdb::MsMs 262620 Specdb::MsMs 262621 Specdb::MsMs 262622 Specdb::MsMs 282552 Specdb::MsMs 282553 Specdb::MsMs 282554 Specdb::MsMs 447358 Specdb::MsMs 452009 Specdb::MsMs 2252725 Specdb::MsMs 2253742 Specdb::MsMs 2253765 Specdb::MsMs 2254813 Specdb::MsMs 2254838 Specdb::MsMs 2255743 Specdb::MsMs 2255752 Specdb::MsMs 2256901 Specdb::MsMs 2257684 Specdb::MsMs 2257708 Specdb::MsMs 2258843 Specdb::MsMs 2258872 Specdb::MsMs 2259710 HMDB02302 IOP #<Reference:0x000055ce32700430> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Common pea Type 1 specific Pisum sativum 3888 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823