1.0 2010-04-08 22:04:50 UTC 2025-11-18 22:27:58 UTC FDB001089 (S)-N-Acetylmethionine Nutrient supplement used as a source of L-methionine. Acetyl-L-Methionine Acetylmethionin Acetylmethionine DL-N-Acetylmethionine L-(N-Acetyl)methionine L-Methionine, N-acetyl- L-N-Acetyl-methionine Methionamine Methionin Methionine, N-acetyl- Methionine, N-acetyl-, L- (8CI) N-Acetyl-L-methionine N-Acetyl-methionine N-Acetyl-S-methylhomocysteine N-Acetyl(methyl)homocysteine N-Acetylmethionine Thiomedon C7H13NO3S 191.248 191.061613977 (2S)-2-acetamido-4-(methylsulfanyl)butanoic acid N-acetylmethionine 65-82-7 [H][C@@](CCSC)(NC(C)=O)C(O)=O InChI=1S/C7H13NO3S/c1-5(9)8-6(7(10)11)3-4-12-2/h6H,3-4H2,1-2H3,(H,8,9)(H,10,11)/t6-/m0/s1 XUYPXLNMDZIRQH-LURJTMIESA-N belongs to the class of organic compounds known as methionine and derivatives. Methionine and derivatives are compounds containing methionine or a derivative thereof resulting from reaction of methionine at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. Methionine and derivatives Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds Acetamides Carbonyl compounds Carboxylic acids Dialkylthioethers Hydrocarbon derivatives Monocarboxylic acids and derivatives N-acyl-L-alpha-amino acids Organic oxides Organonitrogen compounds Organopnictogen compounds Secondary carboxylic acid amides Sulfenyl compounds Thia fatty acids Acetamide Aliphatic acyclic compound Carbonyl group Carboxamide group Carboxylic acid Dialkylthioether Fatty acid Fatty acyl Hydrocarbon derivative Methionine or derivatives Monocarboxylic acid or derivatives N-acyl-alpha amino acid or derivatives N-acyl-alpha-amino acid N-acyl-l-alpha-amino acid Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Organosulfur compound Secondary carboxylic acid amide Sulfenyl compound Thia fatty acid Thioether L-methionine derivative N-acetyl-L-amino acid methyl sulfide monocarboxylic acid Solid logp -0.15 ALOGPS logs -1.45 ALOGPS solubility 6.84e+00 g/l ALOGPS melting_point Mp 104° logp -0.11 ChemAxon pka_strongest_acidic 4.02 ChemAxon pka_strongest_basic -1.8 ChemAxon iupac (2S)-2-acetamido-4-(methylsulfanyl)butanoic acid ChemAxon average_mass 191.248 ChemAxon mono_mass 191.061613977 ChemAxon smiles [H][C@@](CCSC)(NC(C)=O)C(O)=O ChemAxon formula C7H13NO3S ChemAxon inchi InChI=1S/C7H13NO3S/c1-5(9)8-6(7(10)11)3-4-12-2/h6H,3-4H2,1-2H3,(H,8,9)(H,10,11)/t6-/m0/s1 ChemAxon inchikey XUYPXLNMDZIRQH-LURJTMIESA-N ChemAxon polar_surface_area 66.4 ChemAxon refractivity 47.03 ChemAxon polarizability 19.59 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Metabolism and Physiological Effects of N-Acetylmethionine SMP0126707 Metabolism and Physiological Effects of N-Formyl-L-Methionine SMP0126765 Specdb::NmrTwoD 2053 Specdb::MsIr 2599 Specdb::MsIr 2600 Specdb::CMs 1335 Specdb::CMs 1367 Specdb::CMs 149025 Specdb::MsMs 25601 Specdb::MsMs 25602 Specdb::MsMs 25603 Specdb::MsMs 32159 Specdb::MsMs 32160 Specdb::MsMs 32161 Specdb::MsMs 437183 Specdb::MsMs 437184 Specdb::MsMs 437185 Specdb::MsMs 437186 Specdb::MsMs 437187 Specdb::MsMs 445631 Specdb::MsMs 445632 Specdb::MsMs 445633 Specdb::MsMs 445634 Specdb::MsMs 445635 Specdb::MsMs 2232004 Specdb::MsMs 2232168 Specdb::MsMs 2236306 Specdb::MsMs 2238475 Specdb::MsMs 2239125 Specdb::MsMs 2253164 Specdb::MsMs 2253307 Specdb::MsMs 2255179 Specdb::MsMs 2255375 Specdb::NmrOneD 5229 Specdb::NmrOneD 94452 Specdb::NmrOneD 94453 Specdb::NmrOneD 94454 Specdb::NmrOneD 94455 Specdb::NmrOneD 94456 Specdb::NmrOneD 94457 Specdb::NmrOneD 94458 Specdb::NmrOneD 94459 Specdb::NmrOneD 94460 Specdb::NmrOneD 94461 Specdb::NmrOneD 94462 Specdb::NmrOneD 94463 Specdb::NmrOneD 94464 Specdb::NmrOneD 94465 Specdb::NmrOneD 94466 Specdb::NmrOneD 94467 Specdb::NmrOneD 94468 Specdb::NmrOneD 94469 Specdb::NmrOneD 94470 Specdb::NmrOneD 94471 HMDB11745 #<Reference:0x000055ce31f04bc8> #<Reference:0x000055ce31f04a10> #<Reference:0x000055ce31f04858> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Glycine N-acyltransferase Q6IB77 GLYAT Glycine N-acyltransferase-like protein 1 Q969I3 GLYATL1 Glycine N-acyltransferase-like protein 2 Q8WU03 GLYATL2 Rhodopsin P08100 RHO