1.0 2010-04-08 22:04:50 UTC 2025-11-18 22:28:11 UTC FDB001116 D-Glucaric acid Present in apples and grapefruit. D-Glucaric acid is found in pomes and citrus. D-(+)-Saccharic acid D-2,3,4,5-Tetrahydroxyhexanedioic acid D-galactarate D-glucarate D-Glucaric acid D-glucosaccharic acid D-mucic acid D-saccharic acid L-Gularic acid C6H10O8 210.1388 210.037567296 2,3,4,5-tetrahydroxyhexanedioic acid mucic acid 87-73-0 OC(C(O)C(O)C(O)=O)C(O)C(O)=O InChI=1S/C6H10O8/c7-1(3(9)5(11)12)2(8)4(10)6(13)14/h1-4,7-10H,(H,11,12)(H,13,14) DSLZVSRJTYRBFB-UHFFFAOYSA-N belongs to the class of organic compounds known as glucuronic acid derivatives. Glucuronic acid derivatives are compounds containing a glucuronic acid moiety (or a derivative), which consists of a glucose moiety with the C6 carbon oxidized to a carboxylic acid. Glucuronic acid derivatives Organic compounds Organic oxygen compounds Organooxygen compounds Carbohydrates and carbohydrate conjugates Aliphatic acyclic compounds Alpha hydroxy acids and derivatives Beta hydroxy acids and derivatives Carbonyl compounds Carboxylic acids Dicarboxylic acids and derivatives Hydrocarbon derivatives Hydroxy fatty acids Medium-chain fatty acids Medium-chain hydroxy acids and derivatives Monosaccharides Organic oxides Polyols Secondary alcohols Alcohol Aliphatic acyclic compound Alpha-hydroxy acid Beta-hydroxy acid Carbonyl group Carboxylic acid Carboxylic acid derivative Dicarboxylic acid or derivatives Fatty acid Fatty acyl Glucuronic acid or derivatives Hydrocarbon derivative Hydroxy acid Hydroxy fatty acid Medium-chain fatty acid Medium-chain hydroxy acid Monosaccharide Organic oxide Polyol Secondary alcohol logp -1.77 ALOGPS logs -0.52 ALOGPS solubility 6.31e+01 g/l ALOGPS melting_point Mp 125-126° logp -3.1 ChemAxon pka_strongest_acidic 2.83 ChemAxon pka_strongest_basic -3.7 ChemAxon iupac 2,3,4,5-tetrahydroxyhexanedioic acid ChemAxon average_mass 210.1388 ChemAxon mono_mass 210.037567296 ChemAxon smiles OC(C(O)C(O)C(O)=O)C(O)C(O)=O ChemAxon formula C6H10O8 ChemAxon inchi InChI=1S/C6H10O8/c7-1(3(9)5(11)12)2(8)4(10)6(13)14/h1-4,7-10H,(H,11,12)(H,13,14) ChemAxon inchikey DSLZVSRJTYRBFB-UHFFFAOYSA-N ChemAxon polar_surface_area 155.52 ChemAxon refractivity 38.14 ChemAxon polarizability 17.03 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 8 ChemAxon donor_count 6 ChemAxon physiological_charge -2 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 13280 Specdb::CMs 31941 Specdb::CMs 41609 Specdb::CMs 100479 Specdb::MsMs 6908 Specdb::MsMs 6909 Specdb::MsMs 6910 Specdb::MsMs 13580 Specdb::MsMs 13581 Specdb::MsMs 13582 Specdb::MsMs 440082 Specdb::NmrOneD 328962 Specdb::NmrOneD 328963 Specdb::NmrOneD 328964 Specdb::NmrOneD 328965 Specdb::NmrOneD 328966 Specdb::NmrOneD 328967 Specdb::NmrOneD 328968 Specdb::NmrOneD 328969 Specdb::NmrOneD 328970 Specdb::NmrOneD 328971 Specdb::NmrOneD 328972 Specdb::NmrOneD 328973 Specdb::NmrOneD 328974 Specdb::NmrOneD 328975 Specdb::NmrOneD 328976 Specdb::NmrOneD 328977 Specdb::NmrOneD 328978 Specdb::NmrOneD 328979 Specdb::NmrOneD 328980 Specdb::NmrOneD 328981 HMDB29881 16002 #<Reference:0x000055ce32197110> Citrus Unknown generic Pomes Unknown generic UDP-glucuronosyltransferase 1-1 P22309 UGT1A1 UDP-glucuronosyltransferase 1-4 P22310 UGT1A4 UDP-glucuronosyltransferase 1-6 P19224 UGT1A6 UDP-glucuronosyltransferase 1-9 O60656 UGT1A9 UDP-glucuronosyltransferase 2B4 P06133 UGT2B4 UDP-glucuronosyltransferase 2B7 P16662 UGT2B7