1.0 2010-04-08 22:04:50 UTC 2025-11-18 22:28:16 UTC FDB001128 Starch D-allopyranose, also known as hexose, is a member of the class of compounds known as hexoses. Hexoses are monosaccharides in which the sugar unit is a is a six-carbon containing moeity. D-allopyranose is soluble (in water) and a very weakly acidic compound (based on its pKa). D-allopyranose can be found in a number of food items such as ketchup, salt, norway lobster, and american pokeweed, which makes D-allopyranose a potential biomarker for the consumption of these food products. D-allopyranose exists in all living organisms, ranging from bacteria to humans. D-allopyranose is an aldohexose sugar. It is a rare monosaccharide that occurs as a 6-O-cinnamyl glycoside in the leaves of the African shrub Protea rubropilosa. Extracts from the fresh-water alga Ochromas malhamensis contain this sugar but of unknown absolute configuration. It is soluble in water and practically insoluble in methanol . Amylum Polyamylose C6H12O6 180.1559 180.063388116 6-(hydroxymethyl)oxane-2,3,4,5-tetrol d-galactose 9005-25-8 OCC1OC(O)C(O)C(O)C1O InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2 WQZGKKKJIJFFOK-UHFFFAOYSA-N belongs to the class of organic compounds known as hexoses. These are monosaccharides in which the sugar unit is a is a six-carbon containing moeity. Hexoses Organic compounds Organic oxygen compounds Organooxygen compounds Carbohydrates and carbohydrate conjugates Aliphatic heteromonocyclic compounds Hemiacetals Hydrocarbon derivatives Oxacyclic compounds Oxanes Polyols Primary alcohols Secondary alcohols Alcohol Aliphatic heteromonocyclic compound Hemiacetal Hexose monosaccharide Hydrocarbon derivative Organoheterocyclic compound Oxacycle Oxane Polyol Primary alcohol Secondary alcohol L-galactopyranose logp -2.57 ALOGPS logs 0.64 ALOGPS solubility 7.82e+02 g/l ALOGPS logp -2.9 ChemAxon pka_strongest_acidic 11.3 ChemAxon pka_strongest_basic -3 ChemAxon iupac 6-(hydroxymethyl)oxane-2,3,4,5-tetrol ChemAxon average_mass 180.1559 ChemAxon mono_mass 180.063388116 ChemAxon smiles OCC1OC(O)C(O)C(O)C1O ChemAxon formula C6H12O6 ChemAxon inchi InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2 ChemAxon inchikey WQZGKKKJIJFFOK-UHFFFAOYSA-N ChemAxon polar_surface_area 110.38 ChemAxon refractivity 35.92 ChemAxon polarizability 16.3 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 6 ChemAxon donor_count 5 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::EiMs 301 Specdb::MsMs 20108 Specdb::MsMs 20109 Specdb::MsMs 20110 Specdb::MsMs 20552 Specdb::MsMs 20553 Specdb::MsMs 20554 Specdb::MsMs 20774 Specdb::MsMs 20775 Specdb::MsMs 20776 Specdb::MsMs 21194 Specdb::MsMs 21195 Specdb::MsMs 21196 Specdb::MsMs 21659 Specdb::MsMs 21660 Specdb::MsMs 21661 Specdb::MsMs 22103 Specdb::MsMs 22104 Specdb::MsMs 22105 Specdb::MsMs 22325 Specdb::MsMs 22326 Specdb::MsMs 22327 Specdb::MsMs 22745 Specdb::MsMs 22746 Specdb::MsMs 22747 Specdb::MsMs 438683 Specdb::CMs 33933 Specdb::CMs 48780 Specdb::CMs 118482 Specdb::CMs 125897 Adzuki bean Type 1 specific Vigna angularis 3914 0.0 0.0 0.0 mg/100 g Agave Type 1 specific Agave 39509 347.56 910.0 0.24 mg/100 g Alaska blueberry Type 1 specific Vaccinium alaskaense 190544 0.0 0.0 0.0 mg/100 g Alaska pollock Type 1 specific Theragra chalcogramma 1042646 0.0 0.0 0.0 mg/100 g Alfalfa Type 1 specific Medicago sativa 3879 0.0 0.0 0.0 mg/100 g Allium Type 1 specific Allium 4678 0.0 0.0 0.0 mg/100 g Almond Type 1 specific Prunus dulcis 3755 448.0155 1000.0 0.0 mg/100 g Almond milk Type 1 0.07 0.07 0.07 mg/100 g Amaranth Type 1 specific Amaranthus 3564 24501.811667 57270.0 5.435 mg/100 g American cranberry Type 1 specific Vaccinium macrocarpon 13750 0.0 0.0 0.0 mg/100 g American lobster Type 1 specific Homarus americanus 6706 0.0 0.0 0.0 mg/100 g American pokeweed Type 1 specific Phytolacca americana 3527 Anatidae Type 1 specific Anatidae 8830 0.0 0.0 0.0 mg/100 g Anchovy Type 1 specific Engraulidae 43062 0.0 0.0 0.0 mg/100 g Anguilliformes Type 1 specific Anguilliformes 7933 0.0 0.0 0.0 mg/100 g Anise Type 1 specific Pimpinella anisum 271192 Apple Type 1 specific Malus pumila 283210 5.555556 50.0 0.0 mg/100 g Apricot Type 1 specific Prunus armeniaca 36596 87.5 350.0 0.0 mg/100 g Arabica coffee Type 1 specific Coffea arabica 13443 5500.0 28500.0 0.0 mg/100 g Arrowroot Type 1 specific Maranta arundinacea 210060 47250.0 47250.0 47250.0 mg/100 g Asparagus Type 1 specific Asparagus officinalis 4686 0.0 0.0 0.0 mg/100 g Atlantic halibut Type 1 specific Hippoglossus hippoglossus 8267 0.0 0.0 0.0 mg/100 g Atlantic wolffish Type 1 specific Anarhichas lupus 8204 0.0 0.0 0.0 mg/100 g Avocado Type 1 specific Persea americana 3435 67.515 110.0 0.06 mg/100 g Baby food Type 2 specific 3328.75 53230.0 0.0 mg/100 g Bagel Type 2 specific 46150.0 48700.0 43600.0 mg/100 g Baked beans Type 2 specific 7756.666667 8050.0 7380.0 mg/100 g Bamboo shoots Type 1 specific Phyllostachys edulis 38705 0.0 0.0 0.0 mg/100 g Banana Type 1 specific Musa acuminata 4641 2694.398333 5380.0 3.195 mg/100 g Barley Type 1 specific Hordeum vulgare 4513 59100.0 62200.0 56000.0 mg/100 g Bean Type 1 specific 7756.666667 8050.0 7380.0 mg/100 g Bearded seal Type 1 specific Erignathus barbatus 39304 0.0 0.0 0.0 mg/100 g Beer Type 2 specific 0.0 0.0 0.0 mg/100 g Beluga whale Type 1 specific Delphinapterus leucas 9749 0.0 0.0 0.0 mg/100 g Bilberry Type 1 specific Vaccinium myrtillus 180763 0.0 0.0 0.0 mg/100 g Biscuit Type 2 specific 26481.428571 51000.0 0.0 mg/100 g Bivalvia (Clam, Mussel, Oyster) Type 1 specific Bivalvia 6544 1855.0 2310.0 1400.0 mg/100 g Black salsify Type 1 specific Scorzonera hispanica 114289 0.0 0.0 0.0 mg/100 g Black tea Type 1 111.111111 500.0 0.0 mg/100 g Black walnut Type 1 specific Juglans nigra 16719 120.12 240.0 0.24 mg/100 g Black-eyed pea Type 1 specific Vigna unguiculata ssp. unguiculata 3920 Blackcurrant Type 1 specific Ribes nigrum 78511 0.0 0.0 0.0 mg/100 g Blue crab Type 1 specific Callinectes sapidus 6763 0.0 0.0 0.0 mg/100 g Blue whiting Type 1 specific Micromesistius poutassou 81636 0.0 0.0 0.0 mg/100 g Brazil nut Type 1 specific Bertholletia excelsa 3645 425.0 600.0 250.0 mg/100 g Breakfast cereal Type 2 specific 39100.357143 77700.0 0.0 mg/100 g Breakfast sandwich Type 2 specific 17150.833333 24230.0 11370.0 mg/100 g Broccoli Type 1 specific Brassica oleracea var. italica 36774 0.0 0.0 0.0 mg/100 g Brussel sprouts Type 1 specific Brassica oleracea var. gemmifera 178616 122.5 490.0 0.0 mg/100 g Burbot Type 1 specific Lota lota 69944 0.0 0.0 0.0 mg/100 g Burdock Type 1 specific Arctium lappa 4217 Burrito Type 2 specific 15320.0 26370.0 4570.0 mg/100 g Butter Type 2 specific 0.0 0.0 0.0 mg/100 g Buttermilk Type 2 specific 0.0 0.0 0.0 mg/100 g Cabbage Type 1 specific Brassica oleracea var. capitata 3716 0.0 0.0 0.0 mg/100 g Cake Type 2 specific 17766.666667 19600.0 16000.0 mg/100 g Cantaloupe melon Type 1 Cucumis melo var. cantalupensis 0.05 0.05 0.05 mg/100 g Caraway Type 1 specific Carum carvi 48032 4500.0 4500.0 4500.0 mg/100 g Cardamom Type 1 specific Elettaria cardamomum 105181 30000.0 30000.0 30000.0 mg/100 g Carob Type 1 specific Ceratonia siliqua 20340 35000.0 35000.0 35000.0 mg/100 g Carp bream Type 1 specific Abramis brama 38527 0.0 0.0 0.0 mg/100 g Carrot Type 1 specific Daucus carota ssp. sativus 79200 310.014 2000.0 0.0 mg/100 g Casein Type 2 specific 0.0 0.0 0.0 mg/100 g Cashew nut Type 1 specific Anacardium occidentale 171929 9070.0 23490.0 0.0 mg/100 g Cassava Type 1 specific Manihot esculenta 3983 27710.0 55420.0 0.0 mg/100 g Catfish Type 1 specific Siluriformes 7995 0.0 0.0 0.0 mg/100 g Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 538.367347 5490.0 0.0 mg/100 g Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 7.5 10.0 0.0 mg/100 g Celeriac Type 1 specific Apium graveolens var. rapaceum 278110 370.0 370.0 370.0 mg/100 g Celery leaves Type 1 specific Apium graveolens var. secalinum 941588 0.0 0.0 0.0 mg/100 g Celery stalks Type 1 specific Apium graveolens var. dulce 117781 0.0 0.0 0.0 mg/100 g Cetacea (Dolphin, Porpoise, Whale) Type 1 specific Cetacea 9721 0.0 0.0 0.0 mg/100 g Channel catfish Type 1 specific Ictalurus punctatus 7998 0.0 0.0 0.0 mg/100 g Chanterelle Type 1 specific Cantharellus cibarius 36066 0.0 0.0 0.0 mg/100 g Charr Type 1 specific Salvelinus 8033 0.0 0.0 0.0 mg/100 g Chayote Type 1 specific Sechium edule 184140 0.0 0.0 0.0 mg/100 g Cheese Type 2 specific 50.78125 1350.0 0.0 mg/100 g Cherimoya Type 1 specific Annona cherimola 49314 0.0 0.0 0.0 mg/100 g Chervil Type 1 specific Anthriscus cerefolium 40888 0.0 0.0 0.0 mg/100 g Chestnut Type 1 specific Castanea 21019 26900.0 26900.0 26900.0 mg/100 g Chickpea Type 1 specific Cicer arietinum 3827 36400.0 36400.0 36400.0 mg/100 g Chicory Type 1 specific Cichorium intybus 13427 0.0 0.0 0.0 mg/100 g Chili Type 2 specific 4983.333333 6900.0 3350.0 mg/100 g Chinese cabbage Type 1 specific Brassica rapa 3711 0.0 0.0 0.0 mg/100 g Chinese water chestnut Type 1 specific Eleocharis dulcis 110284 23500.0 23500.0 23500.0 mg/100 g Chinook salmon Type 1 specific Oncorhynchus tshawytscha 74940 0.0 0.0 0.0 mg/100 g Chives Type 1 specific Allium schoenoprasum 74900 0.0 0.0 0.0 mg/100 g Chocolate Type 2 specific 4644.0 6820.0 2900.0 mg/100 g Chocolate spread Type 2 specific 0.0 0.0 0.0 mg/100 g Chum salmon Type 1 specific Oncorhynchus keta 8018 0.0 0.0 0.0 mg/100 g Cinnamon Type 1 specific Cinnamomum 13428 24400.0 24400.0 24400.0 mg/100 g Clam Type 1 1.4 1.4 1.4 mg/100 g Clawed lobster Type 1 specific Nephropidae 6704 350.0 800.0 0.0 mg/100 g Clementine Type 1 Citrus × clementina 0.0 0.0 0.0 mg/100 g Clupeinae (Herring, Sardine, Sprat) Type 1 specific Clupeinae 7948 0.0 0.0 0.0 mg/100 g Cocoa bean Type 1 specific Theobroma cacao 3641 6000.0 6000.0 6000.0 mg/100 g Cocoa butter Type 2 specific 0.0 0.0 0.0 mg/100 g Cocoa powder Type 2 specific 5700.0 10500.0 3300.0 mg/100 g Coconut Type 1 specific Cocos nucifera 13894 0.0 0.0 0.0 mg/100 g Coffee Type 1 generic Coffea 13442 5500.0 28500.0 0.0 mg/100 g Coho salmon Type 1 specific Oncorhynchus kisutch 8019 0.0 0.0 0.0 mg/100 g Common bean Type 1 specific Phaseolus vulgaris 3885 7449.642857 34170.0 0.0 mg/100 g Common buckwheat Type 1 specific Fagopyrum esculentum 3617 47700.0 76100.0 0.0 mg/100 g Common cabbage Type 1 specific Brassica oleracea 3712 9.090909 70.0 0.0 mg/100 g Common chokecherry Type 1 specific Prunus virginiana 133204 870.0 870.0 870.0 mg/100 g Common dab Type 1 specific Limanda limanda 27771 0.0 0.0 0.0 mg/100 g Common grape Type 1 specific Vitis vinifera 29760 1350.0 2700.0 0.0 mg/100 g Common hazelnut Type 1 specific Corylus avellana 13451 0.14 0.14 0.14 mg/100 g Common ling Type 1 specific Molva molva 163112 0.0 0.0 0.0 mg/100 g Common mushroom Type 1 specific Agaricus bisporus 5341 122.857143 430.0 0.0 mg/100 g Common octopus Type 1 specific Octopus vulgaris 6645 1500.0 1500.0 1500.0 mg/100 g Common pea Type 1 specific Pisum sativum 3888 12508.571429 39400.0 0.0 mg/100 g Common walnut Type 1 specific Juglans regia 51240 30.02 60.0 0.04 mg/100 g Common wheat Type 1 specific Triticum aestivum 4565 67100.0 67100.0 67100.0 mg/100 g Coriander Type 1 specific Coriandrum sativum 4047 2500.0 10000.0 0.0 mg/100 g Corn Type 1 specific Zea mays 4577 36846.842105 87000.0 0.0 mg/100 g Corn chip Type 2 specific 25985.0 46800.0 5170.0 mg/100 g Corn grits Type 2 specific 41600.0 70200.0 14340.0 mg/100 g Cottonseed Type 1 specific Gossypium 3633 0.0 0.0 0.0 mg/100 g Crab Type 1 specific Brachyura 6752 533.333333 1100.0 0.0 mg/100 g Cracker Type 2 specific 54681.333333 68300.0 40780.0 mg/100 g Crayfish Type 1 specific Astacidea 6712 1200.0 1200.0 1200.0 mg/100 g Cream Type 2 specific 0.0 0.0 0.0 mg/100 g Crisp bread Type 2 specific 21560.0 54800.0 0.0 mg/100 g Cucumber Type 1 specific Cucumis sativus 3659 113.75 830.0 0.0 mg/100 g Cucurbita Type 1 specific Cucurbita 3660 273.076923 1470.0 0.0 mg/100 g Curry powder Type 2 specific 0.0 0.0 0.0 mg/100 g Daikon radish Type 1 specific Raphanus sativus var. longipinnatus 41679 0.0 0.0 0.0 mg/100 g Dandelion Type 1 specific Taraxacum officinale 50225 0.0 0.0 0.0 mg/100 g Date Type 1 specific Phoenix dactylifera 42345 10300.0 20600.0 0.0 mg/100 g Dill Type 1 specific Anethum graveolens 40922 0.0 0.0 0.0 mg/100 g Domestic pig Type 1 specific Sus scrofa domestica 9825 207.831325 11750.0 0.0 mg/100 g Dried milk Type 2 specific 0.0 0.0 0.0 mg/100 g Eastern oyster Type 1 specific Crassostrea virginica 6565 512.6125 900.0 0.45 mg/100 g Edible shell Type 2 specific 56365.0 57330.0 55400.0 mg/100 g Egg roll Type 2 specific 20400.0 22400.0 19100.0 mg/100 g Eggplant Type 1 specific Solanum melongena 4111 200.0 200.0 200.0 mg/100 g Eggs Unknown generic 0.0 0.0 0.0 mg/100 g Elderberry Type 1 specific Sambucus 4201 0.0 0.0 0.0 mg/100 g Empanada Type 2 specific 26130.0 26130.0 26130.0 mg/100 g Endive Type 1 specific Cichorium endivia 114280 0.0 0.0 0.0 mg/100 g Enokitake Type 1 specific Flammulina velutipes 38945 0.0 0.0 0.0 mg/100 g European chestnut Type 1 specific Castanea sativa 21020 51500.0 51500.0 51500.0 mg/100 g European plum Type 1 specific Prunus domestica 3758 1277.5 5110.0 0.0 mg/100 g Evening primrose Type 1 specific Oenothera biennis 3942 Feijoa Type 1 specific Feijoa sellowiana 260130 0.0 0.0 0.0 mg/100 g Fennel Type 1 specific Foeniculum vulgare 48038 0.0 0.0 0.0 mg/100 g Fenugreek Type 1 specific Trigonella foenum-graecum 78534 Fig Type 1 specific Ficus carica 3494 1102.614 5070.0 0.0 mg/100 g Fish oil Type 1 0.0 0.0 0.0 mg/100 g Flatfish Type 1 specific Pleuronectiformes 8252 0.0 0.0 0.0 mg/100 g Flaxseed Type 1 specific Linum usitatissimum 4006 0.0 0.0 0.0 mg/100 g Flour Type 2 specific 61250.0 64500.0 58000.0 mg/100 g French plantain Type 1 specific Musa X paradisiaca 89151 13500.5 40700.0 0.0 mg/100 g French toast Type 2 specific 26600.0 26600.0 26600.0 mg/100 g Fruit gum Type 2 specific 21400.0 21400.0 21400.0 mg/100 g Fruit juice Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit preserve Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit-flavor drink Type 2 specific 15.714286 70.0 0.0 mg/100 g Frybread Type 2 specific 43070.0 43290.0 42850.0 mg/100 g Gadiformes Type 1 specific Gadiformes 8043 0.0 0.0 0.0 mg/100 g Gadus (Common cod) Type 1 specific Gadus 8048 500.0 2500.0 0.0 mg/100 g Garden cress Type 1 specific Lepidium sativum 33125 0.0 0.0 0.0 mg/100 g Garden onion Type 1 specific Allium cepa 4679 0.0 0.0 0.0 mg/100 g Garden onion (var.) Type 1 specific Allium cepa var. cepa 4679 0.0 0.0 0.0 mg/100 g Garden rhubarb Type 1 specific Rheum rhabarbarum 3621 220.0 220.0 220.0 mg/100 g Garden tomato Type 1 specific Solanum lycopersicum 4081 64.545455 220.0 0.0 mg/100 g Garden tomato (var.) Type 1 specific Solanum lycopersicum var. lycopersicum 397755 506.0 506.0 506.0 mg/100 g Garfish Type 1 specific Belone belone 129037 0.0 0.0 0.0 mg/100 g Garlic Type 1 specific Allium sativum 4682 0.0 0.0 0.0 mg/100 g Gelatin Type 2 specific 0.0 0.0 0.0 mg/100 g Gelatin dessert Type 2 specific 85900.0 85900.0 85900.0 mg/100 g Gin Type 2 specific 0.0 0.0 0.0 mg/100 g Ginger Type 1 specific Zingiber officinale 94328 15575.0 31150.0 0.0 mg/100 g Ginkgo nuts Type 1 specific Ginkgo biloba 3311 54370.0 54370.0 54370.0 mg/100 g Globe artichoke Type 1 specific Cynara scolymus 59895 0.0 0.0 0.0 mg/100 g Gooseberry Type 1 specific Ribes uva-crispa 135518 750.0 1500.0 0.0 mg/100 g Grape Type 1 specific Vitis 3603 0.0 0.0 0.0 mg/100 g Grape wine Type 2 specific 0.0 0.0 0.0 mg/100 g Grapefruit Type 1 specific Citrus X paradisi 37656 0.0 0.0 0.0 mg/100 g Grapefruit/Pummelo hybrid Type 1 specific Citrus paradisi X Citrus maxima 37656 0.0 0.0 0.0 mg/100 g Green bean Type 1 specific Phaseolus vulgaris 3885 1468.888889 3100.0 0.0 mg/100 g Green bell pepper Type 1 specific Capsicum annuum 4072 25.0 100.0 0.0 mg/100 g Green lentil Type 1 Lens culinaris 14.35 14.35 14.35 mg/100 g Green plum Type 1 0.0 0.0 0.0 mg/100 g Green tea Type 1 111.111111 500.0 0.0 mg/100 g Green zucchini Type 1 specific Cucurbita pepo var. cylindrica 0.0 0.0 0.0 mg/100 g Greenland halibut/turbot Type 1 specific Reinhardtius hippoglossoides 111784 0.0 0.0 0.0 mg/100 g Groundcherry Type 1 specific Physalis 24663 0.0 0.0 0.0 mg/100 g Guava Type 1 specific Psidium guajava 120290 4400.0 13200.0 0.0 mg/100 g Haddock Type 1 specific Melanogrammus aeglefinus 8056 66.666667 200.0 0.0 mg/100 g Hamburger Type 2 specific 14299.047619 21200.0 8600.0 mg/100 g Hazelnut Type 1 specific Corylus 13450 882.028 1900.0 0.14 mg/100 g Herbal tea Type 1 166.666667 500.0 0.0 mg/100 g Hippoglossus (Common halibut) Type 1 specific Hippoglossus 8266 0.0 0.0 0.0 mg/100 g Honey Type 2 specific 0.0 0.0 0.0 mg/100 g Horchata Type 2 specific 16545.0 32100.0 990.0 mg/100 g Horseradish Type 1 specific Armoracia rusticana 3704 1233.333333 3700.0 0.0 mg/100 g Hot chocolate Type 2 specific 533.333333 1600.0 0.0 mg/100 g Hushpuppy Type 2 specific 30320.0 30320.0 30320.0 mg/100 g Ice cream Type 2 specific 400.0 2000.0 0.0 mg/100 g Italian sweet red pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Jackfruit Type 1 specific Artocarpus heterophyllus 3489 735.365 1470.0 0.73 mg/100 g Japanese pumpkin Type 1 specific Cucurbita maxima 3661 737.5 1470.0 0.0 mg/100 g Jerusalem artichoke Type 1 specific Helianthus tuberosus 4233 13130.0 26260.0 0.0 mg/100 g Jicama Type 1 specific Pachyrhizus erosus 109171 32442.25 32442.25 32442.25 mg/100 g Kale Type 1 specific Brassica napus var. pabularia 26.666667 80.0 0.0 mg/100 g Kefir Type 2 specific 0.0 0.0 0.0 mg/100 g Ketchup Type 2 specific 950.0 1100.0 800.0 mg/100 g Kiwi Type 1 specific Actinidia chinensis 3625 45.0 180.0 0.0 mg/100 g Kohlrabi Type 1 specific Brassica oleracea var. gongylodes 109379 0.0 0.0 0.0 mg/100 g Kombu Type 1 specific Saccharina japonica 88149 0.0 0.0 0.0 mg/100 g Kumquat Type 1 specific Fortunella 2706 0.0 0.0 0.0 mg/100 g Lake trout Type 1 specific Salvelinus namaycush 8040 0.0 0.0 0.0 mg/100 g Lard Type 2 specific 0.0 0.0 0.0 mg/100 g Lasagna Type 2 specific 8920.0 9450.0 8390.0 mg/100 g Leavening agent Type 2 specific 9850.0 37800.0 0.0 mg/100 g Leek Type 1 specific Allium porrum 100.0 100.0 100.0 mg/100 g Lemon Type 1 specific Citrus limon 2708 0.0 0.0 0.0 mg/100 g Lemon sole Type 1 specific Microstomus kitt 106175 0.0 0.0 0.0 mg/100 g Lentils Type 1 generic Lens culinaris 3864 19828.5875 50800.0 0.0 mg/100 g Lettuce Type 1 specific Lactuca sativa 4236 2.5 20.0 0.0 mg/100 g Lichee Type 1 specific Litchi chinensis 151069 0.0 0.0 0.0 mg/100 g Lime Type 1 specific Citrus aurantiifolia 159033 0.0 0.0 0.0 mg/100 g Lingonberry Type 1 specific Vaccinium vitis-idaea 180772 50.0 100.0 0.0 mg/100 g Liquor Type 2 specific 0.0 0.0 0.0 mg/100 g Liquorice Type 2 specific 1567.5 6270.0 0.0 mg/100 g Loganberry Type 1 specific Rubus loganobaccus 0.0 0.0 0.0 mg/100 g Loquat Type 1 specific Eriobotrya japonica 32224 0.0 0.0 0.0 mg/100 g Lovage Type 1 specific Levisticum officinale 48042 Lumpsucker Type 1 specific Cyclopteridae 8101 0.0 0.0 0.0 mg/100 g Macadamia nut Type 1 specific Macadamia 4329 787.50875 1050.0 0.035 mg/100 g Macadamia nut (M. tetraphylla) Type 1 specific Macadamia tetraphylla 512563 0.035 0.035 0.035 mg/100 g Macaroni and cheese Type 2 specific 17138.0 52600.0 9680.0 mg/100 g Maitake Type 1 specific Grifola frondosa 5627 0.0 0.0 0.0 mg/100 g Malus (Crab apple) Type 1 specific Malus 3749 0.0 0.0 0.0 mg/100 g Mamey sapote Type 1 specific Pouteria sapota 233744 3165.575 6330.0 1.15 mg/100 g Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571 0.0 0.0 0.0 mg/100 g Mango Type 1 specific Mangifera indica 29780 24266.666667 72800.0 0.0 mg/100 g Margarine Type 2 specific 0.0 0.0 0.0 mg/100 g Margarine-like spread Type 2 specific 0.0 0.0 0.0 mg/100 g Marine mussel Type 1 specific Mytilidae 6547 0.0 0.0 0.0 mg/100 g Marzipan Type 2 specific 0.0 0.0 0.0 mg/100 g Meat bouillon Type 2 specific 5160.0 12000.0 0.0 mg/100 g Meatball Type 2 specific 0.0 0.0 0.0 mg/100 g Meringue Type 2 specific 0.0 0.0 0.0 mg/100 g Milk (Cow) Type 2 specific 0.0 0.0 0.0 mg/100 g Milk (Human) Type 2 specific 0.0 0.0 0.0 mg/100 g Milk (Other mammals) Type 2 specific 0.0 0.0 0.0 mg/100 g Milkshake Type 2 specific 1000.0 1000.0 1000.0 mg/100 g Millet Type 1 specific Panicum miliaceum 4540 23293.333333 69880.0 0.0 mg/100 g Miso Type 2 specific 0.0 0.0 0.0 mg/100 g Mixed nuts Type 2 specific 4200.0 4200.0 4200.0 mg/100 g Moth bean Type 1 specific Vigna aconitifolia 3918 26600.0 26600.0 26600.0 mg/100 g Mountain hare Type 1 specific Lepus timidus 62621 0.0 0.0 0.0 mg/100 g Mung bean Type 1 specific Vigna radiata 157791 0.0 0.0 0.0 mg/100 g Muskmelon Type 1 specific Cucumis melo 3656 5.0 30.0 0.0 mg/100 g Mustard Type 2 specific 0.0 0.0 0.0 mg/100 g Nachos Type 2 specific 23535.0 30450.0 16620.0 mg/100 g Narrowleaf cattail Type 1 specific Typha angustifolia 59011 0.0 0.0 0.0 mg/100 g Nectarine Type 1 specific Prunus persica var. nucipersica 323851 23.358333 70.0 0.0 mg/100 g Northern pike Type 1 specific Esox lucius 8010 0.0 0.0 0.0 mg/100 g Norway haddock Type 1 specific Sebastes viviparus 394708 0.0 0.0 0.0 mg/100 g Norway lobster Type 1 specific Nephrops norvegicus 6829 800.0 800.0 800.0 mg/100 g Norway pout Type 1 specific Trisopterus esmarkii 80723 0.0 0.0 0.0 mg/100 g Nutmeg Type 1 specific Myristica fragrans 51089 21900.0 31700.0 4000.0 mg/100 g Nutritional drink Type 2 specific 700.0 1400.0 0.0 mg/100 g Oat Type 1 specific Avena sativa 4498 13750.0 55000.0 0.0 mg/100 g Oil palm Type 1 specific Elaeis 51952 0.0 0.0 0.0 mg/100 g Okra Type 1 specific Abelmoschus esculentus 455045 113.333333 340.0 0.0 mg/100 g Olive Type 1 specific Olea europaea 4146 0.0375 0.15 0.0 mg/100 g Oriental wheat Type 1 specific Triticum turanicum 376534 26205.2 52410.0 0.4 mg/100 g Other animal fat Type 2 specific 0.0 0.0 0.0 mg/100 g Other bread Type 2 specific 34560.714286 46000.0 0.0 mg/100 g Other bread product Type 2 specific 45095.0 65800.0 0.0 mg/100 g Other candy Type 2 specific 8753.333333 15300.0 360.0 mg/100 g Other dish Type 2 specific 12832.380952 32400.0 0.0 mg/100 g Other fermented milk Type 2 specific 0.0 0.0 0.0 mg/100 g Other fish product Type 2 specific 8833.333333 18900.0 0.0 mg/100 g Other frozen dessert Type 2 specific 1300.0 1300.0 1300.0 mg/100 g Other fruit product Type 2 specific 189.0 189.0 189.0 mg/100 g Other pasta dish Type 2 specific 6935.0 7440.0 6430.0 mg/100 g Other sandwich Type 2 specific 18490.0 24550.0 13400.0 mg/100 g Other snack food Type 2 specific 39196.666667 71400.0 0.0 mg/100 g Other soy product Type 2 specific 2650.0 2800.0 2500.0 mg/100 g Oyster mushroom Type 1 specific Pleurotus ostreatus 5322 0.0 0.0 0.0 mg/100 g Pacific cod Type 1 specific Gadus macrocephalus 80720 0.0 0.0 0.0 mg/100 g Pacific halibut Type 1 specific Hippoglossus stenolepis 195615 0.0 0.0 0.0 mg/100 g Pacific ocean perch Type 1 specific Sebastes alutus 72055 0.0 0.0 0.0 mg/100 g Pacific rockfish Type 1 specific Sebastes 34820 0.0 0.0 0.0 mg/100 g Painted comber Type 1 specific Serranus scriba 349661 0.0 0.0 0.0 mg/100 g Pak choy Type 1 specific Brassica rapa var. chinensis 93385 0.0 0.0 0.0 mg/100 g Pan dulce Type 2 specific 37800.0 37800.0 37800.0 mg/100 g Pancake Type 2 specific 34807.5 56200.0 20880.0 mg/100 g Papaya Type 1 specific Carica papaya 3649 0.0 0.0 0.0 mg/100 g Parsley Type 1 specific Petroselinum crispum 4043 215.0 430.0 0.0 mg/100 g Parsnip Type 1 specific Pastinaca sativa 4041 0.0 0.0 0.0 mg/100 g Passion fruit Type 1 specific Passiflora edulis 78168 0.0 0.0 0.0 mg/100 g Pasta Type 2 specific 38973.846154 73900.0 0.0 mg/100 g Pastry Type 2 specific 12080.434783 44500.0 0.0 mg/100 g Pate Type 2 specific 0.0 0.0 0.0 mg/100 g Peach Type 1 specific Prunus persica 3760 600.0 3600.0 0.0 mg/100 g Peach (var.) Type 1 specific Prunus persica var. persica 323852 0.0 0.0 0.0 mg/100 g Peanut Type 1 specific Arachis hypogaea 3818 4313.0 5800.0 0.0 mg/100 g Pear Type 1 specific Pyrus communis 23211 0.0 0.0 0.0 mg/100 g Pecan nut Type 1 specific Carya illinoinensis 32201 166.676111 460.0 0.0 mg/100 g Pepper Type 1 specific Capsicum annuum 4072 10.0 100.0 0.0 mg/100 g Pepper (Spice) Type 1 specific Piper nigrum 13216 19250.0 38500.0 0.0 mg/100 g Perciformes Type 1 specific Perciformes 8111 0.0 0.0 0.0 mg/100 g Persian lime Type 1 specific Citrus latifolia 200541 0.0 0.0 0.0 mg/100 g Persimmon Type 1 specific Diospyros 13492 0.0 0.0 0.0 mg/100 g Pie Type 2 specific 14360.0 16950.0 10730.0 mg/100 g Pie crust Type 2 specific 43382.5 51850.0 34670.0 mg/100 g Pikeperch Type 1 specific Sander lucioperca 283035 0.0 0.0 0.0 mg/100 g Piki bread Type 2 specific 42140.0 61300.0 22980.0 mg/100 g Pine nut Type 1 specific Pinus 3337 1732.8575 5500.0 0.0 mg/100 g Pineapple Type 1 specific Ananas comosus 4615 0.271429 1.9 0.0 mg/100 g Pistachio Type 1 specific Pistacia vera 55513 738.611667 1670.0 0.0 mg/100 g Pizza Type 2 specific 21369.193548 27670.0 0.0 mg/100 g Plantain Type 1 Musa × paradisiaca 32.0 32.0 32.0 mg/100 g Pleuronectidae (Dab, Halibut, Plaice) Type 1 specific Pleuronectidae 8256 0.0 0.0 0.0 mg/100 g Pollock Type 1 specific Pollachius 8059 0.0 0.0 0.0 mg/100 g Pomegranate Type 1 specific Punica granatum 22663 0.0 0.0 0.0 mg/100 g Popcorn Type 2 specific 49850.0 60850.0 34400.0 mg/100 g Poppy Type 1 specific Papaver 3468 0.0 0.0 0.0 mg/100 g Port wine Type 2 specific 0.0 0.0 0.0 mg/100 g Pot pie Type 2 specific 14465.0 14800.0 14130.0 mg/100 g Potato Type 1 specific Solanum tuberosum 4113 19379.111111 70600.0 0.0 mg/100 g Potato chip Type 2 specific 49073.333333 58200.0 42950.0 mg/100 g Potato puffs Type 2 specific 20335.0 20830.0 19840.0 mg/100 g Prairie turnip Type 1 specific Pediomelum esculentum 458363 27277.92125 69840.0 1.685 mg/100 g Prickly pear Type 1 specific Opuntia 106975 0.0 0.0 0.0 mg/100 g Processed cheese Type 2 specific 20176.666667 21500.0 18450.0 mg/100 g Prunus (Cherry, Plum) Type 1 specific Prunus 3754 0.0 0.0 0.0 mg/100 g Pupusa Type 2 specific 20216.666667 23580.0 18090.0 mg/100 g Quesadilla Type 2 specific 17100.0 17100.0 17100.0 mg/100 g Quince Type 1 specific Cydonia oblonga 36610 0.0 0.0 0.0 mg/100 g Quinoa Type 1 specific Chenopodium quinoa 63459 23283.541667 52220.0 0.625 mg/100 g Rabbit Type 1 specific Leporidae 9979 0.0 0.0 0.0 mg/100 g Radish Type 1 specific Raphanus sativus 3726 0.0 0.0 0.0 mg/100 g Rainbow trout Type 1 specific Oncorhynchus mykiss 8022 0.0 0.0 0.0 mg/100 g Rape Type 1 specific Brassica napus var. napus 138011 0.0 0.0 0.0 mg/100 g Ravioli Type 2 specific 9425.0 10100.0 8750.0 mg/100 g Red algae Type 1 specific Rhodophyta 2763 0.0 0.0 0.0 mg/100 g Red beetroot Type 1 specific Beta vulgaris var. rubra 0.0 0.0 0.0 mg/100 g Red bell pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Red rice Type 1 specific Oryza rufipogon 4529 1.2 1.2 1.2 mg/100 g Red tea Type 1 166.666667 500.0 0.0 mg/100 g Redcurrant Type 1 specific Ribes rubrum 175228 0.0 0.0 0.0 mg/100 g Remoulade Type 2 specific 0.0 0.0 0.0 mg/100 g Rice Type 1 specific Oryza sativa 4530 49652.307692 78100.0 0.0 mg/100 g Robusta coffee Type 1 specific Coffea canephora 49390 5500.0 28500.0 0.0 mg/100 g Rock ptarmigan Type 1 specific Lagopus muta 64668 0.0 0.0 0.0 mg/100 g Romaine lettuce Type 1 specific Lactuca sativa L. var. longifolia 0.0 0.0 0.0 mg/100 g Rose hip Type 1 specific Rosa 3764 0.0 0.0 0.0 mg/100 g Roselle Type 1 specific Hibiscus sabdariffa 183260 11100.0 11100.0 11100.0 mg/100 g Rubus (Blackberry, Raspberry) Type 1 specific Rubus 23216 0.0 0.0 0.0 mg/100 g Rum Type 2 specific 0.0 0.0 0.0 mg/100 g Rye Type 1 specific Secale cereale 4550 55766.666667 62300.0 52500.0 mg/100 g Rye bread Type 2 specific 32900.244444 46000.0 0.0 mg/100 g Sacred lotus Type 1 specific Nelumbo nucifera 4432 33174.4 33174.4 33174.4 mg/100 g Safflower Type 1 specific Carthamus tinctorius 4222 0.0 0.0 0.0 mg/100 g Saffron Type 1 specific Crocus sativus 82528 12510.0 12510.0 12510.0 mg/100 g Salad Type 2 specific 8480.0 8480.0 8480.0 mg/100 g Salad dressing Type 2 specific 2288.26087 14480.0 0.0 mg/100 g Salmonberry Type 1 specific Rubus spectabilis 59499 0.0 0.0 0.0 mg/100 g Salmonidae (Salmon, Trout) Type 1 specific Salmonidae 8015 0.0 0.0 0.0 mg/100 g Salt Type 2 specific 0.0 0.0 0.0 mg/100 g Sapodilla Type 1 specific Manilkara zapota 3741 4690.0 4690.0 4690.0 mg/100 g Sauce Type 2 specific 478.0 1590.0 0.0 mg/100 g Sausage Type 2 specific 1651.5 18750.0 0.0 mg/100 g Savoy cabbage Type 1 specific Brassica oleracea var. sabauda 1216010 0.0 0.0 0.0 mg/100 g Scallop Type 1 specific Pectinidae 6566 2930.0 3690.0 2170.0 mg/100 g Scombridae (Bonito, Mackerel, Tuna) Type 1 specific Scombridae 8224 0.0 0.0 0.0 mg/100 g Semolina Type 2 specific 0.0 0.0 0.0 mg/100 g Sesame Type 1 specific Sesamum orientale 4182 4375.0 17500.0 0.0 mg/100 g Sheefish Type 1 specific Stenodus leucichthys 59296 0.0 0.0 0.0 mg/100 g Sherry Type 2 specific 0.0 0.0 0.0 mg/100 g Shiitake Type 1 specific Lentinus edodes 5353 0.0 0.0 0.0 mg/100 g Shrimp Type 1 specific Caridea 6694 10475.833333 26280.0 0.0 mg/100 g Smelt Type 1 specific Osmeridae 8012 0.0 0.0 0.0 mg/100 g Snack bar Type 2 specific 9218.75 21950.0 10.0 mg/100 g Snail Type 1 specific Gastropoda 6448 2000.0 2000.0 2000.0 mg/100 g Sockeye salmon Type 1 specific Oncorhynchus nerka 8023 0.0 0.0 0.0 mg/100 g Soft drink Type 2 specific 0.0 0.0 0.0 mg/100 g Soft-necked garlic Type 1 specific Allium sativum L. var. sativum 4682 Sorghum Type 1 specific Sorghum bicolor 4558 71370.0 71370.0 71370.0 mg/100 g Sorrel Type 1 specific Rumex acetosa 41241 0.0 0.0 0.0 mg/100 g Soup Type 2 specific 12311.304348 56150.0 0.0 mg/100 g Soursop Type 1 specific Annona muricata 13337 0.0 0.0 0.0 mg/100 g Soy bean Type 1 specific Glycine max 3847 2694.444444 12300.0 0.0 mg/100 g Soy milk Type 2 specific 0.0 0.0 0.0 mg/100 g Soy sauce Type 2 specific 0.0 0.0 0.0 mg/100 g Spelt Type 1 specific Triticum spelta 58933 24497.455 53920.0 2.365 mg/100 g Spinach Type 1 specific Spinacia oleracea 3562 18.0 90.0 0.0 mg/100 g Spiny dogfish Type 1 specific Squalus acanthias 7797 0.0 0.0 0.0 mg/100 g Spirit Type 2 specific 0.0 0.0 0.0 mg/100 g Spotted seal Type 1 specific Phoca largha 39090 0.0 0.0 0.0 mg/100 g Spread Type 2 specific 0.0 0.0 0.0 mg/100 g Star fruit Type 1 specific Averrhoa carambola 28974 0.0 0.0 0.0 mg/100 g Stew Type 2 specific 6100.0 7770.0 4130.0 mg/100 g Strawberry Type 1 specific Fragaria X ananassa 3747 4.444444 40.0 0.0 mg/100 g Sturgeon Type 1 specific Acipenseridae 7900 0.0 0.0 0.0 mg/100 g Sugar Type 2 specific 252.0 1260.0 0.0 mg/100 g Sugar substitute Type 2 specific 4675.714286 9640.0 0.0 mg/100 g Sunburst squash (pattypan squash) Type 1 specific Cucurbita pepo var. clypeata 737.5 1470.0 0.0 mg/100 g Sunflower Type 1 specific Helianthus annuus 4232 415.0 830.0 0.0 mg/100 g Swede Type 1 specific Brassica napus 3708 50.2 100.0 0.4 mg/100 g Sweet cherry Type 1 specific Prunus avium 42229 0.0 0.0 0.0 mg/100 g Sweet orange Type 1 specific Citrus sinensis 2711 0.0 0.0 0.0 mg/100 g Sweet potato Type 1 specific Ipomoea batatas 4120 6643.30625 15950.0 0.0 mg/100 g Swiss chard Type 1 specific Beta vulgaris ssp. cicla 1527200 0.0 0.0 0.0 mg/100 g Syrup Type 2 specific 0.0 0.0 0.0 mg/100 g Taco Type 2 specific 13495.0 14780.0 9730.0 mg/100 g Taco shell Type 2 57330.0 57330.0 57330.0 mg/100 g Tallow Type 2 specific 0.0 0.0 0.0 mg/100 g Tamale Type 2 specific 13440.0 15130.0 12270.0 mg/100 g Tamarind Type 1 specific Tamarindus indica 58860 0.0 0.0 0.0 mg/100 g Taro Type 1 specific Colocasia esculenta 4460 12710.0 25350.0 70.0 mg/100 g Tea Type 1 specific Camellia sinensis 4442 83.333333 500.0 0.0 mg/100 g Teff Type 1 specific Eragrostis tef 110835 18284.6575 36560.0 9.315 mg/100 g Thistle Type 1 specific Cirsium 41549 0.0 0.0 0.0 mg/100 g Thunnus Type 1 specific Thunnus 8234 0.0 0.0 0.0 mg/100 g Tinda Type 1 specific Citrullus lanatus var. fistulosus 0.0 0.0 0.0 mg/100 g Toffee Type 2 specific 910.0 910.0 910.0 mg/100 g Tofu Type 2 specific 0.0 0.0 0.0 mg/100 g Tortilla Type 2 specific 44325.0 51570.0 40200.0 mg/100 g Tortilla chip Type 2 specific 39675.0 60550.0 6750.0 mg/100 g Tostada shell Type 2 55400.0 55400.0 55400.0 mg/100 g True frog Type 1 specific Ranidae 8397 0.0 0.0 0.0 mg/100 g True oyster Type 1 specific Ostreidae 6563 4200.0 4200.0 4200.0 mg/100 g True sole Type 1 specific Soleidae 30948 0.0 0.0 0.0 mg/100 g Turbot Type 1 specific Scophthalmus maximus 52904 0.0 0.0 0.0 mg/100 g Turkey Type 1 specific Meleagris gallopavo 9103 0.07 0.07 0.07 mg/100 g Turmeric Type 1 specific Curcuma longa 136217 42500.0 42500.0 42500.0 mg/100 g Turnip Type 1 specific Brassica rapa var. rapa 51350 0.0 0.0 0.0 mg/100 g Unclassified food or beverage Type 2 specific 22485.0 45140.0 0.0 mg/100 g Vaccinium (Blueberry, Cranberry, Huckleberry) Type 1 specific Vaccinium 13749 10.0 30.0 0.0 mg/100 g Vegetable juice Type 2 specific 23.0 23.0 23.0 mg/100 g Vegetarian food Type 2 specific 5780.0 5780.0 5780.0 mg/100 g Vermouth Type 2 specific 0.0 0.0 0.0 mg/100 g Vinegar Type 2 specific 0.0 0.0 0.0 mg/100 g Vodka Type 2 specific 0.0 0.0 0.0 mg/100 g Waffle Type 2 specific 38038.333333 40940.0 34900.0 mg/100 g Walnut Type 1 specific Juglans 16718 200.08 600.0 0.0 mg/100 g Wasabi Type 1 specific Wasabia japonica 75806 8.4 8.4 8.4 mg/100 g Water Type 2 specific 0.0 0.0 0.0 mg/100 g Watercress Type 1 specific Rorippa nasturtium-aquaticum 135518 100.0 100.0 100.0 mg/100 g Watermelon Type 1 specific Citrullus lanatus 3654 0.0 0.0 0.0 mg/100 g Wheat Type 1 specific Triticum 4564 49702.272727 68010.0 0.0 mg/100 g Wheat bread Type 2 specific 24577.272727 49000.0 0.0 mg/100 g Whey Type 2 specific 0.0 0.0 0.0 mg/100 g Whisky Type 2 specific 0.0 0.0 0.0 mg/100 g White bread Type 1 26750.542857 40200.0 3.8 mg/100 g White cabbage Type 1 specific Brassica oleracea L. var. capitata L. f. alba DC. 7.5 30.0 0.0 mg/100 g White mustard Type 1 specific Sinapis alba 3728 630.0 630.0 630.0 mg/100 g Whitefish Type 1 specific Coregonus 27772 0.0 0.0 0.0 mg/100 g Whiting Type 1 specific Merlangius merlangus 8058 0.0 0.0 0.0 mg/100 g Wild carrot Type 1 specific Daucus carota 4039 1000.105 2000.0 0.21 mg/100 g Wild celery Type 1 specific Apium graveolens 4045 33.333333 100.0 0.0 mg/100 g Yam Type 1 specific Dioscorea 4672 0.0 0.0 0.0 mg/100 g Yautia Type 1 specific Xanthosoma sagittifolium 28478 53132.0 53132.0 53132.0 mg/100 g Yellow bell pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Yellow pond-lily Type 1 specific Nuphar lutea 77113 21600.0 39500.0 3700.0 mg/100 g Yellow zucchini Type 1 specific Cucurbita pepo var. cylindrica 0.0 0.0 0.0 mg/100 g Ymer Type 2 specific 0.0 0.0 0.0 mg/100 g Yogurt Type 2 specific 0.0 0.0 0.0 mg/100 g Absorbent 14 Anti-nesidioblastosic 468 Antidote 236 Any protective agent counteracting or neutralizing the action of poisons. Emollient 901 Poultice 1238