1.0 2010-04-08 22:04:51 UTC 2019-11-26 02:56:00 UTC FDB001145 Lactose Occurs in mammalian milk (human 6-7%, cow 4-5%), fruits of sapodilla Achras sapota, and a few other plants. Nutrient. obtained industrially from whey Lactose is a disaccharide sugar that is found most notably in milk and is formed from galactose and glucose. Lactose makes up around 2-8% of milk (by weight), although the amount varies among species and individuals. It is extracted from sweet or sour whey. [Wikipedia]. Lactose in the urine is a biomarker for the consumption of milk. Lactose is found in many foods, some of which are tortilla, swamp cabbage, scrapple, and spearmint. (+)-Lactose 1-b-D-Galactopyranosyl-4-a-D-glucopyranose 1-beta-delta-Galactopyranosyl-4-alpha-delta-glucopyranose 1-β-D-galactopyranosyl-4-α-D-glucopyranose 4-O-b-D-Galactopyranosyl-a-D-glucopyranose 4-O-b-D-Galactopyranosyl-D-glucose, 9CI, 8CI 4-O-beta-D-Galactopyranosyl-alpha-D-glucopyranose 4-O-Hexopyranosylhexose 4-O-β-D-galactopyranosyl-α-D-glucopyranose a-Lactose Aletobiose Anhydrous lactose b-D-Galp-(1->4)-a-D-glcp beta-D-Gal-1-4-D-Glc beta-D-Galp-(1->4)-alpha-D-glcp D-lactose Dilactose Fast-flo lactose Flowlac 100 Galactinum Glc-(4-1)Gal Granulac 140m Lactin Lactin (carbohydrate) Lactobiose Lactohale 300 Lactose anhydride Lactose fast-flo Milk sugar Osmolactan Pharmatosa dcl 21 Pharmatose 21 Pharmatose 325m Pharmatose dcl 15 Prismalac Respitose ml 003 Respitose sv 003 Saccharum lactin Sachelac Sorbalac 400 Sorbolac 400 Spherolac Super-tab Tablettose Tablettose 70 Tablettose 80 Zeparox ep α-lactose β-D-galp-(1->4)-α-D-glcp C12H22O11 342.2965 342.116211546 (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-{[(2R,3S,4R,5R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy}oxane-3,4,5-triol lactose 63-42-3 OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O InChI=1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5+,6+,7-,8-,9-,10-,11?,12+/m1/s1 GUBGYTABKSRVRQ-QKKXKWKRSA-N belongs to the class of organic compounds known as o-glycosyl compounds. These are glycoside in which a sugar group is bonded through one carbon to another group via a O-glycosidic bond. O-glycosyl compounds Organic compounds Organic oxygen compounds Organooxygen compounds Carbohydrates and carbohydrate conjugates Aliphatic heteromonocyclic compounds Acetals Disaccharides Hemiacetals Hydrocarbon derivatives Oxacyclic compounds Oxanes Polyols Primary alcohols Secondary alcohols Acetal Alcohol Aliphatic heteromonocyclic compound Disaccharide Hemiacetal Hydrocarbon derivative O-glycosyl compound Organoheterocyclic compound Oxacycle Oxane Polyol Primary alcohol Secondary alcohol Disaccharides glycosylglucose Solid logp -3.01 ALOGPS logs 0.23 ALOGPS solubility 5.86e+02 g/l ALOGPS melting_point 201-202 oC logp -4.7 ChemAxon pka_strongest_acidic 11.25 ChemAxon pka_strongest_basic -3 ChemAxon iupac (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-{[(2R,3S,4R,5R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy}oxane-3,4,5-triol ChemAxon average_mass 342.2965 ChemAxon mono_mass 342.116211546 ChemAxon smiles OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O ChemAxon formula C12H22O11 ChemAxon inchi InChI=1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5+,6+,7-,8-,9-,10-,11?,12+/m1/s1 ChemAxon inchikey GUBGYTABKSRVRQ-QKKXKWKRSA-N ChemAxon polar_surface_area 189.53 ChemAxon refractivity 68.34 ChemAxon polarizability 31.32 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 11 ChemAxon donor_count 8 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Galactose Metabolism SMP00043 map00052 Lactose Degradation SMP00457 Lactose Synthesis SMP00444 Specdb::MsMs 250350 Specdb::MsMs 250351 Specdb::MsMs 250352 Specdb::MsMs 270288 Specdb::MsMs 270289 Specdb::MsMs 270290 HMDB00186 17716 LBT #<Reference:0x000055ce31e7bdc8> #<Reference:0x000055ce31e7bc10> #<Reference:0x000055ce31e7ba58> #<Reference:0x000055ce31e7b8a0> #<Reference:0x000055ce31e7b6e8> #<Reference:0x000055ce31e7b530> #<Reference:0x000055ce31e7b378> #<Reference:0x000055ce31e7b198> #<Reference:0x000055ce31e7af90> #<Reference:0x000055ce31e7add8> #<Reference:0x000055ce31e7ac20> #<Reference:0x000055ce31e7aa68> #<Reference:0x000055ce31e7a8b0> Abalone Type 1 specific Haliotis 6452 Abiyuch Type 1 specific Crateva religiosa 202634 0.0 0.0 0.0 mg/100 g Acerola Type 1 specific Malpighia emarginata 151847 Acorn Type 1 specific Quercus 3511 Adzuki bean Type 1 specific Vigna angularis 3914 0.0 0.0 0.0 mg/100 g Agar Type 1 specific Eucheuma 31444 Agave Type 1 specific Agave 39509 0.0 0.0 0.0 mg/100 g Alaska blueberry Type 1 specific Vaccinium alaskaense 190544 0.0 0.0 0.0 mg/100 g Alaska pollock Type 1 specific Theragra chalcogramma 1042646 0.0 0.0 0.0 mg/100 g Alaska wild rhubarb Type 1 specific Polygonum alpinum 125586 Alfalfa Type 1 specific Medicago sativa 3879 0.0 0.0 0.0 mg/100 g Allium Type 1 specific Allium 4678 2.0 20.0 0.0 mg/100 g Allspice Type 1 specific Pimenta dioica 375272 Almond Type 1 specific Prunus dulcis 3755 0.000909 0.01 0.0 mg/100 g Almond milk Type 1 0.0 0.0 0.0 mg/100 g Alpine sweetvetch Type 1 specific Hedysarum alpinum 57576 Amaranth Type 1 specific Amaranthus 3564 0.0 0.0 0.0 mg/100 g American butterfish Type 1 specific Peprilus triacanthus 183653 American cranberry Type 1 specific Vaccinium macrocarpon 13750 0.0 0.0 0.0 mg/100 g American lobster Type 1 specific Homarus americanus 6706 0.0 0.0 0.0 mg/100 g American pokeweed Type 1 specific Phytolacca americana 3527 Anatidae Type 1 specific Anatidae 8830 0.0 0.0 0.0 mg/100 g Anchovy Type 1 specific Engraulidae 43062 0.0 0.0 0.0 mg/100 g Angelica Type 1 specific Angelica keiskei 357850 Anguilliformes Type 1 specific Anguilliformes 7933 0.0 0.0 0.0 mg/100 g Anise Type 1 specific Pimpinella anisum 271192 Annual wild rice Type 1 specific Zizania aquatica 75727 Apple Type 1 specific Malus pumila 283210 44.375 710.0 0.0 mg/100 g Apricot Type 1 specific Prunus armeniaca 36596 0.0 0.0 0.0 mg/100 g Arabica coffee Type 1 specific Coffea arabica 13443 0.0 0.0 0.0 mg/100 g Arctic blackberry Type 1 specific Rubus arcticus 70741 Arepa Type 2 specific 0.0 0.0 0.0 mg/100 g Arrowhead Type 1 specific Sagittaria latifolia 15008 Arrowroot Type 1 specific Maranta arundinacea 210060 Asian pear Type 1 specific Pyrus pyrifolia 3767 Asparagus Type 1 specific Asparagus officinalis 4686 0.0 0.0 0.0 mg/100 g Atlantic halibut Type 1 specific Hippoglossus hippoglossus 8267 0.0 0.0 0.0 mg/100 g Atlantic herring Type 1 specific Clupea harengus harengus 7950 Atlantic wolffish Type 1 specific Anarhichas lupus 8204 0.0 0.0 0.0 mg/100 g Avocado Type 1 specific Persea americana 3435 0.0 0.0 0.0 mg/100 g Babassu palm Type 1 specific Attalea speciosa 145700 Baby food Type 2 specific 9678.205128 56700.0 0.0 mg/100 g Baked beans Type 2 specific 0.0 0.0 0.0 mg/100 g Bamboo shoots Type 1 specific Phyllostachys edulis 38705 0.0 0.0 0.0 mg/100 g Banana Type 1 specific Musa acuminata 4641 0.0 0.0 0.0 mg/100 g Barley Type 1 specific Hordeum vulgare 4513 0.0 0.0 0.0 mg/100 g Bayberry Type 1 specific Myrica 3509 Bean Type 1 specific 0.0 0.0 0.0 mg/100 g Bearded seal Type 1 specific Erignathus barbatus 39304 0.0 0.0 0.0 mg/100 g Beech nut Type 1 specific Fagus 21024 Beer Type 2 specific 0.0 0.0 0.0 mg/100 g Beluga whale Type 1 specific Delphinapterus leucas 9749 0.0 0.0 0.0 mg/100 g Bilberry Type 1 specific Vaccinium myrtillus 180763 0.0 0.0 0.0 mg/100 g Biscuit Type 2 specific 363.125 2310.0 0.0 mg/100 g Bitter gourd Type 1 specific Momordica charantia 3673 Bivalvia (Clam, Mussel, Oyster) Type 1 specific Bivalvia 6544 0.0 0.0 0.0 mg/100 g Black cabbage Type 1 specific Brassica oleracea var. viridis 3713 Black chokeberry Type 1 specific Photinia melanocarpa 661339 Black crowberry Type 1 specific Empetrum nigrum 191066 Black elderberry Type 1 specific Sambucus nigra 4202 Black huckleberry Type 1 specific Gaylussacia baccata 128893 Black mulberry Type 1 specific Morus nigra 85232 Black radish Type 1 specific Raphanus sativus var. niger 41679 Black raisin Type 1 0.0 0.0 0.0 mg/100 g Black raspberry Type 1 specific Rubus occidentalis 75079 Black salsify Type 1 specific Scorzonera hispanica 114289 0.0 0.0 0.0 mg/100 g Black tea Type 1 0.0 0.0 0.0 mg/100 g Black walnut Type 1 specific Juglans nigra 16719 0.0 0.0 0.0 mg/100 g Black-eyed pea Type 1 specific Vigna unguiculata ssp. unguiculata 3920 Blackcurrant Type 1 specific Ribes nigrum 78511 0.0 0.0 0.0 mg/100 g Blue crab Type 1 specific Callinectes sapidus 6763 0.0 0.0 0.0 mg/100 g Blue whiting Type 1 specific Micromesistius poutassou 81636 0.0 0.0 0.0 mg/100 g Bog bilberry Type 1 specific Vaccinium uliginosum 190548 Borage Type 1 specific Borago officinalis 13363 Boysenberry Type 1 specific Rubus ursinus X idaeus Brassicas Unknown generic 3705 Brazil nut Type 1 specific Bertholletia excelsa 3645 0.0 0.0 0.0 mg/100 g Breadfruit Type 1 specific Artocarpus altilis 194251 Breadnut tree seed Type 1 specific Brosimum alicastrum 194253 Breakfast cereal Type 2 specific 0.0 0.0 0.0 mg/100 g Breakfast sandwich Type 2 specific 603.888889 1710.0 310.0 mg/100 g Broad bean Type 1 specific Vicia faba 3906 Broccoli Type 1 specific Brassica oleracea var. italica 36774 30.0 210.0 0.0 mg/100 g Brussel sprouts Type 1 specific Brassica oleracea var. gemmifera 178616 0.0 0.0 0.0 mg/100 g Buffalo currant Type 1 specific Ribes aureum var. villosum 23283 Burbot Type 1 specific Lota lota 69944 0.0 0.0 0.0 mg/100 g Burdock Type 1 specific Arctium lappa 4217 Burrito Type 2 specific 131.25 560.0 0.0 mg/100 g Butter Type 2 specific 570.0 570.0 570.0 mg/100 g Buttermilk Type 2 specific 3560.0 3670.0 3450.0 mg/100 g Butternut Type 1 specific Juglans cinerea 91214 Butternut squash Type 1 specific Cucurbita moschata 3662 0.0 0.0 0.0 mg/100 g Cabbage Type 1 specific Brassica oleracea var. capitata 3716 0.0 0.0 0.0 mg/100 g Cake Type 2 specific 328.0 590.0 0.0 mg/100 g Calabash Type 1 specific Lagenaria siceraria 3668 Canada blueberry Type 1 specific Vaccinium myrtilloides 1503870 Canola Type 2 specific 138011 Cantaloupe melon Type 1 Cucumis melo var. cantalupensis 0.0 0.0 0.0 mg/100 g Capers Type 1 specific Capparis spinosa 65558 Caraway Type 1 specific Carum carvi 48032 Cardamom Type 1 specific Elettaria cardamomum 105181 Cardoon Type 1 specific Cynara cardunculus 4265 Carob Type 1 specific Ceratonia siliqua 20340 Carp bream Type 1 specific Abramis brama 38527 0.0 0.0 0.0 mg/100 g Carrot Type 1 specific Daucus carota ssp. sativus 79200 0.0 0.0 0.0 mg/100 g Cascade huckleberry Type 1 specific Vaccinium deliciosum 190531 Casein Type 2 specific 500.0 500.0 500.0 mg/100 g Cashew nut Type 1 specific Anacardium occidentale 171929 0.0 0.0 0.0 mg/100 g Cassava Type 1 specific Manihot esculenta 3983 0.0 0.0 0.0 mg/100 g Catfish Type 1 specific Siluriformes 7995 0.0 0.0 0.0 mg/100 g Catjang pea Type 1 specific Vigna unguiculata ssp. cylindrica 3840 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 0.0 0.0 0.0 mg/100 g Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 0.0 0.0 0.0 mg/100 g Celeriac Type 1 specific Apium graveolens var. rapaceum 278110 0.0 0.0 0.0 mg/100 g Celery leaves Type 1 specific Apium graveolens var. secalinum 941588 0.0 0.0 0.0 mg/100 g Celery stalks Type 1 specific Apium graveolens var. dulce 117781 0.0 0.0 0.0 mg/100 g Cereals and cereal products Unknown generic Cetacea (Dolphin, Porpoise, Whale) Type 1 specific Cetacea 9721 0.0 0.0 0.0 mg/100 g Ceylon cinnamon Type 1 specific Cinnamomum verum 128608 Channel catfish Type 1 specific Ictalurus punctatus 7998 0.0 0.0 0.0 mg/100 g Chanterelle Type 1 specific Cantharellus cibarius 36066 0.0 0.0 0.0 mg/100 g Charr Type 1 specific Salvelinus 8033 0.0 0.0 0.0 mg/100 g Chayote Type 1 specific Sechium edule 184140 0.0 0.0 0.0 mg/100 g Cheddar Cheese Type 2 Cheddar Cheese 0.04 0.04 0.04 mg/100 g Cheese Type 2 specific 828.730769 5820.0 0.0 mg/100 g Cherimoya Type 1 specific Annona cherimola 49314 0.0 0.0 0.0 mg/100 g Cherry tomato Type 1 specific Solanum lycopersicum var. cerasiforme 195583 Chervil Type 1 specific Anthriscus cerefolium 40888 0.0 0.0 0.0 mg/100 g Chestnut Type 1 specific Castanea 21019 0.0 0.0 0.0 mg/100 g Chewing gum Type 2 specific 0.0 0.0 0.0 mg/100 g Chia Type 1 specific Salvia hispanica 49212 Chickpea Type 1 specific Cicer arietinum 3827 0.0 0.0 0.0 mg/100 g Chicory Type 1 specific Cichorium intybus 13427 0.0 0.0 0.0 mg/100 g Chicory leaves Type 1 specific Cichorium intybus var. foliosum 13427 Chicory roots Type 1 specific Cichorium intybus var. sativum 13427 Chili Type 2 specific 0.0 0.0 0.0 mg/100 g Chinese bayberry Type 1 specific Myrica rubra 262757 Chinese broccoli Type 1 specific Brassica alboglabra 3714 Chinese cabbage Type 1 specific Brassica rapa 3711 0.0 0.0 0.0 mg/100 g Chinese chestnut Type 1 specific Castanea mollissima 60419 Chinese chives Type 1 specific Allium tuberosum 4683 Chinese cinnamon Type 1 specific Cinnamomum aromaticum 119260 0.0 0.0 0.0 mg/100 g Chinese mustard Type 1 specific Brassica juncea 3707 Chinese water chestnut Type 1 specific Eleocharis dulcis 110284 Chinook salmon Type 1 specific Oncorhynchus tshawytscha 74940 0.0 0.0 0.0 mg/100 g Chives Type 1 specific Allium schoenoprasum 74900 0.0 0.0 0.0 mg/100 g Chocolate Type 2 specific 1795.0 7400.0 0.0 mg/100 g Chocolate spread Type 2 specific 0.0 0.0 0.0 mg/100 g Chum salmon Type 1 specific Oncorhynchus keta 8018 0.0 0.0 0.0 mg/100 g Cinnamon Type 1 specific Cinnamomum 13428 0.0 0.0 0.0 mg/100 g Citrus Unknown generic Clam Type 1 0.0 0.0 0.0 mg/100 g Clawed lobster Type 1 specific Nephropidae 6704 0.0 0.0 0.0 mg/100 g Clementine Type 1 Citrus × clementina 0.0 0.0 0.0 mg/100 g Climbing bean Type 1 specific Vigna umbellata 87088 Cloud ear fungus Type 1 specific Auricularia polytricha 29893 Cloudberry Type 1 specific Rubus chamaemorus 57936 Cloves Type 1 specific Syzygium aromaticum 219868 0.0 0.0 0.0 mg/100 g Clupeinae (Herring, Sardine, Sprat) Type 1 specific Clupeinae 7948 0.0 0.0 0.0 mg/100 g Cocoa bean Type 1 specific Theobroma cacao 3641 Cocoa butter Type 2 specific 0.0 0.0 0.0 mg/100 g Cocoa powder Type 2 specific 0.0 0.0 0.0 mg/100 g Coconut Type 1 specific Cocos nucifera 13894 0.0 0.0 0.0 mg/100 g Coffee Type 1 generic Coffea 13442 0.0 0.0 0.0 mg/100 g Coho salmon Type 1 specific Oncorhynchus kisutch 8019 0.0 0.0 0.0 mg/100 g Colorado pinyon Type 1 specific Pinus edulis 3340 Common bean Type 1 specific Phaseolus vulgaris 3885 0.0 0.0 0.0 mg/100 g Common beet Type 1 specific Beta vulgaris 161934 0.0 0.0 0.0 mg/100 g Common buckwheat Type 1 specific Fagopyrum esculentum 3617 0.0 0.0 0.0 mg/100 g Common cabbage Type 1 specific Brassica oleracea 3712 0.0 0.0 0.0 mg/100 g Common chokecherry Type 1 specific Prunus virginiana 133204 0.0 0.0 0.0 mg/100 g Common dab Type 1 specific Limanda limanda 27771 0.0 0.0 0.0 mg/100 g Common grape Type 1 specific Vitis vinifera 29760 0.0 0.0 0.0 mg/100 g Common hazelnut Type 1 specific Corylus avellana 13451 0.0 0.0 0.0 mg/100 g Common ling Type 1 specific Molva molva 163112 0.0 0.0 0.0 mg/100 g Common mushroom Type 1 specific Agaricus bisporus 5341 0.0 0.0 0.0 mg/100 g Common octopus Type 1 specific Octopus vulgaris 6645 0.0 0.0 0.0 mg/100 g Common oregano Type 1 specific Origanum vulgare 39352 0.0 0.0 0.0 mg/100 g Common pea Type 1 specific Pisum sativum 3888 0.0 0.0 0.0 mg/100 g Common persimmon Type 1 specific Diospyros virginiana 13493 Common sage Type 1 specific Salvia officinalis 38868 Common salsify Type 1 specific Tragopogon porrifolius 13731 Common thyme Type 1 specific Thymus vulgaris 49992 Common verbena Type 1 specific Verbena officinalis 79772 Common walnut Type 1 specific Juglans regia 51240 0.0 0.0 0.0 mg/100 g Common wheat Type 1 specific Triticum aestivum 4565 Conch Type 1 specific Strombidae 69694 Coriander Type 1 specific Coriandrum sativum 4047 0.0 0.0 0.0 mg/100 g Corn Type 1 specific Zea mays 4577 0.0 0.0 0.0 mg/100 g Corn chip Type 2 specific 1450.0 2230.0 0.0 mg/100 g Corn grits Type 2 specific 0.0 0.0 0.0 mg/100 g Corn salad Type 1 specific Valerianella locusta 59166 Cornmint Type 1 specific Mentha arvensis 292239 Cottage cheese Type 2 0.755 0.755 0.755 mg/100 g Cottonseed Type 1 specific Gossypium 3633 0.0 0.0 0.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 0% fat Type 2 specific 5090.0 5090.0 5090.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 1% fat Type 2 specific 5200.0 5200.0 5200.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 2% fat Type 2 specific 5010.0 5010.0 5010.0 mg/100 g Cow milk, pasteurized, vitamin D added, 3.25% fat Type 2 specific 5050.0 5050.0 5050.0 mg/100 g Cowpea Type 1 specific Vigna unguiculata 3917 Crab Type 1 specific Brachyura 6752 0.0 0.0 0.0 mg/100 g Cracker Type 2 specific 520.666667 7740.0 0.0 mg/100 g Crayfish Type 1 specific Astacidea 6712 0.0 0.0 0.0 mg/100 g Cream Type 2 specific 2530.031923 4400.0 0.035 mg/100 g Crisp bread Type 2 specific 0.0 0.0 0.0 mg/100 g Cucumber Type 1 specific Cucumis sativus 3659 0.0 0.0 0.0 mg/100 g Cucurbita Type 1 specific Cucurbita 3660 0.0 0.0 0.0 mg/100 g Cumin Type 1 specific Cuminum cyminum 52462 Cupuaçu Type 1 specific Theobroma grandiflorum 108881 Curry powder Type 2 specific 0.0 0.0 0.0 mg/100 g Custard apple Type 1 specific Annona reticulata 301862 Daikon radish Type 1 specific Raphanus sativus var. longipinnatus 41679 0.0 0.0 0.0 mg/100 g Dandelion Type 1 specific Taraxacum officinale 50225 0.0 0.0 0.0 mg/100 g Date Type 1 specific Phoenix dactylifera 42345 0.0 0.0 0.0 mg/100 g Deerberry Type 1 specific Vaccinium stamineum 176259 Devilfish Type 1 specific Myoxocephalus 8095 Dill Type 1 specific Anethum graveolens 40922 0.0 0.0 0.0 mg/100 g Dock Type 1 specific Rumex 3618 Domestic pig Type 1 specific Sus scrofa domestica 9825 17.025316 2690.0 0.0 mg/100 g Dragée Type 2 specific 0.0 0.0 0.0 mg/100 g Dried milk Type 2 specific 44250.0 50800.0 37700.0 mg/100 g Dulce de leche Type 2 specific 4920.0 4920.0 4920.0 mg/100 g Durian Type 1 specific Durio zibethinus 66656 Eastern oyster Type 1 specific Crassostrea virginica 6565 0.0 0.0 0.0 mg/100 g Egg roll Type 2 specific 0.0 0.0 0.0 mg/100 g Eggplant Type 1 specific Solanum melongena 4111 0.0 0.0 0.0 mg/100 g Eggs Unknown generic 52.083333 1110.0 0.0 mg/100 g Elderberry Type 1 specific Sambucus 4201 0.0 0.0 0.0 mg/100 g Elliott's blueberry Type 1 specific Vaccinium elliottii 283798 Empanada Type 2 specific 0.0 0.0 0.0 mg/100 g Endive Type 1 specific Cichorium endivia 114280 0.0 0.0 0.0 mg/100 g Enokitake Type 1 specific Flammulina velutipes 38945 0.0 0.0 0.0 mg/100 g Epazote Type 1 specific Dysphania ambrosioides 330163 European chestnut Type 1 specific Castanea sativa 21020 European cranberry Type 1 specific Vaccinium oxycoccos 516948 European plum Type 1 specific Prunus domestica 3758 0.0 0.0 0.0 mg/100 g Evening primrose Type 1 specific Oenothera biennis 3942 Evergreen huckleberry Type 1 specific Vaccinium ovatum 84019 Feijoa Type 1 specific Feijoa sellowiana 260130 0.0 0.0 0.0 mg/100 g Fennel Type 1 specific Foeniculum vulgare 48038 0.0 0.0 0.0 mg/100 g Fenugreek Type 1 specific Trigonella foenum-graecum 78534 Fig Type 1 specific Ficus carica 3494 0.0 0.0 0.0 mg/100 g Fireweed Type 1 specific Chamerion angustifolium 13055 Fish oil Type 1 0.0 0.0 0.0 mg/100 g Flatfish Type 1 specific Pleuronectiformes 8252 0.0 0.0 0.0 mg/100 g Flaxseed Type 1 specific Linum usitatissimum 4006 0.0 0.0 0.0 mg/100 g Flour Type 2 specific 0.0 0.0 0.0 mg/100 g Fox grape Type 1 specific Vitis labrusca 103355 French plantain Type 1 specific Musa X paradisiaca 89151 0.0 0.0 0.0 mg/100 g French toast Type 2 specific 150.0 150.0 150.0 mg/100 g Fruit gum Type 2 specific 100.0 100.0 100.0 mg/100 g Fruit juice Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit preserve Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit-flavor drink Type 2 specific 25.0 200.0 0.0 mg/100 g Fruits Unknown generic Frybread Type 2 specific 0.0 0.0 0.0 mg/100 g Gadiformes Type 1 specific Gadiformes 8043 0.0 0.0 0.0 mg/100 g Gadus (Common cod) Type 1 specific Gadus 8048 0.0 0.0 0.0 mg/100 g Garden cress Type 1 specific Lepidium sativum 33125 0.0 0.0 0.0 mg/100 g Garden onion Type 1 specific Allium cepa 4679 0.0 0.0 0.0 mg/100 g Garden onion (var.) Type 1 specific Allium cepa var. cepa 4679 0.0 0.0 0.0 mg/100 g Garden rhubarb Type 1 specific Rheum rhabarbarum 3621 0.0 0.0 0.0 mg/100 g Garden tomato Type 1 specific Solanum lycopersicum 4081 0.0 0.0 0.0 mg/100 g Garden tomato (var.) Type 1 specific Solanum lycopersicum var. lycopersicum 397755 Garfish Type 1 specific Belone belone 129037 0.0 0.0 0.0 mg/100 g Garland chrysanthemum Type 1 specific Chrysanthemum coronarium 99038 Garlic Type 1 specific Allium sativum 4682 0.0 0.0 0.0 mg/100 g Gelatin Type 2 specific 0.0 0.0 0.0 mg/100 g Gelatin dessert Type 2 specific 0.0 0.0 0.0 mg/100 g German camomile Type 1 specific Matricaria recutita 127986 Giant butterbur Type 1 specific Petasites japonicus 186965 Gin Type 2 specific 0.0 0.0 0.0 mg/100 g Ginger Type 1 specific Zingiber officinale 94328 0.0 0.0 0.0 mg/100 g Ginkgo nuts Type 1 specific Ginkgo biloba 3311 Ginseng Type 1 specific Panax 4054 Globe artichoke Type 1 specific Cynara scolymus 59895 0.0 0.0 0.0 mg/100 g Gooseberry Type 1 specific Ribes uva-crispa 135518 0.0 0.0 0.0 mg/100 g Gram bean Type 1 specific Vigna mungo 3915 Grape Type 1 specific Vitis 3603 0.0 0.0 0.0 mg/100 g Grape wine Type 2 specific 0.0 0.0 0.0 mg/100 g Grapefruit Type 1 specific Citrus X paradisi 37656 0.0 0.0 0.0 mg/100 g Grapefruit/Pummelo hybrid Type 1 specific Citrus paradisi X Citrus maxima 37656 0.0 0.0 0.0 mg/100 g Grass pea Type 1 specific Lathyrus sativus 3860 Green bean Type 1 specific Phaseolus vulgaris 3885 0.0 0.0 0.0 mg/100 g Green bell pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Green lentil Type 1 Lens culinaris 0.0 0.0 0.0 mg/100 g Green onion Type 1 Green plum Type 1 0.0 0.0 0.0 mg/100 g Green tea Type 1 0.0 0.0 0.0 mg/100 g Green vegetables Unknown generic Green zucchini Type 1 specific Cucurbita pepo var. cylindrica 0.0 0.0 0.0 mg/100 g Greenland halibut/turbot Type 1 specific Reinhardtius hippoglossoides 111784 0.0 0.0 0.0 mg/100 g Greenthread tea Type 1 specific Thelesperma 153159 Groundcherry Type 1 specific Physalis 24663 0.0 0.0 0.0 mg/100 g Guava Type 1 specific Psidium guajava 120290 0.0 0.0 0.0 mg/100 g Haddock Type 1 specific Melanogrammus aeglefinus 8056 333.333333 1000.0 0.0 mg/100 g Half-highbush blueberry Type 1 specific Vaccinium angustifolium X Vaccinium corymbosum 934696 Hamburger Type 2 specific 254.666667 830.0 0.0 mg/100 g Hard wheat Type 1 specific Triticum durum 4567 Hazelnut Type 1 specific Corylus 13450 0.0 0.0 0.0 mg/100 g Hedge mustard Type 1 specific Sisymbrium 3729 Herbal tea Type 1 0.0 0.0 0.0 mg/100 g Herbs and Spices Unknown generic Hibiscus tea Type 1 specific Hibiscus sabbariffa 183260 0.0 0.0 0.0 mg/100 g Hickory nut Type 1 specific Carya 13402 Highbush blueberry Type 1 specific Vaccinium corymbosum 69266 Hippoglossus (Common halibut) Type 1 specific Hippoglossus 8266 0.0 0.0 0.0 mg/100 g Honey Type 2 specific 115.0 230.0 0.0 mg/100 g Horchata Type 2 specific 0.0 0.0 0.0 mg/100 g Horned melon Type 2 specific Cucumis metuliferus 61886 Horseradish Type 1 specific Armoracia rusticana 3704 0.0 0.0 0.0 mg/100 g Horseradish tree Type 1 specific Moringa oleifera 3735 Hot chocolate Type 2 specific 4238.571429 4630.0 3830.0 mg/100 g Hushpuppy Type 2 specific 0.0 0.0 0.0 mg/100 g Hyacinth bean Type 1 specific Lablab purpureus 35936 Hyssop Type 1 specific Hyssopus officinalis 39324 Ice cream Type 2 specific 3690.0 6230.0 0.0 mg/100 g Iceberg lettuce Type 1 0.0 0.0 0.0 mg/100 g Irish moss Type 1 specific Chondrus crispus 2769 Italian oregano Type 1 specific Origanum X majoricum 1384207 0.0 0.0 0.0 mg/100 g Italian sweet red pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Jackfruit Type 1 specific Artocarpus heterophyllus 3489 0.0 0.0 0.0 mg/100 g Jalapeno pepper Type 1 Capsicum annuum 'Jalapeño' 0.0 0.0 0.0 mg/100 g Japanese chestnut Type 1 specific Castanea crenata 103480 Japanese persimmon Type 1 specific Diospyros kaki 35925 Japanese pumpkin Type 1 specific Cucurbita maxima 3661 0.0 0.0 0.0 mg/100 g Japanese walnut Type 1 specific Juglans ailanthifolia 91209 Java plum Type 1 specific Syzygium cumini 260142 Jerusalem artichoke Type 1 specific Helianthus tuberosus 4233 0.0 0.0 0.0 mg/100 g Jew's ear Type 1 specific Auricularia auricula-judae 29892 Jicama Type 1 specific Pachyrhizus erosus 109171 Jostaberry Type 1 specific Ribes × nidigrolaria Jujube Type 1 specific Ziziphus zizyphus 48393 Jute Type 1 specific Corchorus olitorius 93759 Kai-lan Type 1 specific Brassica oleracea var. alboglabra 3714 Kale Type 1 specific Brassica napus var. pabularia 0.0 0.0 0.0 mg/100 g Kefir Type 2 specific 1891.85 3780.0 3.7 mg/100 g Kelp Type 1 specific Laminaria 33637 Ketchup Type 2 specific 0.0 0.0 0.0 mg/100 g Kiwi Type 1 specific Actinidia chinensis 3625 0.02 0.06 0.0 mg/100 g Kohlrabi Type 1 specific Brassica oleracea var. gongylodes 109379 0.0 0.0 0.0 mg/100 g Komatsuna Type 1 specific Brassica rapa var. perviridis 344680 Kombu Type 1 specific Saccharina japonica 88149 0.0 0.0 0.0 mg/100 g Kumquat Type 1 specific Fortunella 2706 0.0 0.0 0.0 mg/100 g Lake trout Type 1 specific Salvelinus namaycush 8040 0.0 0.0 0.0 mg/100 g Lambsquarters Type 1 specific Chenopodium album 3559 Lard Type 2 specific 0.0 0.0 0.0 mg/100 g Leavening agent Type 2 specific 0.0 0.0 0.0 mg/100 g Leek Type 1 specific Allium porrum 0.0 0.0 0.0 mg/100 g Lemon Type 1 specific Citrus limon 2708 0.0 0.0 0.0 mg/100 g Lemon balm Type 1 specific Melissa officinalis 39338 Lemon grass Type 1 specific Cymbopogon citratus 66014 Lemon sole Type 1 specific Microstomus kitt 106175 0.0 0.0 0.0 mg/100 g Lemon thyme Type 1 specific Thymus pulegioides 751873 Lemon verbena Type 1 specific Aloysia triphylla 542672 Lentils Type 1 generic Lens culinaris 3864 0.0 0.0 0.0 mg/100 g Lettuce Type 1 specific Lactuca sativa 4236 0.0 0.0 0.0 mg/100 g Lichee Type 1 specific Litchi chinensis 151069 0.0 0.0 0.0 mg/100 g Lima bean Type 1 specific Phaseolus lunatus 3884 0.0 0.0 0.0 mg/100 g Lime Type 1 specific Citrus aurantiifolia 159033 0.0 0.0 0.0 mg/100 g Linden Type 1 specific Tilia 64580 Lingonberry Type 1 specific Vaccinium vitis-idaea 180772 0.0 0.0 0.0 mg/100 g Liquor Type 2 specific 0.0 0.0 0.0 mg/100 g Liquorice Type 2 specific 600.0 2400.0 0.0 mg/100 g Loganberry Type 1 specific Rubus loganobaccus 0.0 0.0 0.0 mg/100 g Longan Type 1 specific Dimocarpus longan 128017 Loquat Type 1 specific Eriobotrya japonica 32224 0.0 0.0 0.0 mg/100 g Lotus Type 1 specific Nelumbo 4430 Lovage Type 1 specific Levisticum officinale 48042 Lowbush blueberry Type 1 specific Vaccinium angustifolium 472369 Lumpsucker Type 1 specific Cyclopteridae 8101 0.0 0.0 0.0 mg/100 g Lupine Type 1 specific Lupinus 3869 Macadamia nut Type 1 specific Macadamia 4329 0.0 0.0 0.0 mg/100 g Macadamia nut (M. tetraphylla) Type 1 specific Macadamia tetraphylla 512563 0.0 0.0 0.0 mg/100 g Macaroni and cheese Type 2 specific 2705.0 6900.0 300.0 mg/100 g Maitake Type 1 specific Grifola frondosa 5627 165.165 330.0 0.33 mg/100 g Malabar plum Type 1 specific Syzygium jambos 334483 Malabar spinach Type 1 specific Basella alba 3589 Malus (Crab apple) Type 1 specific Malus 3749 0.0 0.0 0.0 mg/100 g Mamey sapote Type 1 specific Pouteria sapota 233744 0.0 0.0 0.0 mg/100 g Mammee apple Type 1 specific Mammea americana 198777 Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571 0.0 0.0 0.0 mg/100 g Mango Type 1 specific Mangifera indica 29780 0.0 0.0 0.0 mg/100 g Margarine Type 2 specific 0.0 0.0 0.0 mg/100 g Margarine-like spread Type 2 specific 421.0 421.0 421.0 mg/100 g Marine mussel Type 1 specific Mytilidae 6547 0.0 0.0 0.0 mg/100 g Marshmallow Type 2 specific 0.0 0.0 0.0 mg/100 g Marzipan Type 2 specific 0.0 0.0 0.0 mg/100 g Meat bouillon Type 2 specific 0.0 0.0 0.0 mg/100 g Meatball Type 2 specific 0.0 0.0 0.0 mg/100 g Meatloaf Type 2 specific 0.0 0.0 0.0 mg/100 g Medlar Type 1 specific Mespilus germanica 36616 Mentha Type 1 specific Mentha 21819 Meringue Type 2 specific 0.0 0.0 0.0 mg/100 g Mexican groundcherry Type 1 specific Physalis philadelphica var. immaculata 374021 Mexican oregano Type 1 specific Lippia graveolens 0.0 0.0 0.0 mg/100 g Milk (Cow) Type 2 specific 7478.846154 49500.0 3450.0 mg/100 g Milk (Human) Type 2 specific 0.0 0.0 0.0 mg/100 g Milk (Other mammals) Type 2 specific 0.0 0.0 0.0 mg/100 g Milk and milk products Unknown generic Milkshake Type 2 specific 5052.5 5330.0 4260.0 mg/100 g Millet Type 1 specific Panicum miliaceum 4540 0.0 0.0 0.0 mg/100 g Miso Type 2 specific 0.0 0.0 0.0 mg/100 g Mixed nuts Type 2 specific 0.0 0.0 0.0 mg/100 g Morchella (Morel) Type 1 specific Morchellaceae 5192 0.0 0.0 0.0 mg/100 g Moth bean Type 1 specific Vigna aconitifolia 3918 Mountain hare Type 1 specific Lepus timidus 62621 0.0 0.0 0.0 mg/100 g Mountain yam Type 1 specific Dioscorea pentaphylla 167592 Mozzarella cheese Type 2 0.71 0.71 0.71 mg/100 g Mugwort Type 1 specific Artemisia vulgaris 4220 Mulberry Type 1 specific Morus 3497 Multigrain bread Type 2 specific 595.0 620.0 570.0 mg/100 g Mung bean Type 1 specific Vigna radiata 157791 0.0 0.0 0.0 mg/100 g Muscadine grape Type 1 specific Vitis rotundifolia 103349 0.0 0.0 0.0 mg/100 g Muskmelon Type 1 specific Cucumis melo 3656 0.0 0.0 0.0 mg/100 g Mustard Type 2 specific 0.0 0.0 0.0 mg/100 g Mustard spinach Type 1 specific Brassica perviridis Nachos Type 2 specific 870.0 1460.0 280.0 mg/100 g Nance Type 1 specific Byrsonima crassifolia 4270 0.0 0.0 0.0 mg/100 g Nanking cherry Type 1 specific Prunus tomentosa 105667 Napa cabbage Type 1 specific Brassica rapa var. pekinensis 51351 Naranjilla Type 1 specific Solanum quitoense 227725 0.0 0.0 0.0 mg/100 g Narrowleaf cattail Type 1 specific Typha angustifolia 59011 0.0 0.0 0.0 mg/100 g Natal plum Type 1 specific Carissa macrocarpa 403101 Nectarine Type 1 specific Prunus persica var. nucipersica 323851 0.0 0.0 0.0 mg/100 g New Zealand spinach Type 1 specific Tetragonia tetragonioides 45318 Nopal Type 1 specific Opuntia cochenillifera 338184 Northern pike Type 1 specific Esox lucius 8010 0.0 0.0 0.0 mg/100 g Norway haddock Type 1 specific Sebastes viviparus 394708 0.0 0.0 0.0 mg/100 g Norway lobster Type 1 specific Nephrops norvegicus 6829 0.0 0.0 0.0 mg/100 g Norway pout Type 1 specific Trisopterus esmarkii 80723 0.0 0.0 0.0 mg/100 g Nougat Type 2 specific 0.0 0.0 0.0 mg/100 g Nutmeg Type 1 specific Myristica fragrans 51089 0.0 0.0 0.0 mg/100 g Nutritional drink Type 2 specific 1270.0 3410.0 200.0 mg/100 g Nuts Unknown generic Oat Type 1 specific Avena sativa 4498 0.0 0.0 0.0 mg/100 g Ohelo berry Type 1 specific Vaccinium reticulatum 180767 Oil palm Type 1 specific Elaeis 51952 0.0 0.0 0.0 mg/100 g Oil-seed Camellia Type 1 specific Camellia oleifera 385388 Okra Type 1 specific Abelmoschus esculentus 455045 0.0 0.0 0.0 mg/100 g Olive Type 1 specific Olea europaea 4146 0.0 0.0 0.0 mg/100 g Onion-family vegetables Unknown generic Opium poppy Type 1 specific Papaver somniferum 3469 0.0 0.0 0.0 mg/100 g Orange bell pepper Type 1 specific Capsicum annuum 4072 Orange mint Type 1 specific Mentha aquatica 190902 Oregon yampah Type 1 specific Perideridia oregana 234866 Oriental wheat Type 1 specific Triticum turanicum 376534 0.0 0.0 0.0 mg/100 g Ostrich fern Type 1 specific Matteuccia struthiopteris 3277 Other animal fat Type 2 specific 0.0 0.0 0.0 mg/100 g Other beverage Type 2 specific 7840.0 7840.0 7840.0 mg/100 g Other bread Type 2 specific 0.0 0.0 0.0 mg/100 g Other bread product Type 2 specific 0.0 0.0 0.0 mg/100 g Other candy Type 2 specific 1698.571429 8210.0 0.0 mg/100 g Other cereal product Type 2 specific Other dish Type 2 specific 338.181818 3620.0 0.0 mg/100 g Other fermented milk Type 2 specific 3660.0 3780.0 3540.0 mg/100 g Other fish product Type 2 specific 0.0 0.0 0.0 mg/100 g Other frozen dessert Type 2 specific 1088.0 5440.0 0.0 mg/100 g Other fruit product Type 2 specific 0.0 0.0 0.0 mg/100 g Other pasta dish Type 2 specific 0.0 0.0 0.0 mg/100 g Other sandwich Type 2 specific 455.0 2370.0 0.0 mg/100 g Other snack food Type 2 specific 0.0 0.0 0.0 mg/100 g Other soy product Type 2 specific 0.0 0.0 0.0 mg/100 g Oval-leaf huckleberry Type 1 specific Vaccinium ovalifolium 190544 Oxheart cabbage Type 1 specific Brassica oleracea var. conica Oyster mushroom Type 1 specific Pleurotus ostreatus 5322 0.0 0.0 0.0 mg/100 g Pacific cod Type 1 specific Gadus macrocephalus 80720 0.0 0.0 0.0 mg/100 g Pacific halibut Type 1 specific Hippoglossus stenolepis 195615 0.0 0.0 0.0 mg/100 g Pacific ocean perch Type 1 specific Sebastes alutus 72055 0.0 0.0 0.0 mg/100 g Pacific rockfish Type 1 specific Sebastes 34820 0.0 0.0 0.0 mg/100 g Pacific sardine Type 1 specific Sardinops sagax 28381 0.0 0.0 0.0 mg/100 g Painted comber Type 1 specific Serranus scriba 349661 0.0 0.0 0.0 mg/100 g Pak choy Type 1 specific Brassica rapa var. chinensis 93385 0.0 0.0 0.0 mg/100 g Pan dulce Type 2 specific 0.0 0.0 0.0 mg/100 g Pancake Type 2 specific 1576.666667 3340.0 30.0 mg/100 g Papaya Type 1 specific Carica papaya 3649 0.0 0.0 0.0 mg/100 g Parmesan cheese Type 2 0.0 0.0 0.0 mg/100 g Parsley Type 1 specific Petroselinum crispum 4043 0.0 0.0 0.0 mg/100 g Parsnip Type 1 specific Pastinaca sativa 4041 0.0 0.0 0.0 mg/100 g Passion fruit Type 1 specific Passiflora edulis 78168 0.0 0.0 0.0 mg/100 g Pasta Type 2 specific 0.0 0.0 0.0 mg/100 g Pastry Type 2 specific 106.25 930.0 0.0 mg/100 g Pate Type 2 specific 0.0 0.0 0.0 mg/100 g Pea shoots Type 1 0.0 0.0 0.0 mg/100 g Peach Type 1 specific Prunus persica 3760 0.0 0.0 0.0 mg/100 g Peach (var.) Type 1 specific Prunus persica var. persica 323852 0.0 0.0 0.0 mg/100 g Peanut Type 1 specific Arachis hypogaea 3818 0.0 0.0 0.0 mg/100 g Pear Type 1 specific Pyrus communis 23211 1.666667 10.0 0.0 mg/100 g Pecan nut Type 1 specific Carya illinoinensis 32201 0.0 0.0 0.0 mg/100 g Pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Pepper (C. baccatum) Type 1 specific Capsicum baccatum var. baccatum 165788 Pepper (C. chinense) Type 1 specific Capsicum chinense 80379 Pepper (C. frutescens) Type 1 specific Capsicum annuum var. annuum 40321 Pepper (C. pubescens) Type 1 specific Capsicum pubescens 113210 Pepper (Capsicum) Type 1 specific Capsicum 4071 Pepper (Spice) Type 1 specific Piper nigrum 13216 0.0 0.0 0.0 mg/100 g Peppermint Type 1 specific Mentha X piperita 34256 Perciformes Type 1 specific Perciformes 8111 0.0 0.0 0.0 mg/100 g Persian lime Type 1 specific Citrus latifolia 200541 0.0 0.0 0.0 mg/100 g Persimmon Type 1 specific Diospyros 13492 0.0 0.0 0.0 mg/100 g Pie Type 2 specific 743.333333 2000.0 0.0 mg/100 g Pie crust Type 2 specific 0.0 0.0 0.0 mg/100 g Pigeon pea Type 1 specific Cajanus cajan 3821 Pikeperch Type 1 specific Sander lucioperca 283035 500.0 500.0 500.0 mg/100 g Piki bread Type 2 specific 0.0 0.0 0.0 mg/100 g Pili nut Type 1 specific Canarium ovatum 43691 Pine nut Type 1 specific Pinus 3337 0.0 0.0 0.0 mg/100 g Pineapple Type 1 specific Ananas comosus 4615 0.0 0.0 0.0 mg/100 g Pineappple sage Type 1 specific Salvia elegans 888065 Pistachio Type 1 specific Pistacia vera 55513 0.0 0.0 0.0 mg/100 g Pitanga Type 1 specific Eugenia uniflora 119951 Pizza Type 2 specific 295.423729 730.0 0.0 mg/100 g Plains prickly pear Type 1 specific Opuntia macrorhiza 1041245 0.0 0.0 0.0 mg/100 g Plantain Type 1 Musa × paradisiaca 0.0 0.0 0.0 mg/100 g Pleuronectidae (Dab, Halibut, Plaice) Type 1 specific Pleuronectidae 8256 0.0 0.0 0.0 mg/100 g Pollock Type 1 specific Pollachius 8059 0.0 0.0 0.0 mg/100 g Pomegranate Type 1 specific Punica granatum 22663 0.0 0.0 0.0 mg/100 g Pomes Unknown generic Popcorn Type 2 specific 0.0 0.0 0.0 mg/100 g Poppy Type 1 specific Papaver 3468 0.0 0.0 0.0 mg/100 g Port wine Type 2 specific 0.0 0.0 0.0 mg/100 g Pot marjoram Type 1 specific Origanum onites 452416 Pot pie Type 2 specific 345.0 690.0 0.0 mg/100 g Potato Type 1 specific Solanum tuberosum 4113 88.6 1160.0 0.0 mg/100 g Potato chip Type 2 specific 0.0 0.0 0.0 mg/100 g Potato puffs Type 2 specific 0.0 0.0 0.0 mg/100 g Prairie turnip Type 1 specific Pediomelum esculentum 458363 0.0 0.0 0.0 mg/100 g Prickly pear Type 1 specific Opuntia 106975 0.0 0.0 0.0 mg/100 g Processed cheese Type 2 specific 3554.0 6430.0 0.0 mg/100 g Prunus (Cherry, Plum) Type 1 specific Prunus 3754 0.0 0.0 0.0 mg/100 g Pudding Type 2 specific 1953.333333 2360.0 1700.0 mg/100 g Pulses Unknown generic Pummelo Type 1 specific Citrus maxima 37334 Pupusa Type 2 specific 0.0 0.0 0.0 mg/100 g Purple laver Type 1 specific Porphyra laciniata Purple mangosteen Type 1 specific Garcinia mangostana 58228 Purslane Type 1 specific Portulaca oleracea 46147 Quesadilla Type 2 specific 530.0 530.0 530.0 mg/100 g Quince Type 1 specific Cydonia oblonga 36610 0.0 0.0 0.0 mg/100 g Quinoa Type 1 specific Chenopodium quinoa 63459 Rabbit Type 1 specific Leporidae 9979 0.0 0.0 0.0 mg/100 g Radish Type 1 specific Raphanus sativus 3726 0.0 0.0 0.0 mg/100 g Radish (var.) Type 1 specific Raphanus sativus var. sativus 240228 Rainbow trout Type 1 specific Oncorhynchus mykiss 8022 0.0 0.0 0.0 mg/100 g Rambutan Type 1 specific Nephelium lappaceum 151071 Rape Type 1 specific Brassica napus var. napus 138011 0.0 0.0 0.0 mg/100 g Rapini Type 1 specific Brassica ruvo 1204434 0.0 0.0 0.0 mg/100 g Ravioli Type 2 specific 550.0 1100.0 0.0 mg/100 g Red algae Type 1 specific Rhodophyta 2763 0.0 0.0 0.0 mg/100 g Red beetroot Type 1 specific Beta vulgaris var. rubra 0.0 0.0 0.0 mg/100 g Red bell pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Red huckleberry Type 1 specific Vaccinium parvifolium 180766 Red onion Type 1 Red raspberry Type 1 specific Rubus idaeus 32247 Red rice Type 1 specific Oryza rufipogon 4529 0.0 0.0 0.0 mg/100 g Red tea Type 1 0.0 0.0 0.0 mg/100 g Redcurrant Type 1 specific Ribes rubrum 175228 0.0 0.0 0.0 mg/100 g Remoulade Type 2 specific 0.0 0.0 0.0 mg/100 g Rice Type 1 specific Oryza sativa 4530 0.0 0.0 0.0 mg/100 g Robusta coffee Type 1 specific Coffea canephora 49390 0.0 0.0 0.0 mg/100 g Rock ptarmigan Type 1 specific Lagopus muta 64668 0.0 0.0 0.0 mg/100 g Rocket salad Type 1 specific Eruca vesicaria 180536 Rocket salad (ssp.) Type 1 specific Eruca vesicaria ssp. sativa 29727 Romaine lettuce Type 1 specific Lactuca sativa L. var. longifolia 0.0 0.0 0.0 mg/100 g Roman camomile Type 1 specific Chamaemelum nobile 99037 Root vegetables Unknown generic Rose hip Type 1 specific Rosa 3764 0.0 0.0 0.0 mg/100 g Roselle Type 1 specific Hibiscus sabdariffa 183260 Rosemary Type 1 specific Rosmarinus officinalis 39367 Rowal Type 1 specific Pangium edule 112823 0.0 0.0 0.0 mg/100 g Rowanberry Type 1 specific Sorbus aucuparia 36599 Rubus (Blackberry, Raspberry) Type 1 specific Rubus 23216 0.0 0.0 0.0 mg/100 g Rum Type 2 specific 0.0 0.0 0.0 mg/100 g Rye Type 1 specific Secale cereale 4550 0.0 0.0 0.0 mg/100 g Rye bread Type 2 specific 0.002778 0.05 0.0 mg/100 g Sacred lotus Type 1 specific Nelumbo nucifera 4432 Safflower Type 1 specific Carthamus tinctorius 4222 0.0 0.0 0.0 mg/100 g Saffron Type 1 specific Crocus sativus 82528 Sago palm Type 1 specific Metroxylon sagu 93297 Salad Type 2 specific 2.222222 10.0 0.0 mg/100 g Salad dressing Type 2 specific 161.034483 1400.0 0.0 mg/100 g Salmonberry Type 1 specific Rubus spectabilis 59499 0.0 0.0 0.0 mg/100 g Salmonidae (Salmon, Trout) Type 1 specific Salmonidae 8015 0.0 0.0 0.0 mg/100 g Salt Type 2 specific 0.0 0.0 0.0 mg/100 g Sapodilla Type 1 specific Manilkara zapota 3741 Saskatoon berry Type 1 specific Amelanchier alnifolia 32219 Sauce Type 2 specific 75.384615 910.0 0.0 mg/100 g Sausage Type 2 specific 593.793103 2800.0 0.0 mg/100 g Savoy cabbage Type 1 specific Brassica oleracea var. sabauda 1216010 0.0 0.0 0.0 mg/100 g Scallop Type 1 specific Pectinidae 6566 0.0 0.0 0.0 mg/100 g Scarlet bean Type 1 specific Phaseolus coccineus 3886 Scombridae (Bonito, Mackerel, Tuna) Type 1 specific Scombridae 8224 0.0 0.0 0.0 mg/100 g Scrapple Type 2 specific 0.0 0.0 0.0 mg/100 g Sea-buckthornberry Type 1 specific Hippophae rhamnoides 193516 Semolina Type 2 specific 0.0 0.0 0.0 mg/100 g Sesame Type 1 specific Sesamum orientale 4182 0.0 0.0 0.0 mg/100 g Sesbania flower Type 1 specific Sesbania bispinosa 485725 Shallot Type 1 specific Allium ascalonicum 1476995 Shea tree Type 1 specific Vitellaria paradoxa 292385 Sheefish Type 1 specific Stenodus leucichthys 59296 0.0 0.0 0.0 mg/100 g Sherry Type 2 specific 0.0 0.0 0.0 mg/100 g Shiitake Type 1 specific Lentinus edodes 5353 0.0 0.0 0.0 mg/100 g Shrimp Type 1 specific Caridea 6694 0.0 0.0 0.0 mg/100 g Silver linden Type 1 specific Tilia argentea Skunk currant Type 1 specific Ribes glandulosum 175226 Small-leaf linden Type 1 specific Tilia cordata 172266 Smelt Type 1 specific Osmeridae 8012 0.0 0.0 0.0 mg/100 g Snack bar Type 2 specific 83.333333 500.0 0.0 mg/100 g Snail Type 1 specific Gastropoda 6448 0.0 0.0 0.0 mg/100 g Sockeye salmon Type 1 specific Oncorhynchus nerka 8023 0.0 0.0 0.0 mg/100 g Soft drink Type 2 specific 0.0 0.0 0.0 mg/100 g Soft-necked garlic Type 1 specific Allium sativum L. var. sativum 4682 Sorghum Type 1 specific Sorghum bicolor 4558 0.0 0.0 0.0 mg/100 g Sorrel Type 1 specific Rumex acetosa 41241 0.0 0.0 0.0 mg/100 g Soup Type 2 specific 38.636364 320.0 0.0 mg/100 g Sour cherry Type 1 specific Prunus cerasus 140311 0.0 0.0 0.0 mg/100 g Sourdock Type 1 specific Rumex articus 395311 Sourdough Type 2 specific Soursop Type 1 specific Annona muricata 13337 0.0 0.0 0.0 mg/100 g Soy bean Type 1 specific Glycine max 3847 0.0 0.0 0.0 mg/100 g Soy milk Type 2 specific 0.0 0.0 0.0 mg/100 g Soy sauce Type 2 specific 0.0 0.0 0.0 mg/100 g Sparkleberry Type 1 specific Vaccinium arboreum 229201 Spearmint Type 1 specific Mentha spicata 29719 Spelt Type 1 specific Triticum spelta 58933 0.0 0.0 0.0 mg/100 g Spinach Type 1 specific Spinacia oleracea 3562 0.0 0.0 0.0 mg/100 g Spiny dogfish Type 1 specific Squalus acanthias 7797 0.0 0.0 0.0 mg/100 g Spirit Type 2 specific 0.0 0.0 0.0 mg/100 g Spirulina Type 1 specific Spirulina 551299 Spotted seal Type 1 specific Phoca largha 39090 0.0 0.0 0.0 mg/100 g Spread Type 2 specific 0.0 0.0 0.0 mg/100 g Squashberry Type 1 specific Viburnum edule 237934 Star anise Type 1 specific Illicium verum 124778 Star fruit Type 1 specific Averrhoa carambola 28974 0.0 0.0 0.0 mg/100 g Stew Type 2 specific 0.0 0.0 0.0 mg/100 g Strawberry Type 1 specific Fragaria X ananassa 3747 0.0 0.0 0.0 mg/100 g Strawberry guava Type 1 specific Psidium cattleianum 375274 Stuffing Type 2 specific 0.0 0.0 0.0 mg/100 g Sturgeon Type 1 specific Acipenseridae 7900 0.0 0.0 0.0 mg/100 g Sugar Type 2 specific 0.0 0.0 0.0 mg/100 g Sugar apple Type 1 specific Annona squamosa 301693 Sugar substitute Type 2 specific 0.0 0.0 0.0 mg/100 g Summer grape Type 1 specific Vitis aestivalis 3605 Summer savory Type 1 specific Satureja hortensis 49987 Sunburst squash (pattypan squash) Type 1 specific Cucurbita pepo var. clypeata 0.0 0.0 0.0 mg/100 g Sunflower Type 1 specific Helianthus annuus 4232 0.0 0.0 0.0 mg/100 g Swamp cabbage Type 1 specific Ipomoea aquatica 89636 Swede Type 1 specific Brassica napus 3708 0.0 0.0 0.0 mg/100 g Sweet basil Type 1 specific Ocimum basilicum 39350 0.0 0.0 0.0 mg/100 g Sweet bay Type 1 specific Laurus nobilis 85223 Sweet cherry Type 1 specific Prunus avium 42229 0.0 0.0 0.0 mg/100 g Sweet custard Type 2 specific 4610.0 4630.0 4590.0 mg/100 g Sweet marjoram Type 1 specific Origanum majorana 268884 Sweet orange Type 1 specific Citrus sinensis 2711 0.0 0.0 0.0 mg/100 g Sweet potato Type 1 specific Ipomoea batatas 4120 0.0 0.0 0.0 mg/100 g Sweet rowanberry Type 1 specific Grataegosorbus mitschurinii Swiss chard Type 1 specific Beta vulgaris ssp. cicla 1527200 0.0 0.0 0.0 mg/100 g Swiss cheese Type 2 0.0 0.0 0.0 mg/100 g Syrup Type 2 specific 1003.333333 3010.0 0.0 mg/100 g Taco Type 2 specific 37.5 150.0 0.0 mg/100 g Tallow Type 2 specific 0.0 0.0 0.0 mg/100 g Tamale Type 2 specific 0.0 0.0 0.0 mg/100 g Tamarind Type 1 specific Tamarindus indica 58860 0.0 0.0 0.0 mg/100 g Taro Type 1 specific Colocasia esculenta 4460 Tarragon Type 1 specific Artemisia dracunculus 72341 Tartary buckwheat Type 1 specific Fagopyrum tataricum 62330 Tea Type 1 specific Camellia sinensis 4442 0.0 0.0 0.0 mg/100 g Tea leaf willow Type 1 specific Salix pulchra 669814 Teff Type 1 specific Eragrostis tef 110835 0.0 0.0 0.0 mg/100 g Thistle Type 1 specific Cirsium 41549 0.0 0.0 0.0 mg/100 g Thunnus Type 1 specific Thunnus 8234 0.0 0.0 0.0 mg/100 g Tinda Type 1 specific Citrullus lanatus var. fistulosus 0.0 0.0 0.0 mg/100 g Toffee Type 2 specific 1050.0 2100.0 0.0 mg/100 g Tofu Type 2 specific 0.0 0.0 0.0 mg/100 g Topping Type 2 specific 3750.0 3750.0 3750.0 mg/100 g Tortilla Type 2 specific 0.0 0.0 0.0 mg/100 g Tortilla chip Type 2 specific 783.333333 2150.0 0.0 mg/100 g Towel gourd Type 1 specific Luffa aegyptiaca 3670 Tree fern Type 1 specific Cyathea Triticale Type 1 specific X Triticosecale rimpaui Tronchuda cabbage Type 1 specific Brassica oleracea var. costata 416546 True frog Type 1 specific Ranidae 8397 0.0 0.0 0.0 mg/100 g True oyster Type 1 specific Ostreidae 6563 0.0 0.0 0.0 mg/100 g True seal Type 1 specific Phocidae 9709 0.0 0.0 0.0 mg/100 g True sole Type 1 specific Soleidae 30948 0.0 0.0 0.0 mg/100 g Turbot Type 1 specific Scophthalmus maximus 52904 0.0 0.0 0.0 mg/100 g Turkey Type 1 specific Meleagris gallopavo 9103 0.0 0.0 0.0 mg/100 g Turmeric Type 1 specific Curcuma longa 136217 0.0 0.0 0.0 mg/100 g Turnip Type 1 specific Brassica rapa var. rapa 51350 0.0 0.0 0.0 mg/100 g Ucuhuba Type 1 specific Virola surinamensis 224910 Unclassified food or beverage Type 2 specific 0.0 0.0 0.0 mg/100 g Vaccinium (Blueberry, Cranberry, Huckleberry) Type 1 specific Vaccinium 13749 0.0 0.0 0.0 mg/100 g Vanilla Type 1 specific Vanilla 51238 Vegetable juice Type 2 specific 0.0 0.0 0.0 mg/100 g Vegetarian food Type 2 specific 60.0 60.0 60.0 mg/100 g Vermouth Type 2 specific 0.0 0.0 0.0 mg/100 g Vinegar Type 2 specific 0.0 0.0 0.0 mg/100 g Vodka Type 2 specific 0.0 0.0 0.0 mg/100 g Waffle Type 2 specific 1431.666667 1560.0 1350.0 mg/100 g Wakame Type 1 specific Undaria pinnatifida 74381 Walnut Type 1 specific Juglans 16718 0.0 0.0 0.0 mg/100 g Wasabi Type 1 specific Wasabia japonica 75806 0.0 0.0 0.0 mg/100 g Water Type 2 specific 0.0 0.0 0.0 mg/100 g Water spinach Type 1 Ipomoea aquatica 0.0 0.0 0.0 mg/100 g Watercress Type 1 specific Rorippa nasturtium-aquaticum 135518 0.0 0.0 0.0 mg/100 g Watermelon Type 1 specific Citrullus lanatus 3654 0.0 0.0 0.0 mg/100 g Wax apple Type 1 specific Eugenia javanica 119950 Wax gourd Type 1 specific Benincasa hispida 102211 Welsh onion Type 1 specific Allium fistulosum 35875 Wheat Type 1 specific Triticum 4564 0.0 0.0 0.0 mg/100 g Wheat bread Type 2 specific 50.0 620.0 0.0 mg/100 g Whey Type 2 specific 11033.333333 33100.0 0.0 mg/100 g Whisky Type 2 specific 0.0 0.0 0.0 mg/100 g White bread Type 1 0.021429 0.15 0.0 mg/100 g White cabbage Type 1 specific Brassica oleracea L. var. capitata L. f. alba DC. 0.0 0.0 0.0 mg/100 g White lupine Type 1 specific Lupinus albus 3870 White mustard Type 1 specific Sinapis alba 3728 0.0 0.0 0.0 mg/100 g Whitefish Type 1 specific Coregonus 27772 0.0 0.0 0.0 mg/100 g Whiting Type 1 specific Merlangius merlangus 8058 0.0 0.0 0.0 mg/100 g Wild carrot Type 1 specific Daucus carota 4039 0.0 0.0 0.0 mg/100 g Wild celery Type 1 specific Apium graveolens 4045 0.0 0.0 0.0 mg/100 g Wild leek Type 1 specific Allium ampeloprasum 4681 Wild rice Type 1 specific Zizania 15949 Winged bean Type 1 specific Psophocarpus tetragonolobus 3891 Winter savory Type 1 specific Satureja montana 49988 Winter squash Type 1 specific Cucurbita maxima 3661 Yam Type 1 specific Dioscorea 4672 0.0 0.0 0.0 mg/100 g Yardlong bean Type 1 specific Vigna unguiculata ssp. sesquipedalis 138955 Yautia Type 1 specific Xanthosoma sagittifolium 28478 Yellow bell pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Yellow pond-lily Type 1 specific Nuphar lutea 77113 0.0 0.0 0.0 mg/100 g Yellow wax bean Type 1 specific Phaseolus vulgaris 3885 Yellow zucchini Type 1 specific Cucurbita pepo var. cylindrica 0.0 0.0 0.0 mg/100 g Ymer Type 2 specific 3310.0 3370.0 3250.0 mg/100 g Yogurt Type 2 specific 2334.166667 4400.0 0.0 mg/100 g Alpha-lactalbumin P00709 LALBA Beta-galactosidase P16278 GLB1 Lactase-phlorizin hydrolase P09848 LCT Anti hepatotic 327 Any compound that is able to prevent damage to the liver. Anti-encephalopathic 256 Any substance introduced into a living organism with therapeutic or diagnostic purpose. Neoplastic 1145 Sweetener 1341 Substance that sweeten food, beverages, medications, etc.