1.0 2010-04-08 22:04:51 UTC 2025-11-18 22:28:36 UTC FDB001165 N-Glycolylneuraminic acid Isolated from beef serum N-Glycolylneuraminic acid (Neu5Gc) is a widely expressed sialic acid in mammalian cells. Although humans are genetically deficient in producing Neu5Gc, small amounts are present in human cells in vivo. A dietary origin was suggested by human volunteer studies and by observing that free Neu5Gc is metabolically incorporated into cultured human carcinoma cells by unknown mechanisms. 3,5-Dideoxy-5-[(hydroxyacetyl)amino]-D-glycero-D-galacto-2-nonulosonic acid, 9CI Gcneu N-glycoloyl-neuraminate N-glycoloylneuraminate N-glycoloylneuraminic acid N-glycolylneuraminate Neugc Neungc Neungl NGNA Porcine sialic acid C11H19NO10 325.2693 325.100895833 5-[(1,2-dihydroxyethylidene)amino]-2,4-dihydroxy-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylic acid 5-[(1,2-dihydroxyethylidene)amino]-2,4-dihydroxy-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylic acid 1113-83-3 OCC(O)C(O)C1OC(O)(CC(O)C1NC(=O)CO)C(O)=O InChI=1S/C11H19NO10/c13-2-5(16)8(18)9-7(12-6(17)3-14)4(15)1-11(21,22-9)10(19)20/h4-5,7-9,13-16,18,21H,1-3H2,(H,12,17)(H,19,20) FDJKUWYYUZCUJX-UHFFFAOYSA-N belongs to the class of organic compounds known as n-acylneuraminic acids. These are neuraminic acids carrying an N-acyl substituent. N-acylneuraminic acids Organic compounds Organic oxygen compounds Organooxygen compounds Carbohydrates and carbohydrate conjugates Aliphatic heteromonocyclic compounds Alpha hydroxy acids and derivatives C-glucuronides C-glycosyl compounds Carbonyl compounds Carboxylic acids Hemiacetals Hydrocarbon derivatives Monocarboxylic acids and derivatives Neuraminic acids Organic oxides Organonitrogen compounds Organopnictogen compounds Oxacyclic compounds Oxanes Polyols Primary alcohols Pyrans Secondary alcohols Secondary carboxylic acid amides Alcohol Aliphatic heteromonocyclic compound Alpha-hydroxy acid C-glucuronide C-glycosyl compound Carbonyl group Carboxamide group Carboxylic acid Carboxylic acid derivative Glycosyl compound Hemiacetal Hydrocarbon derivative Hydroxy acid Monocarboxylic acid or derivatives N-acylneuraminic acid Neuraminic acid Organic nitrogen compound Organic oxide Organoheterocyclic compound Organonitrogen compound Organopnictogen compound Oxacycle Oxane Polyol Primary alcohol Pyran Secondary alcohol Secondary carboxylic acid amide logp -2.81 ALOGPS logs -0.46 ALOGPS solubility 1.13e+02 g/l ALOGPS melting_point Mp 185-187° logp -3.7 ChemAxon pka_strongest_acidic 2.85 ChemAxon pka_strongest_basic 1.19 ChemAxon iupac 5-[(1,2-dihydroxyethylidene)amino]-2,4-dihydroxy-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylic acid ChemAxon average_mass 325.2693 ChemAxon mono_mass 325.100895833 ChemAxon smiles OCC(O)C(O)C1OC(O)(CC(O)C1NC(=O)CO)C(O)=O ChemAxon formula C11H19NO10 ChemAxon inchi InChI=1S/C11H19NO10/c13-2-5(16)8(18)9-7(12-6(17)3-14)4(15)1-11(21,22-9)10(19)20/h4-5,7-9,13-16,18,21H,1-3H2,(H,12,17)(H,19,20) ChemAxon inchikey FDJKUWYYUZCUJX-UHFFFAOYSA-N ChemAxon polar_surface_area 200.5 ChemAxon refractivity 66.01 ChemAxon polarizability 28.72 ChemAxon rotatable_bond_count 6 ChemAxon acceptor_count 11 ChemAxon donor_count 8 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 44652 Specdb::MsMs 44653 Specdb::MsMs 44654 Specdb::MsMs 117504 Specdb::MsMs 117505 Specdb::MsMs 117506 Specdb::MsMs 3390754 Specdb::MsMs 3390755 Specdb::MsMs 3390756 Specdb::MsMs 3390757 Specdb::MsMs 3390758 Specdb::MsMs 3390759 Specdb::CMs 103946 Specdb::CMs 115884 Specdb::CMs 125448 Specdb::CMs 127055 Specdb::CMs 127565 Specdb::CMs 801303 Specdb::CMs 801304 Specdb::CMs 801305 Specdb::CMs 801306 Specdb::CMs 801307 Specdb::CMs 801308 Specdb::CMs 801309 Specdb::CMs 801310 Specdb::CMs 801311 Specdb::CMs 801312 Specdb::CMs 801313 Specdb::CMs 801314 Specdb::CMs 801315 Specdb::CMs 801316 Specdb::CMs 801317 Specdb::CMs 801318 Specdb::CMs 801319 Specdb::CMs 801320 Specdb::CMs 801321 Specdb::CMs 801322 Specdb::NmrOneD 180981 Specdb::NmrOneD 180982 Specdb::NmrOneD 180983 Specdb::NmrOneD 180984 Specdb::NmrOneD 180985 Specdb::NmrOneD 180986 Specdb::NmrOneD 180987 Specdb::NmrOneD 180988 Specdb::NmrOneD 180989 Specdb::NmrOneD 180990 Specdb::NmrOneD 180991 Specdb::NmrOneD 180992 Specdb::NmrOneD 180993 Specdb::NmrOneD 180994 Specdb::NmrOneD 180995 Specdb::NmrOneD 180996 Specdb::NmrOneD 180997 Specdb::NmrOneD 180998 Specdb::NmrOneD 180999 Specdb::NmrOneD 181000 HMDB00833 29025 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823