1.0 2010-04-08 22:04:54 UTC 2025-11-18 22:29:43 UTC FDB001286 Glabrin A Constituent of the seeds of Annona glabra (pond apple). Glabrin A is found in alcoholic beverages and fruits. Cyclo(glycylleucylvalylisoleucyltyrosylprolyl) C7H13NO4 175.184 175.084457903 4,5-dihydroxy-1-methylpiperidine-2-carboxylic acid 4,5-dihydroxy-1-methylpiperidine-2-carboxylic acid 162157-00-8 CN1CC(O)C(O)CC1C(O)=O InChI=1S/C7H13NO4/c1-8-3-6(10)5(9)2-4(8)7(11)12/h4-6,9-10H,2-3H2,1H3,(H,11,12) VORPREYJNTUAGI-UHFFFAOYSA-N belongs to the class of organic compounds known as alpha amino acids. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon). Alpha amino acids Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic heteromonocyclic compounds 1,2-aminoalcohols 1,2-diols Amino acids Azacyclic compounds Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Piperidinecarboxylic acids Secondary alcohols Trialkylamines 1,2-aminoalcohol 1,2-diol Alcohol Aliphatic heteromonocyclic compound Alpha-amino acid Amine Amino acid Azacycle Carbonyl group Carboxylic acid Hydrocarbon derivative Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organoheterocyclic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Piperidine Piperidinecarboxylic acid Secondary alcohol Tertiary aliphatic amine Tertiary amine logp -2.10 ALOGPS logs 0.75 ALOGPS solubility 9.81e+02 g/l ALOGPS melting_point Mp 300-303° logp -4.2 ChemAxon pka_strongest_acidic 1.4 ChemAxon pka_strongest_basic 8.97 ChemAxon iupac 4,5-dihydroxy-1-methylpiperidine-2-carboxylic acid ChemAxon average_mass 175.184 ChemAxon mono_mass 175.084457903 ChemAxon smiles CN1CC(O)C(O)CC1C(O)=O ChemAxon formula C7H13NO4 ChemAxon inchi InChI=1S/C7H13NO4/c1-8-3-6(10)5(9)2-4(8)7(11)12/h4-6,9-10H,2-3H2,1H3,(H,11,12) ChemAxon inchikey VORPREYJNTUAGI-UHFFFAOYSA-N ChemAxon polar_surface_area 81 ChemAxon refractivity 40.64 ChemAxon polarizability 17.13 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 5 ChemAxon donor_count 3 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 99054 Specdb::MsMs 99055 Specdb::MsMs 99056 Specdb::MsMs 164133 Specdb::MsMs 164134 Specdb::MsMs 164135 Specdb::MsMs 3597196 Specdb::MsMs 3597197 Specdb::MsMs 3597198 Specdb::MsMs 3597199 Specdb::MsMs 3597200 Specdb::MsMs 3597201 Alcoholic beverages Unknown generic Fruits Unknown generic