1.0 2010-04-08 22:04:57 UTC 2019-11-26 02:56:27 UTC FDB001404 Indole-3-butyric acid Indole-3-butyric acid (IBA) is a plant hormone in the auxin family and is an ingredient in many commercial plant rooting horticultural products. Indole-3-butyric acid is found in common pea, potato, and corn. [3-(3-Indolyl)propyl]carboxylic acid β-indolebutyric acid 1H-Indole-3-butanoate 1H-Indole-3-butanoic acid 1H-Indole-3-butanoic acid (9CI) 1H-Indole-3-butyrate 1H-Indole-3-butyric acid 3-Indole butyrate 3-Indole butyric acid 3-Indolebutyrate 3-Indolebutyric acid 3-Indolyl-g-butyrate 3-Indolyl-g-butyric acid 3-Indolyl-gamma-butyrate 3-Indolyl-gamma-butyric acid 3-Indolyl-γ-butyrate 3-Indolyl-γ-butyric acid 3-Indolylbutyric acid 3-Iodolebutyrate 4-(1H-Indol-3-yl)-butyrate 4-(1H-Indol-3-yl)-butyric acid 4-(1H-indol-3-yl)butanoate 4-(1H-indol-3-yl)butanoic acid 4-(1H-Indol-3-yl)butyric acid 4-(3-1H-Indolyl)butyrate 4-(3-1H-Indolyl)butyric acid 4-(3-Indole)-butyrate 4-(3-Indole)-butyric acid 4-(3-Indolyl)butanoic acid 4-(3-Indolyl)butyrate 4-(3-Indolyl)butyric acid 4-(Indol-3-yl)butyrate 4-(Indol-3-yl)butyric acid 4-(indolyl)- butyrate 4-(indolyl)- butyric acid 4-(Indolyl)butyric acid 4-indol-3-ylbutyrate 4-indol-3-Ylbutyric acid 4-Indol-3-ylbutyric-acid B-indolebutyrate B-indolebutyric acid Beta-iba Beta-indolebutyrate Beta-indolebutyric acid Beta-indolylbutyric acid Butyric acid, 4-(indolyl)- gamma-(Indol-3-yl)butyric acid gamma-(Indole-3)-butyric acid IBA Indol-3,4'-yl butyric acid Indolbutyric acid Indole 3-butyrate Indole 3-butyric acid Indole butyric acid Indole-3 Butyrate Indole-3 Butyric acid Indole-3-butanoate Indole-3-butanoic acid Indole-3-Butrylate Indole-3-Butrylic acid Indole-3-butyrate Indole-3-butyric acid (8CI) Indolebutyrate Indolebutyric acid Indolyl-3-butyrate Indolyl-3-butyric acid Seradix C12H13NO2 203.2371 203.094628665 4-(1H-indol-3-yl)butanoic acid 3-indolebutyric acid 133-32-4 OC(=O)CCCC1=CNC2=C1C=CC=C2 InChI=1S/C12H13NO2/c14-12(15)7-3-4-9-8-13-11-6-2-1-5-10(9)11/h1-2,5-6,8,13H,3-4,7H2,(H,14,15) JTEDVYBZBROSJT-UHFFFAOYSA-N belongs to the class of organic compounds known as 3-alkylindoles. 3-alkylindoles are compounds containing an indole moiety that carries an alkyl chain at the 3-position. 3-alkylindoles Organic compounds Organoheterocyclic compounds Indoles and derivatives Indoles Aromatic heteropolycyclic compounds Azacyclic compounds Benzenoids Carbonyl compounds Carboxylic acids Heteroaromatic compounds Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Organonitrogen compounds Organopnictogen compounds Substituted pyrroles 3-alkylindole Aromatic heteropolycyclic compound Azacycle Benzenoid Carbonyl group Carboxylic acid Carboxylic acid derivative Heteroaromatic compound Hydrocarbon derivative Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Pyrrole Substituted pyrrole indol-3-yl carboxylic acid Solid logp 2.38 ALOGPS logs -2.76 ALOGPS solubility 3.56e-01 g/l ALOGPS melting_point 124.5 oC logp 2.6 ChemAxon pka_strongest_acidic 4.86 ChemAxon iupac 4-(1H-indol-3-yl)butanoic acid ChemAxon average_mass 203.2371 ChemAxon mono_mass 203.094628665 ChemAxon smiles OC(=O)CCCC1=CNC2=C1C=CC=C2 ChemAxon formula C12H13NO2 ChemAxon inchi InChI=1S/C12H13NO2/c14-12(15)7-3-4-9-8-13-11-6-2-1-5-10(9)11/h1-2,5-6,8,13H,3-4,7H2,(H,14,15) ChemAxon inchikey JTEDVYBZBROSJT-UHFFFAOYSA-N ChemAxon polar_surface_area 53.09 ChemAxon refractivity 57.65 ChemAxon polarizability 22.03 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 2 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::NmrOneD 1851 Specdb::NmrOneD 166607 Specdb::NmrTwoD 1791 Specdb::CMs 1838 Specdb::CMs 1859 Specdb::CMs 6268 Specdb::CMs 27706 Specdb::CMs 31392 Specdb::CMs 31393 Specdb::CMs 38266 Specdb::CMs 169480 Specdb::MsMs 1999 Specdb::MsMs 2000 Specdb::MsMs 2001 Specdb::MsMs 5714 Specdb::MsMs 5715 Specdb::MsMs 5716 Specdb::MsMs 5717 Specdb::MsMs 5718 Specdb::MsMs 5719 Specdb::MsMs 5720 Specdb::MsMs 5721 Specdb::MsMs 5722 Specdb::MsMs 5723 Specdb::MsMs 5724 Specdb::MsMs 246489 Specdb::MsMs 246490 Specdb::MsMs 246491 Specdb::MsMs 266433 Specdb::MsMs 266434 Specdb::MsMs 266435 Specdb::MsMs 437977 Specdb::MsMs 437978 Specdb::MsMs 437979 Specdb::MsMs 437980 Specdb::MsMs 437981 HMDB02096 33070 3IB #<Reference:0x000055ce31e628c8> #<Reference:0x000055ce31e626e8> #<Reference:0x000055ce31e62508> #<Reference:0x000055ce31e62300> #<Reference:0x000055ce31e62120> #<Reference:0x000055ce31e61f40> #<Reference:0x000055ce31e61d38> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Common pea Type 1 specific Pisum sativum 3888 Corn Type 1 specific Zea mays 4577 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Potato Type 1 specific Solanum tuberosum 4113 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Beta-2-microglobulin precursor [Contains: Beta-2-microglobulin variant pI 5.3] P61769 B2M Hypoglycemic 1017 A drug which lowers the blood glucose level. Insulinase inhibitor 1044 A compound or agent that combines with an enzyme in such a manner as to prevent the normal substrate-enzyme combination and the catalytic reaction. Insulinotonic 1047