1.0 2010-04-08 22:04:58 UTC 2025-11-18 22:31:13 UTC FDB001432 12-oxo-PDA 12-oxo-pda, also known as (15z)-12-oxophyto-10,15-dienoate or 12-oxo-10,15(Z)-phytodienoic acid, is a member of the class of compounds known as prostaglandins and related compounds. Prostaglandins and related compounds are unsaturated carboxylic acids consisting of a 20 carbon skeleton that also contains a five member ring, and are based upon the fatty acid arachidonic acid. Thus, 12-oxo-pda is considered to be an octadecanoid lipid molecule. 12-oxo-pda is practically insoluble (in water) and a weakly acidic compound (based on its pKa). 12-oxo-pda can be found in corn, which makes 12-oxo-pda a potential biomarker for the consumption of this food product. (15Z)-12-Oxophyto-10,15-dienoate (15Z)-12-Oxophyto-10,15-dienoic acid (9S,13S,15Z)-12-Oxo-10,15-phytodienoic acid (9S,13S)-12-Oxophytodienoic acid 12-OPDA 12-Oxo-10,15(Z)-phytodienoic acid 12-Oxo-cis-10,15-phytodienoic acid 12-oxo-phytodienoic acid 12-oxophytodienoic acid 2-Cyclopentene-1-octanoic acid 9(S),13(S)-12-Oxo-PDA cis-(+)-12-Oxo-phytodienoic acid O-phytodienoic acid OPDA C18H28O3 292.4131 292.203844762 8-[(1S,5S)-4-oxo-5-[(2Z)-pent-2-en-1-yl]cyclopent-2-en-1-yl]octanoic acid 12-oxo-phytodienoic acid 85551-10-6 CC\C=C/C[C@H]1[C@@H](CCCCCCCC(O)=O)C=CC1=O InChI=1S/C18H28O3/c1-2-3-7-11-16-15(13-14-17(16)19)10-8-5-4-6-9-12-18(20)21/h3,7,13-16H,2,4-6,8-12H2,1H3,(H,20,21)/b7-3-/t15-,16-/m0/s1 PMTMAFAPLCGXGK-JMTMCXQRSA-N belongs to the class of organic compounds known as prostaglandins and related compounds. These are unsaturated carboxylic acids consisting of a 20 carbon skeleton that also contains a five member ring, and are based upon the fatty acid arachidonic acid. Prostaglandins and related compounds Organic compounds Lipids and lipid-like molecules Fatty Acyls Eicosanoids Aliphatic homomonocyclic compounds Carboxylic acids Cyclic ketones Hydrocarbon derivatives Medium-chain fatty acids Monocarboxylic acids and derivatives Organic oxides Aliphatic homomonocyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Cyclic ketone Hydrocarbon derivative Ketone Medium-chain fatty acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Prostaglandin skeleton 12-oxophytodienoic acid metabolites 12-oxophytodienoic acid metabolites carbocyclic fatty acid oxo carboxylic acid unsaturated fatty acid logp 5.09 ALOGPS logs -4.96 ALOGPS solubility 3.22e-03 g/l ALOGPS logp 5.08 ChemAxon pka_strongest_acidic 4.78 ChemAxon pka_strongest_basic -4.9 ChemAxon iupac 8-[(1S,5S)-4-oxo-5-[(2Z)-pent-2-en-1-yl]cyclopent-2-en-1-yl]octanoic acid ChemAxon average_mass 292.4131 ChemAxon mono_mass 292.203844762 ChemAxon smiles CC\C=C/C[C@H]1[C@@H](CCCCCCCC(O)=O)C=CC1=O ChemAxon formula C18H28O3 ChemAxon inchi InChI=1S/C18H28O3/c1-2-3-7-11-16-15(13-14-17(16)19)10-8-5-4-6-9-12-18(20)21/h3,7,13-16H,2,4-6,8-12H2,1H3,(H,20,21)/b7-3-/t15-,16-/m0/s1 ChemAxon inchikey PMTMAFAPLCGXGK-JMTMCXQRSA-N ChemAxon polar_surface_area 54.37 ChemAxon refractivity 87.26 ChemAxon polarizability 35.15 ChemAxon rotatable_bond_count 11 ChemAxon acceptor_count 3 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 58887 Specdb::MsMs 58888 Specdb::MsMs 58889 Specdb::MsMs 114915 Specdb::MsMs 114916 Specdb::MsMs 114917 Specdb::MsMs 3597349 Specdb::MsMs 3597350 Specdb::MsMs 3597351 Specdb::MsMs 3597352 Specdb::MsMs 3597353 Specdb::MsMs 3597354 15560 Corn Type 1 specific Zea mays 4577