1.0 2010-04-08 22:04:58 UTC 2025-11-18 22:31:18 UTC FDB001447 Medioresinol Medioresinol is a member of the class of compounds known as furanoid lignans. Furanoid lignans are lignans with a structure that contains either a tetrahydrofuran ring, a furan ring, or a furofuan ring system, that arises from the joining of the two phenylpropanoid units. Medioresinol is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). Medioresinol can be found in a number of food items such as garden tomato (variety), common buckwheat, radish (variety), and black elderberry, which makes medioresinol a potential biomarker for the consumption of these food products. (+)-Medioresinol C21H24O7 388.4111 388.152203122 4-[(1S,3aR,4S,6aR)-4-(4-hydroxy-3-methoxyphenyl)-hexahydrofuro[3,4-c]furan-1-yl]-2,6-dimethoxyphenol 4-[(1S,3aR,4S,6aR)-4-(4-hydroxy-3-methoxyphenyl)-hexahydrofuro[3,4-c]furan-1-yl]-2,6-dimethoxyphenol 40957-99-1 COC1=CC(=CC=C1O)[C@H]1OC[C@H]2[C@@H]1CO[C@@H]2C1=CC(OC)=C(O)C(OC)=C1 InChI=1S/C21H24O7/c1-24-16-6-11(4-5-15(16)22)20-13-9-28-21(14(13)10-27-20)12-7-17(25-2)19(23)18(8-12)26-3/h4-8,13-14,20-23H,9-10H2,1-3H3/t13-,14-,20+,21+/m0/s1 VJOBNGRIBLNUKN-BMHXQBNDSA-N belongs to the class of organic compounds known as furanoid lignans. These are lignans with a structure that contains either a tetrahydrofuran ring, a furan ring, or a furofuan ring system, that arises from the joining of the two phenylpropanoid units. Furanoid lignans Organic compounds Lignans, neolignans and related compounds Furanoid lignans Aromatic heteropolycyclic compounds 1-hydroxy-2-unsubstituted benzenoids Alkyl aryl ethers Anisoles Dialkyl ethers Dimethoxybenzenes Furofuran lignans Furofurans Hydrocarbon derivatives Methoxyphenols Oxacyclic compounds Phenoxy compounds Tetrahydrofurans 1-hydroxy-2-unsubstituted benzenoid Alkyl aryl ether Anisole Aromatic heteropolycyclic compound Benzenoid Dialkyl ether Dimethoxybenzene Ether Furanoid lignan Furofuran Furofuran lignan skeleton Hydrocarbon derivative M-dimethoxybenzene Methoxybenzene Methoxyphenol Monocyclic benzene moiety Organic oxygen compound Organoheterocyclic compound Organooxygen compound Oxacycle Phenol Phenol ether Phenoxy compound Tetrahydrofuran dimethoxybenzene furofuran lignan polyphenol logp 2.26 ALOGPS logs -3.99 ALOGPS solubility 3.95e-02 g/l ALOGPS logp 2.12 ChemAxon pka_strongest_acidic 9.21 ChemAxon pka_strongest_basic -3.8 ChemAxon iupac 4-[(1S,3aR,4S,6aR)-4-(4-hydroxy-3-methoxyphenyl)-hexahydrofuro[3,4-c]furan-1-yl]-2,6-dimethoxyphenol ChemAxon average_mass 388.4111 ChemAxon mono_mass 388.152203122 ChemAxon smiles COC1=CC(=CC=C1O)[C@H]1OC[C@H]2[C@@H]1CO[C@@H]2C1=CC(OC)=C(O)C(OC)=C1 ChemAxon formula C21H24O7 ChemAxon inchi InChI=1S/C21H24O7/c1-24-16-6-11(4-5-15(16)22)20-13-9-28-21(14(13)10-27-20)12-7-17(25-2)19(23)18(8-12)26-3/h4-8,13-14,20-23H,9-10H2,1-3H3/t13-,14-,20+,21+/m0/s1 ChemAxon inchikey VJOBNGRIBLNUKN-BMHXQBNDSA-N ChemAxon polar_surface_area 86.61 ChemAxon refractivity 101.56 ChemAxon polarizability 39.43 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 7 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 109896 Specdb::MsMs 109897 Specdb::MsMs 109898 Specdb::MsMs 177444 Specdb::MsMs 177445 Specdb::MsMs 177446 Asparagus Type 1 specific Asparagus officinalis 4686 0.005 0.005 0.005 mg/100 g Barley Type 1 specific Hordeum vulgare 4513 0.011 0.011 0.011 mg/100 g Black elderberry Type 1 specific Sambucus nigra 4202 Black salsify Type 1 specific Scorzonera hispanica 114289 Common buckwheat Type 1 specific Fagopyrum esculentum 3617 0.033 0.033 0.033 mg/100 g Common wheat Type 1 specific Triticum aestivum 4565 0.03 0.029999999 0.029999999 mg/100 g Cucumber Type 1 specific Cucumis sativus 3659 0.0 0.0 0.0 mg/100 g Eggplant Type 1 specific Solanum melongena 4111 0.004 0.004 0.004 mg/100 g Garden tomato (var.) Type 1 specific Solanum lycopersicum var. lycopersicum 397755 0.002 0.002 0.002 mg/100 g Kiwi Type 1 specific Actinidia chinensis 3625 0.005 0.005 0.005 mg/100 g Oat Type 1 specific Avena sativa 4498 0.04 0.039999999 0.039999999 mg/100 g Pineapple Type 1 specific Ananas comosus 4615 0.003 0.003 0.003 mg/100 g Radish (var.) Type 1 specific Raphanus sativus var. sativus 240228 0.001 0.001 0.001 mg/100 g Rye Type 1 specific Secale cereale 4550 0.148 0.148000002 0.148000002 mg/100 g Sesame Type 1 specific Sesamum orientale 4182 4.153 4.152999878 4.152999878 mg/100 g Tofu Type 2 specific 0.01 0.01 0.01 mg/100 g