1.0 2010-04-08 22:04:58 UTC 2025-11-18 22:31:20 UTC FDB001452 (+)-Bornyl diphosphate (+)-bornyl diphosphate is a member of the class of compounds known as bicyclic monoterpenoids. Bicyclic monoterpenoids are monoterpenoids containing exactly 2 rings, which are fused to each other (+)-bornyl diphosphate is slightly soluble (in water) and a moderately acidic compound (based on its pKa). (+)-bornyl diphosphate can be found in common sage, which makes (+)-bornyl diphosphate a potential biomarker for the consumption of this food product. (+)-Bornyl pyrophosphate (+)-bornyl-diphosphate C10H20O7P2 314.2091 314.068426018 {[hydroxy({[(1S,2S,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-yl]oxy})phosphoryl]oxy}phosphonic acid {hydroxy[(1S,2S,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-yl]oxyphosphoryl}oxyphosphonic acid 64822-87-3 CC1(C)[C@@H]2CC[C@]1(C)[C@H](C2)OP(O)(=O)OP(O)(O)=O InChI=1S/C10H20O7P2/c1-9(2)7-4-5-10(9,3)8(6-7)16-19(14,15)17-18(11,12)13/h7-8H,4-6H2,1-3H3,(H,14,15)(H2,11,12,13)/t7-,8+,10-/m1/s1 VZPAJODTZAAANV-KHQFGBGNSA-N belongs to the class of organic compounds known as bicyclic monoterpenoids. These are monoterpenoids containing exactly 2 rings, which are fused to each other. Bicyclic monoterpenoids Organic compounds Lipids and lipid-like molecules Prenol lipids Monoterpenoids Aliphatic homopolycyclic compounds Hydrocarbon derivatives Monoalkyl phosphates Organic oxides Organic pyrophosphates Organooxygen compounds Aliphatic homopolycyclic compound Alkyl phosphate Bicyclic monoterpenoid Bornane monoterpenoid Hydrocarbon derivative Monoalkyl phosphate Organic oxide Organic oxygen compound Organic phosphoric acid derivative Organic pyrophosphate Organooxygen compound Phosphoric acid ester logp 1.05 ALOGPS logs -1.72 ALOGPS solubility 6.01e+00 g/l ALOGPS logp 1.44 ChemAxon pka_strongest_acidic 1.77 ChemAxon iupac {[hydroxy({[(1S,2S,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-yl]oxy})phosphoryl]oxy}phosphonic acid ChemAxon average_mass 314.2091 ChemAxon mono_mass 314.068426018 ChemAxon smiles CC1(C)[C@@H]2CC[C@]1(C)[C@H](C2)OP(O)(=O)OP(O)(O)=O ChemAxon formula C10H20O7P2 ChemAxon inchi InChI=1S/C10H20O7P2/c1-9(2)7-4-5-10(9,3)8(6-7)16-19(14,15)17-18(11,12)13/h7-8H,4-6H2,1-3H3,(H,14,15)(H2,11,12,13)/t7-,8+,10-/m1/s1 ChemAxon inchikey VZPAJODTZAAANV-KHQFGBGNSA-N ChemAxon polar_surface_area 113.29 ChemAxon refractivity 67.06 ChemAxon polarizability 39.28 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 5 ChemAxon donor_count 3 ChemAxon physiological_charge -2 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 93384 Specdb::MsMs 93385 Specdb::MsMs 93386 Specdb::MsMs 157134 Specdb::MsMs 157135 Specdb::MsMs 157136 Specdb::MsMs 3597403 Specdb::MsMs 3597404 Specdb::MsMs 3597405 Specdb::MsMs 3597406 Specdb::MsMs 3597407 Specdb::MsMs 3597408 15395 Common sage Type 1 specific Salvia officinalis 38868