1.0 2010-04-08 22:04:58 UTC 2025-11-18 22:31:23 UTC FDB001456 cis-Sabinene hydrate Cis-sabinene hydrate is a member of the class of compounds known as bicyclic monoterpenoids. Bicyclic monoterpenoids are monoterpenoids containing exactly 2 rings, which are fused to each other. Thus, cis-sabinene hydrate is considered to be an isoprenoid lipid molecule. Cis-sabinene hydrate is practically insoluble (in water) and an extremely weak acidic compound (based on its pKa). Cis-sabinene hydrate is a balsamic tasting compound and can be found in a number of food items such as sweet marjoram, spearmint, common sage, and pot marjoram, which makes cis-sabinene hydrate a potential biomarker for the consumption of these food products. (Z)-Sabinene hydrate C10H18O 154.2493 154.135765198 (1S,2R,5R)-2-methyl-5-(propan-2-yl)bicyclo[3.1.0]hexan-2-ol sabinene hydrate 15537-55-0 CC(C)[C@@]12C[C@@H]1[C@](C)(O)CC2 InChI=1S/C10H18O/c1-7(2)10-5-4-9(3,11)8(10)6-10/h7-8,11H,4-6H2,1-3H3/t8-,9-,10-/m1/s1 KXSDPILWMGFJMM-OPRDCNLKSA-N belongs to the class of organic compounds known as bicyclic monoterpenoids. These are monoterpenoids containing exactly 2 rings, which are fused to each other. Bicyclic monoterpenoids Organic compounds Lipids and lipid-like molecules Prenol lipids Monoterpenoids Aliphatic homopolycyclic compounds Cyclic alcohols and derivatives Hydrocarbon derivatives Tertiary alcohols Alcohol Aliphatic homopolycyclic compound Bicyclic monoterpenoid Cyclic alcohol Hydrocarbon derivative Organic oxygen compound Organooxygen compound Tertiary alcohol Thujane monoterpenoid Bicyclic monoterpenoids Bicyclic monoterpenoids Cyclic monoterpenes logp 2.12 ALOGPS logs -2.28 ALOGPS solubility 8.10e-01 g/l ALOGPS logp 1.89 ChemAxon pka_strongest_acidic 19.13 ChemAxon pka_strongest_basic -0.99 ChemAxon iupac (1S,2R,5R)-2-methyl-5-(propan-2-yl)bicyclo[3.1.0]hexan-2-ol ChemAxon average_mass 154.2493 ChemAxon mono_mass 154.135765198 ChemAxon smiles CC(C)[C@@]12C[C@@H]1[C@](C)(O)CC2 ChemAxon formula C10H18O ChemAxon inchi InChI=1S/C10H18O/c1-7(2)10-5-4-9(3,11)8(10)6-10/h7-8,11H,4-6H2,1-3H3/t8-,9-,10-/m1/s1 ChemAxon inchikey KXSDPILWMGFJMM-OPRDCNLKSA-N ChemAxon polar_surface_area 20.23 ChemAxon refractivity 45.55 ChemAxon polarizability 18.65 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 1 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 54966 Specdb::MsMs 54967 Specdb::MsMs 54968 Specdb::MsMs 151065 Specdb::MsMs 151066 Specdb::MsMs 151067 Specdb::MsMs 3597427 Specdb::MsMs 3597428 Specdb::MsMs 3597429 Specdb::MsMs 3597430 Specdb::MsMs 3597431 Specdb::MsMs 3597432 32314 Common oregano Type 1 specific Origanum vulgare 39352 2.3 2.3 2.3 mg/100 g Common sage Type 1 specific Salvia officinalis 38868 Cumin Type 1 specific Cuminum cyminum 52462 20.7 20.7 20.7 mg/100 g Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571 Nutmeg Type 1 specific Myristica fragrans 51089 Pepper (Spice) Type 1 specific Piper nigrum 13216 Pot marjoram Type 1 specific Origanum onites 452416 0.2 0.4 0.0 mg/100 g Rosemary Type 1 specific Rosmarinus officinalis 39367 0.02 0.02 0.02 mg/100 g Spearmint Type 1 specific Mentha spicata 29719 Sweet basil Type 1 specific Ocimum basilicum 39350 Sweet bay Type 1 specific Laurus nobilis 85223 Sweet marjoram Type 1 specific Origanum majorana 268884 Sweet orange Type 1 specific Citrus sinensis 2711 balsam balsamic