1.0 2010-04-08 22:04:59 UTC 2025-11-18 22:31:43 UTC FDB001503 Liriodenine Liriodenine, also known as oxoushinsunine or micheline b, is a member of the class of compounds known as aporphines. Aporphines are quinoline alkaloids containing the dibenzo[de,g]quinoline ring system or a dehydrogenated derivative thereof. Liriodenine is practically insoluble (in water) and a strong basic compound (based on its pKa). Liriodenine can be found in cherimoya and custard apple, which makes liriodenine a potential biomarker for the consumption of these food products. Liriodenine is a bio-active isolate of the Chinese medicinal herb Zanthoxylum nitidum . 8H-Benzo(g)-1,3-benzodioxolo(6,5,4-de)quinolin-8-one 8H-Benzo(g)-1,3-benzodioxolo(6,5,4-de)quinolin-8-one (9CI) 8H-Benzo[g]-1,3-benzodioxolo[6,5,4-de]quinolin-8-one Micheline b Oxoushinsunin Oxoushinsunine Spermatheridin Spermatheridine Ushinsunine, oxo- C17H9NO3 275.2583 275.058243159 3,5-dioxa-11-azapentacyclo[10.7.1.0²,⁶.0⁸,²⁰.0¹⁴,¹⁹]icosa-1(20),2(6),7,9,11,14(19),15,17-octaen-13-one 3,5-dioxa-11-azapentacyclo[10.7.1.0²,⁶.0⁸,²⁰.0¹⁴,¹⁹]icosa-1(20),2(6),7,9,11,14(19),15,17-octaen-13-one 475-75-2 O=C1C2=C(C=CC=C2)C2=C3C(C=CN=C13)=CC1=C2OCO1 InChI=1S/C17H9NO3/c19-16-11-4-2-1-3-10(11)14-13-9(5-6-18-15(13)16)7-12-17(14)21-8-20-12/h1-7H,8H2 MUMCCPUVOAUBAN-UHFFFAOYSA-N belongs to the class of organic compounds known as aporphines. These are quinoline alkaloids containing the dibenzo[de,g]quinoline ring system or a dehydrogenated derivative thereof. Aporphines Organic compounds Alkaloids and derivatives Aporphines Aromatic heteropolycyclic compounds Acetals Aryl ketones Azacyclic compounds Benzodioxoles Benzoquinolines Heteroaromatic compounds Hydrocarbon derivatives Isoquinolines and derivatives Naphthalenes Organic oxides Organonitrogen compounds Organopnictogen compounds Oxacyclic compounds Phenanthrenes and derivatives Pyridines and derivatives Acetal Aporphine Aromatic heteropolycyclic compound Aryl ketone Azacycle Benzenoid Benzodioxole Benzoquinoline Heteroaromatic compound Hydrocarbon derivative Isoquinoline Ketone Naphthalene Organic nitrogen compound Organic oxide Organic oxygen compound Organoheterocyclic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Oxacycle Phenanthrene Pyridine Quinoline alkaloid antibiotic cyclic ketone isoquinoline alkaloid organic heteropentacyclic compound oxacycle logp 2.74 ALOGPS logs -2.77 ALOGPS solubility 4.66e-01 g/l ALOGPS logp 2.89 ChemAxon pka_strongest_basic 3.47 ChemAxon iupac 3,5-dioxa-11-azapentacyclo[10.7.1.0²,⁶.0⁸,²⁰.0¹⁴,¹⁹]icosa-1(20),2(6),7,9,11,14(19),15,17-octaen-13-one ChemAxon average_mass 275.2583 ChemAxon mono_mass 275.058243159 ChemAxon smiles O=C1C2=C(C=CC=C2)C2=C3C(C=CN=C13)=CC1=C2OCO1 ChemAxon formula C17H9NO3 ChemAxon inchi InChI=1S/C17H9NO3/c19-16-11-4-2-1-3-10(11)14-13-9(5-6-18-15(13)16)7-12-17(14)21-8-20-12/h1-7H,8H2 ChemAxon inchikey MUMCCPUVOAUBAN-UHFFFAOYSA-N ChemAxon polar_surface_area 48.42 ChemAxon refractivity 75.4 ChemAxon polarizability 27.87 ChemAxon rotatable_bond_count 0 ChemAxon acceptor_count 4 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 72750 Specdb::MsMs 72751 Specdb::MsMs 72752 Specdb::MsMs 131742 Specdb::MsMs 131743 Specdb::MsMs 131744 Specdb::MsMs 3597604 Specdb::MsMs 3597605 Specdb::MsMs 3597606 Specdb::MsMs 3597607 Specdb::MsMs 3597608 Specdb::MsMs 3597609 Cherimoya Type 1 specific Annona cherimola 49314 Custard apple Type 1 specific Annona reticulata 301862