1.0 2010-04-08 22:05:00 UTC 2025-11-18 22:31:52 UTC FDB001526 Arctiopicrin Arctiopicrin belongs to germacranolides and derivatives class of compounds. Those are sesquiterpene lactones with a structure based on the germacranolide skeleton, characterized by a gamma lactone fused to a 1,7-dimethylcyclodec-1-ene moiety. Arctiopicrin is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). Arctiopicrin can be found in burdock, which makes arctiopicrin a potential biomarker for the consumption of this food product. Arctiopicrine C19H26O6 350.4061 350.172938564 (3aR,4S,11aR)-10-(hydroxymethyl)-6-methyl-3-methylidene-2-oxo-2H,3H,3aH,4H,5H,8H,9H,11aH-cyclodeca[b]furan-4-yl 3-hydroxy-2-methylpropanoate arctiopicrin 19889-01-1 CC(CO)C(=O)O[C@H]1C\C(C)=C\CC\C(CO)=C\[C@H]2OC(=O)C(=C)[C@H]12 InChI=1S/C19H26O6/c1-11-5-4-6-14(10-21)8-16-17(13(3)19(23)25-16)15(7-11)24-18(22)12(2)9-20/h5,8,12,15-17,20-21H,3-4,6-7,9-10H2,1-2H3/b11-5+,14-8-/t12?,15-,16+,17+/m0/s1 VOOFFTMORIBISQ-UMRVURNHSA-N belongs to the class of organic compounds known as germacranolides and derivatives. These are sesquiterpene lactones with a structure based on the germacranolide skeleton, characterized by a gamma lactone fused to a 1,7-dimethylcyclodec-1-ene moiety. Germacranolides and derivatives Organic compounds Lipids and lipid-like molecules Prenol lipids Terpene lactones Aliphatic heteropolycyclic compounds Beta hydroxy acids and derivatives Carbonyl compounds Dicarboxylic acids and derivatives Enoate esters Gamma butyrolactones Germacrane sesquiterpenoids Hydrocarbon derivatives Organic oxides Oxacyclic compounds Primary alcohols Tetrahydrofurans Alcohol Aliphatic heteropolycyclic compound Alpha,beta-unsaturated carboxylic ester Beta-hydroxy acid Carbonyl group Carboxylic acid derivative Carboxylic acid ester Dicarboxylic acid or derivatives Enoate ester Gamma butyrolactone Germacrane sesquiterpenoid Germacranolide Hydrocarbon derivative Hydroxy acid Lactone Organic oxide Organic oxygen compound Organoheterocyclic compound Organooxygen compound Oxacycle Primary alcohol Sesquiterpenoid Tetrahydrofuran Germacrenes germacranolide logp 1.53 ALOGPS logs -2.87 ALOGPS solubility 4.75e-01 g/l ALOGPS logp 1.59 ChemAxon pka_strongest_acidic 6.19 ChemAxon pka_strongest_basic -2.7 ChemAxon iupac (3aR,4S,11aR)-10-(hydroxymethyl)-6-methyl-3-methylidene-2-oxo-2H,3H,3aH,4H,5H,8H,9H,11aH-cyclodeca[b]furan-4-yl 3-hydroxy-2-methylpropanoate ChemAxon average_mass 350.4061 ChemAxon mono_mass 350.172938564 ChemAxon smiles CC(CO)C(=O)O[C@H]1C\C(C)=C\CC\C(CO)=C\[C@H]2OC(=O)C(=C)[C@H]12 ChemAxon formula C19H26O6 ChemAxon inchi InChI=1S/C19H26O6/c1-11-5-4-6-14(10-21)8-16-17(13(3)19(23)25-16)15(7-11)24-18(22)12(2)9-20/h5,8,12,15-17,20-21H,3-4,6-7,9-10H2,1-2H3/b11-5+,14-8-/t12?,15-,16+,17+/m0/s1 ChemAxon inchikey VOOFFTMORIBISQ-UMRVURNHSA-N ChemAxon polar_surface_area 93.06 ChemAxon refractivity 93.42 ChemAxon polarizability 36.35 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 4 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 53376 Specdb::MsMs 53377 Specdb::MsMs 53378 Specdb::MsMs 174981 Specdb::MsMs 174982 Specdb::MsMs 174983 Specdb::MsMs 3597676 Specdb::MsMs 3597677 Specdb::MsMs 3597678 Specdb::MsMs 3597679 Specdb::MsMs 3597680 Specdb::MsMs 3597681 Burdock Type 1 specific Arctium lappa 4217 Antibiotic 147 A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. Bitter 732 Gram(+)icide 962 A substance that kills or slows the growth of bacteria. Pesticide 1210 Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests.