1.0 2010-04-08 22:05:00 UTC 2025-11-18 22:31:56 UTC FDB001538 Tetramethoxyluteolin Tetramethoxyluteolin, also known as 3'4'57-tetramethoxyflavone or 3',4',5,7-tetramethyl-luteolin, is a member of the class of compounds known as 7-o-methylated flavonoids. 7-o-methylated flavonoids are flavonoids with methoxy groups attached to the C7 atom of the flavonoid backbone. Thus, tetramethoxyluteolin is considered to be a flavonoid lipid molecule. Tetramethoxyluteolin is practically insoluble (in water) and an extremely weak acidic compound (based on its pKa). Tetramethoxyluteolin can be found in mandarin orange (clementine, tangerine), which makes tetramethoxyluteolin a potential biomarker for the consumption of this food product. 2-(3,4-Dimethoxyphenyl)-5,7-dimethoxy-4H-1-benzopyran-4-one 3',4',5,7-Tetramethoxyflavone 3',4',5,7-Tetramethylluteolin 5,7,3',4'-Tetramethoxyflavone 5,7,3',4'-Tetramethylluteolin Anisopirol Luteolin 5,7,3',4'-tetramethyl ether Luteolin tetramethyl ether Luteolin tetramethylether Tetramethoxyluteolin C19H18O6 342.3426 342.110338308 2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-4H-chromen-4-one 2-(3,4-dimethoxyphenyl)-5,7-dimethoxychromen-4-one 855-97-0 COC1=CC2=C(C(=O)C=C(O2)C2=CC=C(OC)C(OC)=C2)C(OC)=C1 InChI=1S/C19H18O6/c1-21-12-8-17(24-4)19-13(20)10-15(25-18(19)9-12)11-5-6-14(22-2)16(7-11)23-3/h5-10H,1-4H3 CLXVBVLQKLQNRQ-UHFFFAOYSA-N belongs to the class of organic compounds known as 7-o-methylated flavonoids. These are flavonoids with methoxy groups attached to the C7 atom of the flavonoid backbone. 7-O-methylated flavonoids Organic compounds Phenylpropanoids and polyketides Flavonoids O-methylated flavonoids Aromatic heteropolycyclic compounds 3'-O-methylated flavonoids 4'-O-methylated flavonoids 5-O-methylated flavonoids Alkyl aryl ethers Anisoles Chromones Dimethoxybenzenes Flavones Heteroaromatic compounds Hydrocarbon derivatives Organic oxides Oxacyclic compounds Phenoxy compounds Pyranones and derivatives Vinylogous esters 1-benzopyran 3p-methoxyflavonoid-skeleton 4p-methoxyflavonoid-skeleton 5-methoxyflavonoid-skeleton 7-methoxyflavonoid-skeleton Alkyl aryl ether Anisole Aromatic heteropolycyclic compound Benzenoid Benzopyran Chromone Dimethoxybenzene Ether Flavone Heteroaromatic compound Hydrocarbon derivative Methoxybenzene Monocyclic benzene moiety O-dimethoxybenzene Organic oxide Organic oxygen compound Organoheterocyclic compound Organooxygen compound Oxacycle Phenol ether Phenoxy compound Pyran Pyranone Vinylogous ester Flavones and Flavonols logp 3.19 ALOGPS logs -4.53 ALOGPS solubility 1.00e-02 g/l ALOGPS logp 2.34 ChemAxon pka_strongest_acidic 15.41 ChemAxon pka_strongest_basic -4.3 ChemAxon iupac 2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-4H-chromen-4-one ChemAxon average_mass 342.3426 ChemAxon mono_mass 342.110338308 ChemAxon smiles COC1=CC2=C(C(=O)C=C(O2)C2=CC=C(OC)C(OC)=C2)C(OC)=C1 ChemAxon formula C19H18O6 ChemAxon inchi InChI=1S/C19H18O6/c1-21-12-8-17(24-4)19-13(20)10-15(25-18(19)9-12)11-5-6-14(22-2)16(7-11)23-3/h5-10H,1-4H3 ChemAxon inchikey CLXVBVLQKLQNRQ-UHFFFAOYSA-N ChemAxon polar_surface_area 63.22 ChemAxon refractivity 92.82 ChemAxon polarizability 36.05 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 6 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 78126 Specdb::MsMs 78127 Specdb::MsMs 78128 Specdb::MsMs 138393 Specdb::MsMs 138394 Specdb::MsMs 138395 Specdb::MsMs 3597706 Specdb::MsMs 3597707 Specdb::MsMs 3597708 Specdb::MsMs 3597709 Specdb::MsMs 3597710 Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571