1.0 2010-04-08 22:05:02 UTC 2025-11-18 22:32:11 UTC FDB001602 Xanthoangelol B Xanthoangelol b is a member of the class of compounds known as 3-prenylated chalcones. 3-prenylated chalcones are chalcones featuring a C5-isoprenoid unit at the 3-position. Thus, xanthoangelol b is considered to be a flavonoid lipid molecule. Xanthoangelol b is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). Xanthoangelol b can be found in angelica, which makes xanthoangelol b a potential biomarker for the consumption of this food product. C25H28O5 408.4868 408.193674006 (2E)-1-{2,4-dihydroxy-3-[(2E)-6-hydroxy-3,7-dimethylocta-2,7-dien-1-yl]phenyl}-3-(4-hydroxyphenyl)prop-2-en-1-one xanthoangelol B 132998-81-3 CC(=C)C(O)CC\C(C)=C\CC1=C(O)C=CC(C(=O)\C=C\C2=CC=C(O)C=C2)=C1O InChI=1S/C25H28O5/c1-16(2)22(27)13-5-17(3)4-11-20-24(29)15-12-21(25(20)30)23(28)14-8-18-6-9-19(26)10-7-18/h4,6-10,12,14-15,22,26-27,29-30H,1,5,11,13H2,2-3H3/b14-8+,17-4+ NCHZAFAGBAEJJJ-BAYITLGHSA-N belongs to the class of organic compounds known as 3-prenylated chalcones. These are chalcones featuring a C5-isoprenoid unit at the 3-position. 3-prenylated chalcones Organic compounds Phenylpropanoids and polyketides Linear 1,3-diarylpropanoids Chalcones and dihydrochalcones Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids 1-hydroxy-4-unsubstituted benzenoids 2'-Hydroxychalcones Acryloyl compounds Aryl ketones Benzoyl derivatives Cinnamylphenols Enones Fatty alcohols Hydrocarbon derivatives Hydroxycinnamic acids and derivatives Organic oxides Resorcinols Secondary alcohols Styrenes Vinylogous acids 1-hydroxy-2-unsubstituted benzenoid 1-hydroxy-4-unsubstituted benzenoid 2'-hydroxychalcone 3-prenylated chalcone Acryloyl-group Alcohol Alpha,beta-unsaturated ketone Aromatic homomonocyclic compound Aryl ketone Benzenoid Benzoyl Cinnamylphenol Enone Fatty acyl Fatty alcohol Hydrocarbon derivative Hydroxycinnamic acid or derivatives Ketone Monocyclic benzene moiety Organic oxide Organic oxygen compound Organooxygen compound Phenol Resorcinol Secondary alcohol Styrene Vinylogous acid Chalcones and dihydrochalcones logp 4.30 ALOGPS logs -4.60 ALOGPS solubility 1.03e-02 g/l ALOGPS logp 5.85 ChemAxon pka_strongest_acidic 7.57 ChemAxon pka_strongest_basic -1.4 ChemAxon iupac (2E)-1-{2,4-dihydroxy-3-[(2E)-6-hydroxy-3,7-dimethylocta-2,7-dien-1-yl]phenyl}-3-(4-hydroxyphenyl)prop-2-en-1-one ChemAxon average_mass 408.4868 ChemAxon mono_mass 408.193674006 ChemAxon smiles CC(=C)C(O)CC\C(C)=C\CC1=C(O)C=CC(C(=O)\C=C\C2=CC=C(O)C=C2)=C1O ChemAxon formula C25H28O5 ChemAxon inchi InChI=1S/C25H28O5/c1-16(2)22(27)13-5-17(3)4-11-20-24(29)15-12-21(25(20)30)23(28)14-8-18-6-9-19(26)10-7-18/h4,6-10,12,14-15,22,26-27,29-30H,1,5,11,13H2,2-3H3/b14-8+,17-4+ ChemAxon inchikey NCHZAFAGBAEJJJ-BAYITLGHSA-N ChemAxon polar_surface_area 97.99 ChemAxon refractivity 121.31 ChemAxon polarizability 46.12 ChemAxon rotatable_bond_count 9 ChemAxon acceptor_count 5 ChemAxon donor_count 4 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 64227 Specdb::MsMs 64228 Specdb::MsMs 64229 Specdb::MsMs 121332 Specdb::MsMs 121333 Specdb::MsMs 121334 Specdb::MsMs 3597827 Specdb::MsMs 3597828 Specdb::MsMs 3597829 Specdb::MsMs 3597830 Specdb::MsMs 3597831 Specdb::MsMs 3597832 Angelica Type 1 specific Angelica keiskei 357850