1.0 2010-04-08 22:05:05 UTC 2025-11-18 22:32:45 UTC FDB001744 3-Hydroxy-5-methoxystilbene-2-carboxylic acid 4-o-methylpinosylvic acid is a member of the class of compounds known as stilbenes. Stilbenes are organic compounds containing a 1,2-diphenylethylene moiety. Stilbenes (C6-C2-C6 ) are derived from the common phenylpropene (C6-C3) skeleton building block. The introduction of one or more hydroxyl groups to a phenyl ring lead to stilbenoids. 4-o-methylpinosylvic acid is practically insoluble (in water) and a moderately acidic compound (based on its pKa). 4-o-methylpinosylvic acid can be found in pulses, which makes 4-o-methylpinosylvic acid a potential biomarker for the consumption of this food product. C16H14O4 270.28 270.089208936 2-hydroxy-4-methoxy-6-[(E)-2-phenylethenyl]benzoic acid 2-hydroxy-4-methoxy-6-[(E)-2-phenylethenyl]benzoic acid 161582-47-4 COC1=CC(O)=C(C(O)=O)C(\C=C\C2=CC=CC=C2)=C1 InChI=1S/C16H14O4/c1-20-13-9-12(15(16(18)19)14(17)10-13)8-7-11-5-3-2-4-6-11/h2-10,17H,1H3,(H,18,19)/b8-7+ PICDNGANOHNCPT-BQYQJAHWSA-N belongs to the class of organic compounds known as stilbenes. These are organic compounds containing a 1,2-diphenylethylene moiety. Stilbenes (C6-C2-C6 ) are derived from the common phenylpropene (C6-C3) skeleton building block. The introduction of one or more hydroxyl groups to a phenyl ring lead to stilbenoids. Stilbenes Organic compounds Phenylpropanoids and polyketides Stilbenes Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids 1-hydroxy-4-unsubstituted benzenoids Alkyl aryl ethers Anisoles Benzoic acids Benzoyl derivatives Carboxylic acids Hydrocarbon derivatives Methoxybenzenes Methoxyphenols Monocarboxylic acids and derivatives Organic oxides P-methoxybenzoic acids and derivatives Phenoxy compounds Salicylic acids Styrenes Vinylogous acids 1-hydroxy-2-unsubstituted benzenoid 1-hydroxy-4-unsubstituted benzenoid Alkyl aryl ether Anisole Aromatic homomonocyclic compound Benzenoid Benzoic acid Benzoic acid or derivatives Benzoyl Carboxylic acid Carboxylic acid derivative Ether Hydrocarbon derivative Hydroxybenzoic acid Methoxybenzene Methoxyphenol Monocarboxylic acid or derivatives Monocyclic benzene moiety Organic oxide Organic oxygen compound Organooxygen compound P-methoxybenzoic acid or derivatives Phenol Phenol ether Phenoxy compound Salicylic acid Salicylic acid or derivatives Stilbene Styrene Vinylogous acid logp 3.44 ALOGPS logs -3.59 ALOGPS solubility 6.92e-02 g/l ALOGPS logp 4.16 ChemAxon pka_strongest_acidic 2.81 ChemAxon pka_strongest_basic -4.9 ChemAxon iupac 2-hydroxy-4-methoxy-6-[(E)-2-phenylethenyl]benzoic acid ChemAxon average_mass 270.28 ChemAxon mono_mass 270.089208936 ChemAxon smiles COC1=CC(O)=C(C(O)=O)C(\C=C\C2=CC=CC=C2)=C1 ChemAxon formula C16H14O4 ChemAxon inchi InChI=1S/C16H14O4/c1-20-13-9-12(15(16(18)19)14(17)10-13)8-7-11-5-3-2-4-6-11/h2-10,17H,1H3,(H,18,19)/b8-7+ ChemAxon inchikey PICDNGANOHNCPT-BQYQJAHWSA-N ChemAxon polar_surface_area 66.76 ChemAxon refractivity 77.21 ChemAxon polarizability 28.52 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 4 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 16751 Specdb::CMs 47002 Specdb::CMs 157364 Specdb::MsMs 69903 Specdb::MsMs 69904 Specdb::MsMs 69905 Specdb::MsMs 128283 Specdb::MsMs 128284 Specdb::MsMs 128285 Specdb::MsMs 452104 Specdb::MsMs 2337943 Specdb::MsMs 2337944 Specdb::MsMs 2337945 Specdb::MsMs 2624417 Specdb::MsMs 2624418 Specdb::MsMs 2624419 HMDB0040868 Pigeon pea Type 1 specific Cajanus cajan 3821