1.0 2010-04-08 22:05:06 UTC 2025-11-18 22:32:48 UTC FDB001755 Jacquinelin Jacquinelin, also known as 11,13-dihydro-8-deoxylactucin or jacquilenin, is a member of the class of compounds known as gamma butyrolactones. Gamma butyrolactones are compounds containing a gamma butyrolactone moiety, which consists of an aliphatic five-member ring with four carbon atoms, one oxygen atom, and bears a ketone group on the carbon adjacent to the oxygen atom. Jacquinelin is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). Jacquinelin can be found in chicory and endive, which makes jacquinelin a potential biomarker for the consumption of these food products. C15H18O4 262.301 262.120509064 (3S,3aS,9aS,9bS)-9-(hydroxymethyl)-3,6-dimethyl-2H,3H,3aH,4H,5H,7H,9aH,9bH-azuleno[4,5-b]furan-2,7-dione (3S,3aS,9aS,9bS)-9-(hydroxymethyl)-3,6-dimethyl-3H,3aH,4H,5H,9aH,9bH-azuleno[4,5-b]furan-2,7-dione 7726-34-3 [H][C@@]12CCC(C)=C3C(=O)C=C(CO)[C@]3([H])[C@@]1([H])OC(=O)[C@H]2C InChI=1S/C15H18O4/c1-7-3-4-10-8(2)15(18)19-14(10)13-9(6-16)5-11(17)12(7)13/h5,8,10,13-14,16H,3-4,6H2,1-2H3/t8-,10-,13-,14-/m0/s1 SNIFBMIPCYBVSS-LMVZTGKYSA-N belongs to the class of organic compounds known as gamma butyrolactones. Gamma butyrolactones are compounds containing a gamma butyrolactone moiety, which consists of an aliphatic five-member ring with four carbon atoms, one oxygen atom, and bears a ketone group on the carbon adjacent to the oxygen atom. Gamma butyrolactones Organic compounds Organoheterocyclic compounds Lactones Gamma butyrolactones Aliphatic heteropolycyclic compounds Carboxylic acid esters Hydrocarbon derivatives Ketones Monocarboxylic acids and derivatives Organic oxides Oxacyclic compounds Primary alcohols Tetrahydrofurans Alcohol Aliphatic heteropolycyclic compound Carbonyl group Carboxylic acid derivative Carboxylic acid ester Gamma butyrolactone Hydrocarbon derivative Ketone Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Oxacycle Primary alcohol Tetrahydrofuran logp 1.17 ALOGPS logs -2.70 ALOGPS solubility 5.19e-01 g/l ALOGPS logp 1.19 ChemAxon pka_strongest_acidic 13.66 ChemAxon pka_strongest_basic -2.8 ChemAxon iupac (3S,3aS,9aS,9bS)-9-(hydroxymethyl)-3,6-dimethyl-2H,3H,3aH,4H,5H,7H,9aH,9bH-azuleno[4,5-b]furan-2,7-dione ChemAxon average_mass 262.301 ChemAxon mono_mass 262.120509064 ChemAxon smiles [H][C@@]12CCC(C)=C3C(=O)C=C(CO)[C@]3([H])[C@@]1([H])OC(=O)[C@H]2C ChemAxon formula C15H18O4 ChemAxon inchi InChI=1S/C15H18O4/c1-7-3-4-10-8(2)15(18)19-14(10)13-9(6-16)5-11(17)12(7)13/h5,8,10,13-14,16H,3-4,6H2,1-2H3/t8-,10-,13-,14-/m0/s1 ChemAxon inchikey SNIFBMIPCYBVSS-LMVZTGKYSA-N ChemAxon polar_surface_area 63.6 ChemAxon refractivity 70.49 ChemAxon polarizability 27.85 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 3 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 92691 Specdb::MsMs 92692 Specdb::MsMs 92693 Specdb::MsMs 156357 Specdb::MsMs 156358 Specdb::MsMs 156359 Specdb::MsMs 3598351 Specdb::MsMs 3598352 Specdb::MsMs 3598353 Specdb::MsMs 3598354 Specdb::MsMs 3598355 Specdb::MsMs 3598356 Chicory Type 1 specific Cichorium intybus 13427 Endive Type 1 specific Cichorium endivia 114280