1.0 2010-04-08 22:05:09 UTC 2025-11-18 22:33:27 UTC FDB001893 1-Dehydro-[8]-gingerdione 1-dehydro-[8]-gingerdione belongs to hydroxycinnamic acids and derivatives class of compounds. Those are compounds containing an cinnamic acid (or a derivative thereof) where the benzene ring is hydroxylated. 1-dehydro-[8]-gingerdione is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). 1-dehydro-[8]-gingerdione can be found in ginger, which makes 1-dehydro-[8]-gingerdione a potential biomarker for the consumption of this food product. C19H26O4 318.4073 318.18310932 (1E)-1-(4-hydroxy-3-methoxyphenyl)dodec-1-ene-3,5-dione (1E)-1-(4-hydroxy-3-methoxyphenyl)dodec-1-ene-3,5-dione 748159-34-4 CCCCCCCC(=O)CC(=O)\C=C\C1=CC(OC)=C(O)C=C1 InChI=1S/C19H26O4/c1-3-4-5-6-7-8-16(20)14-17(21)11-9-15-10-12-18(22)19(13-15)23-2/h9-13,22H,3-8,14H2,1-2H3/b11-9+ QOJHXMDTWFYFRL-PKNBQFBNSA-N belongs to the class of organic compounds known as hydroxycinnamic acids and derivatives. Hydroxycinnamic acids and derivatives are compounds containing an cinnamic acid (or a derivative thereof) where the benzene ring is hydroxylated. Hydroxycinnamic acids and derivatives Organic compounds Phenylpropanoids and polyketides Cinnamic acids and derivatives Hydroxycinnamic acids and derivatives Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids Acryloyl compounds Alkyl aryl ethers Anisoles Beta-diketones Enones Hydrocarbon derivatives Ketones Methoxybenzenes Methoxyphenols Organic oxides Phenoxy compounds Styrenes 1,3-dicarbonyl compound 1,3-diketone 1-hydroxy-2-unsubstituted benzenoid Acryloyl-group Alkyl aryl ether Alpha,beta-unsaturated ketone Anisole Aromatic homomonocyclic compound Benzenoid Carbonyl group Enone Ether Hydrocarbon derivative Hydroxycinnamic acid or derivatives Ketone Methoxybenzene Methoxyphenol Monocyclic benzene moiety Organic oxide Organic oxygen compound Organooxygen compound Phenol Phenol ether Phenoxy compound Styrene logp 4.71 ALOGPS logs -4.73 ALOGPS solubility 5.90e-03 g/l ALOGPS logp 5.15 ChemAxon pka_strongest_acidic 8.52 ChemAxon pka_strongest_basic -4.7 ChemAxon iupac (1E)-1-(4-hydroxy-3-methoxyphenyl)dodec-1-ene-3,5-dione ChemAxon average_mass 318.4073 ChemAxon mono_mass 318.18310932 ChemAxon smiles CCCCCCCC(=O)CC(=O)\C=C\C1=CC(OC)=C(O)C=C1 ChemAxon formula C19H26O4 ChemAxon inchi InChI=1S/C19H26O4/c1-3-4-5-6-7-8-16(20)14-17(21)11-9-15-10-12-18(22)19(13-15)23-2/h9-13,22H,3-8,14H2,1-2H3/b11-9+ ChemAxon inchikey QOJHXMDTWFYFRL-PKNBQFBNSA-N ChemAxon polar_surface_area 63.6 ChemAxon refractivity 92.58 ChemAxon polarizability 36.58 ChemAxon rotatable_bond_count 11 ChemAxon acceptor_count 4 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 52851 Specdb::MsMs 52852 Specdb::MsMs 52853 Specdb::MsMs 176052 Specdb::MsMs 176053 Specdb::MsMs 176054 Specdb::MsMs 3599011 Specdb::MsMs 3599012 Specdb::MsMs 3599013 Specdb::MsMs 3599014 Specdb::MsMs 3599015 Specdb::MsMs 3599016 Ginger Type 1 specific Zingiber officinale 94328