1.0 2010-04-08 22:05:09 UTC 2025-11-18 22:33:28 UTC FDB001895 Dehydrogingerdione Dehydrogingerdione is a member of the class of compounds known as methoxyphenols. Methoxyphenols are compounds containing a methoxy group attached to the benzene ring of a phenol moiety. Dehydrogingerdione is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). Dehydrogingerdione can be found in ginger, which makes dehydrogingerdione a potential biomarker for the consumption of this food product. 6-dehydrogingerdione C17H22O4 290.3542 290.151809192 (1Z,3Z)-3-hydroxy-1-(4-hydroxy-3-methoxyphenyl)deca-1,3-dien-5-one (1Z,3Z)-3-hydroxy-1-(4-hydroxy-3-methoxyphenyl)deca-1,3-dien-5-one 189128-20-9 CCCCCC(=O)\C=C(/O)\C=C/C1=CC(OC)=C(O)C=C1 InChI=1S/C17H22O4/c1-3-4-5-6-14(18)12-15(19)9-7-13-8-10-16(20)17(11-13)21-2/h7-12,19-20H,3-6H2,1-2H3/b9-7-,15-12- FZWNRFAUDBWSKY-YUKZMVOFSA-N belongs to the class of organic compounds known as methoxyphenols. Methoxyphenols are compounds containing a methoxy group attached to the benzene ring of a phenol moiety. Methoxyphenols Organic compounds Benzenoids Phenols Methoxyphenols Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids Acryloyl compounds Alkyl aryl ethers Anisoles Enols Enones Hydrocarbon derivatives Ketones Methoxybenzenes Organic oxides Phenoxy compounds Styrenes Vinylogous acids 1-hydroxy-2-unsubstituted benzenoid Acryloyl-group Alkyl aryl ether Alpha,beta-unsaturated ketone Anisole Aromatic homomonocyclic compound Carbonyl group Enol Enone Ether Hydrocarbon derivative Ketone Methoxybenzene Methoxyphenol Monocyclic benzene moiety Organic oxide Organic oxygen compound Organooxygen compound Phenol ether Phenoxy compound Styrene Vinylogous acid logp 3.80 ALOGPS logs -3.83 ALOGPS solubility 4.27e-02 g/l ALOGPS logp 3.9 ChemAxon pka_strongest_acidic 8.46 ChemAxon pka_strongest_basic -4.8 ChemAxon iupac (1Z,3Z)-3-hydroxy-1-(4-hydroxy-3-methoxyphenyl)deca-1,3-dien-5-one ChemAxon average_mass 290.3542 ChemAxon mono_mass 290.151809192 ChemAxon smiles CCCCCC(=O)\C=C(/O)\C=C/C1=CC(OC)=C(O)C=C1 ChemAxon formula C17H22O4 ChemAxon inchi InChI=1S/C17H22O4/c1-3-4-5-6-14(18)12-15(19)9-7-13-8-10-16(20)17(11-13)21-2/h7-12,19-20H,3-6H2,1-2H3/b9-7-,15-12- ChemAxon inchikey FZWNRFAUDBWSKY-YUKZMVOFSA-N ChemAxon polar_surface_area 66.76 ChemAxon refractivity 85.7 ChemAxon polarizability 32.18 ChemAxon rotatable_bond_count 8 ChemAxon acceptor_count 4 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 93462 Specdb::MsMs 93463 Specdb::MsMs 93464 Specdb::MsMs 157239 Specdb::MsMs 157240 Specdb::MsMs 157241 Specdb::MsMs 3599023 Specdb::MsMs 3599024 Specdb::MsMs 3599025 Specdb::MsMs 3599026 Specdb::MsMs 3599027 Specdb::MsMs 3599028 Ginger Type 1 specific Zingiber officinale 94328 Anti prostaglandin 550 A chemical substance which inhibits the function of the endocrine glands, the biosynthesis of their secreted hormones, or the action of hormones upon their specific sites. Anti-inflammatory 370 A substance that reduces or suppresses inflammation.