1.0 2010-04-08 22:05:12 UTC 2025-11-18 22:34:20 UTC FDB002006 N-Isobutyl-2,4,8-decatrienamide Alkaloid from the roots of Achillea millefolium (yarrow). N-Isobutyl-2,4,8-decatrienamide is found in herbs and spices. 2,4,8-Decatrienoic acid isobutylamide N-(2-Methylpropyl)-2,4,8-decatrienamide, 9CI N-Isobutyl-2,4,8-decatrienamide C14H23NO 221.3385 221.177964363 (Z,2E,4Z,8Z)-N-(2-methylpropyl)deca-2,4,8-trienimidic acid (Z,2E,4Z,8Z)-N-(2-methylpropyl)deca-2,4,8-trienimidic acid 52657-13-3 C\C=C/CC\C=C/C=C/C(/O)=N/CC(C)C InChI=1S/C14H23NO/c1-4-5-6-7-8-9-10-11-14(16)15-12-13(2)3/h4-5,8-11,13H,6-7,12H2,1-3H3,(H,15,16)/b5-4-,9-8-,11-10+ OCUXKVCDBHKIIP-ZIVSJQOCSA-N belongs to the class of organic compounds known as n-acyl amines. N-acyl amines are compounds containing a fatty acid moiety linked to an amine group through an ester linkage. N-acyl amines Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty amides Aliphatic acyclic compounds Carbonyl compounds Hydrocarbon derivatives Organic oxides Organonitrogen compounds Organopnictogen compounds Secondary carboxylic acid amides Aliphatic acyclic compound Carbonyl group Carboxamide group Carboxylic acid derivative Hydrocarbon derivative N-acyl-amine Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Secondary carboxylic acid amide logp 4.71 ALOGPS logs -4.66 ALOGPS solubility 4.89e-03 g/l ALOGPS logp 4.34 ChemAxon pka_strongest_acidic 8.5 ChemAxon pka_strongest_basic 5.89 ChemAxon iupac (Z,2E,4Z,8Z)-N-(2-methylpropyl)deca-2,4,8-trienimidic acid ChemAxon average_mass 221.3385 ChemAxon mono_mass 221.177964363 ChemAxon smiles C\C=C/CC\C=C/C=C/C(/O)=N/CC(C)C ChemAxon formula C14H23NO ChemAxon inchi InChI=1S/C14H23NO/c1-4-5-6-7-8-9-10-11-14(16)15-12-13(2)3/h4-5,8-11,13H,6-7,12H2,1-3H3,(H,15,16)/b5-4-,9-8-,11-10+ ChemAxon inchikey OCUXKVCDBHKIIP-ZIVSJQOCSA-N ChemAxon polar_surface_area 32.59 ChemAxon refractivity 73.79 ChemAxon polarizability 27.57 ChemAxon rotatable_bond_count 7 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 23860 Specdb::CMs 41810 Specdb::CMs 162947 Specdb::MsMs 94617 Specdb::MsMs 94618 Specdb::MsMs 94619 Specdb::MsMs 158682 Specdb::MsMs 158683 Specdb::MsMs 158684 Specdb::MsMs 2403740 Specdb::MsMs 2403741 Specdb::MsMs 2403742 Specdb::MsMs 2535779 Specdb::MsMs 2535780 Specdb::MsMs 2535781 HMDB30188 #<Reference:0x000055ce3207c6e0> Herbs and Spices Unknown generic