1.0 2010-04-08 22:05:17 UTC 2025-11-18 22:35:52 UTC FDB002240 (E)-Ribosylzeatin Isolated from many plants. (E)-Ribosylzeatin is found in many foods, some of which are cauliflower, chicory, chayote, and wild carrot. (E)-Ribosylzeatin 9-(b-D-Ribofuranosyl)zeatin 9-Ribosyl-trans-zeatin Ribosylzeatin Trans-zeatin riboside Zeatin riboside Zeatin-9-beta-D-ribofuranoside C15H21N5O5 351.3577 351.154268807 2-(6-{[(2E)-4-hydroxy-3-methylbut-2-en-1-yl]amino}-9H-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol 2-(6-{[(2E)-4-hydroxy-3-methylbut-2-en-1-yl]amino}purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol 6025-53-2 C\C(CO)=C/CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O InChI=1S/C15H21N5O5/c1-8(4-21)2-3-16-13-10-14(18-6-17-13)20(7-19-10)15-12(24)11(23)9(5-22)25-15/h2,6-7,9,11-12,15,21-24H,3-5H2,1H3,(H,16,17,18)/b8-2+ GOSWTRUMMSCNCW-KRXBUXKQSA-N belongs to the class of organic compounds known as purine nucleosides. Purine nucleosides are compounds comprising a purine base attached to a ribosyl or deoxyribosyl moiety. Purine nucleosides Organic compounds Nucleosides, nucleotides, and analogues Purine nucleosides Aromatic heteropolycyclic compounds 6-alkylaminopurines Aminopyrimidines and derivatives Azacyclic compounds Glycosylamines Heteroaromatic compounds Hydrocarbon derivatives Imidolactams N-substituted imidazoles Organopnictogen compounds Oxacyclic compounds Pentoses Primary alcohols Secondary alcohols Secondary alkylarylamines Tetrahydrofurans 6-alkylaminopurine 6-aminopurine Alcohol Amine Aminopyrimidine Aromatic heteropolycyclic compound Azacycle Azole Glycosyl compound Heteroaromatic compound Hydrocarbon derivative Imidazole Imidazopyrimidine Imidolactam Monosaccharide N-glycosyl compound N-substituted imidazole Organic nitrogen compound Organic oxygen compound Organoheterocyclic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Oxacycle Pentose monosaccharide Primary alcohol Purine Purine nucleoside Pyrimidine Secondary alcohol Secondary aliphatic/aromatic amine Secondary amine Tetrahydrofuran logp -0.39 ALOGPS logs -1.82 ALOGPS solubility 5.27e+00 g/l ALOGPS melting_point Mp 180-182° logp -1.7 ChemAxon pka_strongest_acidic 12.45 ChemAxon pka_strongest_basic 4.85 ChemAxon iupac 2-(6-{[(2E)-4-hydroxy-3-methylbut-2-en-1-yl]amino}-9H-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol ChemAxon average_mass 351.3577 ChemAxon mono_mass 351.154268807 ChemAxon smiles C\C(CO)=C/CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O ChemAxon formula C15H21N5O5 ChemAxon inchi InChI=1S/C15H21N5O5/c1-8(4-21)2-3-16-13-10-14(18-6-17-13)20(7-19-10)15-12(24)11(23)9(5-22)25-15/h2,6-7,9,11-12,15,21-24H,3-5H2,1H3,(H,16,17,18)/b8-2+ ChemAxon inchikey GOSWTRUMMSCNCW-KRXBUXKQSA-N ChemAxon polar_surface_area 145.78 ChemAxon refractivity 89.58 ChemAxon polarizability 36.29 ChemAxon rotatable_bond_count 6 ChemAxon acceptor_count 9 ChemAxon donor_count 5 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 16073 Specdb::CMs 41896 Specdb::CMs 150260 Specdb::NmrOneD 161389 Specdb::NmrOneD 161390 Specdb::NmrOneD 161391 Specdb::NmrOneD 161392 Specdb::NmrOneD 161393 Specdb::NmrOneD 161394 Specdb::NmrOneD 161395 Specdb::NmrOneD 161396 Specdb::NmrOneD 161397 Specdb::NmrOneD 161398 Specdb::NmrOneD 161399 Specdb::NmrOneD 161400 Specdb::NmrOneD 161401 Specdb::NmrOneD 161402 Specdb::NmrOneD 161403 Specdb::NmrOneD 161404 Specdb::NmrOneD 161405 Specdb::NmrOneD 161406 Specdb::NmrOneD 161407 Specdb::NmrOneD 161408 Specdb::MsMs 62952 Specdb::MsMs 62953 Specdb::MsMs 62954 Specdb::MsMs 119793 Specdb::MsMs 119794 Specdb::MsMs 119795 Specdb::MsMs 2815939 Specdb::MsMs 2815940 Specdb::MsMs 2815941 Specdb::MsMs 2892467 Specdb::MsMs 2892468 Specdb::MsMs 2892469 HMDB0030388 Alfalfa Type 1 specific Medicago sativa 3879 Carrot Type 1 specific Daucus carota ssp. sativus 79200 Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 Chayote Type 1 specific Sechium edule 184140 Chestnut Type 1 specific Castanea 21019 Chicory Type 1 specific Cichorium intybus 13427 Coconut Type 1 specific Cocos nucifera 13894 Common bean Type 1 specific Phaseolus vulgaris 3885 Common beet Type 1 specific Beta vulgaris 161934 Common pea Type 1 specific Pisum sativum 3888 Common wheat Type 1 specific Triticum aestivum 4565 Corn Type 1 specific Zea mays 4577 Garden tomato (var.) Type 1 specific Solanum lycopersicum var. lycopersicum 397755 Gram bean Type 1 specific Vigna mungo 3915 Green bean Type 1 specific Phaseolus vulgaris 3885 Hyacinth bean Type 1 specific Lablab purpureus 35936 Kiwi Type 1 specific Actinidia chinensis 3625 Mango Type 1 specific Mangifera indica 29780 Pear Type 1 specific Pyrus communis 23211 Potato Type 1 specific Solanum tuberosum 4113 Rice Type 1 specific Oryza sativa 4530 Sour cherry Type 1 specific Prunus cerasus 140311 Soy bean Type 1 specific Glycine max 3847 Sweet potato Type 1 specific Ipomoea batatas 4120 Turnip Type 1 specific Brassica rapa var. rapa 51350 Wild carrot Type 1 specific Daucus carota 4039 Yellow wax bean Type 1 specific Phaseolus vulgaris 3885