1.0 2010-04-08 22:05:18 UTC 2025-11-18 22:35:57 UTC FDB002251 (±)-Tryptophan Dietary supplement, nutrient Tryptophan is one of the 20 standard amino acids, as well as an essential amino acid in the human diet. Only the L-stereoisomer of tryptophan is used in structural or enzyme proteins, but the D-stereoisomer is occasionally found in naturally produced peptides (for example, the marine venom peptide contryphan). (+-)-Tryptophan (+/-)-2-Amino-3-(3-indolyl)propionic acid (+/-)-alpha-Amino-3-indolepropionic acid DL-α-Amino-3-indolepropionic acid DL-2-Amino-3-indolepropionic acid DL-3beta-Indolylalanine DL-alpha-Amino-3-indolepropionic acid DL-Tryptophan Racemic tryptophan C11H12N2O2 204.2252 204.089877638 2-amino-3-(1H-indol-3-yl)propanoic acid tryptophan(.) 54-12-6 NC(CC1=CNC2=C1C=CC=C2)C(O)=O InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15) QIVBCDIJIAJPQS-UHFFFAOYSA-N belongs to the class of organic compounds known as indolyl carboxylic acids and derivatives. Indolyl carboxylic acids and derivatives are compounds containing a carboxylic acid chain (of at least 2 carbon atoms) linked to an indole ring. Indolyl carboxylic acids and derivatives Organic compounds Organoheterocyclic compounds Indoles and derivatives Indolyl carboxylic acids and derivatives Aromatic heteropolycyclic compounds 3-alkylindoles Alpha amino acids Amino acids Aralkylamines Azacyclic compounds Benzenoids Carbonyl compounds Carboxylic acids Heteroaromatic compounds Hydrocarbon derivatives Monoalkylamines Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Substituted pyrroles 3-alkylindole Alpha-amino acid Alpha-amino acid or derivatives Amine Amino acid Amino acid or derivatives Aralkylamine Aromatic heteropolycyclic compound Azacycle Benzenoid Carbonyl group Carboxylic acid Carboxylic acid derivative Heteroaromatic compound Hydrocarbon derivative Indole Indolyl carboxylic acid derivative Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary aliphatic amine Primary amine Pyrrole Substituted pyrrole alpha-amino acid aminoalkylindole aromatic amino acid logp -1.10 ALOGPS logs -2.18 ALOGPS solubility 1.36e+00 g/l ALOGPS melting_point Mp 293° logp -1.1 ChemAxon pka_strongest_acidic 2.54 ChemAxon pka_strongest_basic 9.4 ChemAxon iupac 2-amino-3-(1H-indol-3-yl)propanoic acid ChemAxon average_mass 204.2252 ChemAxon mono_mass 204.089877638 ChemAxon smiles NC(CC1=CNC2=C1C=CC=C2)C(O)=O ChemAxon formula C11H12N2O2 ChemAxon inchi InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15) ChemAxon inchikey QIVBCDIJIAJPQS-UHFFFAOYSA-N ChemAxon polar_surface_area 79.11 ChemAxon refractivity 56.2 ChemAxon polarizability 21.19 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 3 ChemAxon donor_count 3 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 1860 Specdb::CMs 1880 Specdb::CMs 13015 Specdb::CMs 31954 Specdb::CMs 31955 Specdb::CMs 41903 Specdb::CMs 158523 Specdb::EiMs 728 Specdb::NmrOneD 2598 Specdb::NmrOneD 3301 Specdb::NmrOneD 161429 Specdb::NmrOneD 161430 Specdb::NmrOneD 161431 Specdb::NmrOneD 161432 Specdb::NmrOneD 161433 Specdb::NmrOneD 161434 Specdb::NmrOneD 161435 Specdb::NmrOneD 161436 Specdb::NmrOneD 161437 Specdb::NmrOneD 161438 Specdb::NmrOneD 161439 Specdb::NmrOneD 161440 Specdb::NmrOneD 161441 Specdb::NmrOneD 161442 Specdb::NmrOneD 161443 Specdb::NmrOneD 161444 Specdb::NmrOneD 161445 Specdb::NmrOneD 161446 Specdb::NmrOneD 161447 Specdb::NmrOneD 161448 Specdb::MsMs 21128 Specdb::MsMs 21129 Specdb::MsMs 21130 Specdb::MsMs 22679 Specdb::MsMs 22680 Specdb::MsMs 22681 Specdb::MsMs 438700 Specdb::MsMs 438701 Specdb::MsMs 438702 Specdb::MsMs 438703 Specdb::MsMs 438704 Specdb::MsMs 438705 Specdb::MsMs 438706 Specdb::MsMs 438707 Specdb::MsMs 438708 Specdb::MsMs 438709 Specdb::MsMs 438710 Specdb::MsMs 438711 Specdb::MsMs 438712 Specdb::MsMs 438713 Specdb::MsMs 438714 Specdb::MsMs 438715 Specdb::MsMs 438716 Specdb::MsMs 438717 Specdb::MsMs 438718 HMDB30396 27897 #<Reference:0x000055ce30678f78> #<Reference:0x000055ce30678dc0> Adzuki bean Type 1 specific Vigna angularis 3914 0.0 0.0 0.0 mg/100 g Agar Type 1 specific Eucheuma 31444 0.0 0.0 0.0 mg/100 g Alfalfa Type 1 specific Medicago sativa 3879 0.0 0.0 0.0 mg/100 g Allium Type 1 specific Allium 4678 15.630875 74.0 0.167 mg/100 g Almond Type 1 specific Prunus dulcis 3755 106.75 210.0 3.5 mg/100 g Anatidae Type 1 specific Anatidae 8830 122.725714 320.0 2.33 mg/100 g Anchovy Type 1 specific Engraulidae 43062 71.165 140.0 2.33 mg/100 g Anguilliformes Type 1 specific Anguilliformes 7933 83.875 170.0 2.67 mg/100 g Apple Type 1 specific Malus pumila 283210 2.0333 8.0 0.017 mg/100 g Apricot Type 1 specific Prunus armeniaca 36596 5.422167 14.0 0.15 mg/100 g Arabica coffee Type 1 specific Coffea arabica 13443 22.010583 230.0 0.0 mg/100 g Asparagus Type 1 specific Asparagus officinalis 4686 7.752125 19.0 0.217 mg/100 g Atlantic halibut Type 1 specific Hippoglossus hippoglossus 8267 101.665 200.0 3.33 mg/100 g Atlantic wolffish Type 1 specific Anarhichas lupus 8204 86.415 170.0 2.83 mg/100 g Avocado Type 1 specific Persea americana 3435 10.675 21.0 0.35 mg/100 g Baby food Type 2 specific 0.0 0.0 0.0 mg/100 g Bamboo shoots Type 1 specific Phyllostachys edulis 38705 0.0 0.0 0.0 mg/100 g Banana Type 1 specific Musa acuminata 4641 Barley Type 1 specific Hordeum vulgare 4513 61.0 120.0 2.0 mg/100 g Beer Type 2 specific 2.37225 6.0 0.05 mg/100 g Bilberry Type 1 specific Vaccinium myrtillus 180763 5.5915 11.0 0.183 mg/100 g Biscuit Type 2 specific 28.720333 95.0 0.517 mg/100 g Bitter gourd Type 1 specific Momordica charantia 3673 Black salsify Type 1 specific Scorzonera hispanica 114289 0.15 0.3 0.0 mg/100 g Black tea Type 1 208.425 820.0 0.0 mg/100 g Black walnut Type 1 specific Juglans nigra 16719 86.415 170.0 2.83 mg/100 g Blackcurrant Type 1 specific Ribes nigrum 78511 3.0501 13.0 0.067 mg/100 g Blue whiting Type 1 specific Micromesistius poutassou 81636 0.0 0.0 0.0 mg/100 g Brazil nut Type 1 specific Bertholletia excelsa 3645 81.335 160.0 2.67 mg/100 g Breakfast cereal Type 2 specific 22.875 210.0 0.0 mg/100 g Broccoli Type 1 specific Brassica oleracea var. italica 36774 14.497167 59.0 0.0 mg/100 g Brussel sprouts Type 1 specific Brassica oleracea var. gemmifera 178616 24.65425 55.0 0.617 mg/100 g Burbot Type 1 specific Lota lota 69944 0.45 0.9 0.0 mg/100 g Butter Type 2 specific 3.5585 7.0 0.117 mg/100 g Buttermilk Type 2 specific 24.14575 48.0 0.783 mg/100 g Carp bream Type 1 specific Abramis brama 38527 1.25 2.5 0.0 mg/100 g Carrot Type 1 specific Daucus carota ssp. sativus 79200 4.320833 13.0 0.1 mg/100 g Casein Type 2 specific 660.85 1300.0 21.7 mg/100 g Cashew nut Type 1 specific Anacardium occidentale 171929 127.0825 260.0 4.0 mg/100 g Cassava Type 1 specific Manihot esculenta 3983 9.6585 19.0 0.317 mg/100 g Catfish Type 1 specific Siluriformes 7995 86.415 170.0 2.83 mg/100 g Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 137.383723 2000.0 0.0 mg/100 g Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 11.2849 35.0 0.0 mg/100 g Celeriac Type 1 specific Apium graveolens var. rapaceum 278110 7.625 15.0 0.25 mg/100 g Celery leaves Type 1 specific Apium graveolens var. secalinum 941588 7.625 15.0 0.25 mg/100 g Cetacea (Dolphin, Porpoise, Whale) Type 1 specific Cetacea 9721 0.0 0.0 0.0 mg/100 g Chanterelle Type 1 specific Cantharellus cibarius 36066 0.15 0.3 0.0 mg/100 g Charr Type 1 specific Salvelinus 8033 0.0 0.0 0.0 mg/100 g Chayote Type 1 specific Sechium edule 184140 5.5915 11.0 0.183 mg/100 g Cheese Type 2 specific 157.410692 530.0 0.783 mg/100 g Cherimoya Type 1 specific Annona cherimola 49314 0.0 0.0 0.0 mg/100 g Cherry tomato Type 1 specific Solanum lycopersicum var. cerasiforme 195583 Chervil Type 1 specific Anthriscus cerefolium 40888 21.09575 54.0 0.483 mg/100 g Chestnut Type 1 specific Castanea 21019 11.1835 22.0 0.367 mg/100 g Chewing gum Type 2 specific 0.0 0.0 0.0 mg/100 g Chicken Type 1 specific Gallus gallus 9031 116.916071 330.0 3.0 mg/100 g Chickpea Type 1 specific Cicer arietinum 3827 81.335 160.0 2.67 mg/100 g Chicory Type 1 specific Cichorium intybus 13427 10.675 25.0 0.283 mg/100 g Chinese cabbage Type 1 specific Brassica rapa 3711 6.6085 13.0 0.217 mg/100 g Chives Type 1 specific Allium schoenoprasum 74900 17.7915 35.0 0.583 mg/100 g Chocolate Type 2 specific 36.7016 92.0 0.883 mg/100 g Chocolate spread Type 2 specific 0.0 0.0 0.0 mg/100 g Cinnamon Type 1 specific Cinnamomum 13428 0.0 0.0 0.0 mg/100 g Clawed lobster Type 1 specific Nephropidae 6704 108.445 220.0 3.5 mg/100 g Clupeinae (Herring, Sardine, Sprat) Type 1 specific Clupeinae 7948 52.86625 230.0 0.0 mg/100 g Cocoa butter Type 2 specific 0.0 0.0 0.0 mg/100 g Cocoa powder Type 2 specific 91.5 240.0 1.33 mg/100 g Coconut Type 1 specific Cocos nucifera 13894 24.78125 110.0 0.0 mg/100 g Coffee Type 1 generic Coffea 13442 22.010583 230.0 0.0 mg/100 g Cold cut Type 2 specific 82.605 220.0 0.0 mg/100 g Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 96.5825 200.0 3.0 mg/100 g Common bean Type 1 specific Phaseolus vulgaris 3885 41.874188 250.0 0.283 mg/100 g Common buckwheat Type 1 specific Fagopyrum esculentum 3617 47.02125 130.0 0.0 mg/100 g Common cabbage Type 1 specific Brassica oleracea 3712 9.912167 71.0 0.067 mg/100 g Common dab Type 1 specific Limanda limanda 27771 0.0 0.0 0.0 mg/100 g Common ling Type 1 specific Molva molva 163112 0.0 0.0 0.0 mg/100 g Common mushroom Type 1 specific Agaricus bisporus 5341 15.50425 33.0 0.467 mg/100 g Common octopus Type 1 specific Octopus vulgaris 6645 0.0 0.0 0.0 mg/100 g Common pea Type 1 specific Pisum sativum 3888 33.55 180.0 0.0 mg/100 g Coriander Type 1 specific Coriandrum sativum 4047 0.0 0.0 0.0 mg/100 g Corn Type 1 specific Zea mays 4577 13.442167 62.0 0.0 mg/100 g Cottonseed Type 1 specific Gossypium 3633 0.0 0.0 0.0 mg/100 g Crab Type 1 specific Brachyura 6752 127.081667 260.0 3.83 mg/100 g Cracker Type 2 specific 55.915 110.0 1.83 mg/100 g Crayfish Type 1 specific Astacidea 6712 1.165 2.33 0.0 mg/100 g Cream Type 2 specific 17.8485 44.0 0.383 mg/100 g Crisp bread Type 2 specific 71.166 170.0 2.0 mg/100 g Cucumber Type 1 specific Cucumis sativus 3659 0.756917 5.0 0.0 mg/100 g Cucurbita Type 1 specific Cucurbita 3660 4.82925 13.0 0.1 mg/100 g Curry powder Type 2 specific 0.0 0.0 0.0 mg/100 g Daikon radish Type 1 specific Raphanus sativus var. longipinnatus 41679 1.2875 5.0 0.0 mg/100 g Dandelion Type 1 specific Taraxacum officinale 50225 0.0 0.0 0.0 mg/100 g Date Type 1 specific Phoenix dactylifera 42345 27.45 54.0 0.9 mg/100 g Dill Type 1 specific Anethum graveolens 40922 16.775 66.0 0.0 mg/100 g Domestic pig Type 1 specific Sus scrofa domestica 9825 95.484586 320.0 0.0 mg/100 g Dragée Type 2 specific 0.0 0.0 0.0 mg/100 g Dried milk Type 2 specific 218.585 490.0 6.17 mg/100 g Dumpling Type 2 specific 0.0 0.0 0.0 mg/100 g Eggplant Type 1 specific Solanum melongena 4111 2.03325 8.0 0.0 mg/100 g Eggs Unknown generic 156.802692 1000.0 2.67 mg/100 g Elderberry Type 1 specific Sambucus 4201 5.591833 13.0 0.167 mg/100 g Endive Type 1 specific Cichorium endivia 114280 2.5415 5.0 0.083 mg/100 g European plum Type 1 specific Prunus domestica 3758 3.30425 9.0 0.067 mg/100 g Fennel Type 1 specific Foeniculum vulgare 48038 63.6425 250.0 0.0 mg/100 g Fig Type 1 specific Ficus carica 3494 12.030667 39.0 0.1 mg/100 g Fish oil Type 1 0.0 0.0 0.0 mg/100 g Flatfish Type 1 specific Pleuronectiformes 8252 71.165 140.0 2.33 mg/100 g Flaxseed Type 1 specific Linum usitatissimum 4006 101.6675 400.0 0.0 mg/100 g French plantain Type 1 specific Musa X paradisiaca 89151 7.625 15.0 0.25 mg/100 g Fruit gum Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit juice Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit preserve Type 2 specific 0.0 0.0 0.0 mg/100 g Gadiformes Type 1 specific Gadiformes 8043 0.0 0.0 0.0 mg/100 g Gadus (Common cod) Type 1 specific Gadus 8048 45.386679 240.0 0.0 mg/100 g Garden cress Type 1 specific Lepidium sativum 33125 20.3335 40.0 0.667 mg/100 g Garden rhubarb Type 1 specific Rheum rhabarbarum 3621 5.5915 11.0 0.183 mg/100 g Garden tomato Type 1 specific Solanum lycopersicum 4081 12.899188 100.0 0.117 mg/100 g Garfish Type 1 specific Belone belone 129037 122.0 240.0 4.0 mg/100 g Garlic Type 1 specific Allium sativum 4682 62.78 180.0 1.12 mg/100 g Gelatin Type 2 specific 0.0 0.0 0.0 mg/100 g Gelatin dessert Type 2 specific 2.0335 4.0 0.067 mg/100 g Ginger Type 1 specific Zingiber officinale 94328 6.1 12.0 0.2 mg/100 g Globe artichoke Type 1 specific Cynara scolymus 59895 0.0 0.0 0.0 mg/100 g Gooseberry Type 1 specific Ribes uva-crispa 135518 4.575 9.0 0.15 mg/100 g Grape Type 1 specific Vitis 3603 1.14375 7.0 0.0 mg/100 g Grape wine Type 2 specific 0.0 0.0 0.0 mg/100 g Grapefruit Type 1 specific Citrus X paradisi 37656 2.03325 6.0 0.033 mg/100 g Green bell pepper Type 1 specific Capsicum annuum 4072 5.0 5.0 5.0 mg/100 g Green grape Type 1 Green onion Type 1 Green tea Type 1 208.425 820.0 0.0 mg/100 g Green zucchini Type 1 specific Cucurbita pepo var. cylindrica 10.0 10.0 10.0 mg/100 g Greenland halibut/turbot Type 1 specific Reinhardtius hippoglossoides 111784 16.945 100.0 0.0 mg/100 g Groundcherry Type 1 specific Physalis 24663 0.0 0.0 0.0 mg/100 g Guava Type 1 specific Psidium guajava 120290 4.0665 8.0 0.133 mg/100 g Haddock Type 1 specific Melanogrammus aeglefinus 8056 83.028333 280.0 0.0 mg/100 g Hard wheat Type 1 specific Triticum durum 4567 0.0 0.0 0.0 mg/100 g Hazelnut Type 1 specific Corylus 13450 96.585 190.0 3.17 mg/100 g Herbal tea Type 1 208.425 820.0 0.0 mg/100 g Horseradish Type 1 specific Armoracia rusticana 3704 12.2 39.0 0.15 mg/100 g Hot chocolate Type 2 specific 25.0355 50.0 0.817 mg/100 g Ice cream Type 2 specific 11.4316 56.0 0.0 mg/100 g Italian sweet red pepper Type 1 specific Capsicum annuum 4072 12.0 12.0 12.0 mg/100 g Jerusalem artichoke Type 1 specific Helianthus tuberosus 4233 7.1165 14.0 0.233 mg/100 g Kale Type 1 specific Brassica napus var. pabularia 15.504 35.0 0.433 mg/100 g Kefir Type 2 specific 23.8915 47.0 0.783 mg/100 g Ketchup Type 2 specific 4.06675 16.0 0.0 mg/100 g Kiwi Type 1 specific Actinidia chinensis 3625 6.1 12.0 0.2 mg/100 g Kohlrabi Type 1 specific Brassica oleracea var. gongylodes 109379 5.0835 10.0 0.167 mg/100 g Kombu Type 1 specific Saccharina japonica 88149 0.0 0.0 0.0 mg/100 g Kumquat Type 1 specific Fortunella 2706 0.0 0.0 0.0 mg/100 g Lake trout Type 1 specific Salvelinus namaycush 8040 0.0 0.0 0.0 mg/100 g Lard Type 2 specific 0.0 0.0 0.0 mg/100 g Leavening agent Type 2 specific 123.27 440.0 1.0 mg/100 g Leek Type 1 specific Allium porrum 9.15 18.0 0.3 mg/100 g Lemon Type 1 specific Citrus limon 2708 0.338833 2.0 0.0 mg/100 g Lemon sole Type 1 specific Microstomus kitt 106175 101.6675 210.0 3.17 mg/100 g Lentils Type 1 generic Lens culinaris 3864 31.77125 250.0 0.0 mg/100 g Lettuce Type 1 specific Lactuca sativa 4236 5.59175 15.0 0.15 mg/100 g Lichee Type 1 specific Litchi chinensis 151069 3.5585 7.0 0.117 mg/100 g Lime Type 1 specific Citrus aurantiifolia 159033 1.525 3.0 0.05 mg/100 g Lingonberry Type 1 specific Vaccinium vitis-idaea 180772 2.5415 8.0 0.033 mg/100 g Liquor Type 2 specific 2.541688 40.0 0.0 mg/100 g Liquorice Type 2 specific 3.177125 25.0 0.0 mg/100 g Loganberry Type 1 specific Rubus loganobaccus 0.0 0.0 0.0 mg/100 g Loquat Type 1 specific Eriobotrya japonica 32224 2.5415 5.0 0.083 mg/100 g Lumpsucker Type 1 specific Cyclopteridae 8101 0.0 0.0 0.0 mg/100 g Malus (Crab apple) Type 1 specific Malus 3749 2.0335 4.0 0.067 mg/100 g Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571 1.525 4.0 0.033 mg/100 g Mango Type 1 specific Mangifera indica 29780 4.0665 8.0 0.133 mg/100 g Margarine Type 2 specific 3.981917 11.0 0.0 mg/100 g Margarine-like spread Type 2 specific 2.5415 5.0 0.083 mg/100 g Marine mussel Type 1 specific Mytilidae 6547 115.223333 310.0 2.5 mg/100 g Marshmallow Type 2 specific 0.0 0.0 0.0 mg/100 g Marzipan Type 2 specific 27.9575 110.0 0.0 mg/100 g Meat bouillon Type 2 specific 13.532 100.0 0.0 mg/100 g Meatball Type 2 specific 0.0 0.0 0.0 mg/100 g Meringue Type 2 specific 0.0 0.0 0.0 mg/100 g Mikan Type 1 Citrus unshiu Milk (Cow) Type 2 specific 20.767688 47.0 0.0 mg/100 g Milk (Human) Type 2 specific 0.283333 0.7 0.0 mg/100 g Milk (Other mammals) Type 2 specific 22.3665 44.0 0.733 mg/100 g Millet Type 1 specific Panicum miliaceum 4540 55.9175 120.0 1.67 mg/100 g Miso Type 2 specific 1.05 2.1 0.0 mg/100 g Mountain hare Type 1 specific Lepus timidus 62621 2.0 4.0 0.0 mg/100 g Mung bean Type 1 specific Vigna radiata 157791 75.48675 260.0 0.617 mg/100 g Muskmelon Type 1 specific Cucumis melo 3656 1.01675 4.0 0.017 mg/100 g Mustard Type 2 specific 3.05 12.0 0.0 mg/100 g Nectarine Type 1 specific Prunus persica var. nucipersica 323851 2.5415 5.0 0.083 mg/100 g Northern pike Type 1 specific Esox lucius 8010 2.5 5.0 0.0 mg/100 g Norway haddock Type 1 specific Sebastes viviparus 394708 0.0 0.0 0.0 mg/100 g Norway lobster Type 1 specific Nephrops norvegicus 6829 111.835 220.0 3.67 mg/100 g Norway pout Type 1 specific Trisopterus esmarkii 80723 0.0 0.0 0.0 mg/100 g Nutmeg Type 1 specific Myristica fragrans 51089 0.0 0.0 0.0 mg/100 g Oat Type 1 specific Avena sativa 4498 68.65375 180.0 0.0 mg/100 g Oil palm Type 1 specific Elaeis 51952 0.0 0.0 0.0 mg/100 g Okra Type 1 specific Abelmoschus esculentus 455045 8.6415 17.0 0.283 mg/100 g Olive Type 1 specific Olea europaea 4146 1.14375 5.0 0.0 mg/100 g Orange bell pepper Type 1 specific Capsicum annuum 4072 Other alcoholic beverage Type 2 specific 0.0 0.0 0.0 mg/100 g Other animal fat Type 2 specific 13.725 54.0 0.0 mg/100 g Other bread Type 2 specific 4.931667 76.0 0.0 mg/100 g Other bread product Type 2 specific 39.395 110.0 0.75 mg/100 g Other candy Type 2 specific 0.0 0.0 0.0 mg/100 g Other dish Type 2 specific 52.528333 110.0 1.67 mg/100 g Other fermented milk Type 2 specific 24.90825 51.0 0.783 mg/100 g Other fish product Type 2 specific 0.0 0.0 0.0 mg/100 g Other frozen dessert Type 2 specific 0.0 0.0 0.0 mg/100 g Other fruit product Type 2 specific 17.281 34.0 0.562 mg/100 g Other snack food Type 2 specific 0.0 0.0 0.0 mg/100 g Oyster mushroom Type 1 specific Pleurotus ostreatus 5322 44.225 87.0 1.45 mg/100 g Pacific ocean perch Type 1 specific Sebastes alutus 72055 0.0 0.0 0.0 mg/100 g Pak choy Type 1 specific Brassica rapa var. chinensis 93385 7.625 15.0 0.25 mg/100 g Papaya Type 1 specific Carica papaya 3649 4.575 9.0 0.15 mg/100 g Parsley Type 1 specific Petroselinum crispum 4043 19.825 56.0 0.367 mg/100 g Parsnip Type 1 specific Pastinaca sativa 4041 10.675 21.0 0.35 mg/100 g Passion fruit Type 1 specific Passiflora edulis 78168 0.0 0.0 0.0 mg/100 g Pasta Type 2 specific 54.9 140.0 0.9 mg/100 g Pastry Type 2 specific 12.247545 67.0 0.0 mg/100 g Pate Type 2 specific 76.25 150.0 2.5 mg/100 g Peach Type 1 specific Prunus persica 3760 5.422167 23.0 0.033 mg/100 g Peanut Type 1 specific Arachis hypogaea 3818 110.5625 380.0 0.0 mg/100 g Pear Type 1 specific Pyrus communis 23211 1.525 3.0 0.05 mg/100 g Pecan nut Type 1 specific Carya illinoinensis 32201 48.123333 97.0 1.55 mg/100 g Pepper Type 1 specific Capsicum annuum 4072 4.865429 26.0 0.0 mg/100 g Pepper (Spice) Type 1 specific Piper nigrum 13216 0.0 0.0 0.0 mg/100 g Perciformes Type 1 specific Perciformes 8111 1.5 3.0 0.0 mg/100 g Persimmon Type 1 specific Diospyros 13492 6.1 12.0 0.2 mg/100 g Pikeperch Type 1 specific Sander lucioperca 283035 0.4415 0.883 0.0 mg/100 g Pine nut Type 1 specific Pinus 3337 55.915 110.0 1.83 mg/100 g Pineapple Type 1 specific Ananas comosus 4615 1.779125 6.0 0.0 mg/100 g Pistachio Type 1 specific Pistacia vera 55513 142.3325 290.0 4.5 mg/100 g Pizza Type 2 specific 22.027667 47.0 0.633 mg/100 g Pleuronectidae (Dab, Halibut, Plaice) Type 1 specific Pleuronectidae 8256 28.805 170.0 0.0 mg/100 g Pollock Type 1 specific Pollachius 8059 1.36 4.33 0.0 mg/100 g Pomegranate Type 1 specific Punica granatum 22663 0.0 0.0 0.0 mg/100 g Poppy Type 1 specific Papaver 3468 127.085 250.0 4.17 mg/100 g Potato Type 1 specific Solanum tuberosum 4113 31.72 170.0 0.0 mg/100 g Prickly pear Type 1 specific Opuntia 106975 0.0 0.0 0.0 mg/100 g Prunus (Cherry, Plum) Type 1 specific Prunus 3754 2.2875 7.0 0.05 mg/100 g Quince Type 1 specific Cydonia oblonga 36610 0.0 0.0 0.0 mg/100 g Rabbit Type 1 specific Leporidae 9979 142.335 280.0 4.67 mg/100 g Rainbow trout Type 1 specific Oncorhynchus mykiss 8022 2.6575 6.3 0.0 mg/100 g Rape Type 1 specific Brassica napus var. napus 138011 0.0 0.0 0.0 mg/100 g Red beetroot Type 1 specific Beta vulgaris var. rubra 3.219333 9.0 0.083 mg/100 g Red bell pepper Type 1 specific Capsicum annuum 4072 7000.0 7000.0 7000.0 mg/100 g Red tea Type 1 208.425 820.0 0.0 mg/100 g Redcurrant Type 1 specific Ribes rubrum 175228 3.43125 15.0 0.0 mg/100 g Remoulade Type 2 specific 0.1 0.4 0.0 mg/100 g Rice Type 1 specific Oryza sativa 4530 47.656438 190.0 0.0 mg/100 g Robusta coffee Type 1 specific Coffea canephora 49390 22.010583 230.0 0.0 mg/100 g Rock ptarmigan Type 1 specific Lagopus muta 64668 1.95 3.9 0.0 mg/100 g Rose hip Type 1 specific Rosa 3764 0.3805 2.0 0.0 mg/100 g Rubus (Blackberry, Raspberry) Type 1 specific Rubus 23216 4.429786 15.0 0.0 mg/100 g Rye Type 1 specific Secale cereale 4550 33.549 110.0 0.0 mg/100 g Rye bread Type 2 specific 8.953529 78.0 0.0 mg/100 g Safflower Type 1 specific Carthamus tinctorius 4222 0.0 0.0 0.0 mg/100 g Salad dressing Type 2 specific 3.770292 70.0 0.0 mg/100 g Salmonidae (Salmon, Trout) Type 1 specific Salmonidae 8015 97.905 230.0 1.55 mg/100 g Salt Type 2 specific 0.0 0.0 0.0 mg/100 g Sauce Type 2 specific 0.0 0.0 0.0 mg/100 g Sausage Type 2 specific 57.142353 230.0 0.0 mg/100 g Savoy cabbage Type 1 specific Brassica oleracea var. sabauda 1216010 10.1665 20.0 0.333 mg/100 g Scombridae (Bonito, Mackerel, Tuna) Type 1 specific Scombridae 8224 95.3125 210.0 2.5 mg/100 g Semolina Type 2 specific 55.915 110.0 1.83 mg/100 g Sesame Type 1 specific Sesamum orientale 4182 164.36 500.0 0.0 mg/100 g Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 84.156667 200.0 2.33 mg/100 g Sherry Type 2 specific 0.0 0.0 0.0 mg/100 g Shrimp Type 1 specific Caridea 6694 110.14 270.0 3.17 mg/100 g Snail Type 1 specific Gastropoda 6448 0.0 0.0 0.0 mg/100 g Soft drink Type 2 specific 0.0 0.0 0.0 mg/100 g Sorrel Type 1 specific Rumex acetosa 41241 0.0 0.0 0.0 mg/100 g Soup Type 2 specific 8.1335 16.0 0.267 mg/100 g Soy bean Type 1 specific Glycine max 3847 92.686667 520.0 0.0 mg/100 g Soy milk Type 2 specific 0.0 0.0 0.0 mg/100 g Soy sauce Type 2 specific 45.75 90.0 1.5 mg/100 g Spinach Type 1 specific Spinacia oleracea 3562 19.31675 42.0 0.567 mg/100 g Spiny dogfish Type 1 specific Squalus acanthias 7797 0.0 0.0 0.0 mg/100 g Spirit Type 2 specific 0.0 0.0 0.0 mg/100 g Star fruit Type 1 specific Averrhoa carambola 28974 4.0665 8.0 0.133 mg/100 g Strawberry Type 1 specific Fragaria X ananassa 3747 2.922875 8.0 0.067 mg/100 g Sturgeon Type 1 specific Acipenseridae 7900 0.0 0.0 0.0 mg/100 g Sugar Type 2 specific 0.0 0.0 0.0 mg/100 g Sugar substitute Type 2 specific 0.0 0.0 0.0 mg/100 g Sunflower Type 1 specific Helianthus annuus 4232 0.0 0.0 0.0 mg/100 g Swede Type 1 specific Brassica napus 3708 7.1165 14.0 0.233 mg/100 g Sweet orange Type 1 specific Citrus sinensis 2711 1.863833 6.0 0.033 mg/100 g Sweet potato Type 1 specific Ipomoea batatas 4120 12.877833 29.0 0.367 mg/100 g Swiss chard Type 1 specific Beta vulgaris ssp. cicla 1527200 8.6415 17.0 0.283 mg/100 g Syrup Type 2 specific 0.0 0.0 0.0 mg/100 g Tallow Type 2 specific 79.638333 190.0 1.83 mg/100 g Tamarind Type 1 specific Tamarindus indica 58860 9.15 18.0 0.3 mg/100 g Tea Type 1 specific Camellia sinensis 4442 138.95 820.0 0.0 mg/100 g Thistle Type 1 specific Cirsium 41549 0.0 0.0 0.0 mg/100 g Thunnus Type 1 specific Thunnus 8234 134.71 310.0 3.17 mg/100 g Toffee Type 2 specific 6.1 24.0 0.0 mg/100 g Tofu Type 2 specific 0.65 1.3 0.0 mg/100 g True frog Type 1 specific Ranidae 8397 1.35 2.7 0.0 mg/100 g True seal Type 1 specific Phocidae 9709 0.0 0.0 0.0 mg/100 g Turbot Type 1 specific Scophthalmus maximus 52904 91.5 180.0 3.0 mg/100 g Turkey Type 1 specific Meleagris gallopavo 9103 82.605 220.0 0.0 mg/100 g Turnip Type 1 specific Brassica rapa var. rapa 51350 4.0665 8.0 0.133 mg/100 g Unclassified food or beverage Type 2 specific 0.0 0.0 0.0 mg/100 g Vaccinium (Blueberry, Cranberry, Huckleberry) Type 1 specific Vaccinium 13749 1.27075 3.0 0.033 mg/100 g Vegetable juice Type 2 specific 0.1815 0.363 0.0 mg/100 g Vermouth Type 2 specific 0.0 0.0 0.0 mg/100 g Walnut Type 1 specific Juglans 16718 0.0 0.0 0.0 mg/100 g Water Type 2 specific 0.0 0.0 0.0 mg/100 g Watercress Type 1 specific Rorippa nasturtium-aquaticum 135518 11.1835 22.0 0.367 mg/100 g Watermelon Type 1 specific Citrullus lanatus 3654 4.575 9.0 0.15 mg/100 g Wheat Type 1 specific Triticum 4564 68.987857 340.0 0.0 mg/100 g Wheat bread Type 2 specific 25.073947 110.0 0.0 mg/100 g Whey Type 2 specific 71.6745 210.0 0.217 mg/100 g Whisky Type 2 specific 0.0 0.0 0.0 mg/100 g White bread Type 1 0.7 1.4 0.0 mg/100 g Whitefish Type 1 specific Coregonus 27772 1.25 2.5 0.0 mg/100 g Whiting Type 1 specific Merlangius merlangus 8058 1.665 3.33 0.0 mg/100 g Wild celery Type 1 specific Apium graveolens 4045 5.0835 10.0 0.167 mg/100 g Yam Type 1 specific Dioscorea 4672 6.1 12.0 0.2 mg/100 g Yellow bell pepper Type 1 specific Capsicum annuum 4072 Ymer Type 2 specific 44.9875 90.0 1.45 mg/100 g Yogurt Type 2 specific 18.6052 52.0 0.0 mg/100 g