1.0 2010-04-08 22:05:20 UTC 2019-11-26 02:57:20 UTC FDB002338 Methyl tetradecanoate Flavour ingredient Fatty acids, C10-16, Me esters FEMA 2722 Metholeneat 2495 Methyl myristate METHYL MYRISTATE, 99.5% Methyl myristylate Methyl n-tetradecanoate Methyl tetradecanoate Methyl tetradecanoic acid Myristic acid methyl ester Myristic acid, methyl ester Myristic acid, methyl ester (8CI) Tetradecanoic acid, methyl ester Uniphat A50 C15H30O2 242.3975 242.224580204 methyl tetradecanoate methyl myristate 124-10-7 CCCCCCCCCCCCCC(=O)OC InChI=1S/C15H30O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17-2/h3-14H2,1-2H3 ZAZKJZBWRNNLDS-UHFFFAOYSA-N belongs to the class of organic compounds known as fatty acid methyl esters. Fatty acid methyl esters are compounds containing a fatty acid that is esterified with a methyl group. They have the general structure RC(=O)OR', where R=fatty aliphatic tail or organyl group and R'=methyl group. Fatty acid methyl esters Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acid esters Aliphatic acyclic compounds Carbonyl compounds Hydrocarbon derivatives Methyl esters Monocarboxylic acids and derivatives Organic oxides Aliphatic acyclic compound Carbonyl group Carboxylic acid derivative Carboxylic acid ester Fatty acid methyl ester Hydrocarbon derivative Methyl ester Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Wax monoesters Liquid logp 6.38 ALOGPS logs -5.97 ALOGPS solubility 2.59e-04 g/l ALOGPS melting_point Mp 18.5° logp 5.51 ChemAxon pka_strongest_basic -7 ChemAxon iupac methyl tetradecanoate ChemAxon average_mass 242.3975 ChemAxon mono_mass 242.224580204 ChemAxon smiles CCCCCCCCCCCCCC(=O)OC ChemAxon formula C15H30O2 ChemAxon inchi InChI=1S/C15H30O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17-2/h3-14H2,1-2H3 ChemAxon inchikey ZAZKJZBWRNNLDS-UHFFFAOYSA-N ChemAxon polar_surface_area 26.3 ChemAxon refractivity 72.65 ChemAxon polarizability 32.14 ChemAxon rotatable_bond_count 13 ChemAxon acceptor_count 1 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 1390 Specdb::CMs 2855 Specdb::CMs 27306 Specdb::CMs 28226 Specdb::CMs 28244 Specdb::CMs 28637 Specdb::CMs 31607 Specdb::CMs 32312 Specdb::CMs 157055 Specdb::MsMs 60426 Specdb::MsMs 60427 Specdb::MsMs 60428 Specdb::MsMs 116742 Specdb::MsMs 116743 Specdb::MsMs 116744 Specdb::MsMs 2663860 Specdb::MsMs 2663861 Specdb::MsMs 2663862 Specdb::MsMs 3015474 Specdb::MsMs 3015475 Specdb::MsMs 3015476 HMDB30469 #<Reference:0x000055ce32d49f08> Blackberry Type 1 specific Rubus Evergreen blackberry Type 1 specific Rubus laciniatus fatty orris petal waxy