1.0 2010-04-08 22:05:25 UTC 2020-02-24 19:10:32 UTC FDB002561 Cryptochlorogenic acid Constituent of coffee and sunflowers. Cryptochlorogenic acid is found in many foods, some of which are arabica coffee, highbush blueberry, cereals and cereal products, and robusta coffee. 4-(3,4-Dihydroxycinnamoyl)quinate 4-(3,4-Dihydroxycinnamoyl)quinic acid 4-Caffeoylquinate 4-Caffeoylquinic acid 4-O-(e)-Caffeoylquinate 4-O-(e)-Caffeoylquinic acid 4-O-Caffeoylquinate 4-O-Caffeoylquinic acid Cryptochlorogenate Cryptochlorogenic acid C16H18O9 354.3087 354.095082174 (1S,3R,4S,5R)-4-{[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}-1,3,5-trihydroxycyclohexane-1-carboxylic acid (1S,3R,4S,5R)-4-{[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}-1,3,5-trihydroxycyclohexane-1-carboxylic acid 905-99-7 O[C@@H]1C[C@@](O)(C[C@@H](O)[C@H]1OC(=O)\C=C\C1=CC(O)=C(O)C=C1)C(O)=O InChI=1S/C16H18O9/c17-9-3-1-8(5-10(9)18)2-4-13(21)25-14-11(19)6-16(24,15(22)23)7-12(14)20/h1-5,11-12,14,17-20,24H,6-7H2,(H,22,23)/b4-2+/t11-,12-,14-,16+/m1/s1 GYFFKZTYYAFCTR-JUHZACGLSA-N belongs to the class of organic compounds known as quinic acids and derivatives. Quinic acids and derivatives are compounds containing a quinic acid moiety (or a derivative thereof), which is a cyclitol made up of a cyclohexane ring that bears four hydroxyl groups at positions 1,3.4, and 5, as well as a carboxylic acid at position 1. Quinic acids and derivatives Organic compounds Organic oxygen compounds Organooxygen compounds Alcohols and polyols Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids 1-hydroxy-4-unsubstituted benzenoids Alpha hydroxy acids and derivatives Carbonyl compounds Carboxylic acids Catechols Cinnamic acid esters Coumaric acids and derivatives Cyclohexanols Dicarboxylic acids and derivatives Enoate esters Fatty acid esters Hydrocarbon derivatives Organic oxides Polyols Styrenes Tertiary alcohols 1-hydroxy-2-unsubstituted benzenoid 1-hydroxy-4-unsubstituted benzenoid Alpha,beta-unsaturated carboxylic ester Alpha-hydroxy acid Aromatic homomonocyclic compound Benzenoid Carbonyl group Carboxylic acid Carboxylic acid derivative Carboxylic acid ester Catechol Cinnamic acid ester Cinnamic acid or derivatives Coumaric acid or derivatives Cyclohexanol Dicarboxylic acid or derivatives Enoate ester Fatty acid ester Fatty acyl Hydrocarbon derivative Hydroxy acid Hydroxycinnamic acid or derivatives Monocyclic benzene moiety Organic oxide Phenol Polyol Quinic acid Secondary alcohol Styrene Tertiary alcohol cinnamate ester cyclitol carboxylic acid logp 0.17 ALOGPS logs -2.06 ALOGPS solubility 3.12e+00 g/l ALOGPS melting_point Mp 182-184° logp -0.27 ChemAxon pka_strongest_acidic 3.39 ChemAxon pka_strongest_basic -3.2 ChemAxon iupac (1S,3R,4S,5R)-4-{[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}-1,3,5-trihydroxycyclohexane-1-carboxylic acid ChemAxon average_mass 354.3087 ChemAxon mono_mass 354.095082174 ChemAxon smiles O[C@@H]1C[C@@](O)(C[C@@H](O)[C@H]1OC(=O)\C=C\C1=CC(O)=C(O)C=C1)C(O)=O ChemAxon formula C16H18O9 ChemAxon inchi InChI=1S/C16H18O9/c17-9-3-1-8(5-10(9)18)2-4-13(21)25-14-11(19)6-16(24,15(22)23)7-12(14)20/h1-5,11-12,14,17-20,24H,6-7H2,(H,22,23)/b4-2+/t11-,12-,14-,16+/m1/s1 ChemAxon inchikey GYFFKZTYYAFCTR-JUHZACGLSA-N ChemAxon polar_surface_area 164.75 ChemAxon refractivity 83.23 ChemAxon polarizability 34.16 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 8 ChemAxon donor_count 6 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 2254 Specdb::CMs 16162 Specdb::CMs 31608 Specdb::CMs 42060 Specdb::CMs 134712 Specdb::CMs 142446 Specdb::MsMs 96414 Specdb::MsMs 96415 Specdb::MsMs 96416 Specdb::MsMs 160893 Specdb::MsMs 160894 Specdb::MsMs 160895 Specdb::MsMs 374129 Specdb::MsMs 374130 Specdb::MsMs 2256535 Specdb::MsMs 2258074 Specdb::MsMs 2258482 Specdb::MsMs 2273379 Specdb::MsMs 2273380 Specdb::MsMs 2273381 Specdb::MsMs 3069018 Specdb::MsMs 3069019 Specdb::MsMs 3069020 Specdb::NmrOneD 17702 Specdb::NmrOneD 17703 Specdb::NmrOneD 17704 Specdb::NmrOneD 17705 Specdb::NmrOneD 17706 Specdb::NmrOneD 17707 Specdb::NmrOneD 17708 Specdb::NmrOneD 17709 Specdb::NmrOneD 17710 Specdb::NmrOneD 17711 Specdb::NmrOneD 17712 Specdb::NmrOneD 17713 Specdb::NmrOneD 17714 Specdb::NmrOneD 17715 Specdb::NmrOneD 17716 Specdb::NmrOneD 17717 Specdb::NmrOneD 17718 Specdb::NmrOneD 17719 Specdb::NmrOneD 17720 Specdb::NmrOneD 17721 HMDB30653 #<Reference:0x000055ce302a8060> Apple Type 1 specific Malus pumila 283210 0.542857 0.542857136 0.542857136 mg/100 g Apricot Type 1 specific Prunus armeniaca 36596 0.0 0.0 0.0 mg/100 g Arabica coffee Type 1 specific Coffea arabica 13443 46.301334 60.292999268 19.006002426 mg/100 g Asian pear Type 1 specific Pyrus pyrifolia 3767 Beer Type 2 specific 0.007833 0.015666666 0.0 mg/100 g Black tea Type 1 1.206832 1.206832307 1.206832307 mg/100 g Blackcurrant Type 1 specific Ribes nigrum 78511 0.366667 0.366666675 0.366666675 mg/100 g Breakfast cereal Type 2 specific Carrot Type 1 specific Daucus carota ssp. sativus 79200 0.119 0.119000003 0.119000003 mg/100 g Cereals and cereal products Unknown generic Coffee Type 1 generic Coffea 13442 59.948999 60.292999268 59.604999542 mg/100 g Coffee and coffee products Unknown generic Common grape Type 1 specific Vitis vinifera 29760 Eggplant Type 1 specific Solanum melongena 4111 European plum Type 1 specific Prunus domestica 3758 16.325 31.249999523 1.399999976 mg/100 g Garden tomato (var.) Type 1 specific Solanum lycopersicum var. lycopersicum 397755 1.17 1.16999994 1.16999994 mg/100 g Gooseberry Type 1 specific Ribes uva-crispa 135518 0.0 0.0 0.0 mg/100 g Grape wine Type 2 specific 0.0 0.0 0.0 mg/100 g Green tea Type 1 1.206832 1.206832307 1.206832307 mg/100 g Highbush blueberry Type 1 specific Vaccinium corymbosum 69266 0.35 0.350000001 0.350000001 mg/100 g Jostaberry Type 1 specific Ribes × nidigrolaria 0.8 0.800000012 0.800000012 mg/100 g Loquat Type 1 specific Eriobotrya japonica 32224 1.992857 1.992857141 1.992857141 mg/100 g Peach (var.) Type 1 specific Prunus persica var. persica 323852 0.0 0.0 0.0 mg/100 g Pear Type 1 specific Pyrus communis 23211 0.0 0.0 0.0 mg/100 g Potato Type 1 specific Solanum tuberosum 4113 Quince Type 1 specific Cydonia oblonga 36610 0.4469 0.617142852 0.202307697 mg/100 g Red raspberry Type 1 specific Rubus idaeus 32247 0.0 0.0 0.0 mg/100 g Redcurrant Type 1 specific Ribes rubrum 175228 0.0 0.0 0.0 mg/100 g Robusta coffee Type 1 specific Coffea canephora 49390 52.121 60.292999268 36.465000153 mg/100 g Rubus (Blackberry, Raspberry) Type 1 specific Rubus 23216 0.1 0.100000001 0.100000001 mg/100 g Rye bread Type 2 specific 0.0 0.0 0.0 mg/100 g Sour cherry Type 1 specific Prunus cerasus 140311 0.266667 0.266666671 0.266666671 mg/100 g Strawberry Type 1 specific Fragaria X ananassa 3747 0.0 0.0 0.0 mg/100 g Sweet cherry Type 1 specific Prunus avium 42229 0.766667 0.766666651 0.766666651 mg/100 g Tea Type 1 specific Camellia sinensis 4442 1.206832 1.206832307 1.206832307 mg/100 g Yali pear Type 1 specific Pyrus × bretschneideri Hepatoprotective 981 Any compound that is able to prevent damage to the liver.