1.0 2010-04-08 22:05:26 UTC 2025-11-18 22:38:31 UTC FDB002589 trans-o-Coumaric acid Occurs in many plants e.g. Melilotus officinalis (sweet clover) Coumaric acid is a hydroxycinnamic acid, an organic compound that is a hydroxy derivative of cinnamic acid. There are three isomers, o-coumaric acid, m-coumaric acid, and p-coumaric acid, that differ by the position of the hydroxy substitution of the phenyl group. p-Coumaric acid is the most abundant isomer of the three in nature. trans-o-Coumaric acid is found in green vegetables. (2E)-3-(2-Hydroxyphenyl)-2-propenoic acid (2E)-3-(2-Hydroxyphenyl)acrylic acid (2E)-3-(2-Hydroxyphenyl)prop-2-enoic acid (E)-2-Hydroxycinnamic acid (E)-3-(2-Hydroxyphenyl)-2-propenoic acid (E)-3-(2-Hydroxyphenyl)prop-2-enoic acid (E)-o-Hydroxycinnamic acid 2-Propenoic acid, 3-(2-hydroxyphenyl)-, (2E)- 2-Propenoic acid, 3-(2-hydroxyphenyl)-, (E)- (9CI) Cinnamic acid, o-hydroxy-, (E)- o-Hydroxy-trans-cinnamate o-Hydroxy-trans-cinnamic acid trans-2-Coumaric acid trans-2-Hydroxycinnamate trans-2-Hydroxycinnamic acid trans-o-Coumarate trans-o-Hydroxycinnamate trans-o-Hydroxycinnamic acid C9H8O3 164.158 164.047344122 (2E)-3-(2-hydroxyphenyl)prop-2-enoic acid O-coumaric acid 614-60-8 OC(=O)\C=C\C1=CC=CC=C1O InChI=1S/C9H8O3/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-6,10H,(H,11,12)/b6-5+ PMOWTIHVNWZYFI-AATRIKPKSA-N belongs to the class of organic compounds known as hydroxycinnamic acids. Hydroxycinnamic acids are compounds containing an cinnamic acid where the benzene ring is hydroxylated. Hydroxycinnamic acids Organic compounds Phenylpropanoids and polyketides Cinnamic acids and derivatives Hydroxycinnamic acids and derivatives Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids 1-hydroxy-4-unsubstituted benzenoids Carbonyl compounds Carboxylic acids Cinnamic acids Coumaric acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Styrenes 1-hydroxy-2-unsubstituted benzenoid 1-hydroxy-4-unsubstituted benzenoid Aromatic homomonocyclic compound Benzenoid Carbonyl group Carboxylic acid Carboxylic acid derivative Cinnamic acid Coumaric acid Coumaric acid or derivatives Hydrocarbon derivative Hydroxycinnamic acid Monocarboxylic acid or derivatives Monocyclic benzene moiety Organic oxide Organic oxygen compound Organooxygen compound Phenol Styrene 2-coumaric acid Monolignols phenols logp 1.90 ALOGPS logs -2.15 ALOGPS solubility 1.15e+00 g/l ALOGPS melting_point Mp 207-208° dec. logp 1.83 ChemAxon pka_strongest_acidic 4.04 ChemAxon pka_strongest_basic -6 ChemAxon iupac (2E)-3-(2-hydroxyphenyl)prop-2-enoic acid ChemAxon average_mass 164.158 ChemAxon mono_mass 164.047344122 ChemAxon smiles OC(=O)\C=C\C1=CC=CC=C1O ChemAxon formula C9H8O3 ChemAxon inchi InChI=1S/C9H8O3/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-6,10H,(H,11,12)/b6-5+ ChemAxon inchikey PMOWTIHVNWZYFI-AATRIKPKSA-N ChemAxon polar_surface_area 57.53 ChemAxon refractivity 45.04 ChemAxon polarizability 16.11 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::NmrOneD 3928 Specdb::NmrOneD 4207 Specdb::MsIr 1806 Specdb::MsIr 1807 Specdb::MsIr 1808 Specdb::EiMs 1657 Specdb::CMs 884 Specdb::CMs 885 Specdb::CMs 886 Specdb::CMs 1483 Specdb::CMs 5775 Specdb::CMs 29926 Specdb::CMs 30244 Specdb::CMs 30891 Specdb::CMs 30892 Specdb::CMs 31422 Specdb::CMs 31834 Specdb::CMs 38449 Specdb::CMs 146277 Specdb::MsMs 6475 Specdb::MsMs 6476 Specdb::MsMs 6477 Specdb::MsMs 6478 Specdb::MsMs 6479 Specdb::MsMs 6483 Specdb::MsMs 6484 Specdb::MsMs 240529 Specdb::MsMs 240530 Specdb::MsMs 240531 Specdb::MsMs 242584 Specdb::MsMs 242585 Specdb::MsMs 242586 Specdb::MsMs 437426 Specdb::MsMs 437427 Specdb::MsMs 437428 Specdb::MsMs 437429 Specdb::MsMs 437430 Specdb::MsMs 439095 Specdb::MsMs 439699 Specdb::MsMs 439700 Specdb::MsMs 448051 Specdb::MsMs 2229164 Specdb::MsMs 2349275 Specdb::MsMs 2349276 HMDB0002641 American cranberry Type 1 specific Vaccinium macrocarpon 13750 Anatidae Type 1 specific Anatidae 8830 Apple Type 1 specific Malus pumila 283210 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Fruit juice Type 2 specific Green vegetables Unknown generic Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Olive Type 1 specific Olea europaea 4146 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823