1.0 2010-04-08 22:05:26 UTC 2020-02-24 19:10:33 UTC FDB002592 cis-p-Coumaric acid Coumaric acid is a hydroxycinnamic acid, an organic compound that is a hydroxy derivative of cinnamic acid. There are three isomers, o-coumaric acid, m-coumaric acid, and p-coumaric acid, that differ by the position of the hydroxy substitution of the phenyl group. p-Coumaric acid is the most abundant isomer of the three in nature. cis-p-Coumaric acid is found in coriander. (2Z)-3-(4-Hydroxyphenyl)acrylate (2Z)-3-(4-Hydroxyphenyl)acrylic acid (Z)-3-(4-Hydroxyphenyl)-2-propenoate (Z)-3-(4-Hydroxyphenyl)-2-propenoic acid (Z)-P-Coumarate (Z)-P-Coumaric acid (Z)-P-Hydroxycinnamate (Z)-P-Hydroxycinnamic acid cis-4-Hydroxycinnamate cis-4-Hydroxycinnamic acid cis-p-coumarate cis-p-Coumaric acid cis-P-Coumarinate cis-P-Coumarinic acid cis-P-Hydroxycinnamate cis-P-Hydroxycinnamic acid C9H8O3 164.158 164.047344122 (2Z)-3-(4-hydroxyphenyl)prop-2-enoic acid cis-p-coumaric acid 4501-31-9 OC(=O)\C=C/C1=CC=C(O)C=C1 InChI=1S/C9H8O3/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6,10H,(H,11,12)/b6-3- NGSWKAQJJWESNS-UTCJRWHESA-N belongs to the class of organic compounds known as hydroxycinnamic acids. Hydroxycinnamic acids are compounds containing an cinnamic acid where the benzene ring is hydroxylated. Hydroxycinnamic acids Organic compounds Phenylpropanoids and polyketides Cinnamic acids and derivatives Hydroxycinnamic acids and derivatives Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids Carbonyl compounds Carboxylic acids Cinnamic acids Coumaric acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Styrenes 1-hydroxy-2-unsubstituted benzenoid Aromatic homomonocyclic compound Benzenoid Carbonyl group Carboxylic acid Carboxylic acid derivative Cinnamic acid Coumaric acid Coumaric acid or derivatives Hydrocarbon derivative Hydroxycinnamic acid Monocarboxylic acid or derivatives Monocyclic benzene moiety Organic oxide Organic oxygen compound Organooxygen compound Phenol Styrene 4-coumaric acid logp 1.74 ALOGPS logs -2.21 ALOGPS solubility 1.02e+00 g/l ALOGPS melting_point Mp 134-134.5 dec. (subl. from 124°) logp 1.83 ChemAxon pka_strongest_acidic 3.5 ChemAxon pka_strongest_basic -6 ChemAxon iupac (2Z)-3-(4-hydroxyphenyl)prop-2-enoic acid ChemAxon average_mass 164.158 ChemAxon mono_mass 164.047344122 ChemAxon smiles OC(=O)\C=C/C1=CC=C(O)C=C1 ChemAxon formula C9H8O3 ChemAxon inchi InChI=1S/C9H8O3/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6,10H,(H,11,12)/b6-3- ChemAxon inchikey NGSWKAQJJWESNS-UTCJRWHESA-N ChemAxon polar_surface_area 57.53 ChemAxon refractivity 45.04 ChemAxon polarizability 16.28 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsIr 3956 Specdb::MsIr 3957 Specdb::MsIr 3958 Specdb::CMs 1463 Specdb::CMs 26576 Specdb::CMs 31609 Specdb::CMs 42079 Specdb::CMs 167778 Specdb::MsMs 108807 Specdb::MsMs 108808 Specdb::MsMs 108809 Specdb::MsMs 176118 Specdb::MsMs 176119 Specdb::MsMs 176120 Specdb::MsMs 2418400 Specdb::MsMs 2418401 Specdb::MsMs 2418402 Specdb::MsMs 2543504 Specdb::MsMs 2543505 Specdb::MsMs 2543506 HMDB30677 #<Reference:0x00005612735db638> Coriander Type 1 specific Coriandrum sativum 4047 85.65 144.0 27.3 mg/100 g Grape wine Type 2 specific 0.0 0.0 0.0 mg/100 g Pear Type 1 specific Pyrus communis 23211 3.2175 18.275 0.0 mg/100 g