1.0 2010-04-08 22:05:30 UTC 2020-02-24 19:11:04 UTC FDB002753 Peonidin Widespread anthocyanin found especies in concord grapes, blueberries, cherries and red table wines Peonidin is an anthocyanidin, and a primary plant pigment. Peonidin gives purplish-red hues to flowers such as the peony, from which it takes its name, and roses. It is also present in some blue flowers, such as the morning glory. Peonidin is found in many foods, some of which are common grape, common pea, sour cherry, and fruits. 3,4',5,7-Tetrahydroxy-3'-methoxyflavylium chloride 3,5,7-Trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-1-benzopyrylium chloride 3,5,7-Trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-1-benzopyrylium(1+), 9CI Paeonidin Peonidin C16H13O6 301.2708 301.071213148 3,5,7-trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-1lambda4-chromen-1-ylium 3,5,7-trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-1lambda4-chromen-1-ylium 134-01-0 COC1=C(O)C=CC(=C1)C1=[O+]C2=CC(O)=CC(O)=C2C=C1O InChI=1S/C16H12O6/c1-21-15-4-8(2-3-11(15)18)16-13(20)7-10-12(19)5-9(17)6-14(10)22-16/h2-7H,1H3,(H3-,17,18,19,20)/p+1 XFDQJKDGGOEYPI-UHFFFAOYSA-O belongs to the class of organic compounds known as 3'-o-methylated flavonoids. These are flavonoids with methoxy groups attached to the C3' atom of the flavonoid backbone. 3'-O-methylated flavonoids Organic compounds Phenylpropanoids and polyketides Flavonoids O-methylated flavonoids Aromatic heteropolycyclic compounds 1-benzopyrans 1-hydroxy-2-unsubstituted benzenoids 1-hydroxy-4-unsubstituted benzenoids 3-hydroxyflavonoids 4'-hydroxyflavonoids 5-hydroxyflavonoids 7-hydroxyflavonoids Alkyl aryl ethers Anisoles Anthocyanidins Heteroaromatic compounds Hydrocarbon derivatives Methoxybenzenes Methoxyphenols Organic cations Oxacyclic compounds Phenoxy compounds Polyols 1-benzopyran 1-hydroxy-2-unsubstituted benzenoid 1-hydroxy-4-unsubstituted benzenoid 3-hydroxyflavonoid 3p-methoxyflavonoid-skeleton 4'-hydroxyflavonoid 5-hydroxyflavonoid 7-hydroxyflavonoid Alkyl aryl ether Anisole Anthocyanidin Aromatic heteropolycyclic compound Benzenoid Benzopyran Ether Heteroaromatic compound Hydrocarbon derivative Hydroxyflavonoid Methoxybenzene Methoxyphenol Monocyclic benzene moiety Organic cation Organic oxygen compound Organoheterocyclic compound Organooxygen compound Oxacycle Phenol Phenol ether Phenoxy compound Polyol Anthocyanidins Anthocyanidins anthocyanidin cation Solid logp 1.90 ALOGPS logs -4.14 ALOGPS solubility 2.42e-02 g/l ALOGPS logp 3.08 ChemAxon pka_strongest_acidic 6.01 ChemAxon pka_strongest_basic -4.9 ChemAxon iupac 3,5,7-trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-1lambda4-chromen-1-ylium ChemAxon average_mass 301.2708 ChemAxon mono_mass 301.071213148 ChemAxon smiles COC1=C(O)C=CC(=C1)C1=[O+]C2=CC(O)=CC(O)=C2C=C1O ChemAxon formula C16H13O6 ChemAxon inchi InChI=1S/C16H12O6/c1-21-15-4-8(2-3-11(15)18)16-13(20)7-10-12(19)5-9(17)6-14(10)22-16/h2-7H,1H3,(H3-,17,18,19,20)/p+1 ChemAxon inchikey XFDQJKDGGOEYPI-UHFFFAOYSA-O ChemAxon polar_surface_area 103.29 ChemAxon refractivity 88.6 ChemAxon polarizability 30.14 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 6 ChemAxon donor_count 4 ChemAxon physiological_charge -1 ChemAxon formal_charge 1 ChemAxon Specdb::MsMs 65730 Specdb::MsMs 65731 Specdb::MsMs 65732 Specdb::MsMs 123165 Specdb::MsMs 123166 Specdb::MsMs 123167 Specdb::MsMs 1479287 Specdb::MsMs 1479385 Specdb::CMs 2558 Specdb::CMs 50912 Specdb::NmrOneD 287135 Specdb::NmrOneD 287136 Specdb::NmrOneD 287137 Specdb::NmrOneD 287138 Specdb::NmrOneD 287139 Specdb::NmrOneD 287140 Specdb::NmrOneD 287141 Specdb::NmrOneD 287142 Specdb::NmrOneD 287143 Specdb::NmrOneD 287144 Specdb::NmrOneD 287145 Specdb::NmrOneD 287146 Specdb::NmrOneD 287147 Specdb::NmrOneD 287148 Specdb::NmrOneD 287149 Specdb::NmrOneD 287150 Specdb::NmrOneD 287151 Specdb::NmrOneD 287152 Specdb::NmrOneD 287153 Specdb::NmrOneD 287154 HMDB05797 Alcoholic beverages Unknown generic Allium Type 1 specific Allium 4678 0.0 0.0 0.0 mg/100 g Almond Type 1 specific Prunus dulcis 3755 0.0 0.0 0.0 mg/100 g American cranberry Type 1 specific Vaccinium macrocarpon 13750 8.2275 30.54 0.51 mg/100 g Apple Type 1 specific Malus pumila 283210 0.01 0.07 0.0 mg/100 g Avocado Type 1 specific Persea americana 3435 0.0 0.0 0.0 mg/100 g Banana Type 1 specific Musa acuminata 4641 0.0 0.0 0.0 mg/100 g Bilberry Type 1 specific Vaccinium myrtillus 180763 20.45 20.45 20.45 mg/100 g Black chokeberry Type 1 specific Photinia melanocarpa 661339 0.37 0.66 0.08 mg/100 g Black raspberry Type 1 specific Rubus occidentalis 75079 1.09 1.09 1.09 mg/100 g Blackcurrant Type 1 specific Ribes nigrum 78511 0.365 0.66 0.07 mg/100 g Brazil nut Type 1 specific Bertholletia excelsa 3645 0.0 0.0 0.0 mg/100 g Broccoli Type 1 specific Brassica oleracea var. italica 36774 0.0 0.0 0.0 mg/100 g Carrot Type 1 specific Daucus carota ssp. sativus 79200 0.0 0.0 0.0 mg/100 g Cashew nut Type 1 specific Anacardium occidentale 171929 0.0 0.0 0.0 mg/100 g Colorado pinyon Type 1 specific Pinus edulis 3340 0.0 0.0 0.0 mg/100 g Common bean Type 1 specific Phaseolus vulgaris 3885 1.36 1.360000014 1.360000014 mg/100 g Common cabbage Type 1 specific Brassica oleracea 3712 0.16 0.16 0.16 mg/100 g Common grape Type 1 specific Vitis vinifera 29760 0.0 0.0 0.0 mg/100 g Common oregano Type 1 specific Origanum vulgare 39352 Common pea Type 1 specific Pisum sativum 3888 Common walnut Type 1 specific Juglans regia 51240 0.0 0.0 0.0 mg/100 g Cowpea Type 1 specific Vigna unguiculata 3917 11.07 11.07 11.07 mg/100 g Date Type 1 specific Phoenix dactylifera 42345 0.0 0.0 0.0 mg/100 g European plum Type 1 specific Prunus domestica 3758 1.108 5.21 0.0 mg/100 g Fig Type 1 specific Ficus carica 3494 0.0 0.0 0.0 mg/100 g French plantain Type 1 specific Musa X paradisiaca 89151 Fruits Unknown generic Garden onion (var.) Type 1 specific Allium cepa var. cepa 4679 2.07 2.07 2.07 mg/100 g Garden tomato Type 1 specific Solanum lycopersicum 4081 0.0 0.0 0.0 mg/100 g Globe artichoke Type 1 specific Cynara scolymus 59895 0.0 0.0 0.0 mg/100 g Gooseberry Type 1 specific Ribes uva-crispa 135518 0.77 0.77 0.77 mg/100 g Grape Type 1 specific Vitis 3603 2.4075 4.78 0.17 mg/100 g Grape wine Type 2 specific 3.45 7.82 1.25 mg/100 g Grapefruit Type 1 specific Citrus X paradisi 37656 0.0 0.0 0.0 mg/100 g Hazelnut Type 1 specific Corylus 13450 0.0 0.0 0.0 mg/100 g Highbush blueberry Type 1 specific Vaccinium corymbosum 69266 Java plum Type 1 specific Syzygium cumini 260142 5.16 5.16 5.16 mg/100 g Jostaberry Type 1 specific Ribes × nidigrolaria 0.08 0.08 0.08 mg/100 g Kiwi Type 1 specific Actinidia chinensis 3625 0.0 0.0 0.0 mg/100 g Lettuce Type 1 specific Lactuca sativa 4236 0.0 0.0 0.0 mg/100 g Macadamia nut Type 1 specific Macadamia 4329 0.0 0.0 0.0 mg/100 g Muskmelon Type 1 specific Cucumis melo 3656 0.0 0.0 0.0 mg/100 g Nectarine Type 1 specific Prunus persica var. nucipersica 323851 0.0 0.0 0.0 mg/100 g Peach Type 1 specific Prunus persica 3760 0.0 0.0 0.0 mg/100 g Peanut Type 1 specific Arachis hypogaea 3818 0.0 0.0 0.0 mg/100 g Pear Type 1 specific Pyrus communis 23211 0.0 0.0 0.0 mg/100 g Pecan nut Type 1 specific Carya illinoinensis 32201 0.0 0.0 0.0 mg/100 g Pineapple Type 1 specific Ananas comosus 4615 0.0 0.0 0.0 mg/100 g Pistachio Type 1 specific Pistacia vera 55513 0.0 0.0 0.0 mg/100 g Pomegranate Type 1 specific Punica granatum 22663 0.0 0.0 0.0 mg/100 g Potato Type 1 specific Solanum tuberosum 4113 0.0 0.0 0.0 mg/100 g Prunus (Cherry, Plum) Type 1 specific Prunus 3754 2.615 7.52 0.0 mg/100 g Radish Type 1 specific Raphanus sativus 3726 0.0 0.0 0.0 mg/100 g Rapini Type 1 specific Brassica ruvo 1204434 0.0 0.0 0.0 mg/100 g Redcurrant Type 1 specific Ribes rubrum 175228 0.08 0.16 0.0 mg/100 g Rubus (Blackberry, Raspberry) Type 1 specific Rubus 23216 0.165 0.21 0.12 mg/100 g Saskatoon berry Type 1 specific Amelanchier alnifolia 32219 2.96 2.96 2.96 mg/100 g Sea-buckthornberry Type 1 specific Hippophae rhamnoides 193516 0.01 0.01 0.01 mg/100 g Sour cherry Type 1 specific Prunus cerasus 140311 1.16 3.11 0.14 mg/100 g Strawberry Type 1 specific Fragaria X ananassa 3747 0.05 0.05 0.05 mg/100 g Sweet cherry Type 1 specific Prunus avium 42229 1.5 1.5 1.5 mg/100 g Sweet orange Type 1 specific Citrus sinensis 2711 0.215 0.43 0.0 mg/100 g Sweet potato Type 1 specific Ipomoea batatas 4120 Vaccinium (Blueberry, Cranberry, Huckleberry) Type 1 specific Vaccinium 13749 7.878333 20.29 0.21 mg/100 g Vinegar Type 2 specific 0.07 0.07 0.07 mg/100 g Watermelon Type 1 specific Citrullus lanatus 3654 0.0 0.0 0.0 mg/100 g Wheat Type 1 specific Triticum 4564 1.81 1.81 1.81 mg/100 g Wild celery Type 1 specific Apium graveolens 4045 0.0 0.0 0.0 mg/100 g Anti neoplastic 465 A substance that inhibits or prevents the proliferation of neoplasms. Anti-oxidant 502 A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. In European countries, E-numbers for permitted antioxidant food additives are from E 300 to E 324. Larvistat 1064 Pesticide 1210 Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. Pigment 1227 An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light.