1.0 2010-04-08 22:05:35 UTC 2019-11-26 02:58:10 UTC FDB002929 (2E,4E)-Decadienoic isobutylamide Constituent of Achillea millefolium (yarrow). (2E,4E)-Decadienoic isobutylamide is found in tarragon, herbs and spices, and pepper (spice). (2E,4E)-N-isobutyl-2,4-decadienamide (E,E)-N-(2-Methylpropyl)-2,4-decadienamide (E,E)-N-Isobutyl-2,4-decadienamide 2,4-Decadienamide, N-(2-methylpropyl)-, (2E,4E)- 2,4-Decadienamide, N-(2-methylpropyl)-, (E,E)- 2,4-Decadienamide, N-isobutyl-, (E,E)- N-(2-Methylpropyl)-(2e,4e)-2,4-decadienamide N-(2-Methylpropyl)-(e,e)-2,4-decadienamide N-(2-Methylpropyl)-2,4-Decadienamide N-Isobutyl-(e,e)-2,4-decadienamide N-Isobutyldeca-trans-2-trans-4-dienamide N-Isobutyldeca-trans-2,trans-4-dienamide Pellitorin Pellitorine Pellitorine (6ci) trans-Pellitorin C14H25NO 223.3544 223.193614427 (Z,2E,4Z)-N-(2-methylpropyl)deca-2,4-dienimidic acid (Z,2E,4Z)-N-(2-methylpropyl)deca-2,4-dienimidic acid 18836-52-7 CCCCC\C=C/C=C/C(/O)=N/CC(C)C InChI=1S/C14H25NO/c1-4-5-6-7-8-9-10-11-14(16)15-12-13(2)3/h8-11,13H,4-7,12H2,1-3H3,(H,15,16)/b9-8-,11-10+ MAGQQZHFHJDIRE-QNRZBPGKSA-N belongs to the class of organic compounds known as n-acyl amines. N-acyl amines are compounds containing a fatty acid moiety linked to an amine group through an ester linkage. N-acyl amines Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty amides Aliphatic acyclic compounds Carbonyl compounds Hydrocarbon derivatives Organic oxides Organonitrogen compounds Organopnictogen compounds Secondary carboxylic acid amides Aliphatic acyclic compound Carbonyl group Carboxamide group Carboxylic acid derivative Hydrocarbon derivative N-acyl-amine Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Secondary carboxylic acid amide Solid logp 4.98 ALOGPS logs -4.87 ALOGPS solubility 2.98e-03 g/l ALOGPS melting_point Mp 90-95° logp 4.71 ChemAxon pka_strongest_acidic 8.54 ChemAxon pka_strongest_basic 5.94 ChemAxon iupac (Z,2E,4Z)-N-(2-methylpropyl)deca-2,4-dienimidic acid ChemAxon average_mass 223.3544 ChemAxon mono_mass 223.193614427 ChemAxon smiles CCCCC\C=C/C=C/C(/O)=N/CC(C)C ChemAxon formula C14H25NO ChemAxon inchi InChI=1S/C14H25NO/c1-4-5-6-7-8-9-10-11-14(16)15-12-13(2)3/h8-11,13H,4-7,12H2,1-3H3,(H,15,16)/b9-8-,11-10+ ChemAxon inchikey MAGQQZHFHJDIRE-QNRZBPGKSA-N ChemAxon polar_surface_area 32.59 ChemAxon refractivity 72.67 ChemAxon polarizability 28.43 ChemAxon rotatable_bond_count 8 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 19922 Specdb::CMs 42264 Specdb::CMs 172509 Specdb::MsMs 58359 Specdb::MsMs 58360 Specdb::MsMs 58361 Specdb::MsMs 114285 Specdb::MsMs 114286 Specdb::MsMs 114287 Specdb::MsMs 2788894 Specdb::MsMs 2788895 Specdb::MsMs 2788896 Specdb::MsMs 2920756 Specdb::MsMs 2920757 Specdb::MsMs 2920758 HMDB30951 #<Reference:0x000055ac40338e38> Herbs and Spices Unknown generic Pepper (Spice) Type 1 specific Piper nigrum 13216 Tarragon Type 1 specific Artemisia dracunculus 72341 herbal spicy cyclooxygenase inhibitor 849 A compound or agent that combines with cyclooxygenases (EC 1.14.99.1) and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of icosanoids, prostaglandins, and thromboxanes. cyclooxygenase-1 inhibitor 840 A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 1.