1.0 2010-04-08 22:05:35 UTC 2019-11-26 02:58:13 UTC FDB002951 Elaidic acid Minor constituent of plant oils Elaidic acid is the major trans fat found in hydrogenated vegetable oils and occurs in small amounts in caprine and bovine milk (very roughly 0.1 % of the fatty acids). It is the trans isomer of oleic acid. (9E)-9-Octadecenoic acid (9e)-Octadecenoate (9E)-Octadecenoic acid (e)-9-octadecenoic acid (e)-Oleate (E)-Oleic acid 9-OCTADECENOate 9-OCTADECENOIC ACID 9-Octadecenoic acid, (E)- 9-trans-Octadecenoate 9-trans-octadecenoic acid Acide elaidique D9-trans-Octadecenoate D9-trans-Octadecenoic acid Elaidate Elaidic acid Elaidinsaeure Elaidinsaure trans-9-Octadecenoate trans-9-octadecenoic acid trans-D9-Octadecenoate trans-D9-Octadecenoic acid trans-delta(9)-Octadecenoate trans-Delta(9)-Octadecenoic acid trans-Elaidate Trans-elaidic acid trans-Octadec-9-enoic acid trans-Oleate trans-Oleic acid trans-δ(9)-octadecenoate trans-δ(9)-octadecenoic acid C18H34O2 282.4614 282.255880332 (9E)-octadec-9-enoic acid elaidic acid 112-79-8 CCCCCCCC\C=C\CCCCCCCC(O)=O InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9+ ZQPPMHVWECSIRJ-MDZDMXLPSA-N belongs to the class of organic compounds known as long-chain fatty acids. These are fatty acids with an aliphatic tail that contains between 13 and 21 carbon atoms. Long-chain fatty acids Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acids and conjugates Aliphatic acyclic compounds Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Straight chain fatty acids Unsaturated fatty acids Aliphatic acyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Hydrocarbon derivative Long-chain fatty acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Straight chain fatty acid Unsaturated fatty acid Monounsaturated fatty acids Unsaturated fatty acids Unsaturated fatty acids octadec-9-enoic acid Solid logp 7.68 ALOGPS logs -6.37 ALOGPS solubility 1.21e-04 g/l ALOGPS melting_point Mp 45-45.5° logp 6.78 ChemAxon pka_strongest_acidic 4.99 ChemAxon iupac (9E)-octadec-9-enoic acid ChemAxon average_mass 282.4614 ChemAxon mono_mass 282.255880332 ChemAxon smiles CCCCCCCC\C=C\CCCCCCCC(O)=O ChemAxon formula C18H34O2 ChemAxon inchi InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9+ ChemAxon inchikey ZQPPMHVWECSIRJ-MDZDMXLPSA-N ChemAxon polar_surface_area 37.3 ChemAxon refractivity 87.4 ChemAxon polarizability 37.64 ChemAxon rotatable_bond_count 15 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::EiMs 809 Specdb::NmrOneD 1425 Specdb::NmrOneD 2163 Specdb::NmrOneD 2851 Specdb::NmrTwoD 1370 Specdb::CMs 1881 Specdb::CMs 23176 Specdb::CMs 31169 Specdb::CMs 32369 Specdb::CMs 37631 Specdb::CMs 151247 Specdb::CMs 1066884 Specdb::MsMs 84009 Specdb::MsMs 84010 Specdb::MsMs 84011 Specdb::MsMs 145758 Specdb::MsMs 145759 Specdb::MsMs 145760 Specdb::MsMs 2235923 Specdb::MsMs 2237470 Specdb::MsMs 2239502 Specdb::MsMs 2469820 Specdb::MsMs 2469821 Specdb::MsMs 2469822 Specdb::MsMs 2492333 Specdb::MsMs 2492334 Specdb::MsMs 2492335 HMDB00573 27997 OLA #<Reference:0x000055ce32c46840> #<Reference:0x000055ce32c46660> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Fats and oils Unknown generic Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Milk (Cow) Type 2 specific 199.285714 907.0 40.0 mg/100 g Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Pomegranate Type 1 specific Punica granatum 22663 550.0 550.0 550.0 mg/100 g Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Anti leukotriene-D4 401 A substance that diminishes the rate of a chemical reaction. Anti-inflammatory 370 A substance that reduces or suppresses inflammation.