1.0 2010-04-08 22:05:37 UTC 2025-11-18 22:46:22 UTC FDB002998 Adipostatin A Isolated from cereals and other plants. Adipostatin A is found in many foods, some of which are hard wheat, rye, cereals and cereal products, and common wheat. 1,3-Benzenediol, 5-pentadecyl- 5-Pentadecyl-1,3-benzenediol 5-Pentadecyl-resorcinol 5-Pentadecylbenzene-1,3-diol 5-Pentadecylresorcinol Adipostatin A Cardol Resorcinol, 5-pentadecyl- C21H36O2 320.5093 320.271530396 5-pentadecylbenzene-1,3-diol cardol 3158-56-3 CCCCCCCCCCCCCCCC1=CC(O)=CC(O)=C1 InChI=1S/C21H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-16-20(22)18-21(23)17-19/h16-18,22-23H,2-15H2,1H3 KVVSCMOUFCNCGX-UHFFFAOYSA-N belongs to the class of organic compounds known as resorcinols. Resorcinols are compounds containing a resorcinol moiety, which is a benzene ring bearing two hydroxyl groups at positions 1 and 3. Resorcinols Organic compounds Benzenoids Phenols Benzenediols Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids 1-hydroxy-4-unsubstituted benzenoids Benzene and substituted derivatives Hydrocarbon derivatives Organooxygen compounds 1-hydroxy-2-unsubstituted benzenoid 1-hydroxy-4-unsubstituted benzenoid Aromatic homomonocyclic compound Hydrocarbon derivative Monocyclic benzene moiety Organic oxygen compound Organooxygen compound Resorcinol 5-alkylresorcinol logp 8.18 ALOGPS logs -5.92 ALOGPS solubility 3.83e-04 g/l ALOGPS melting_point Mp 95.5-96° (91-92°) logp 8.1 ChemAxon pka_strongest_acidic 9.36 ChemAxon pka_strongest_basic -5.7 ChemAxon iupac 5-pentadecylbenzene-1,3-diol ChemAxon average_mass 320.5093 ChemAxon mono_mass 320.271530396 ChemAxon smiles CCCCCCCCCCCCCCCC1=CC(O)=CC(O)=C1 ChemAxon formula C21H36O2 ChemAxon inchi InChI=1S/C21H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-16-20(22)18-21(23)17-19/h16-18,22-23H,2-15H2,1H3 ChemAxon inchikey KVVSCMOUFCNCGX-UHFFFAOYSA-N ChemAxon polar_surface_area 40.46 ChemAxon refractivity 99.48 ChemAxon polarizability 42.26 ChemAxon rotatable_bond_count 14 ChemAxon acceptor_count 2 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 5544 Specdb::CMs 42310 Specdb::CMs 133558 Specdb::CMs 141292 Specdb::MsMs 12566 Specdb::MsMs 12567 Specdb::MsMs 12568 Specdb::MsMs 19238 Specdb::MsMs 19239 Specdb::MsMs 19240 Specdb::MsMs 2713420 Specdb::MsMs 2713421 Specdb::MsMs 2713422 Specdb::MsMs 2964570 Specdb::MsMs 2964571 Specdb::MsMs 2964572 HMDB31009 2120 #<Reference:0x000055ce32748488> Amaranth Type 1 specific Amaranthus 3564 Annual wild rice Type 1 specific Zizania aquatica 75727 Barley Type 1 specific Hordeum vulgare 4513 0.01575 0.01575 0.01575 mg/100 g Breakfast cereal Type 2 specific Bulgur Type 2 specific Cashew nut Type 1 specific Anacardium occidentale 171929 Cereals and cereal products Unknown generic Common buckwheat Type 1 specific Fagopyrum esculentum 3617 Common wheat Type 1 specific Triticum aestivum 4565 0.176143 0.176142863 0.176142863 mg/100 g Corn Type 1 specific Zea mays 4577 Flour Type 2 specific Ginkgo nuts Type 1 specific Ginkgo biloba 3311 Hard wheat Type 1 specific Triticum durum 4567 0.459 0.458999991 0.458999991 mg/100 g Mango Type 1 specific Mangifera indica 29780 Millet Type 1 specific Panicum miliaceum 4540 Oat Type 1 specific Avena sativa 4498 Oriental wheat Type 1 specific Triticum turanicum 376534 Quinoa Type 1 specific Chenopodium quinoa 63459 Red rice Type 1 specific Oryza rufipogon 4529 Rice Type 1 specific Oryza sativa 4530 Rye Type 1 specific Secale cereale 4550 1.649486 1.649485676 1.649485676 mg/100 g Sorghum Type 1 specific Sorghum bicolor 4558 Soy bean Type 1 specific Glycine max 3847 Spelt Type 1 specific Triticum spelta 58933 Tartary buckwheat Type 1 specific Fagopyrum tataricum 62330 Teff Type 1 specific Eragrostis tef 110835 Triticale Type 1 specific X Triticosecale rimpaui Wheat Type 1 specific Triticum 4564 Wild rice Type 1 specific Zizania 15949 Anti-filarial 282 Cyclooxygenase inhibitor 849 A compound or agent that combines with cyclooxygenases (EC 1.14.99.1) and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of icosanoids, prostaglandins, and thromboxanes. Molluscicide 1113 A substance used to destroy pests of the phylum Mollusca. Pesticide 1210 Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests.